From 0fea3d4ca57187f271d7580ff16f32b7ab4657df Mon Sep 17 00:00:00 2001 From: Dimitri van Heesch Date: Thu, 7 Aug 2014 20:58:49 +0200 Subject: Introduced template directory for template and resource files and resource compiler & manager --- .gitignore | 3 + Makefile.in | 2 +- jquery/Makefile | 25 +- jquery/README | 5 +- jquery/split_jquery.pl | 25 - qtools/qcstring.h | 8 +- src/bib2xhtml.pl | 319 --- src/cite.cpp | 31 +- src/compound.xsd | 844 ------- src/context.cpp | 13 +- src/doxygen.bst | 1388 ------------ src/doxygen.cpp | 6 +- src/doxygen.css | 1440 ------------ src/doxygen.sty | 478 ---- src/dynsections.js | 97 - src/extsearch.js | 129 -- src/footer.html | 20 - src/ftvhelp.cpp | 578 +---- src/header.html | 54 - src/htmlgen.cpp | 995 +-------- src/index.xsd | 66 - src/jquery_fx.js | 1 - src/jquery_p1.js | 18 - src/jquery_p2.js | 10 - src/jquery_p3.js | 3 - src/jquery_pt.js | 8 - src/jquery_ui.js | 40 - src/lang_cfg.py | 0 src/latexgen.cpp | 27 +- src/layout_default.h | 194 -- src/libdoxygen.pro.in | 5 +- src/libdoxygen.t.in | 92 +- src/navtree.css | 143 -- src/navtree.js | 527 ----- src/res2cc_cmd.py | 102 + src/resize.js | 97 - src/resize_js.h | 93 - src/resourcemgr.cpp | 183 ++ src/resourcemgr.h | 63 + src/search.css | 271 --- src/search.js | 776 ------- src/search_functions.php | 366 ---- src/search_opensearch.php | 127 -- src/searchindex.cpp | 35 +- src/svgpan.js | 319 --- src/template.cpp | 192 +- src/xmlgen.cpp | 86 +- templates/html/arrowdown.luma | 49 + templates/html/arrowright.luma | 49 + templates/html/bc_s.luma | 66 + templates/html/bdwn.luma | 21 + templates/html/bib2xhtml.pl | 319 +++ templates/html/close.png | Bin 0 -> 273 bytes templates/html/closed.luma | 23 + templates/html/doc.luma | 50 + templates/html/doxygen.bst | 1388 ++++++++++++ templates/html/doxygen.css | 1440 ++++++++++++ templates/html/doxygen.luma | 68 + templates/html/dynsections.js | 97 + templates/html/extsearch.js | 129 ++ templates/html/folderclosed.luma | 49 + templates/html/folderopen.luma | 49 + templates/html/footer.html | 20 + templates/html/header.html | 54 + templates/html/htmlallmembers.tpl | 22 + templates/html/htmlannotated.tpl | 15 + templates/html/htmlbase.tpl | 216 ++ templates/html/htmlclass.tpl | 452 ++++ templates/html/htmlclasses.tpl | 21 + templates/html/htmlclmembers.tpl | 20 + templates/html/htmlclmembersindex.tpl | 26 + templates/html/htmldeclcomp.tpl | 32 + templates/html/htmldir.tpl | 78 + templates/html/htmldirtree.tpl | 46 + templates/html/htmldyncontents.tpl | 7 + templates/html/htmldynheader.tpl | 7 + templates/html/htmlfile.tpl | 256 +++ templates/html/htmlfiles.tpl | 15 + templates/html/htmlflmembers.tpl | 20 + templates/html/htmlinclude.tpl | 27 + templates/html/htmlindexpages.tpl | 19 + templates/html/htmljsnavindex.tpl | 7 + templates/html/htmljsnavtree.tpl | 20 + templates/html/htmllayout.tpl | 232 ++ templates/html/htmlmemberindex.tpl | 37 + templates/html/htmlmembersindex.tpl | 81 + templates/html/htmlmembertabs.tpl | 48 + templates/html/htmlmemdecl.tpl | 214 ++ templates/html/htmlmemdecls.tpl | 38 + templates/html/htmlmemdef.tpl | 284 +++ templates/html/htmlmeminherit.tpl | 20 + templates/html/htmlmemlist.tpl | 15 + templates/html/htmlmemsummary.tpl | 7 + templates/html/htmlmodule.tpl | 310 +++ templates/html/htmlmodules.tpl | 15 + templates/html/htmlnamespace.tpl | 206 ++ templates/html/htmlnamespaces.tpl | 15 + templates/html/htmlnavpath.tpl | 14 + templates/html/htmlnavtree.tpl | 22 + templates/html/htmlnsmembers.tpl | 20 + templates/html/htmlnsmembersindex.tpl | 26 + templates/html/htmlobjlink.tpl | 6 + templates/html/htmlpage.tpl | 14 + templates/html/htmlpages.tpl | 15 + templates/html/htmlsource.tpl | 37 + templates/html/htmltabs.tpl | 92 + templates/html/htmltypeconstraints.tpl | 13 + templates/html/jquery.js | 68 + templates/html/mag.png | Bin 0 -> 524 bytes templates/html/mag_sel.png | Bin 0 -> 563 bytes templates/html/nav_f.lum | 11 + templates/html/nav_g.png | Bin 0 -> 95 bytes templates/html/nav_h.lum | 6 + templates/html/navtree.css | 143 ++ templates/html/navtree.js | 523 +++++ templates/html/open.luma | 23 + templates/html/resize.js | 97 + templates/html/search.css | 271 +++ templates/html/search.js | 791 +++++++ templates/html/search_functions.php | 366 ++++ templates/html/search_l.png | Bin 0 -> 604 bytes templates/html/search_m.png | Bin 0 -> 158 bytes templates/html/search_noidx.css | 271 +++ templates/html/search_opensearch.php | 127 ++ templates/html/search_r.png | Bin 0 -> 612 bytes templates/html/splitbar.lum | 1028 +++++++++ templates/html/svgpan.js | 319 +++ templates/html/sync_off.luma | 54 + templates/html/sync_on.luma | 54 + templates/html/tab_a.lum | 8 + templates/html/tab_b.lum | 8 + templates/html/tab_h.lum | 8 + templates/html/tab_s.lum | 8 + templates/html/tabs.css | 60 + templates/latex/doxygen.sty | 478 ++++ templates/xml/compound.xsd | 844 +++++++ templates/xml/index.xsd | 66 + winbuild/Doxygen.vcproj | 3763 ++++++++++++++++++++++++-------- winbuild/GenResources.rules | 19 + 139 files changed, 16177 insertions(+), 10499 deletions(-) delete mode 100644 jquery/split_jquery.pl delete mode 100755 src/bib2xhtml.pl delete mode 100644 src/compound.xsd delete mode 100644 src/doxygen.bst delete mode 100644 src/doxygen.css delete mode 100644 src/doxygen.sty delete mode 100644 src/dynsections.js delete mode 100644 src/extsearch.js delete mode 100644 src/footer.html delete mode 100644 src/header.html delete mode 100644 src/index.xsd delete mode 100644 src/jquery_fx.js delete mode 100644 src/jquery_p1.js delete mode 100644 src/jquery_p2.js delete mode 100644 src/jquery_p3.js delete mode 100644 src/jquery_pt.js delete mode 100644 src/jquery_ui.js mode change 100644 => 100755 src/lang_cfg.py delete mode 100644 src/layout_default.h delete mode 100644 src/navtree.css delete mode 100644 src/navtree.js create mode 100755 src/res2cc_cmd.py delete mode 100644 src/resize.js delete mode 100644 src/resize_js.h create mode 100644 src/resourcemgr.cpp create mode 100644 src/resourcemgr.h delete mode 100644 src/search.css delete mode 100644 src/search.js delete mode 100644 src/search_functions.php delete mode 100644 src/search_opensearch.php delete mode 100644 src/svgpan.js create mode 100644 templates/html/arrowdown.luma create mode 100644 templates/html/arrowright.luma create mode 100644 templates/html/bc_s.luma create mode 100644 templates/html/bdwn.luma create mode 100755 templates/html/bib2xhtml.pl create mode 100644 templates/html/close.png create mode 100644 templates/html/closed.luma create mode 100644 templates/html/doc.luma create mode 100644 templates/html/doxygen.bst create mode 100644 templates/html/doxygen.css create mode 100644 templates/html/doxygen.luma create mode 100644 templates/html/dynsections.js create mode 100644 templates/html/extsearch.js create mode 100644 templates/html/folderclosed.luma create mode 100644 templates/html/folderopen.luma create mode 100644 templates/html/footer.html create mode 100644 templates/html/header.html create mode 100644 templates/html/htmlallmembers.tpl create mode 100644 templates/html/htmlannotated.tpl create mode 100644 templates/html/htmlbase.tpl create mode 100644 templates/html/htmlclass.tpl create mode 100644 templates/html/htmlclasses.tpl create mode 100644 templates/html/htmlclmembers.tpl create mode 100644 templates/html/htmlclmembersindex.tpl create mode 100644 templates/html/htmldeclcomp.tpl create mode 100644 templates/html/htmldir.tpl create mode 100644 templates/html/htmldirtree.tpl create mode 100644 templates/html/htmldyncontents.tpl create mode 100644 templates/html/htmldynheader.tpl create mode 100644 templates/html/htmlfile.tpl create mode 100644 templates/html/htmlfiles.tpl create mode 100644 templates/html/htmlflmembers.tpl create mode 100644 templates/html/htmlinclude.tpl create mode 100644 templates/html/htmlindexpages.tpl create mode 100644 templates/html/htmljsnavindex.tpl create mode 100644 templates/html/htmljsnavtree.tpl create mode 100644 templates/html/htmllayout.tpl create mode 100644 templates/html/htmlmemberindex.tpl create mode 100644 templates/html/htmlmembersindex.tpl create mode 100644 templates/html/htmlmembertabs.tpl create mode 100644 templates/html/htmlmemdecl.tpl create mode 100644 templates/html/htmlmemdecls.tpl create mode 100644 templates/html/htmlmemdef.tpl create mode 100644 templates/html/htmlmeminherit.tpl create mode 100644 templates/html/htmlmemlist.tpl create mode 100644 templates/html/htmlmemsummary.tpl create mode 100644 templates/html/htmlmodule.tpl create mode 100644 templates/html/htmlmodules.tpl create mode 100644 templates/html/htmlnamespace.tpl create mode 100644 templates/html/htmlnamespaces.tpl create mode 100644 templates/html/htmlnavpath.tpl create mode 100644 templates/html/htmlnavtree.tpl create mode 100644 templates/html/htmlnsmembers.tpl create mode 100644 templates/html/htmlnsmembersindex.tpl create mode 100644 templates/html/htmlobjlink.tpl create mode 100644 templates/html/htmlpage.tpl create mode 100644 templates/html/htmlpages.tpl create mode 100644 templates/html/htmlsource.tpl create mode 100644 templates/html/htmltabs.tpl create mode 100644 templates/html/htmltypeconstraints.tpl create mode 100644 templates/html/jquery.js create mode 100644 templates/html/mag.png create mode 100644 templates/html/mag_sel.png create mode 100644 templates/html/nav_f.lum create mode 100644 templates/html/nav_g.png create mode 100644 templates/html/nav_h.lum create mode 100644 templates/html/navtree.css create mode 100644 templates/html/navtree.js create mode 100644 templates/html/open.luma create mode 100644 templates/html/resize.js create mode 100644 templates/html/search.css create mode 100644 templates/html/search.js create mode 100644 templates/html/search_functions.php create mode 100644 templates/html/search_l.png create mode 100644 templates/html/search_m.png create mode 100644 templates/html/search_noidx.css create mode 100644 templates/html/search_opensearch.php create mode 100644 templates/html/search_r.png create mode 100644 templates/html/splitbar.lum create mode 100644 templates/html/svgpan.js create mode 100644 templates/html/sync_off.luma create mode 100644 templates/html/sync_on.luma create mode 100644 templates/html/tab_a.lum create mode 100644 templates/html/tab_b.lum create mode 100644 templates/html/tab_h.lum create mode 100644 templates/html/tab_s.lum create mode 100644 templates/html/tabs.css create mode 100644 templates/latex/doxygen.sty create mode 100644 templates/xml/compound.xsd create mode 100644 templates/xml/index.xsd create mode 100644 winbuild/GenResources.rules diff --git a/.gitignore b/.gitignore index 0894b42..d97dc2e 100644 --- a/.gitignore +++ b/.gitignore @@ -70,3 +70,6 @@ /man /docbook /perlmod +!/templates/html +!/templates/latex + diff --git a/Makefile.in b/Makefile.in index e90167c..af7a76f 100644 --- a/Makefile.in +++ b/Makefile.in @@ -102,7 +102,7 @@ pdf: docs DISTFILES = Doxyfile vhdlparser libmd5 addon tmake doc examples bin lib objects testing \ qtools src configure configure.bin Makefile.in Makefile.win_nmake.in \ Makefile.win_make.in INSTALL LANGUAGE.HOWTO LICENSE PLATFORMS \ - VERSION README.md packages winbuild jquery + VERSION README.md packages winbuild jquery templates archive: clean tar zcvf dx`date +%y%m%d`.tgz $(DISTFILES) diff --git a/jquery/Makefile b/jquery/Makefile index 2290ef9..996f472 100644 --- a/jquery/Makefile +++ b/jquery/Makefile @@ -3,6 +3,7 @@ JQUERY_UI_VERSION = 1.8.18 HASHCHANGE_VERSION = 1.3 SCROLL_VERSION = 1.4.2 POWERTIP_VERSION = 1.2.0 + MINIFIER ?= /usr/local/bin/yuicompressor-2.4.7 SCRIPTS = jquery-$(JQUERY_VERSION).js \ jquery.ui-$(JQUERY_UI_VERSION).core.js \ @@ -12,31 +13,17 @@ SCRIPTS = jquery-$(JQUERY_VERSION).js \ jquery.ba-$(HASHCHANGE_VERSION)-hashchange.js \ jquery.scrollTo-$(SCROLL_VERSION).js \ jquery.powertip-$(POWERTIP_VERSION).js -RESULTS = jquery_p1.js jquery_p2.js jquery_p3.js \ - jquery_ui.js jquery_fx.js jquery_pt.js +RESULTS = jquery.js SCRIPTS_MIN = $(SCRIPTS:%.js=%-min.js) all: $(RESULTS) install: $(RESULTS) - cp $(RESULTS) ../src/ - -jquery_ui.js: scripts - cat jquery.ui-$(JQUERY_UI_VERSION).core-min.js \ - jquery.ui-$(JQUERY_UI_VERSION).widget-min.js \ - jquery.ui-$(JQUERY_UI_VERSION).mouse-min.js \ - jquery.ui-$(JQUERY_UI_VERSION).resizable-min.js \ - jquery.ba-$(HASHCHANGE_VERSION)-hashchange-min.js > jquery_ui.js - -jquery_pt.js: scripts - cat jquery.powertip-$(POWERTIP_VERSION)-min.js > jquery_pt.js - -jquery_fx.js: scripts - cat jquery.scrollTo-$(SCROLL_VERSION)-min.js > jquery_fx.js + cp $(RESULTS) ../templates/html/ -jquery_p1.js jquery_p2.js jquery_p3.js: scripts - perl split_jquery.pl jquery-$(JQUERY_VERSION)-min.js $@ +jquery.js: scripts + cat $(SCRIPTS_MIN) > jquery.js scripts: $(SCRIPTS_MIN) @@ -44,5 +31,5 @@ clean: rm -f $(SCRIPTS_MIN) $(RESULTS) %-min.js: %.js - java -jar $(MINIFIER).jar --line-break 13000 $^ > $@ + java -jar $(MINIFIER).jar $^ > $@ diff --git a/jquery/README b/jquery/README index 7fd4dcd..5e385a5 100644 --- a/jquery/README +++ b/jquery/README @@ -11,7 +11,4 @@ packages: - jquery.scrollTo: 1.4.2: https://github.com/flesler/jquery.scrollTo - jquery.powertip: 1.2.0: http://stevenbenner.github.io/jquery-powertip/ -The Makefile will built the jquery_*.js files used by doxygen. -Some files are split into smaller parts to make sure Visual Studio can compile them -as strings. - +The Makefile will built the jquery.js files used by doxygen. diff --git a/jquery/split_jquery.pl b/jquery/split_jquery.pl deleted file mode 100644 index 3edc763..0000000 --- a/jquery/split_jquery.pl +++ /dev/null @@ -1,25 +0,0 @@ -# script to split file into parts of roughly 32kb -#!/bin/perl -my $file = shift; -my $target = shift; -my $count = 1; -my $len = 0; -$target=~/p(\d+).js/; -my $part = $1; -open(F,"<$file") || die ("cannot open file for reading: $!"); -open(G,">$target") || die("cannot open file for writing: $!"); -while () -{ - if ($part==$count) - { - print G "$_"; - } - $len+=length($_); - if ($len>32768) - { - $len=0; - $count++; - } -} -close(F); -close(G); diff --git a/qtools/qcstring.h b/qtools/qcstring.h index 6930718..bc3a091 100644 --- a/qtools/qcstring.h +++ b/qtools/qcstring.h @@ -297,7 +297,7 @@ public: { if (!str) return *this; int len1 = length(); - int len2 = strlen(str); + int len2 = (int)strlen(str); resize(len1+len2+1); memcpy(data()+len1,str,len2); return *this; @@ -467,7 +467,7 @@ public: { if (str) { - int len = strlen(str); + int len = (int)strlen(str); u.s.isShort = len0) { - uint len=strlen(str); + uint len=(uint)strlen(str); if (len>maxlen) len=maxlen; u.s.isShort = len<=SHORT_STR_MAX_LEN; if (u.s.isShort) @@ -543,7 +543,7 @@ public: } if (str) { - int len = strlen(str); + int len = (int)strlen(str); u.s.isShort = len ':crlf'; -$label_styles{'numbered'} = $LABEL_NUMBERED = 2; -$list_start[$LABEL_NUMBERED] = 'dl class="citelist"'; -$list_end[$LABEL_NUMBERED] = "/dl"; -@tmpfiles = (); -sub html_ent { - s/\\i\b/i/g; - s/\\\'(\001\d+)\{([AEIOUaeiou])\1\}/&$2acute;/gs; - s/\\\'([AEIOUaeiou])/&$1acute;/g; - s/\\\`(\001\d+)\{([AEIOUaeiou])\1\}/&$2grave;/gs; - s/\\\`([AEIOUaeiou])/&$1grave;/g; - s/\\\"(\001\d+)\{([AEIOUaeiouy])\1\}/&$2uml;/gs; - s/\\\"([AEIOUaeiouy])/&$1uml;/g; - s/\\\~(\001\d+)\{([ANOano])\1\}/&$2tilde;/gs; - s/\\\~([ANOano])/&$1tilde;/g; - s/\\\^(\001\d+)\{([AEIOUaeiou])\1\}/&$2circ;/gs; - s/\\\^([AEIOUaeiou])/&$1circ;/g; - s/\\c(\001\d+)\{([Cc])\1\}/&$2cedil;/gs; - s/\\u(\001\d+)\{(.)\1\}/$2/gs; - s/\\v(\001\d+)\{(.)\1\}/$2/gs; - s/\\([lL])\b/$1/g; - s/\\\=(\001\d+)\{(.)\1\}/$2/gs; - s/\\\=(.)/$1/g; - s/\\\.(\001\d+)\{(.)\1\}/$2/gs; - s/\\\.(.)/$1/g; - s/\\([Oo])\b\s*/&$1slash;/g; - s/\\AA\b\s*/Å/g; - s/\\aa\b\s*/å/g; - s/\\AE\b\s*/Æ/g; - s/\\ae\b\s*/æ/g; - s/\\ss\b\s*/ß/g; - s/\\S\b\s*/§/g; - s/\\P\b\s*/¶/g; - s/\\pounds\b\s*/£/g; - s/\?\`/¿/g; - s/\!\`/¡/g; - s/\-\-\-/—/g; - s/([^\!])\-\-([^\>])/$1–$2/g; - s/\\([aA]lpha)\b/&$1;/g; - s/\\([bB]eta)\b/&$1;/g; - s/\\([gG]amma)\b/&$1;/g; - s/\\([dD]elta)\b/&$1;/g; - s/\\varepsilon\b/ε/g; - s/\\([eE]psilon)\b/&$1;/g; - s/\\([zZ]eta)\b/&$1;/g; - s/\\([eE]ta)\b/&$1;/g; - s/\\([tT]heta)\b/&$1;/g; - s/\\vartheta\b/θ/g; - s/\\([iI]ota)\b/&$1;/g; - s/\\([kK]appa)\b/&$1;/g; - s/\\([lL]ambda)\b/&$1;/g; - s/\\([mM]u)\b/&$1;/g; - s/\\([nN]u)\b/&$1;/g; - s/\\([xX]i)\b/&$1;/g; - s/\\([oO]micron)\b/&$1;/g; - s/\\([pP]i)\b/&$1;/g; - s/\\varpi\b/π/g; - s/\\([rR]ho)\b/&$1;/g; - s/\\varrho\b/ρ/g; - s/\\([sS]igma)\b/&$1;/g; - s/\\varsigma\b/ς/g; - s/\\([tT]au)\b/&$1;/g; - s/\\([uU]psilon)\b/&$1;/g; - s/\\([pP]hi)\b/&$1;/g; - s/\\varphi\b/φ/g; - s/\\([cC]hi)\b/&$1;/g; - s/\\([pP]si)\b/&$1;/g; - s/\\([oO]mega)\b/&$1;/g; - s/\\S\b/§/g; - s/^\\circ\b/°/g; - s/\\infty\b/∞/g; - s/\\emptyset\b/∅/g; - s/\\pm\b/±/g; - s/\\times\b/×/g; - s/\\cdot\b/⋅/g; - s/\\partial\b/∂/g; - s/\\nabla\b/∇/g; - s/\\surd\b/√/g; - s/\\perp\b/⊥/g; - s/\\sum\b/∑/g; - s/\\int\b/∫/g; - s/\\prod\b/∏/g; - s/\\sim\b/∼/g; - s/\\approx\b/≈/g; - s/\\ne\b/≠/g; - s/\\equiv\b/≡/g; - s/\\propto\b/∝/g; - s/\\le\b/≤/g; - s/\\ge\b/≥/g; - s/\\leftarrow\b/←/g; - s/\\rightarrow\b/→/g; - s/\\in\b/∈/g; - s/\\notin\b/∉/g; - s/\\lceil\b/⌈/g; - s/\\rceil\b/⌉/g; - s/\\lfloor\b/⌊/g; - s/\\rfloor\b/⌋/g; -} -foreach (@ARGV) { - if (/\.bib$/) { - $bibfile = $_; - $bibfile =~ s/\.bib$//; - push(@bibfiles,$bibfile); - } else { - $htmlfile = $_; - } -} -exit(1) unless defined($htmlfile); -$bibdatacmd="\\bibdata{".join(',',@bibfiles)."}"; -$label_style = $LABEL_NUMBERED; -$bstfile = "doxygen"; -umask(077); -open(HTMLFILE,">$htmlfile$$"); -if (open(OHTMLFILE, "$htmlfile")) { - $mode = (stat OHTMLFILE)[2] & 0xfff; -} else { - print "Error opening $htmlfile\n"; - exit(1); -} -$beginstring = ""; -$endstring = ""; -@citations = (); -loop: -while () { - print HTMLFILE; - last loop if m/^$beginstring$/; -} -loop: -while () { - print HTMLFILE; - last loop if m/^$endstring$/; - push(@citations, $2) if m/^([^\\]*)?(.+\})(.*)?$/; -} -push(@citations, $bibdatacmd); -$auxfile = "bib$$"; -push(@tmpfiles, "$auxfile.aux"); -open(AUXFILE, ">$auxfile" . ".aux"); -print AUXFILE "\\relax\n\\bibstyle{$bstfile}\n"; -foreach $citation (@citations) { - print AUXFILE "$citation\n"; -} -close(AUXFILE); -push(@tmpfiles, "$auxfile.blg"); -push(@tmpfiles, "$auxfile.bbl"); -`bibtex $auxfile 2>&1`; -if ($?==-1) -{ - print "bibtex command failed: $!\n"; -} -$beginstring = ""; -$endstring = ""; -loop: -while () { - last loop if m/^$beginstring$/; - print HTMLFILE; -} -loop: -while () { - last loop if m/^$endstring$/; -} -print HTMLFILE "$beginstring\n"; -$t = $auxfile . ".bbl"; -$/ = ""; -open(BBLFILE, "<$t") || die "error opening $t: $!\n"; -$nentry = 0; -loop: -while () { - if (($nentry == 0) && (m/^#/)) { - if ((m/#\s*label-style:\s*(\S+)/) && (! defined $label_style)) { - $label_style = $label_styles{$1}; - if (! defined $label_style) { - print STDERR "label style unknown: \n"; - next loop; - } - } - next loop; - } - $nentry++; - ($bcite, $blabel) = m+
\[([^\]]*)\]
+; - $blabel = "$nentry"; - $bibcite{$bcite} = $blabel; -} -close(BBLFILE); -$label_style = $LABEL_DEFAULT if (! defined $label_style); -$list_start = $list_start[$label_style]; -$list_end = $list_end[$label_style]; -print HTMLFILE "<$list_start>\n\n"; -open(BBLFILE, "<$t") || die "error opening $t: $!\n"; -$nentry = 0; -loop: -while () { - next loop if (($nentry == 0) && (m/^#/)); - $nentry++; - s/\\\{/\002/g; - s/\\\}/\003/g; - s/\\\$/\004/g; - { - local ($c, $l, $z) = (0, 0, ()); - s/([\{\}])/join("","\001",($1 eq "\{" ? $z[$l++]=$c++ : $z[--$l]),$1)/ge; - } - s/\%\n//g; - s/(\.(<\/cite>|<\/a>|\')+)\./$1/g; - s:(
\[)[^\]]*(\]
):$1$nentry$2:; - while (m/(\\(cite(label)?)(\001\d+)\{([^\001]+)\4\})/) { - $old = $1; - $cmd = $2; - $doxref = defined($3); - $bcite = $5; - if (! defined $bibcite{$bcite}) { - $blabel = " [" . $bcite . "]"; - } elsif ($doxref) { - $blabel = " [" . $bibcite{$bcite} . "]<\/a>"; - } else { - $blabel = " [" . $bibcite{$bcite} . "]"; - } - $old =~ s/(\W)/\\$1/g; - s/\s*$old/$blabel/g; - } - s/In ()([^\[]+) \[(\2)/In $1\[$2/; - s/\\htmladdnormallink(foot)?(\001\d+)\{([^\001]+)\2\}(\001\d+)\{([^\001]+)\4\}/$3<\/a>/gs; - s/\&/\005/g; - s/\\?&/&/g; - s/\005/&/g; - html_ent(); - while (m/\\char([\'\"]?[0-9a-fA-F]+)/) { - $o = $r = $1; - if ($r =~ s/^\'//) { - $r = oct($r); - } elsif ($r =~ s/^\"//) { - $r = hex($r); - } - s/\\char$o\s*/&#$r;/g; - } - s/{\\etalchar\001(\d+)\{(.)}\001\1\}/$2/g; - s/\\par\b/

/g; - s/\\url(\001\d+)\{(.*)\1\}/$2<\/a>/gs; - s/\\href(\001\d+)\{(.*)\1\}(\001\d+)\{([^\001]*)\3\}/$4<\/a>/gs; - s/\\href(\001\d+)\{(.*)\1\}/$2<\/a>/gs; - s/(\001\d+)\{\\rm\s+(.*)\1\}/$2/gs; - s/\\textrm(\001\d+)\{(.*)\1\}/$2/gs; - s/(\001\d+)\{\\em\s+(.*)\1\}/$2<\/em>/gs; - s/(\001\d+)\{\\it\s+(.*)\1\}/$2<\/i>/gs; - s/(\001\d+)\{\\bf\s+(.*)\1\}/$2<\/b>/gs; - s/(\001\d+)\{\\tt\s+(.*)\1\}/$2<\/tt>/gs; - s/\\emph(\001\d+)\{(.*)\1\}/$2<\/em>/gs; - s/\\textit(\001\d+)\{(.*)\1\}/$2<\/i>/gs; - s/\\textbf(\001\d+)\{(.*)\1\}/$2<\/b>/gs; - s/\\texttt(\001\d+)\{(.*)\1\}/$2<\/tt>/gs; - s/\\mathrm(\001\d+)\{(.*)\1\}/$2/gs; - s/\\mathnormal(\001\d+)\{(.*)\1\}/$2/gs; - s/\\mathsf(\001\d+)\{(.*)\1\}/$2/gs; - s/\\mathbf(\001\d+)\{(.*)\1\}/$2<\/b>/gs; - s/\\mathcal(\001\d+)\{(.*)\1\}/$2<\/i>/gs; - s/\\mathit(\001\d+)\{(.*)\1\}/$2<\/i>/gs; - s/\\mathtt(\001\d+)\{(.*)\1\}/$2<\/tt>/gs; - s/\\bibxhtmlname(\001\d+)\{(.*)\1\}/$2/ges; - sub domath { - local($t) = @_; - $t =~ s/\^(\001\d+)\{\\circ\1\}/\&\#176;/gs; - $t =~ s/\^\\circ/\&\#176;/g; - $t =~ s/\^(\001\d+)\{(.*)\1\}/$2<\/sup>/gs; - $t =~ s/\^(\w)/$1<\/sup>/g; - $t =~ s/\_(\001\d+)\{(.*)\1\}/$2<\/sub>/gs; - $t =~ s/\_(\w)/$1<\/sub>/g; - $t; - } - s/(\$([^\$]+)\$)/&domath($2)/ge; - s/(\\\((([^\\]|\\[^\(\)])+)\\\))/&domath($2)/ge; - s/\\mbox(\001\d+)\{(.*)\1\}/$2/gs; - while (s/(\++; - s/\001\d+[\{\}]//gs; - tr/\002\003\004/{}$/; - print HTMLFILE $_; -} -close(BBLFILE); -print HTMLFILE "<$list_end>\n\n$endstring\n"; -while () { - print HTMLFILE; -} -close (OHTMLFILE); -close(HTMLFILE); -chmod($mode, "$htmlfile$$"); -rename("$htmlfile$$", $htmlfile); -unlink(@tmpfiles); -exit(0); diff --git a/src/cite.cpp b/src/cite.cpp index 42374d0..f0d7d66 100644 --- a/src/cite.cpp +++ b/src/cite.cpp @@ -21,20 +21,11 @@ #include "util.h" #include "language.h" #include "ftextstream.h" +#include "resourcemgr.h" #include //-------------------------------------------------------------------------- -static const char *doxygen_bst = -#include "doxygen.bst.h" -; - -static const char *bib2xhtml_pl = -#include "bib2xhtml.pl.h" -; - -//-------------------------------------------------------------------------- - const QCString CiteConsts::fileName("citelist"); const QCString CiteConsts::anchorPrefix("CITEREF_"); const QCString bibTmpFile("bibTmpFile_"); @@ -153,26 +144,12 @@ void CiteDict::generatePage() const f.close(); // 2. generate bib2xhtml - QCString bib2xhtmlFile = outputDir+"/bib2xhtml.pl"; - f.setName(bib2xhtmlFile); - QCString bib2xhtml = bib2xhtml_pl; - if (!f.open(IO_WriteOnly)) - { - err("could not open file %s for writing\n",bib2xhtmlFile.data()); - } - f.writeBlock(bib2xhtml, bib2xhtml.length()); - f.close(); + QCString bib2xhtmlFile = outputDir+"/bib2xhtml.pl"; + ResourceMgr::instance().copyResource("bib2xhtml.pl",outputDir); // 3. generate doxygen.bst QCString doxygenBstFile = outputDir+"/doxygen.bst"; - QCString bstData = doxygen_bst; - f.setName(doxygenBstFile); - if (!f.open(IO_WriteOnly)) - { - err("could not open file %s for writing\n",doxygenBstFile.data()); - } - f.writeBlock(bstData, bstData.length()); - f.close(); + ResourceMgr::instance().copyResource("doxygen.bst",outputDir); // 4. for all formats we just copy the bib files to as special output directory // so bibtex can find them without path (bibtex doesn't support paths or diff --git a/src/compound.xsd b/src/compound.xsd deleted file mode 100644 index be897c3..0000000 --- a/src/compound.xsd +++ /dev/null @@ -1,844 +0,0 @@ - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/src/context.cpp b/src/context.cpp index b35fffa..4b174b0 100644 --- a/src/context.cpp +++ b/src/context.cpp @@ -13,6 +13,7 @@ * */ +#include #include #include "context.h" @@ -1108,6 +1109,7 @@ class DefinitionContext : public PropertyMapper public: DefinitionContext(Definition *d) : m_def(d) { + assert(d!=0); //%% string name: the name of the symbol addProperty("name",this,&DefinitionContext::name); //%% string bareName: the bare name of the symbol with scope info @@ -8147,7 +8149,6 @@ void generateOutputViaTemplate() SharedPtr exampleList (ExampleListContext::alloc()); SharedPtr moduleTree (ModuleTreeContext::alloc()); SharedPtr moduleList (ModuleListContext::alloc()); - SharedPtr mainPage (PageContext::alloc(Doxygen::mainPage,TRUE)); SharedPtr globalsIndex (GlobalsIndexContext::alloc()); SharedPtr classMembersIndex (ClassMembersIndexContext::alloc()); SharedPtr namespaceMembersIndex(NamespaceMembersIndexContext::alloc()); @@ -8187,7 +8188,15 @@ void generateOutputViaTemplate() //%% DirList dirList ctx->set("dirList",dirList.get()); //%% Page mainPage - ctx->set("mainPage",mainPage.get()); + if (Doxygen::mainPage) + { + SharedPtr mainPage(PageContext::alloc(Doxygen::mainPage,TRUE)); + ctx->set("mainPage",mainPage.get()); + } + else + { + ctx->set("mainPage",FALSE); + } //%% GlobalsIndex globalsIndex: ctx->set("globalsIndex",globalsIndex.get()); //%% ClassMembersIndex classMembersIndex: diff --git a/src/doxygen.bst b/src/doxygen.bst deleted file mode 100644 index c6ae7a8..0000000 --- a/src/doxygen.bst +++ /dev/null @@ -1,1388 +0,0 @@ - % $Id: html-btxbst.doc 1.5 2010/12/08 19:02:34 dds Exp $ - % - % This file is either "html-btxbst.doc" or was derived from - % "html-btxbst.doc" using cpp. "html-btxbst.doc" itself was edited - % from "btxbst.doc" and "named.bst". - % The following copyright information is from btxbst.doc: - % version 0.99b for BibTeX versions 0.99a or later, LaTeX version 2.09. - % Copyright (C) 1985, all rights reserved. - % Copying of this file is authorized only if either - % (1) you make absolutely no changes to your copy, including name, or - % (2) if you do make changes, you name it something other than - % btxbst.doc, plain.bst, unsrt.bst, alpha.bst, and abbrv.bst. - % This restriction helps ensure that all standard styles are identical. - % The file btxbst.doc has the documentation for this style. - % "named" style (sorted keys of the form [name, year]) - % Some code for this was taken from "named.bst". - -ENTRY - { address - author - booktitle - chapter - edition - editor - howpublished - institution - journal - key - month - note - number - organization - pages - publisher - school - series - title - type - volume - year - dvi - html - keywords - pdf - postscript - url - doi - mailto - } - {} - { label extra.label sort.label } - -INTEGERS { output.state before.all mid.sentence after.sentence after.block } - -FUNCTION {init.state.consts} -{ #0 'before.all := - #1 'mid.sentence := - #2 'after.sentence := - #3 'after.block := -} - -STRINGS { s t } - -FUNCTION {output.nonnull} -{ 's := - output.state mid.sentence = - { ", " * write$ } - { output.state after.block = - { add.period$ write$ - newline$ - } - { output.state before.all = - 'write$ - { add.period$ " " * write$ } - if$ - } - if$ - mid.sentence 'output.state := - } - if$ - s -} - -FUNCTION {output} -{ duplicate$ empty$ - 'pop$ - 'output.nonnull - if$ -} - -FUNCTION {output.check} -{ 't := - duplicate$ empty$ - { pop$ "empty " t * " in " * cite$ * warning$ } - 'output.nonnull - if$ -} - -FUNCTION {output.bibitem} -{ newline$ - author empty$ - { editor empty$ - { organization empty$ - 'skip$ - { "" * write$ newline$ } - if$ - } - { "" * write$ newline$ } - if$ - } - { "" * write$ newline$ } - if$ - keywords empty$ - 'skip$ - { "" * write$ newline$ } - if$ - "

[" * label * "]
" * write$ - "" - before.all 'output.state := -} - -FUNCTION {fin.entry} -{ add.period$ - write$ - postscript empty$ - 'skip$ - { newline$ "" * write$ } - if$ - pdf empty$ - 'skip$ - { newline$ "" * write$ } - if$ - dvi empty$ - 'skip$ - { newline$ "" * write$ } - if$ - doi empty$ - 'skip$ - { newline$ "" * write$ } - if$ - "
" write$ - newline$ - newline$ -} - -FUNCTION {new.block} -{ output.state before.all = - 'skip$ - { after.block 'output.state := } - if$ -} - -FUNCTION {new.sentence} -{ output.state after.block = - 'skip$ - { output.state before.all = - 'skip$ - { after.sentence 'output.state := } - if$ - } - if$ -} - -FUNCTION {not} -{ { #0 } - { #1 } - if$ -} - -FUNCTION {and} -{ 'skip$ - { pop$ #0 } - if$ -} - -FUNCTION {or} -{ { pop$ #1 } - 'skip$ - if$ -} - -FUNCTION {str.to.int} -{ - 's := - #0 - { s empty$ not } - { % Multiply the number on the top of the stack by 10 = 1010 binary - duplicate$ + % x2 - duplicate$ % x2 x2 - duplicate$ + duplicate$ + % x2 x8 - + - s #1 #1 substring$ chr.to.int$ #48 - + % #48 is ascii for '0' - s #2 global.max$ substring$ 's := - } - while$ -} - -FUNCTION {new.block.checka} -{ empty$ - 'skip$ - 'new.block - if$ -} - -FUNCTION {new.block.checkb} -{ empty$ - swap$ empty$ - and - 'skip$ - 'new.block - if$ -} - -FUNCTION {new.sentence.checka} -{ empty$ - 'skip$ - 'new.sentence - if$ -} - -FUNCTION {new.sentence.checkb} -{ empty$ - swap$ empty$ - and - 'skip$ - 'new.sentence - if$ -} - -FUNCTION {field.or.null} -{ duplicate$ empty$ - { pop$ "" } - 'skip$ - if$ -} - -FUNCTION {emphasize} -{ duplicate$ empty$ - { pop$ "" } - { "" swap$ * "" * } - if$ -} - -FUNCTION {add.link} % title -{ - 't := - t empty$ - { "" } - { url empty$ - { html empty$ - { t } - { "" * t * "" * } - if$ } - { "" * t * "" * } - if$ - } - if$ -} - -FUNCTION {add.mailto} % authors -{ - 't := - t empty$ - { "" } - { mailto empty$ - { t } - { "" * t * "" * } - if$ - } - if$ -} - -INTEGERS { nameptr namesleft numnames } - -FUNCTION {format.names} -{ 's := - #1 'nameptr := - s num.names$ 'numnames := - numnames 'namesleft := - { namesleft #0 > } - { s nameptr "{ff~}{vv~}{ll}{, jj}" format.name$ 't := - "\bibxhtmlname{" t * "}" * 't := - nameptr #1 > - { namesleft #1 > - { ", " * t * } - { numnames #2 > - { "," * } - 'skip$ - if$ - t "others" = - { " et~al." * } - { " and " * t * } - if$ - } - if$ - } - 't - if$ - nameptr #1 + 'nameptr := - namesleft #1 - 'namesleft := - } - while$ -} - -FUNCTION {format.authors} -{ author empty$ - { "" } - { author format.names } - if$ - add.mailto -} - -FUNCTION {format.editors} -{ editor empty$ - { "" } - { editor format.names - editor num.names$ #1 > - { ", editors" * } - { ", editor" * } - if$ - } - if$ -} - -FUNCTION {format.title} -{ title empty$ - { "" } - { title "t" change.case$ } - if$ - add.link -} - -FUNCTION {n.dashify} -{ 't := - "" - { t empty$ not } - { t #1 #1 substring$ "-" = - { t #1 #2 substring$ "--" = not - { "--" * - t #2 global.max$ substring$ 't := - } - { { t #1 #1 substring$ "-" = } - { "-" * - t #2 global.max$ substring$ 't := - } - while$ - } - if$ - } - { t #1 #1 substring$ * - t #2 global.max$ substring$ 't := - } - if$ - } - while$ -} - -FUNCTION {format.date} -{ year empty$ - { month empty$ - { "" } - { "there's a month but no year in " cite$ * warning$ - month - } - if$ - } - { month empty$ - 'year - { month " " * year * } - if$ - } - if$ -} - -FUNCTION {format.btitle} -{ title emphasize - add.link -} - -FUNCTION {tie.or.space.connect} -{ duplicate$ text.length$ #3 < - { "~" } - { " " } - if$ - swap$ * * -} - -FUNCTION {either.or.check} -{ empty$ - 'pop$ - { "can't use both " swap$ * " fields in " * cite$ * warning$ } - if$ -} - -FUNCTION {format.bvolume} -{ volume empty$ - { "" } - { "volume" volume tie.or.space.connect - series empty$ - 'skip$ - { " of " * series emphasize * } - if$ - "volume and number" number either.or.check - } - if$ -} - -FUNCTION {format.number.series} -{ volume empty$ - { number empty$ - { series field.or.null } - { output.state mid.sentence = - { "number" } - { "Number" } - if$ - number tie.or.space.connect - series empty$ - { "there's a number but no series in " cite$ * warning$ } - { " in " * series * } - if$ - } - if$ - } - { "" } - if$ -} - -FUNCTION {format.edition} -{ edition empty$ - { "" } - { output.state mid.sentence = - { edition "l" change.case$ " edition" * } - { edition "t" change.case$ " edition" * } - if$ - } - if$ -} - -INTEGERS { multiresult } - -FUNCTION {multi.page.check} -{ 't := - #0 'multiresult := - { multiresult not - t empty$ not - and - } - { t #1 #1 substring$ - duplicate$ "-" = - swap$ duplicate$ "," = - swap$ "+" = - or or - { #1 'multiresult := } - { t #2 global.max$ substring$ 't := } - if$ - } - while$ - multiresult -} - -FUNCTION {format.pages} -{ pages empty$ - { "" } - { pages multi.page.check - { "pages" pages n.dashify tie.or.space.connect } - { "page" pages tie.or.space.connect } - if$ - } - if$ -} - -FUNCTION {format.vol.num.pages} -{ volume field.or.null - number empty$ - 'skip$ - { "(" number * ")" * * - volume empty$ - { "there's a number but no volume in " cite$ * warning$ } - 'skip$ - if$ - } - if$ - pages empty$ - 'skip$ - { duplicate$ empty$ - { pop$ format.pages } - { ":" * pages n.dashify * } - if$ - } - if$ -} - -FUNCTION {format.chapter.pages} -{ chapter empty$ - 'format.pages - { type empty$ - { "chapter" } - { type "l" change.case$ } - if$ - chapter tie.or.space.connect - pages empty$ - 'skip$ - { ", " * format.pages * } - if$ - } - if$ -} - -FUNCTION {format.in.ed.booktitle} -{ booktitle empty$ - { "" } - { editor empty$ - { "In " booktitle emphasize * } - { "In " format.editors * ", " * booktitle emphasize * } - if$ - } - if$ -} - -FUNCTION {empty.misc.check} -{ author empty$ title empty$ howpublished empty$ - month empty$ year empty$ note empty$ - and and and and and - key empty$ not and - { "all relevant fields are empty in " cite$ * warning$ } - 'skip$ - if$ -} - -FUNCTION {format.thesis.type} -{ type empty$ - 'skip$ - { pop$ - type "t" change.case$ - } - if$ -} - -FUNCTION {format.tr.number} -{ type empty$ - { "Technical Report" } - 'type - if$ - number empty$ - { "t" change.case$ } - { number tie.or.space.connect } - if$ -} - -FUNCTION {format.article.crossref} -{ - "In " * - key empty$ - { journal empty$ - { "need key or journal for " cite$ * " to crossref " * crossref * - warning$ - "" - } - { "" * journal * "" * } - if$ - } - { key * } - if$ - " \citelabel{" * crossref * "}" * -} - -FUNCTION {format.crossref.editor} -{ editor #1 "{vv~}{ll}" format.name$ - editor num.names$ duplicate$ - #2 > - { pop$ " et~al." * } - { #2 < - 'skip$ - { editor #2 "{ff }{vv }{ll}{ jj}" format.name$ "others" = - { " et~al." * } - { " and " * editor #2 "{vv~}{ll}" format.name$ * } - if$ - } - if$ - } - if$ -} - -FUNCTION {format.book.crossref} -{ volume empty$ - { "empty volume in " cite$ * "'s crossref of " * crossref * warning$ - "In " - } - { "Volume" volume tie.or.space.connect - " of " * - } - if$ - "" * - editor empty$ - editor field.or.null author field.or.null = - or - { key empty$ - { series empty$ - { "need editor, key, or series for " cite$ * " to crossref " * - crossref * warning$ - "" * - } - { "" * series * "" * } - if$ - } - { key * } - if$ - } - { format.crossref.editor * } - if$ - " \citelabel{" * crossref * "}" * -} - -FUNCTION {format.incoll.inproc.crossref} -{ - "In " * - editor empty$ - editor field.or.null author field.or.null = - or - { key empty$ - { booktitle empty$ - { "need editor, key, or booktitle for " cite$ * " to crossref " * - crossref * warning$ - "" - } - { "" * booktitle * "" * } - if$ - } - { key * } - if$ - } - { format.crossref.editor * } - if$ - " \citelabel{" * crossref * "}" * -} - -FUNCTION {article} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - crossref missing$ - { journal emphasize "journal" output.check - format.vol.num.pages output - format.date "year" output.check - } - { format.article.crossref output.nonnull - format.pages output - } - if$ - new.block - note output - fin.entry -} - -FUNCTION {book} -{ output.bibitem - author empty$ - { format.editors "author and editor" output.check } - { format.authors output.nonnull - crossref missing$ - { "author and editor" editor either.or.check } - 'skip$ - if$ - } - if$ - new.block - format.btitle "title" output.check - crossref missing$ - { format.bvolume output - new.block - format.number.series output - new.sentence - publisher "publisher" output.check - address output - } - { new.block - format.book.crossref output.nonnull - } - if$ - format.edition output - format.date "year" output.check - new.block - note output - fin.entry -} - -FUNCTION {booklet} -{ output.bibitem - format.authors output - new.block - format.title "title" output.check - howpublished address new.block.checkb - howpublished output - address output - format.date output - new.block - note output - fin.entry -} - -FUNCTION {inbook} -{ output.bibitem - author empty$ - { format.editors "author and editor" output.check } - { format.authors output.nonnull - crossref missing$ - { "author and editor" editor either.or.check } - 'skip$ - if$ - } - if$ - new.block - format.btitle "title" output.check - crossref missing$ - { format.bvolume output - format.chapter.pages "chapter and pages" output.check - new.block - format.number.series output - new.sentence - publisher "publisher" output.check - address output - } - { format.chapter.pages "chapter and pages" output.check - new.block - format.book.crossref output.nonnull - } - if$ - format.edition output - format.date "year" output.check - new.block - note output - fin.entry -} - -FUNCTION {incollection} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - crossref missing$ - { format.in.ed.booktitle "booktitle" output.check - format.bvolume output - format.number.series output - format.chapter.pages output - new.sentence - publisher "publisher" output.check - address output - format.edition output - format.date "year" output.check - } - { format.incoll.inproc.crossref output.nonnull - format.chapter.pages output - } - if$ - new.block - note output - fin.entry -} - -FUNCTION {inproceedings} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - crossref missing$ - { format.in.ed.booktitle "booktitle" output.check - format.bvolume output - format.number.series output - format.pages output - address empty$ - { organization publisher new.sentence.checkb - organization output - publisher output - format.date "year" output.check - } - { address output.nonnull - format.date "year" output.check - new.sentence - organization output - publisher output - } - if$ - } - { format.incoll.inproc.crossref output.nonnull - format.pages output - } - if$ - new.block - note output - fin.entry -} - -FUNCTION {conference} { inproceedings } - -FUNCTION {manual} -{ output.bibitem - author empty$ - { organization empty$ - 'skip$ - { organization output.nonnull - address output - } - if$ - } - { format.authors output.nonnull } - if$ - new.block - format.btitle "title" output.check - author empty$ - { organization empty$ - { address new.block.checka - address output - } - 'skip$ - if$ - } - { organization address new.block.checkb - organization output - address output - } - if$ - format.edition output - format.date output - new.block - note output - fin.entry -} - -FUNCTION {mastersthesis} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - "Master's thesis" format.thesis.type output.nonnull - school "school" output.check - address output - format.date "year" output.check - new.block - note output - fin.entry -} - -FUNCTION {misc} -{ output.bibitem - format.authors output - title howpublished new.block.checkb - format.title output - howpublished new.block.checka - howpublished output - format.date output - new.block - note output - fin.entry - empty.misc.check -} - -FUNCTION {phdthesis} -{ output.bibitem - format.authors "author" output.check - new.block - format.btitle "title" output.check - new.block - "PhD thesis" format.thesis.type output.nonnull - school "school" output.check - address output - format.date "year" output.check - new.block - note output - fin.entry -} - -FUNCTION {proceedings} -{ output.bibitem - editor empty$ - { organization output } - { format.editors output.nonnull } - if$ - new.block - format.btitle "title" output.check - format.bvolume output - format.number.series output - address empty$ - { editor empty$ - { publisher new.sentence.checka } - { organization publisher new.sentence.checkb - organization output - } - if$ - publisher output - format.date "year" output.check - } - { address output.nonnull - format.date "year" output.check - new.sentence - editor empty$ - 'skip$ - { organization output } - if$ - publisher output - } - if$ - new.block - note output - fin.entry -} - -FUNCTION {techreport} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - format.tr.number output.nonnull - institution "institution" output.check - address output - format.date "year" output.check - new.block - note output - fin.entry -} - -FUNCTION {unpublished} -{ output.bibitem - format.authors "author" output.check - new.block - format.title "title" output.check - new.block - note "note" output.check - format.date output - fin.entry -} - -FUNCTION {default.type} { misc } - -MACRO {jan} {"January"} - -MACRO {feb} {"February"} - -MACRO {mar} {"March"} - -MACRO {apr} {"April"} - -MACRO {may} {"May"} - -MACRO {jun} {"June"} - -MACRO {jul} {"July"} - -MACRO {aug} {"August"} - -MACRO {sep} {"September"} - -MACRO {oct} {"October"} - -MACRO {nov} {"November"} - -MACRO {dec} {"December"} - -MACRO {acmcs} {"ACM Computing Surveys"} - -MACRO {acta} {"Acta Informatica"} - -MACRO {cacm} {"Communications of the ACM"} - -MACRO {ibmjrd} {"IBM Journal of Research and Development"} - -MACRO {ibmsj} {"IBM Systems Journal"} - -MACRO {ieeese} {"IEEE Transactions on Software Engineering"} - -MACRO {ieeetc} {"IEEE Transactions on Computers"} - -MACRO {ieeetcad} - {"IEEE Transactions on Computer-Aided Design of Integrated Circuits"} - -MACRO {ipl} {"Information Processing Letters"} - -MACRO {jacm} {"Journal of the ACM"} - -MACRO {jcss} {"Journal of Computer and System Sciences"} - -MACRO {scp} {"Science of Computer Programming"} - -MACRO {sicomp} {"SIAM Journal on Computing"} - -MACRO {tocs} {"ACM Transactions on Computer Systems"} - -MACRO {tods} {"ACM Transactions on Database Systems"} - -MACRO {tog} {"ACM Transactions on Graphics"} - -MACRO {toms} {"ACM Transactions on Mathematical Software"} - -MACRO {toois} {"ACM Transactions on Office Information Systems"} - -MACRO {toplas} {"ACM Transactions on Programming Languages and Systems"} - -MACRO {tcs} {"Theoretical Computer Science"} - -READ - -FUNCTION {sortify} -{ purify$ - "l" change.case$ -} - -INTEGERS { len } - -FUNCTION {chop.word} -{ 's := - 'len := - s #1 len substring$ = - { s len #1 + global.max$ substring$ } - 's - if$ -} - - -FUNCTION {format.lab.names} -{ 's := - s num.names$ 'numnames := - numnames #1 = - { s #1 "{vv }{ll}" format.name$ } - { numnames #2 = - { s #1 "{vv }{ll }and " format.name$ s #2 "{vv }{ll}" format.name$ * } - { s #1 "{vv }{ll }" format.name$ "et~al." * } - if$ - } - if$ -} - -FUNCTION {author.key.label} -{ author empty$ - { key empty$ - { cite$ #1 #3 substring$ } - { key } - if$ - } - { author format.lab.names } - if$ -} - -FUNCTION {author.editor.key.label} -{ author empty$ - { editor empty$ - { key empty$ - { cite$ #1 #3 substring$ } - { key } - if$ - } - { editor format.lab.names } - if$ - } - { author format.lab.names } - if$ -} - -FUNCTION {author.key.organization.label} -{ author empty$ - { key empty$ - { organization empty$ - { cite$ #1 #3 substring$ } - { "The " #4 organization chop.word #3 text.prefix$ } - if$ - } - { key } - if$ - } - { author format.lab.names } - if$ -} - -FUNCTION {editor.key.organization.label} -{ editor empty$ - { key empty$ - { organization empty$ - { cite$ #1 #3 substring$ } - { "The " #4 organization chop.word #3 text.prefix$ } - if$ - } - { key } - if$ - } - { editor format.lab.names } - if$ -} - -FUNCTION {month.to.int} -{ - "l" change.case$ #3 text.prefix$ - 's := - s "jan" = { #1 } { - s "feb" = { #2 } { - s "mar" = { #3 } { - s "apr" = { #4 } { - s "may" = { #5 } { - s "jun" = { #6 } { - s "jul" = { #7 } { - s "aug" = { #8 } { - s "sep" = { #9 } { - s "oct" = { #10 } { - s "nov" = { #11 } { - s "dec" = { #12 } { #13 } % 13 if nothing matches - if$}if$}if$}if$}if$}if$}if$}if$}if$}if$}if$}if$ -} - -INTEGERS { done c } -FUNCTION { get.day } -{ month field.or.null 's := - - % Strip out month name - #0 'done := - { s "" = not done not and } - { s #1 #1 substring$ " " = 'done := - s #2 global.max$ substring$ 's := - } - while$ - - % Build up first number in t - "0" 't := - #0 'done := - { s "" = not done not and } - { s #1 #1 substring$ chr.to.int$ 'c := - c #47 > c #58 < and - { t c int.to.chr$ * 't := } - { #1 'done := } - if$ - s #2 global.max$ substring$ 's := - } - while$ - - t str.to.int -} - -FUNCTION { sortify.fourdigit } -{ 's := - s empty$ - { "0000" } - { s - } - if$ -} - -FUNCTION { sortify.twodigit } -{ 's := - s empty$ - { "00" } - { s - str.to.int #10 + int.to.str$ - } - if$ -} - -FUNCTION {calc.label} -{ type$ "book" = - type$ "inbook" = - or - 'author.editor.key.label - { type$ "proceedings" = - 'editor.key.organization.label - { type$ "manual" = - 'author.key.organization.label - 'author.key.label - if$ - } - if$ - } - if$ - duplicate$ - - year empty$ - 'skip$ - { ", " * } - if$ - year field.or.null purify$ * % CHANGED - pfps - 15 Feb 1989 - 'label := - - year field.or.null purify$ - #-1 #4 substring$ - sortify.fourdigit - " " * - month field.or.null month.to.int int.to.str$ sortify.twodigit * - " " * - get.day int.to.str$ sortify.twodigit * - " " * - * sortify 'sort.label := -} - -FUNCTION {sort.format.names} -{ 's := - #1 'nameptr := - "" - s num.names$ 'numnames := - numnames 'namesleft := - { namesleft #0 > } - { nameptr #1 > - { " " * } - 'skip$ - if$ - s nameptr "{vv{ } }{ll{ }}{ ff{ }}{ jj{ }}" format.name$ 't := - nameptr numnames = t "others" = and - { "et al." * } - { t sortify * } - if$ - nameptr #1 + 'nameptr := - namesleft #1 - 'namesleft := - } - while$ -} - -FUNCTION {sort.format.title} -{ 't := - "A " #2 - "An " #3 - "The " #4 t chop.word - chop.word - chop.word - sortify - #1 global.max$ substring$ -} - -FUNCTION {author.sort} -{ author empty$ - { key empty$ - { "to sort, need author or key in " cite$ * warning$ - "" - } - { key sortify } - if$ - } - { author sort.format.names } - if$ -} - -FUNCTION {author.editor.sort} -{ author empty$ - { editor empty$ - { key empty$ - { "to sort, need author, editor, or key in " cite$ * warning$ - "" - } - { key sortify } - if$ - } - { editor sort.format.names } - if$ - } - { author sort.format.names } - if$ -} - -FUNCTION {author.organization.sort} -{ author empty$ - { organization empty$ - { key empty$ - { "to sort, need author, organization, or key in " cite$ * warning$ - "" - } - { key sortify } - if$ - } - { "The " #4 organization chop.word sortify } - if$ - } - { author sort.format.names } - if$ -} - -FUNCTION {editor.organization.sort} -{ editor empty$ - { organization empty$ - { key empty$ - { "to sort, need editor, organization, or key in " cite$ * warning$ - "" - } - { key sortify } - if$ - } - { "The " #4 organization chop.word sortify } - if$ - } - { editor sort.format.names } - if$ -} - -FUNCTION {presort} -{ calc.label - sort.label - " " - * - type$ "book" = - type$ "inbook" = - or - 'author.editor.sort - { type$ "proceedings" = - 'editor.organization.sort - { type$ "manual" = - 'author.organization.sort - 'author.sort - if$ - } - if$ - } - if$ - * - " " - * - year field.or.null sortify - * - " " - * - title field.or.null - sort.format.title - * - #1 entry.max$ substring$ - 'sort.key$ := -} - -ITERATE {presort} - -SORT - -STRINGS { longest.label last.sort.label next.extra } - -INTEGERS { longest.label.width last.extra.num } - -FUNCTION {initialize.longest.label} -{ "" 'longest.label := - #0 int.to.chr$ 'last.sort.label := - "" 'next.extra := - #0 'longest.label.width := - #0 'last.extra.num := -} - -FUNCTION {forward.pass} -{ last.sort.label sort.label = - { last.extra.num #1 + 'last.extra.num := - last.extra.num int.to.chr$ 'extra.label := - } - { "a" chr.to.int$ 'last.extra.num := - "" 'extra.label := - sort.label 'last.sort.label := - } - if$ -} - -FUNCTION {reverse.pass} -{ next.extra "b" = - { "a" 'extra.label := } - 'skip$ - if$ - label extra.label * 'label := - label width$ longest.label.width > - { label 'longest.label := - label width$ 'longest.label.width := - } - 'skip$ - if$ - extra.label 'next.extra := -} - -EXECUTE {initialize.longest.label} - -ITERATE {forward.pass} - -REVERSE {reverse.pass} - -FUNCTION {begin.bib} -{ - "# label-style: default" write$ newline$ -} - -EXECUTE {begin.bib} - -EXECUTE {init.state.consts} - -ITERATE {call.type$} - -FUNCTION {end.bib} -{ newline$ -} - -EXECUTE {end.bib} diff --git a/src/doxygen.cpp b/src/doxygen.cpp index 4e8409a..df1f853 100644 --- a/src/doxygen.cpp +++ b/src/doxygen.cpp @@ -100,6 +100,9 @@ #include "context.h" #include "fileparser.h" +// provided by the generated file resources.cpp +extern void initResources(); + #define RECURSE_ENTRYTREE(func,var) \ do { if (var->children()) { \ EntryNavListIterator eli(*var->children()); \ @@ -9915,6 +9918,7 @@ static const char *getArg(int argc,char **argv,int &optind) void initDoxygen() { + initResources(); const char *lang = portable_getenv("LC_ALL"); if (lang) portable_setenv("LANG",lang); setlocale(LC_ALL,""); @@ -10884,7 +10888,7 @@ void parseInput() QCString htmlOutput; bool &generateHtml = Config_getBool("GENERATE_HTML"); - if (generateHtml) + if (generateHtml || g_useOutputTemplate /* TODO: temp hack */) htmlOutput = createOutputDirectory(outputDirectory,"HTML_OUTPUT","/html"); QCString docbookOutput; diff --git a/src/doxygen.css b/src/doxygen.css deleted file mode 100644 index 2f4bf70..0000000 --- a/src/doxygen.css +++ /dev/null @@ -1,1440 +0,0 @@ -/* The standard CSS for doxygen $doxygenversion */ - -body, table, div, p, dl { - font: 400 14px/22px Roboto,sans-serif; -} - -/* @group Heading Levels */ - -h1.groupheader { - font-size: 150%; -} - -.title { - font: 400 14px/28px Roboto,sans-serif; - font-size: 150%; - font-weight: bold; - margin: 10px 2px; -} - -h2.groupheader { - border-bottom: 1px solid ##99; - color: ##44; - font-size: 150%; - font-weight: normal; - margin-top: 1.75em; - padding-top: 8px; - padding-bottom: 4px; - width: 100%; -} - -h3.groupheader { - font-size: 100%; -} - -h1, h2, h3, h4, h5, h6 { - -webkit-transition: text-shadow 0.5s linear; - -moz-transition: text-shadow 0.5s linear; - -ms-transition: text-shadow 0.5s linear; - -o-transition: text-shadow 0.5s linear; - transition: text-shadow 0.5s linear; - margin-right: 15px; -} - -h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow { - text-shadow: 0 0 15px cyan; -} - -dt { - font-weight: bold; -} - -div.multicol { - -moz-column-gap: 1em; - -webkit-column-gap: 1em; - -moz-column-count: 3; - -webkit-column-count: 3; -} - -p.startli, p.startdd { - margin-top: 2px; -} - -p.starttd { - margin-top: 0px; -} - -p.endli { - margin-bottom: 0px; -} - -p.enddd { - margin-bottom: 4px; -} - -p.endtd { - margin-bottom: 2px; -} - -/* @end */ - -caption { - font-weight: bold; -} - -span.legend { - font-size: 70%; - text-align: center; -} - -h3.version { - font-size: 90%; - text-align: center; -} - -div.qindex, div.navtab{ - background-color: ##ee; - border: 1px solid ##b0; - text-align: center; -} - -div.qindex, div.navpath { - width: 100%; - line-height: 140%; -} - -div.navtab { - margin-right: 15px; -} - -/* @group Link Styling */ - -a { - color: ##50; - font-weight: normal; - text-decoration: none; -} - -.contents a:visited { - color: ##60; -} - -a:hover { - text-decoration: underline; -} - -a.qindex { - font-weight: bold; -} - -a.qindexHL { - font-weight: bold; - background-color: ##AA; - color: #ffffff; - border: 1px double ##98; -} - -.contents a.qindexHL:visited { - color: #ffffff; -} - -a.el { - font-weight: bold; -} - -a.elRef { -} - -a.code, a.code:visited, a.line, a.line:visited { - color: #4665A2; -} - -a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited { - color: #4665A2; -} - -/* @end */ - -dl.el { - margin-left: -1cm; -} - -pre.fragment { - border: 1px solid #C4CFE5; - background-color: #FBFCFD; - padding: 4px 6px; - margin: 4px 8px 4px 2px; - overflow: auto; - word-wrap: break-word; - font-size: 9pt; - line-height: 125%; - font-family: monospace, fixed; - font-size: 105%; -} - -div.fragment { - padding: 4px 6px; - margin: 4px 8px 4px 2px; - background-color: ##FC; - border: 1px solid ##CC; -} - -div.line { - font-family: monospace, fixed; - font-size: 13px; - min-height: 13px; - line-height: 1.0; - text-wrap: unrestricted; - white-space: -moz-pre-wrap; /* Moz */ - white-space: -pre-wrap; /* Opera 4-6 */ - white-space: -o-pre-wrap; /* Opera 7 */ - white-space: pre-wrap; /* CSS3 */ - word-wrap: break-word; /* IE 5.5+ */ - text-indent: -53px; - padding-left: 53px; - padding-bottom: 0px; - margin: 0px; - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -div.line.glow { - background-color: cyan; - box-shadow: 0 0 10px cyan; -} - - -span.lineno { - padding-right: 4px; - text-align: right; - border-right: 2px solid #0F0; - background-color: #E8E8E8; - white-space: pre; -} -span.lineno a { - background-color: #D8D8D8; -} - -span.lineno a:hover { - background-color: #C8C8C8; -} - -div.ah { - background-color: black; - font-weight: bold; - color: #ffffff; - margin-bottom: 3px; - margin-top: 3px; - padding: 0.2em; - border: solid thin #333; - border-radius: 0.5em; - -webkit-border-radius: .5em; - -moz-border-radius: .5em; - box-shadow: 2px 2px 3px #999; - -webkit-box-shadow: 2px 2px 3px #999; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444)); - background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000); -} - -div.groupHeader { - margin-left: 16px; - margin-top: 12px; - font-weight: bold; -} - -div.groupText { - margin-left: 16px; - font-style: italic; -} - -body { - background-color: white; - color: black; - margin: 0; -} - -div.contents { - margin-top: 10px; - margin-left: 12px; - margin-right: 8px; -} - -td.indexkey { - background-color: ##ee; - font-weight: bold; - border: 1px solid ##cc; - margin: 2px 0px 2px 0; - padding: 2px 10px; - white-space: nowrap; - vertical-align: top; -} - -td.indexvalue { - background-color: ##ee; - border: 1px solid ##cc; - padding: 2px 10px; - margin: 2px 0px; -} - -tr.memlist { - background-color: ##f0; -} - -p.formulaDsp { - text-align: center; -} - -img.formulaDsp { - -} - -img.formulaInl { - vertical-align: middle; -} - -div.center { - text-align: center; - margin-top: 0px; - margin-bottom: 0px; - padding: 0px; -} - -div.center img { - border: 0px; -} - -address.footer { - text-align: right; - padding-right: 12px; -} - -img.footer { - border: 0px; - vertical-align: middle; -} - -/* @group Code Colorization */ - -span.keyword { - color: #008000 -} - -span.keywordtype { - color: #604020 -} - -span.keywordflow { - color: #e08000 -} - -span.comment { - color: #800000 -} - -span.preprocessor { - color: #806020 -} - -span.stringliteral { - color: #002080 -} - -span.charliteral { - color: #008080 -} - -span.vhdldigit { - color: #ff00ff -} - -span.vhdlchar { - color: #000000 -} - -span.vhdlkeyword { - color: #700070 -} - -span.vhdllogic { - color: #ff0000 -} - -blockquote { - background-color: ##F8; - border-left: 2px solid ##AA; - margin: 0 24px 0 4px; - padding: 0 12px 0 16px; -} - -/* @end */ - -/* -.search { - color: #003399; - font-weight: bold; -} - -form.search { - margin-bottom: 0px; - margin-top: 0px; -} - -input.search { - font-size: 75%; - color: #000080; - font-weight: normal; - background-color: #e8eef2; -} -*/ - -td.tiny { - font-size: 75%; -} - -.dirtab { - padding: 4px; - border-collapse: collapse; - border: 1px solid ##b0; -} - -th.dirtab { - background: ##ee; - font-weight: bold; -} - -hr { - height: 0px; - border: none; - border-top: 1px solid ##66; -} - -hr.footer { - height: 1px; -} - -/* @group Member Descriptions */ - -table.memberdecls { - border-spacing: 0px; - padding: 0px; -} - -.memberdecls td, .fieldtable tr { - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -.memberdecls td.glow, .fieldtable tr.glow { - background-color: cyan; - box-shadow: 0 0 15px cyan; -} - -.mdescLeft, .mdescRight, -.memItemLeft, .memItemRight, -.memTemplItemLeft, .memTemplItemRight, .memTemplParams { - background-color: ##FA; - border: none; - margin: 4px; - padding: 1px 0 0 8px; -} - -.mdescLeft, .mdescRight { - padding: 0px 8px 4px 8px; - color: #555; -} - -.memSeparator { - border-bottom: 1px solid #DEE4F0; - line-height: 1px; - margin: 0px; - padding: 0px; -} - -.memItemLeft, .memTemplItemLeft { - white-space: nowrap; -} - -.memItemRight { - width: 100%; -} - -.memTemplParams { - color: ##60; - white-space: nowrap; - font-size: 80%; -} - -/* @end */ - -/* @group Member Details */ - -/* Styles for detailed member documentation */ - -.memtemplate { - font-size: 80%; - color: ##60; - font-weight: normal; - margin-left: 9px; -} - -.memnav { - background-color: ##ee; - border: 1px solid ##b0; - text-align: center; - margin: 2px; - margin-right: 15px; - padding: 2px; -} - -.mempage { - width: 100%; -} - -.memitem { - padding: 0; - margin-bottom: 10px; - margin-right: 5px; - -webkit-transition: box-shadow 0.5s linear; - -moz-transition: box-shadow 0.5s linear; - -ms-transition: box-shadow 0.5s linear; - -o-transition: box-shadow 0.5s linear; - transition: box-shadow 0.5s linear; - display: table !important; - width: 100%; -} - -.memitem.glow { - box-shadow: 0 0 15px cyan; -} - -.memname { - font-weight: bold; - margin-left: 6px; -} - -.memname td { - vertical-align: bottom; -} - -.memproto, dl.reflist dt { - border-top: 1px solid ##B4; - border-left: 1px solid ##B4; - border-right: 1px solid ##B4; - padding: 6px 0px 6px 0px; - color: ##2b; - font-weight: bold; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - background-image:url('nav_f.png'); - background-repeat:repeat-x; - background-color: ##E6; - /* opera specific markup */ - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - border-top-right-radius: 4px; - border-top-left-radius: 4px; - /* firefox specific markup */ - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - -moz-border-radius-topright: 4px; - -moz-border-radius-topleft: 4px; - /* webkit specific markup */ - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - -webkit-border-top-right-radius: 4px; - -webkit-border-top-left-radius: 4px; - -} - -.memdoc, dl.reflist dd { - border-bottom: 1px solid ##B4; - border-left: 1px solid ##B4; - border-right: 1px solid ##B4; - padding: 6px 10px 2px 10px; - background-color: ##FC; - border-top-width: 0; - background-image:url('nav_g.png'); - background-repeat:repeat-x; - background-color: #FFFFFF; - /* opera specific markup */ - border-bottom-left-radius: 4px; - border-bottom-right-radius: 4px; - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - /* firefox specific markup */ - -moz-border-radius-bottomleft: 4px; - -moz-border-radius-bottomright: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - /* webkit specific markup */ - -webkit-border-bottom-left-radius: 4px; - -webkit-border-bottom-right-radius: 4px; - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); -} - -dl.reflist dt { - padding: 5px; -} - -dl.reflist dd { - margin: 0px 0px 10px 0px; - padding: 5px; -} - -.paramkey { - text-align: right; -} - -.paramtype { - white-space: nowrap; -} - -.paramname { - color: #602020; - white-space: nowrap; -} -.paramname em { - font-style: normal; -} -.paramname code { - line-height: 14px; -} - -.params, .retval, .exception, .tparams { - margin-left: 0px; - padding-left: 0px; -} - -.params .paramname, .retval .paramname { - font-weight: bold; - vertical-align: top; -} - -.params .paramtype { - font-style: italic; - vertical-align: top; -} - -.params .paramdir { - font-family: "courier new",courier,monospace; - vertical-align: top; -} - -table.mlabels { - border-spacing: 0px; -} - -td.mlabels-left { - width: 100%; - padding: 0px; -} - -td.mlabels-right { - vertical-align: bottom; - padding: 0px; - white-space: nowrap; -} - -span.mlabels { - margin-left: 8px; -} - -span.mlabel { - background-color: ##88; - border-top:1px solid ##70; - border-left:1px solid ##70; - border-right:1px solid ##CC; - border-bottom:1px solid ##CC; - text-shadow: none; - color: white; - margin-right: 4px; - padding: 2px 3px; - border-radius: 3px; - font-size: 7pt; - white-space: nowrap; - vertical-align: middle; -} - - - -/* @end */ - -/* these are for tree view inside a (index) page */ - -div.directory { - margin: 10px 0px; - border-top: 1px solid ##AA; - border-bottom: 1px solid ##AA; - width: 100%; -} - -.directory table { - border-collapse:collapse; -} - -.directory td { - margin: 0px; - padding: 0px; - vertical-align: top; -} - -.directory td.entry { - white-space: nowrap; - padding-right: 6px; - padding-top: 3px; -} - -.directory td.entry a { - outline:none; -} - -.directory td.entry a img { - border: none; -} - -.directory td.desc { - width: 100%; - padding-left: 6px; - padding-right: 6px; - padding-top: 3px; - border-left: 1px solid rgba(0,0,0,0.05); -} - -.directory tr.even { - padding-left: 6px; - background-color: ##F8; -} - -.directory img { - vertical-align: -30%; -} - -.directory .levels { - white-space: nowrap; - width: 100%; - text-align: right; - font-size: 9pt; -} - -.directory .levels span { - cursor: pointer; - padding-left: 2px; - padding-right: 2px; - color: ##50; -} - -.arrow { - color: ##AA; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; - cursor: pointer; - font-size: 80%; - display: inline-block; - width: 16px; - height: 22px; -} - -.icon { - font-family: Arial, Helvetica; - font-weight: bold; - font-size: 12px; - height: 14px; - width: 16px; - display: inline-block; - background-color: ##88; - color: white; - text-align: center; - border-radius: 4px; - margin-left: 2px; - margin-right: 2px; -} - -.icona { - width: 24px; - height: 22px; - display: inline-block; -} - -.iconfopen { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('ftv2folderopen.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -.iconfclosed { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('ftv2folderclosed.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -.icondoc { - width: 24px; - height: 18px; - margin-bottom: 4px; - background-image:url('ftv2doc.png'); - background-position: 0px -4px; - background-repeat: repeat-y; - vertical-align:top; - display: inline-block; -} - -table.directory { - font: 400 14px Roboto,sans-serif; -} - -/* @end */ - -div.dynheader { - margin-top: 8px; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -address { - font-style: normal; - color: ##33; -} - -table.doxtable { - border-collapse:collapse; - margin-top: 4px; - margin-bottom: 4px; -} - -table.doxtable td, table.doxtable th { - border: 1px solid ##37; - padding: 3px 7px 2px; -} - -table.doxtable th { - background-color: ##47; - color: #FFFFFF; - font-size: 110%; - padding-bottom: 4px; - padding-top: 5px; -} - -table.fieldtable { - /*width: 100%;*/ - margin-bottom: 10px; - border: 1px solid ##B4; - border-spacing: 0px; - -moz-border-radius: 4px; - -webkit-border-radius: 4px; - border-radius: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); - box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); -} - -.fieldtable td, .fieldtable th { - padding: 3px 7px 2px; -} - -.fieldtable td.fieldtype, .fieldtable td.fieldname { - white-space: nowrap; - border-right: 1px solid ##B4; - border-bottom: 1px solid ##B4; - vertical-align: top; -} - -.fieldtable td.fieldname { - padding-top: 3px; -} - -.fieldtable td.fielddoc { - border-bottom: 1px solid ##B4; - /*width: 100%;*/ -} - -.fieldtable td.fielddoc p:first-child { - margin-top: 0px; -} - -.fieldtable td.fielddoc p:last-child { - margin-bottom: 2px; -} - -.fieldtable tr:last-child td { - border-bottom: none; -} - -.fieldtable th { - background-image:url('nav_f.png'); - background-repeat:repeat-x; - background-color: ##E6; - font-size: 90%; - color: ##2B; - padding-bottom: 4px; - padding-top: 5px; - text-align:left; - -moz-border-radius-topleft: 4px; - -moz-border-radius-topright: 4px; - -webkit-border-top-left-radius: 4px; - -webkit-border-top-right-radius: 4px; - border-top-left-radius: 4px; - border-top-right-radius: 4px; - border-bottom: 1px solid ##B4; -} - - -.tabsearch { - top: 0px; - left: 10px; - height: 36px; - background-image: url('tab_b.png'); - z-index: 101; - overflow: hidden; - font-size: 13px; -} - -.navpath ul -{ - font-size: 11px; - background-image:url('tab_b.png'); - background-repeat:repeat-x; - background-position: 0 -5px; - height:30px; - line-height:30px; - color:##9b; - border:solid 1px ##ca; - overflow:hidden; - margin:0px; - padding:0px; -} - -.navpath li -{ - list-style-type:none; - float:left; - padding-left:10px; - padding-right:15px; - background-image:url('bc_s.png'); - background-repeat:no-repeat; - background-position:right; - color:##45; -} - -.navpath li.navelem a -{ - height:32px; - display:block; - text-decoration: none; - outline: none; - color: ##30; - font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - text-decoration: none; -} - -.navpath li.navelem a:hover -{ - color:##80; -} - -.navpath li.footer -{ - list-style-type:none; - float:right; - padding-left:10px; - padding-right:15px; - background-image:none; - background-repeat:no-repeat; - background-position:right; - color:##45; - font-size: 8pt; -} - - -div.summary -{ - float: right; - font-size: 8pt; - padding-right: 5px; - width: 50%; - text-align: right; -} - -div.summary a -{ - white-space: nowrap; -} - -div.ingroups -{ - font-size: 8pt; - width: 50%; - text-align: left; -} - -div.ingroups a -{ - white-space: nowrap; -} - -div.header -{ - background-image:url('nav_h.png'); - background-repeat:repeat-x; - background-color: ##FA; - margin: 0px; - border-bottom: 1px solid ##CC; -} - -div.headertitle -{ - padding: 5px 5px 5px 10px; -} - -dl -{ - padding: 0 0 0 10px; -} - -/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */ -dl.section -{ - margin-left: 0px; - padding-left: 0px; -} - -dl.note -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #D0C000; -} - -dl.warning, dl.attention -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #FF0000; -} - -dl.pre, dl.post, dl.invariant -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #00D000; -} - -dl.deprecated -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #505050; -} - -dl.todo -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #00C0E0; -} - -dl.test -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #3030E0; -} - -dl.bug -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #C08050; -} - -dl.section dd { - margin-bottom: 6px; -} - - -#projectlogo -{ - text-align: center; - vertical-align: bottom; - border-collapse: separate; -} - -#projectlogo img -{ - border: 0px none; -} - -#projectname -{ - font: 300% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 2px 0px; -} - -#projectbrief -{ - font: 120% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; -} - -#projectnumber -{ - font: 50% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; -} - -#titlearea -{ - padding: 0px; - margin: 0px; - width: 100%; - border-bottom: 1px solid ##70; -} - -.image -{ - text-align: center; -} - -.dotgraph -{ - text-align: center; -} - -.mscgraph -{ - text-align: center; -} - -.diagraph -{ - text-align: center; -} - -.caption -{ - font-weight: bold; -} - -div.zoom -{ - border: 1px solid ##A0; -} - -dl.citelist { - margin-bottom:50px; -} - -dl.citelist dt { - color:##40; - float:left; - font-weight:bold; - margin-right:10px; - padding:5px; -} - -dl.citelist dd { - margin:2px 0; - padding:5px 0; -} - -div.toc { - padding: 14px 25px; - background-color: ##F6; - border: 1px solid ##DD; - border-radius: 7px 7px 7px 7px; - float: right; - height: auto; - margin: 0 20px 10px 10px; - width: 200px; -} - -div.toc li { - background: url("bdwn.png") no-repeat scroll 0 5px transparent; - font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif; - margin-top: 5px; - padding-left: 10px; - padding-top: 2px; -} - -div.toc h3 { - font: bold 12px/1.2 Arial,FreeSans,sans-serif; - color: ##60; - border-bottom: 0 none; - margin: 0; -} - -div.toc ul { - list-style: none outside none; - border: medium none; - padding: 0px; -} - -div.toc li.level1 { - margin-left: 0px; -} - -div.toc li.level2 { - margin-left: 15px; -} - -div.toc li.level3 { - margin-left: 30px; -} - -div.toc li.level4 { - margin-left: 45px; -} - -.inherit_header { - font-weight: bold; - color: gray; - cursor: pointer; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -.inherit_header td { - padding: 6px 0px 2px 5px; -} - -.inherit { - display: none; -} - -tr.heading h2 { - margin-top: 12px; - margin-bottom: 4px; -} - -/* tooltip related style info */ - -.ttc { - position: absolute; - display: none; -} - -#powerTip { - cursor: default; - white-space: nowrap; - background-color: white; - border: 1px solid gray; - border-radius: 4px 4px 4px 4px; - box-shadow: 1px 1px 7px gray; - display: none; - font-size: smaller; - max-width: 80%; - opacity: 0.9; - padding: 1ex 1em 1em; - position: absolute; - z-index: 2147483647; -} - -#powerTip div.ttdoc { - color: grey; - font-style: italic; -} - -#powerTip div.ttname a { - font-weight: bold; -} - -#powerTip div.ttname { - font-weight: bold; -} - -#powerTip div.ttdeci { - color: #006318; -} - -#powerTip div { - margin: 0px; - padding: 0px; - font: 12px/16px Roboto,sans-serif; -} - -#powerTip:before, #powerTip:after { - content: ""; - position: absolute; - margin: 0px; -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.s:after, #powerTip.s:before, -#powerTip.w:after, #powerTip.w:before, -#powerTip.e:after, #powerTip.e:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.nw:after, #powerTip.nw:before, -#powerTip.sw:after, #powerTip.sw:before { - border: solid transparent; - content: " "; - height: 0; - width: 0; - position: absolute; -} - -#powerTip.n:after, #powerTip.s:after, -#powerTip.w:after, #powerTip.e:after, -#powerTip.nw:after, #powerTip.ne:after, -#powerTip.sw:after, #powerTip.se:after { - border-color: rgba(255, 255, 255, 0); -} - -#powerTip.n:before, #powerTip.s:before, -#powerTip.w:before, #powerTip.e:before, -#powerTip.nw:before, #powerTip.ne:before, -#powerTip.sw:before, #powerTip.se:before { - border-color: rgba(128, 128, 128, 0); -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.nw:after, #powerTip.nw:before { - top: 100%; -} - -#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after { - border-top-color: #ffffff; - border-width: 10px; - margin: 0px -10px; -} -#powerTip.n:before { - border-top-color: #808080; - border-width: 11px; - margin: 0px -11px; -} -#powerTip.n:after, #powerTip.n:before { - left: 50%; -} - -#powerTip.nw:after, #powerTip.nw:before { - right: 14px; -} - -#powerTip.ne:after, #powerTip.ne:before { - left: 14px; -} - -#powerTip.s:after, #powerTip.s:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.sw:after, #powerTip.sw:before { - bottom: 100%; -} - -#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after { - border-bottom-color: #ffffff; - border-width: 10px; - margin: 0px -10px; -} - -#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before { - border-bottom-color: #808080; - border-width: 11px; - margin: 0px -11px; -} - -#powerTip.s:after, #powerTip.s:before { - left: 50%; -} - -#powerTip.sw:after, #powerTip.sw:before { - right: 14px; -} - -#powerTip.se:after, #powerTip.se:before { - left: 14px; -} - -#powerTip.e:after, #powerTip.e:before { - left: 100%; -} -#powerTip.e:after { - border-left-color: #ffffff; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.e:before { - border-left-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -#powerTip.w:after, #powerTip.w:before { - right: 100%; -} -#powerTip.w:after { - border-right-color: #ffffff; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.w:before { - border-right-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -@media print -{ - #top { display: none; } - #side-nav { display: none; } - #nav-path { display: none; } - body { overflow:visible; } - h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } - .summary { display: none; } - .memitem { page-break-inside: avoid; } - #doc-content - { - margin-left:0 !important; - height:auto !important; - width:auto !important; - overflow:inherit; - display:inline; - } -} - diff --git a/src/doxygen.sty b/src/doxygen.sty deleted file mode 100644 index c423e12..0000000 --- a/src/doxygen.sty +++ /dev/null @@ -1,478 +0,0 @@ -\NeedsTeXFormat{LaTeX2e} -\ProvidesPackage{doxygen} - -% Packages used by this style file -\RequirePackage{alltt} -\RequirePackage{array} -\RequirePackage{calc} -\RequirePackage{float} -\RequirePackage{ifthen} -\RequirePackage{verbatim} -\RequirePackage[table]{xcolor} -\RequirePackage{xtab} - -%---------- Internal commands used in this style file ---------------- - -\newcommand{\ensurespace}[1]{% - \begingroup% - \setlength{\dimen@}{#1}% - \vskip\z@\@plus\dimen@% - \penalty -100\vskip\z@\@plus -\dimen@% - \vskip\dimen@% - \penalty 9999% - \vskip -\dimen@% - \vskip\z@skip% hide the previous |\vskip| from |\addvspace| - \endgroup% -} - -\newcommand{\DoxyLabelFont}{} -\newcommand{\entrylabel}[1]{% - {% - \parbox[b]{\labelwidth-4pt}{% - \makebox[0pt][l]{\DoxyLabelFont#1}% - \vspace{1.5\baselineskip}% - }% - }% -} - -\newenvironment{DoxyDesc}[1]{% - \ensurespace{4\baselineskip}% - \begin{list}{}{% - \settowidth{\labelwidth}{20pt}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{0pt}% - \setlength{\leftmargin}{\labelwidth+\labelsep}% - \renewcommand{\makelabel}{\entrylabel}% - }% - \item[#1]% -}{% - \end{list}% -} - -\newsavebox{\xrefbox} -\newlength{\xreflength} -\newcommand{\xreflabel}[1]{% - \sbox{\xrefbox}{#1}% - \setlength{\xreflength}{\wd\xrefbox}% - \ifthenelse{\xreflength>\labelwidth}{% - \begin{minipage}{\textwidth}% - \setlength{\parindent}{0pt}% - \hangindent=15pt\bfseries #1\vspace{1.2\itemsep}% - \end{minipage}% - }{% - \parbox[b]{\labelwidth}{\makebox[0pt][l]{\textbf{#1}}}% - }% -} - -%---------- Commands used by doxygen LaTeX output generator ---------- - -% Used by 
 ...
-\newenvironment{DoxyPre}{% - \small% - \begin{alltt}% -}{% - \end{alltt}% - \normalsize% -} - -% Used by @code ... @endcode -\newenvironment{DoxyCode}{% - \par% - \scriptsize% - \begin{alltt}% -}{% - \end{alltt}% - \normalsize% -} - -% Used by @example, @include, @includelineno and @dontinclude -\newenvironment{DoxyCodeInclude}{% - \DoxyCode% -}{% - \endDoxyCode% -} - -% Used by @verbatim ... @endverbatim -\newenvironment{DoxyVerb}{% - \footnotesize% - \verbatim% -}{% - \endverbatim% - \normalsize% -} - -% Used by @verbinclude -\newenvironment{DoxyVerbInclude}{% - \DoxyVerb% -}{% - \endDoxyVerb% -} - -% Used by numbered lists (using '-#' or
    ...
) -\newenvironment{DoxyEnumerate}{% - \enumerate% -}{% - \endenumerate% -} - -% Used by bullet lists (using '-', @li, @arg, or
    ...
) -\newenvironment{DoxyItemize}{% - \itemize% -}{% - \enditemize% -} - -% Used by description lists (using
...
) -\newenvironment{DoxyDescription}{% - \description% -}{% - \enddescription% -} - -% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc -% (only if caption is specified) -\newenvironment{DoxyImage}{% - \begin{figure}[H]% - \begin{center}% -}{% - \end{center}% - \end{figure}% -} - -% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc -% (only if no caption is specified) -\newenvironment{DoxyImageNoCaption}{% -}{% -} - -% Used by @attention -\newenvironment{DoxyAttention}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @author and @authors -\newenvironment{DoxyAuthor}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @date -\newenvironment{DoxyDate}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @invariant -\newenvironment{DoxyInvariant}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @note -\newenvironment{DoxyNote}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @post -\newenvironment{DoxyPostcond}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @pre -\newenvironment{DoxyPrecond}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @copyright -\newenvironment{DoxyCopyright}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @remark -\newenvironment{DoxyRemark}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @return and @returns -\newenvironment{DoxyReturn}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @since -\newenvironment{DoxySince}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @see -\newenvironment{DoxySeeAlso}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @version -\newenvironment{DoxyVersion}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @warning -\newenvironment{DoxyWarning}[1]{% - \begin{DoxyDesc}{#1}% -}{% - \end{DoxyDesc}% -} - -% Used by @internal -\newenvironment{DoxyInternal}[1]{% - \paragraph*{#1}% -}{% -} - -% Used by @par and @paragraph -\newenvironment{DoxyParagraph}[1]{% - \begin{list}{}{% - \settowidth{\labelwidth}{40pt}% - \setlength{\leftmargin}{\labelwidth}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{-4pt}% - \renewcommand{\makelabel}{\entrylabel}% - }% - \item[#1]% -}{% - \end{list}% -} - -% Used by parameter lists -\newenvironment{DoxyParams}[2][]{% - \par% - \tabletail{\hline}% - \tablelasttail{\hline}% - \tablefirsthead{}% - \tablehead{}% - \ifthenelse{\equal{#1}{}}% - {\tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]}% - \begin{xtabular}{|>{\raggedleft\hspace{0pt}}p{0.15\textwidth}|% - p{0.805\textwidth}|}}% - {\ifthenelse{\equal{#1}{1}}% - {\tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]}% - \begin{xtabular}{|>{\centering}p{0.10\textwidth}|% - >{\raggedleft\hspace{0pt}}p{0.15\textwidth}|% - p{0.678\textwidth}|}}% - {\tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]}% - \begin{xtabular}{|>{\centering}p{0.10\textwidth}|% - >{\centering\hspace{0pt}}p{0.15\textwidth}|% - >{\raggedleft\hspace{0pt}}p{0.15\textwidth}|% - p{0.501\textwidth}|}}% - }\hline% -}{% - \end{xtabular}% - \tablefirsthead{}% - \vspace{6pt}% -} - -% Used for fields of simple structs -\newenvironment{DoxyFields}[1]{% - \par% - \tabletail{\hline}% - \tablelasttail{\hline}% - \tablehead{}% - \tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]}% - \begin{xtabular}{|>{\raggedleft\hspace{0pt}}p{0.15\textwidth}|% - p{0.15\textwidth}|% - p{0.63\textwidth}|}% - \hline% -}{% - \end{xtabular}% - \tablefirsthead{}% - \vspace{6pt}% -} - -% Used for parameters within a detailed function description -\newenvironment{DoxyParamCaption}{% - \renewcommand{\item}[2][]{##1 {\em ##2}}% -}{% -} - -% Used by return value lists -\newenvironment{DoxyRetVals}[1]{% - \par% - \tabletail{\hline}% - \tablelasttail{\hline}% - \tablehead{}% - \tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]}% - \begin{xtabular}{|>{\raggedleft\hspace{0pt}}p{0.25\textwidth}|% - p{0.705\textwidth}|}% - \hline% -}{% - \end{xtabular}% - \tablefirsthead{}% - \vspace{6pt}% -} - -% Used by exception lists -\newenvironment{DoxyExceptions}[1]{% - \par% - \tabletail{\hline}% - \tablelasttail{\hline}% - \tablehead{}% - \tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]}% - \begin{xtabular}{|>{\raggedleft\hspace{0pt}}p{0.25\textwidth}|% - p{0.705\textwidth}|}% - \hline% -}{% - \end{xtabular}% - \tablefirsthead{}% - \vspace{6pt}% -} - -% Used by template parameter lists -\newenvironment{DoxyTemplParams}[1]{% - \par% - \tabletail{\hline}% - \tablelasttail{\hline}% - \tablehead{}% - \tablefirsthead{\multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]}% - \begin{xtabular}{|>{\raggedleft\hspace{0pt}}p{0.25\textwidth}|% - p{0.705\textwidth}|}% - \hline% -}{% - \end{xtabular}% - \tablefirsthead{}% - \vspace{6pt}% -} - -% Used for member lists -\newenvironment{DoxyCompactItemize}{% - \begin{itemize}% - \setlength{\itemsep}{-3pt}% - \setlength{\parsep}{0pt}% - \setlength{\topsep}{0pt}% - \setlength{\partopsep}{0pt}% -}{% - \end{itemize}% -} - -% Used for member descriptions -\newenvironment{DoxyCompactList}{% - \begin{list}{}{% - \setlength{\leftmargin}{0.5cm}% - \setlength{\itemsep}{0pt}% - \setlength{\parsep}{0pt}% - \setlength{\topsep}{0pt}% - \renewcommand{\makelabel}{\hfill}% - }% -}{% - \end{list}% -} - -% Used for reference lists (@bug, @deprecated, @todo, etc.) -\newenvironment{DoxyRefList}{% - \begin{list}{}{% - \setlength{\labelwidth}{10pt}% - \setlength{\leftmargin}{\labelwidth}% - \addtolength{\leftmargin}{\labelsep}% - \renewcommand{\makelabel}{\xreflabel}% - }% -}{% - \end{list}% -} - -% Used by @bug, @deprecated, @todo, etc. -\newenvironment{DoxyRefDesc}[1]{% - \begin{list}{}{% - \renewcommand\makelabel[1]{\textbf{##1}}% - \settowidth\labelwidth{\makelabel{#1}}% - \setlength\leftmargin{\labelwidth+\labelsep}% - }% -}{% - \end{list}% -} - -% Used by parameter lists and simple sections -\newenvironment{Desc} -{\begin{list}{}{% - \settowidth{\labelwidth}{40pt}% - \setlength{\leftmargin}{\labelwidth}% - \setlength{\parsep}{0pt}% - \setlength{\itemsep}{-4pt}% - \renewcommand{\makelabel}{\entrylabel}% - } -}{% - \end{list}% -} - -% Used by tables -\newcommand{\PBS}[1]{\let\temp=\\#1\let\\=\temp}% -\newlength{\tmplength}% -\newenvironment{TabularC}[1]% -{% -\setlength{\tmplength}% - {\linewidth/(#1)-\tabcolsep*2-\arrayrulewidth*(#1+1)/(#1)}% - \par\begin{xtabular*}{\linewidth}% - {*{#1}{|>{\PBS\raggedright\hspace{0pt}}p{\the\tmplength}}|}% -}% -{\end{xtabular*}\par}% - -% Used by nested tables -\newenvironment{TabularNC}[1]% -{% -\setlength{\tmplength}% - {\linewidth/(#1)-\tabcolsep*2-\arrayrulewidth*(#1+1)/(#1)}% - \par\begin{tabular*}{\linewidth}% - {*{#1}{|>{\PBS\raggedright\hspace{0pt}}p{\the\tmplength}}|}% -}% -{\end{tabular*}\par}% - -% Used for member group headers -\newenvironment{Indent}{% - \begin{list}{}{% - \setlength{\leftmargin}{0.5cm}% - }% - \item[]\ignorespaces% -}{% - \unskip% - \end{list}% -} - -% Used when hyperlinks are turned off -\newcommand{\doxyref}[3]{% - \textbf{#1} (\textnormal{#2}\,\pageref{#3})% -} - -% Used by @addindex -\newcommand{\lcurly}{\{} -\newcommand{\rcurly}{\}} - -% Used for syntax highlighting -\definecolor{comment}{rgb}{0.5,0.0,0.0} -\definecolor{keyword}{rgb}{0.0,0.5,0.0} -\definecolor{keywordtype}{rgb}{0.38,0.25,0.125} -\definecolor{keywordflow}{rgb}{0.88,0.5,0.0} -\definecolor{preprocessor}{rgb}{0.5,0.38,0.125} -\definecolor{stringliteral}{rgb}{0.0,0.125,0.25} -\definecolor{charliteral}{rgb}{0.0,0.5,0.5} -\definecolor{vhdldigit}{rgb}{1.0,0.0,1.0} -\definecolor{vhdlkeyword}{rgb}{0.43,0.0,0.43} -\definecolor{vhdllogic}{rgb}{1.0,0.0,0.0} -\definecolor{vhdlchar}{rgb}{0.0,0.0,0.0} diff --git a/src/dynsections.js b/src/dynsections.js deleted file mode 100644 index 85e1836..0000000 --- a/src/dynsections.js +++ /dev/null @@ -1,97 +0,0 @@ -function toggleVisibility(linkObj) -{ - var base = $(linkObj).attr('id'); - var summary = $('#'+base+'-summary'); - var content = $('#'+base+'-content'); - var trigger = $('#'+base+'-trigger'); - var src=$(trigger).attr('src'); - if (content.is(':visible')===true) { - content.hide(); - summary.show(); - $(linkObj).addClass('closed').removeClass('opened'); - $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png'); - } else { - content.show(); - summary.hide(); - $(linkObj).removeClass('closed').addClass('opened'); - $(trigger).attr('src',src.substring(0,src.length-10)+'open.png'); - } - return false; -} - -function updateStripes() -{ - $('table.directory tr'). - removeClass('even').filter(':visible:even').addClass('even'); -} - -function toggleLevel(level) -{ - $('table.directory tr').each(function() { - var l = this.id.split('_').length-1; - var i = $('#img'+this.id.substring(3)); - var a = $('#arr'+this.id.substring(3)); - if (l": ">", - '"': '"', - "'": ''', - "/": '/' -}; - -function escapeHtml(s) { - return String(s).replace(/[&<>"'\/]/g, function (s) { - return entityMap[s]; - }); -} - -function searchFor(query,page,count) { - $.getJSON(serverUrl+"?cb=?", - { - n:count, - p:page, - q:query - }, - function(data) { - var results = $('#searchresults'); - $('#MSearchField').val(query); - if (data.hits>0) { - if (data.hits==1) { - results.html('

'+searchResultsText[1]+'

'); - } else { - results.html('

'+searchResultsText[2].replace(/\$num/,data.hits)+'

'); - } - var r=''; - $.each(data.items, function(i,item){ - var prefix = tagMap[item.tag]; - if (prefix) prefix+='/'; else prefix=''; - r+=''+ - ''+ - ''; - for (var i=0;i'; - } - r+=''; - }); - r+='
'+(data.first+i+1)+'.'+escapeHtml(item.type)+' '+ - ''+escapeHtml(item.name)+''; - if (item.type=="source") { - var l=item.url.match(/[1-9][0-9]*$/); - if (l) r+=' at line '+parseInt(l[0]); - } - r+='
'; - if (data.pages>1) // write multi page navigation bar - { - r+='
'; - if (data.page>0) - { - r+='« '; - } - var firstPage = data.page-5; - var lastPage = data.page+5; - if (firstPage<0) - { - lastPage-=firstPage; - firstPage=0; - } - if (lastPage>data.pages) - { - lastPage=data.pages; - } - for(var i=firstPage;i '; - } - else - { - r+=''+(i+1).toString()+' '; - } - } - if (data.page+1»'; - } - r+='
'; - } - results.append(r); - } else { - results.html('

'+searchResultsText[0]+'

'); - } - }); -} diff --git a/src/footer.html b/src/footer.html deleted file mode 100644 index d2aa9e6..0000000 --- a/src/footer.html +++ /dev/null @@ -1,20 +0,0 @@ - - - - - -
-$generatedby   -doxygen - $doxygenversion -
- - - diff --git a/src/ftvhelp.cpp b/src/ftvhelp.cpp index 4613a92..f45d956 100644 --- a/src/ftvhelp.cpp +++ b/src/ftvhelp.cpp @@ -36,549 +36,10 @@ #include "htmldocvisitor.h" #include "filedef.h" #include "util.h" +#include "resourcemgr.h" #define MAX_INDENT 1024 - -static const char navtree_script[]= -#include "navtree.js.h" -; - -static const char resize_script[]= -#include "resize.js.h" -; - -static const char navtree_css[]= -#include "navtree.css.h" -; - -static unsigned char blank_png[352] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -static unsigned char folderopen_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,228,195,193,190,187,218,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,195,215,221,225,225,178,176,176,175,176,178,180,255,255,255,255,255,255, - 255,255,255,255,255,255,189,206,215,219,226,220,214,212,207,204,200,176,255,255,255,255,255,255, - 255,255,255,255,168,154,153,153,152,152,151,149,150,150,149,147,146,145,145,167,255,255,255,255, - 255,255,255,255,146,187,187,188,187,187,185,183,183,182,179,178,175,173,174,145,255,255,255,255, - 255,255,255,255,146,180,182,182,181,181,179,178,176,174,173,171,169,170,168,144,255,255,255,255, - 255,255,255,255,144,173,176,176,177,175,175,174,171,170,168,168,166,166,164,143,255,255,255,255, - 255,255,255,255,142,168,170,171,170,170,169,168,166,166,165,163,163,164,162,142,255,255,255,255, - 255,255,255,255,141,162,166,164,164,165,163,163,161,161,161,161,161,160,159,141,255,255,255,255, - 255,255,255,255,138,157,159,159,158,158,158,157,157,157,157,156,157,157,155,138,255,255,255,255, - 255,255,255,255,137,154,153,154,154,153,154,154,154,153,154,154,154,154,154,137,255,255,255,255, - 255,255,255,255,137,154,154,154,154,154,154,154,153,154,154,153,153,153,154,137,255,255,255,255, - 255,255,255,255,137,125,125,125,125,124,125,124,124,125,124,124,125,124,125,138,255,255,255,255, - 255,255,255,255,212,209,204,199,193,190,186,183,180,181,185,188,192,197,202,203,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char folderopen_a_png[528] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,148,148,148,148,148,148,148,148,148,148,148,148,148,148,148,148, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -static unsigned char folderclosed_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,197,155,155,155,155,196,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,155,191,191,191,192,155,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,168,144,180,180,181,180,145,145,146,145,146,146,146,146,145,167,255,255,255,255, - 255,255,255,255,147,225,226,226,225,226,225,221,221,219,215,214,212,211,213,145,255,255,255,255, - 255,255,255,255,147,212,211,211,210,211,210,205,206,205,201,201,199,196,201,145,255,255,255,255, - 255,255,255,255,146,204,203,204,203,203,202,200,200,197,197,196,195,194,196,145,255,255,255,255, - 255,255,255,255,146,202,200,201,201,200,199,198,198,195,194,194,193,192,194,145,255,255,255,255, - 255,255,255,255,145,200,196,196,196,195,195,193,192,192,190,189,189,189,191,143,255,255,255,255, - 255,255,255,255,143,192,191,190,190,189,189,188,186,187,186,185,185,185,187,142,255,255,255,255, - 255,255,255,255,142,186,184,183,182,183,182,183,180,181,181,181,181,181,182,141,255,255,255,255, - 255,255,255,255,138,177,175,176,176,177,177,176,175,174,175,175,175,174,176,138,255,255,255,255, - 255,255,255,255,138,173,169,170,168,170,169,170,170,169,171,171,171,171,174,137,255,255,255,255, - 255,255,255,255,138,166,163,163,162,162,162,162,162,162,164,163,163,163,166,137,255,255,255,255, - 255,255,255,255,137,124,124,124,125,124,124,124,125,125,124,124,125,124,125,138,255,255,255,255, - 255,255,255,255,231,231,228,225,222,220,218,216,214,215,217,219,221,224,227,226,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char folderclosed_a_png[528] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, - 0, 0, 0, 0,148,148,148,148,148,148,148,148,148,148,148,148,148,148,148,148, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -static unsigned char doc_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,218,214,208,208,204,191,179,190,197,209,231,255,255,255,255,255,255,255,255, - 255,255,255,255,255,195,224,226,226,222,214,204,181,203,229,188,225,255,255,255,255,255,255,255, - 255,255,255,255,255,198,226,228,227,227,224,215,203,180,252,229,184,224,255,255,255,255,255,255, - 255,255,255,255,255,198,229,230,229,229,228,224,214,154,252,252,229,187,235,255,255,255,255,255, - 255,255,255,255,255,198,232,233,233,232,231,230,223,176,154,144,165,177,216,255,255,255,255,255, - 255,255,255,255,255,198,236,236,216,226,238,219,232,225,209,190,189,166,193,255,255,255,255,255, - 255,255,255,255,255,198,239,240,178,177,230,175,169,184,188,219,208,189,187,255,255,255,255,255, - 255,255,255,255,255,198,241,242,240,218,237,236,240,235,241,244,221,208,182,255,255,255,255,255, - 255,255,255,255,255,198,243,243,188,154,183,158,166,140,185,198,231,219,177,255,255,255,255,255, - 255,255,255,255,255,198,243,245,248,228,241,241,226,249,237,227,239,232,177,255,255,255,255,255, - 255,255,255,255,255,198,244,246,213,172,163,149,171,200,167,149,242,239,177,255,255,255,255,255, - 255,255,255,255,255,198,249,248,240,218,237,236,240,235,241,244,244,242,177,255,255,255,255,255, - 255,255,255,255,255,198,249,251,188,155,184,158,166,140,185,198,246,244,177,255,255,255,255,255, - 255,255,255,255,255,198,251,253,248,228,241,241,226,249,237,227,249,246,177,255,255,255,255,255, - 255,255,255,255,255,196,253,252,252,252,252,251,251,250,250,249,249,248,175,255,255,255,255,255, - 255,255,255,255,255,194, 64, 30, 37, 37, 37, 37, 37, 37, 37, 37, 30, 64,188,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char doc_a_png[528] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -#if 0 -static unsigned char module_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,255,193,128,136,255,255,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,255,213,128,170,255,255,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,247,247,128,196,255,247,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,213,255,153,230,255,213,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,187,255,187,255,230,204,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,153,255,247,255,196,204,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,128,247,255,255,170,204,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,128,213,255,255,136,204,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,255,255,128,187,255,230,138,204,255,217,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char namespace_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,226,128,128,198,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,255,189,128,198,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,255,244,141,198,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,255,255,220,198,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,226,255,255,220,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,198,220,255,255,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,198,141,250,255,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,198,128,198,255,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,157,255,255,198,128,128,226,255,255,157,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char class_png[528] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,187,247,255,255,230,170,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,196,255,255,255,255,255,255,170,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,145,255,255,230,128,136,230,247,179,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,179,255,255,170,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,179,255,255,162,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,179,255,255,170,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,145,255,255,221,128,128,221,255,179,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,196,255,255,255,255,255,255,187,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,187,247,255,255,240,179,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,128,128,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255, - 255,255,128,128,128,128,128,128,128,128,128,128,128,128,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - - -static unsigned char letter_a_png[528] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 60,156,204,204,204,204,204,204,204,204,156, 51, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 78,255,255,255,255,255,255,255,255,255,255,255,252, 72, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,210,255,255,255,255,255,255,255,255,255,255,255,255,207, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,240,255,255,255,255,255,255,255,255,255,255,255,255,240, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,222,255,255,255,255,255,255,255,255,255,255,255,255,219, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,111,255,255,255,255,255,255,255,255,255,255,255,255, 99, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 99,198,204,204,204,204,204,204,204,204,195, 90, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; -#endif - - -static unsigned char arrow_right_png[352] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,152,152,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,152,152,152,152,255,255,255,255,255,255,255,255,255, - 255,255,255,152,152,152,152,152,255,255,255,255,255,255,255,255, - 255,255,255,152,152,152,152,152,152,152,255,255,255,255,255,255, - 255,255,255,152,152,152,152,152,152,152,152,255,255,255,255,255, - 255,255,255,152,152,152,152,152,152,152,255,255,255,255,255,255, - 255,255,255,152,152,152,152,152,255,255,255,255,255,255,255,255, - 255,255,255,152,152,152,152,255,255,255,255,255,255,255,255,255, - 255,255,255,152,152,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char arrow_right_a_png[352] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,223, 75, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,176, 33, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,255,248,117, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,255,255,255,211, 60, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,255,255,255,255,255, 77, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,255,255,255,211, 60, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,255,248,117, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,255,255,176, 33, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,223, 75, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -static unsigned char arrow_down_png[352] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,152,152,152,152,152,152,152,152,152,255,255,255,255, - 255,255,255,152,152,152,152,152,152,152,152,152,255,255,255,255, - 255,255,255,255,152,152,152,152,152,152,152,255,255,255,255,255, - 255,255,255,255,152,152,152,152,152,152,152,255,255,255,255,255, - 255,255,255,255,255,152,152,152,152,152,255,255,255,255,255,255, - 255,255,255,255,255,255,152,152,152,255,255,255,255,255,255,255, - 255,255,255,255,255,255,152,152,152,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,152,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -static unsigned char arrow_down_a_png[352] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0,231,255,255,255,255,255,255,255,216, 0, 0, 0, 0, - 0, 0, 0, 87,255,255,255,255,255,255,255, 65, 0, 0, 0, 0, - 0, 0, 0, 0,186,255,255,255,255,255,164, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 38,251,255,255,255,241, 25, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0,127,255,255,255,107, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0,221,255,204, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 72,253, 52, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 77, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -#define SPLITBAR_LINE 170,242,224,202,183,170 -#define SPLITBAR_BLOCK2 SPLITBAR_LINE , SPLITBAR_LINE -#define SPLITBAR_BLOCK4 SPLITBAR_BLOCK2 , SPLITBAR_BLOCK2 -#define SPLITBAR_BLOCK8 SPLITBAR_BLOCK4 , SPLITBAR_BLOCK4 -#define SPLITBAR_BLOCK16 SPLITBAR_BLOCK8 , SPLITBAR_BLOCK8 -#define SPLITBAR_BLOCK32 SPLITBAR_BLOCK16 , SPLITBAR_BLOCK16 - -#define SPLITBAR_ALTLINE1 170,242,170,202,170,170 -#define SPLITBAR_ALTLINE2 170,243,224,255,183,255 -#define SPLITBAR_ALTBLOCK2 SPLITBAR_ALTLINE1 , SPLITBAR_ALTLINE2 -#define SPLITBAR_ALTBLOCK4 SPLITBAR_ALTBLOCK2 , SPLITBAR_ALTBLOCK2 -#define SPLITBAR_ALTBLOCK8 SPLITBAR_ALTBLOCK4 , SPLITBAR_ALTBLOCK4 - -static unsigned char splitbar_png[32*32*6] = -{ - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK8, - SPLITBAR_BLOCK8, - SPLITBAR_ALTBLOCK8, - SPLITBAR_BLOCK8, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32, - SPLITBAR_BLOCK32 -}; - -struct FTVImageInfo -{ - const char *alt; - const char *name; - const unsigned char *data; - //unsigned int len; - unsigned short width, height; -}; - -//extern FTVImageInfo image_info[]; - -#if 0 -#define FTVIMG_blank 0 -#define FTVIMG_doc 1 -#define FTVIMG_folderclosed 2 -#define FTVIMG_folderopen 3 -#define FTVIMG_lastnode 4 -#define FTVIMG_link 5 -#define FTVIMG_mlastnode 6 -#define FTVIMG_mnode 7 -#define FTVIMG_node 8 -#define FTVIMG_plastnode 9 -#define FTVIMG_pnode 10 -#define FTVIMG_vertline 11 -#define FTVIMG_ns 12 -#define FTVIMG_cl 13 -#define FTVIMG_mo 14 - -#define FTV_S(name) #name -#define FTV_ICON_FILE(name) "ftv2" FTV_S(name) ".png" -#define FTVIMG_INDEX(name) FTVIMG_ ## name -#define FTV_INFO(name) ( image_info[FTVIMG_INDEX(name)] ) -#define FTV_IMGATTRIBS(name) \ - "src=\"" FTV_ICON_FILE(name) "\" " \ - "alt=\"" << FTV_INFO(name).alt << "\" " \ - "width=\"" << FTV_INFO(name).width << "\" " \ - "height=\"" << FTV_INFO(name).height << "\" " - - -static FTVImageInfo image_info[] = -{ - { " ", "ftv2blank.png", 0 /*ftv2blank_png*/ /*,174*/,16,22 }, - { "*", "ftv2doc.png", 0 /*ftv2doc_png*/ /*,255*/,24,22 }, - { "+", "ftv2folderclosed.png", 0 /*ftv2folderclosed_png*/ /*,259*/,24,22 }, - { "-", "ftv2folderopen.png", 0 /*ftv2folderopen_png*/ /*,261*/,24,22 }, - { "\\", "ftv2lastnode.png", 0 /*ftv2lastnode_png*/ /*,233*/,16,22 }, - { "-", "ftv2link.png", 0 /*ftv2link_png*/ /*,358*/,24,22 }, - { "\\", "ftv2mlastnode.png", 0 /*ftv2mlastnode_png*/ /*,160*/,16,22 }, - { "o", "ftv2mnode.png", 0 /*ftv2mnode_png*/ /*,194*/,16,22 }, - { "o", "ftv2node.png", 0 /*ftv2node_png*/ /*,235*/,16,22 }, - { "\\", "ftv2plastnode.png", 0 /*ftv2plastnode_png*/ /*,165*/,16,22 }, - { "o", "ftv2pnode.png", 0 /*ftv2pnode_png*/ /*,200*/,16,22 }, - { "|", "ftv2vertline.png", 0 /*ftv2vertline_png*/ /*,229*/,16,22 }, - { "N", "ftv2ns.png", 0 /*ftv2vertline_png*/ /*,352*/,24,22 }, - { "C", "ftv2cl.png", 0 /*ftv2vertline_png*/ /*,352*/,24,22 }, - { "M", "ftv2mo.png", 0 /*ftv2vertline_png*/ /*,352*/,24,22 }, - { 0, 0, 0 /*, 0*/, 0, 0 } -}; -#endif - -static ColoredImgDataItem ftv_image_data[] = -{ - { "ftv2blank.png", 16, 22, blank_png, blank_png }, - { "ftv2doc.png", 24, 22, doc_png, doc_a_png }, - { "ftv2folderclosed.png", 24, 22, folderclosed_png, folderclosed_a_png }, - { "ftv2folderopen.png", 24, 22, folderopen_png, folderopen_a_png }, -// { "ftv2ns.png", 24, 22, namespace_png, letter_a_png }, -// { "ftv2mo.png", 24, 22, module_png, letter_a_png }, -// { "ftv2cl.png", 24, 22, class_png, letter_a_png }, - { "ftv2lastnode.png", 16, 22, blank_png, blank_png }, - { "ftv2link.png", 24, 22, doc_png, doc_a_png }, - { "ftv2mlastnode.png", 16, 22, arrow_down_png, arrow_down_a_png }, - { "ftv2mnode.png", 16, 22, arrow_down_png, arrow_down_a_png }, - { "ftv2node.png", 16, 22, blank_png, blank_png }, - { "ftv2plastnode.png", 16, 22, arrow_right_png, arrow_right_a_png }, - { "ftv2pnode.png", 16, 22, arrow_right_png, arrow_right_a_png }, - { "ftv2vertline.png", 16, 22, blank_png, blank_png }, - { "ftv2splitbar.png", 6,1024, splitbar_png, 0 }, - { 0, 0, 0, 0, 0 } -}; - static int folderId=1; struct FTVNode @@ -1118,7 +579,7 @@ static bool generateJSTree(NavIndexEntryList &navIndex,FTextStream &t, static void generateJSNavTree(const QList &nodeList) { QCString htmlOutput = Config_getString("HTML_OUTPUT"); - QFile f(htmlOutput+"/navtree.js"); + QFile f(htmlOutput+"/navtreedata.js"); NavIndexEntryList navIndex; if (f.open(IO_WriteOnly) /*&& fidx.open(IO_WriteOnly)*/) { @@ -1218,8 +679,8 @@ static void generateJSNavTree(const QList &nodeList) } t << endl << "var SYNCONMSG = '" << theTranslator->trPanelSynchronisationTooltip(FALSE) << "';"; t << endl << "var SYNCOFFMSG = '" << theTranslator->trPanelSynchronisationTooltip(TRUE) << "';"; - t << endl << navtree_script; } + ResourceMgr::instance().copyResource("navtree.js",htmlOutput); } //----------------------------------------------------------- @@ -1228,7 +689,13 @@ static void generateJSNavTree(const QList &nodeList) void FTVHelp::generateTreeViewImages() { QCString dname=Config_getString("HTML_OUTPUT"); - writeColoredImgData(dname,ftv_image_data); + const ResourceMgr &rm = ResourceMgr::instance(); + rm.copyResource("doc.luma",dname); + rm.copyResource("folderopen.luma",dname); + rm.copyResource("folderclosed.luma",dname); + rm.copyResource("arrowdown.luma",dname); + rm.copyResource("arrowright.luma",dname); + rm.copyResource("splitbar.lum",dname); } // new style scripts @@ -1239,28 +706,9 @@ void FTVHelp::generateTreeViewScripts() // generate navtree.js & navtreeindex.js generateJSNavTree(m_indentNodes[0]); - // generate resize.js - { - QFile f(htmlOutput+"/resize.js"); - if (f.open(IO_WriteOnly)) - { - FTextStream t(&f); - t << resize_script; - } - } - // generate navtree.css - { - QFile f(htmlOutput+"/navtree.css"); - if (f.open(IO_WriteOnly)) - { - FTextStream t(&f); - t << substitute( - replaceColorMarkers(navtree_css), - "$width", - QCString().setNum(Config_getInt("TREEVIEW_WIDTH"))+"px" - ); - } - } + // copy resize.js & navtree.css + ResourceMgr::instance().copyResource("resize.js",htmlOutput); + ResourceMgr::instance().copyResource("navtree.css",htmlOutput); } // write tree inside page diff --git a/src/header.html b/src/header.html deleted file mode 100644 index 70305df..0000000 --- a/src/header.html +++ /dev/null @@ -1,54 +0,0 @@ - - - - - - -$projectname: $title -$title - - - -$treeview -$search -$mathjax - -$extrastylesheet - - -
- - -
- - - - - - - - - - - - - - - - - - - - - -
-
$projectname -  $projectnumber -
-
$projectbrief
- 		-
$projectbrief
- 		$searchbox
-
- - diff --git a/src/htmlgen.cpp b/src/htmlgen.cpp index 1ee3c16..c4bd80a 100644 --- a/src/htmlgen.cpp +++ b/src/htmlgen.cpp @@ -41,826 +41,16 @@ #include "image.h" #include "ftvhelp.h" #include "bufstr.h" +#include "resourcemgr.h" //#define DBG_HTML(x) x; -#define DBG_HTML(x) - -static const char defaultHtmlHeader[] = -#include "header.html.h" -; - -static const char defaultHtmlFooter[] = -#include "footer.html.h" -; - -static const char defaultStyleSheet[] = -#include "doxygen.css.h" -; - -static const char search_functions_script[]= -#include "search_functions.php.h" -; - -static const char search_opensearch_script[]= -#include "search_opensearch.php.h" -; - -static const char search_styleSheet[] = -#include "search.css.h" -; - -static const char search_jquery_script1[]= -#include "jquery_p1.js.h" -; - -static const char search_jquery_script2[]= -#include "jquery_p2.js.h" -; - -static const char search_jquery_script3[]= -#include "jquery_p3.js.h" -; - -static const char search_jquery_script4[]= -#include "jquery_ui.js.h" -; - -static const char search_jquery_script5[]= -#include "jquery_fx.js.h" -; - -static const char search_jquery_script6[]= -#include "jquery_pt.js.h" -; - -static const char svgpan_script[]= -#include "svgpan.js.h" -; - -static const char dynsections_script[]= -#include "dynsections.js.h" -; - -static const char extsearch_script[]= -#include "extsearch.js.h" -; +#define DBG_HTML(x) static QCString g_header; static QCString g_footer; static QCString g_mathjax_code; -//------------------------- Pictures for the Tabs ------------------------ - -// active tab background luma -static unsigned char tab_a_png[36] = -{ - 31, 42, 59, 69, 73, 74, 75, 77, 77, - 77, 79, 80, 80, 82, 81, 83, 84, 86, - 87, 88, 89, 90, 91, 91, 93, 94, 94, - 96, 96, 97, 98, 98, 99, 99, 99, 100 -}; - -// normal tab background luma -static unsigned char tab_b_png[36] = -{ - 218, 228, 235, 233, 230, 227, 225, 222, 221, - 218, 217, 215, 214, 213, 212, 211, 210, 209, - 209, 197, 198, 199, 200, 201, 202, 203, 204, - 205, 207, 209, 211, 213, 217, 219, 206, 188 -}; - -// hovering tab background luma -static unsigned char tab_h_png[36] = -{ - 181, 191, 198, 196, 193, 190, 188, 185, 184, - 181, 180, 178, 177, 176, 175, 174, 173, 172, - 172, 154, 155, 156, 157, 158, 159, 160, 161, - 162, 164, 166, 168, 170, 174, 176, 163, 145 -}; - -// shadowed header -static unsigned char header_png[12] = -{ - 255, 240, 241, 242, 243, 244, - 245, 246, 247, 248, 249, 250 -}; - -// function header -static unsigned char func_header_png[56] = -{ - 248, 247, 246, 245, 244, 243, 242, 241, - 240, 239, 238, 237, 236, 235, 234, 233, - 232, 231, 230, 229, 228, 223, 223, 223, - 223, 223, 223, 223, 223, 223, 223, 223, - 224, 224, 224, 224, 225, 225, 225, 225, - 225, 226, 226, 226, 227, 227, 227, 227, - 228, 228, 228, 229, 229, 229, 229, 229 -}; - -// tab separator -static unsigned char tab_s_png[36] = -{ - 187, 186, 185, 183, 182, 181, 180, 178, 176, - 174, 173, 171, 169, 167, 164, 163, 161, 158, - 156, 154, 152, 150, 148, 145, 143, 141, 140, - 138, 136, 134, 131, 131, 128, 126, 125, 124 -}; - -// breadcrumbs luma -static unsigned char bc_s_png[240] = -{ - 150,187,187,148,148,148,148,148, - 147,175,186,147,147,147,147,147, - 146,153,185,185,146,146,146,146, - 144,144,177,183,144,144,144,144, - 144,144,159,182,144,144,144,144, - 143,143,144,179,181,143,143,143, - 142,142,142,165,180,142,142,142, - 141,141,141,144,178,178,141,141, - 139,139,139,139,167,176,139,139, - 137,137,137,137,146,174,137,137, - 137,137,137,137,137,169,173,137, - 135,135,135,135,135,150,171,135, - 133,133,133,133,133,135,167,169, - 132,132,132,132,132,132,154,167, - 129,129,129,129,129,129,140,164, - 129,129,129,129,129,129,154,163, - 127,127,127,127,127,128,161,161, - 125,125,125,125,125,141,158,125, - 123,123,123,123,123,152,156,123, - 121,121,121,121,129,154,121,121, - 120,120,120,120,143,152,120,120, - 118,118,118,120,150,150,118,118, - 117,117,117,132,148,117,117,117, - 114,114,114,142,145,114,114,114, - 113,113,120,143,113,113,113,113, - 111,111,133,141,111,111,111,111, - 110,112,140,140,110,110,110,110, - 109,124,138,109,109,109,109,109, - 107,133,136,107,107,107,107,107, - 111,134,106,106,106,106,106,106 -}; - -// breadcrumbs alpha map -static unsigned char bc_s_a_png[240] = -{ - 241,241, 21, 0, 0, 0, 0, 0, - 162,205,117, 0, 0, 0, 0, 0, - 54,231,225, 3, 0, 0, 0, 0, - 0,198,215, 78, 0, 0, 0, 0, - 0, 93,211,186, 0, 0, 0, 0, - 0, 6,232,235, 42, 0, 0, 0, - 0, 0,132,203,147, 0, 0, 0, - 0, 0, 27,242,241, 15, 0, 0, - 0, 0, 0,168,205,108, 0, 0, - 0, 0, 0, 63,228,219, 0, 0, - 0, 0, 0, 0,207,221, 72, 0, - 0, 0, 0, 0,102,208,177, 0, - 0, 0, 0, 0, 9,238,240, 36, - 0, 0, 0, 0, 0,138,201,138, - 0, 0, 0, 0, 0, 77,187,158, - 0, 0, 0, 0, 0,159,204,120, - 0, 0, 0, 0, 15,241,241, 21, - 0, 0, 0, 0,111,208,171, 0, - 0, 0, 0, 0,210,222, 66, 0, - 0, 0, 0, 60,227,219, 0, 0, - 0, 0, 0,162,204,114, 0, 0, - 0, 0, 18,238,238, 21, 0, 0, - 0, 0,114,205,165, 0, 0, 0, - 0, 0,216,225, 60, 0, 0, 0, - 0, 66,226,216, 0, 0, 0, 0, - 0,165,204,111, 0, 0, 0, 0, - 21,241,241, 18, 0, 0, 0, 0, - 117,203,159, 0, 0, 0, 0, 0, - 219,227, 57, 0, 0, 0, 0, 0, - 211,201, 0, 0, 0, 0, 0, 0 -}; - -// doxygen logo luma -static unsigned char doxygen_png[3224] = -{ - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 91, 91, 91, 91, 32, 32,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,255,255,255,255, 32, 32,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,253,253,253,253, 32, 32,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,253,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,251,251,251,251, 32, 32,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,251,255,255,255,255,255,255,255,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,249,249,249,249, 32, 32,249,249,249,249, 32, 32, 32, 32, 32, 32,249,249,249,249, 32, 32, 32, 32, 32, 32,249,249,249,249, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,249,249,249, 32, 32, 32, 32, 32,249,249,249,249, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,249,249,249,249,249,249, 32, 32, 32, 32, 32, 32, 32,249,249,249,249,249, 32, 32, 32, 32, 32,249, 32, 32, 32, 32, 32,255,255,255, - 32, 32, 32, 32, 46,132,190,190,147, 61,247,247,247,247, 32, 32,247,247, 32, 32,118,161,190,190,161,118, 32, 32,247, 32, 46, 89, 89, 89, 89, 46, 32,247,247, 32, 89, 89, 89, 89, 61, 89, 89, 89, 89, 46, 32,247, 32, 46, 89, 89, 89, 89, 32,247, 32, 32,118,175,190,161, 89, 61, 89, 89, 89, 61, 32,247,247,247, 32, 32,104,147,190,190,190,132, 89, 32, 32,247,247, 32, 46, 89, 89, 89, 75, 32, 89,161,190,161, 75, 32,255,255, - 32, 32, 32, 74,230,244,244,244,244,244,244,244,244,244, 32, 32,244, 32, 74,216,244,244,244,244,244,244,216, 74, 32,244, 32,187,244,244,244,159, 32,244, 32,117,244,244,244,230, 46,173,244,244,244,131, 32,244, 32,131,244,244,244,173, 32, 32, 46,173,244,244,244,244,244,230,244,244,244,131, 32,244,244, 32, 74,202,244,244,244,244,244,244,244,173, 46, 32,244, 32, 89,244,244,244,187,145,244,244,244,244,244, 89, 32,255, - 32, 32, 46,213,241,241,241,241,241,241,241,241,241,241, 32, 32, 32, 60,227,241,241,241,241,241,241,241,241,227, 60, 32, 32, 46,227,241,241,241,102, 32, 60,227,241,241,241, 88, 32,116,241,241,241,199, 32,241, 32,185,241,241,241,116, 32, 32,143,241,241,241,241,241,241,241,241,241,241,130, 32,241, 32, 74,227,241,241,241,199,185,241,241,241,241,171, 32,241, 32, 88,241,241,241,241,241,241,241,241,241,241,199, 32,255, - 32, 32,128,237,237,237,223,128, 87,128,237,237,237,237, 32, 32, 32,182,237,237,237,196,100,100,196,237,237,237,182, 32,237, 32,100,237,237,237,223, 59,196,237,237,237,141, 32, 32, 46,237,237,237,237, 59, 32, 46,237,237,237,237, 46, 32, 59,237,237,237,237,169, 87, 87,182,237,237,237,128, 32,237, 32,196,237,237,237, 87, 32, 32, 73,223,237,237,237, 73, 32, 32, 87,237,237,237,237,223,182,223,237,237,237,237, 46, 32, - 32, 32,207,234,234,234,113, 32, 32, 32,234,234,234,234, 32, 32, 59,234,234,234,221, 45, 32, 32, 45,221,234,234,234, 59, 32,234, 32,140,234,234,234,221,234,234,234,194, 32, 32,234, 32,167,234,234,234,126, 32, 99,234,234,234,167, 32, 32,126,234,234,234,180, 32, 32, 32,126,234,234,234,126, 32, 32, 99,234,234,234,167, 32, 32, 32, 32,153,234,234,234,126, 32, 32, 86,234,234,234,207, 45, 32, 45,234,234,234,234, 86, 32, - 32, 45,231,231,231,218, 32, 32, 32, 32,231,231,231,231, 32, 32, 98,231,231,231,165, 32,231,231, 32,165,231,231,231, 98, 32,231, 32, 45,191,231,231,231,231,231,218, 72, 32,231,231, 32, 98,231,231,231,165, 32,151,231,231,231,112, 32, 32,165,231,231,231,112, 32,231, 32,125,231,231,231,125, 32, 32,138,231,231,231,178,125,125,125,125,178,231,231,231,178, 32, 32, 85,231,231,231,178, 32,255, 32,191,231,231,231, 85, 32, - 32, 84,227,227,227,175, 32, 32, 32, 32,227,227,227,227, 32, 32,123,227,227,227,123, 32,227,227, 32,123,227,227,227,123, 32,227,227, 32, 71,227,227,227,227,227,123, 32,227,227,227,227, 32,214,227,227,227, 45,201,227,227,227, 45, 32, 32,175,227,227,227, 84, 32,227, 32,123,227,227,227,123, 32, 32,175,227,227,227,227,227,227,227,227,227,227,227,227,175, 32, 32, 84,227,227,227,175, 32,255, 32,175,227,227,227, 84, 32, - 32, 83,223,223,223,172, 32, 32, 32, 32,223,223,223,223, 32, 32,121,223,223,223,121, 32,223,223, 32,121,223,223,223,121, 32,223,223,223, 32,172,223,223,223,210, 45, 32,223,223,223,223, 32,147,223,223,223,134,223,223,223,147, 32,223, 32,172,223,223,223, 83, 32,223, 32,121,223,223,223,121, 32, 32,172,223,223,223,223,223,223,223,223,223,223,223,223,172, 32, 32, 83,223,223,223,172, 32,255, 32,172,223,223,223, 83, 32, - 32, 82,220,220,220,170, 32, 32, 32, 32,220,220,220,220, 32, 32,120,220,220,220,120, 32,220,220, 32,120,220,220,220,120, 32,220,220, 32, 95,220,220,220,220,220,132, 32,220,220,220,220, 32, 95,220,220,220,207,220,220,220, 95, 32,220, 32,170,220,220,220,107, 32,220, 32,120,220,220,220,120, 32, 32,170,220,220,220,132, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 82,220,220,220,170, 32,255, 32,170,220,220,220, 82, 32, - 32, 57,216,216,216,216, 32, 32, 32, 32,216,216,216,216, 32, 32, 81,216,216,216,167, 32,216,216, 32,155,216,216,216, 81, 32,216, 32, 57,204,216,216,216,216,216,216, 93, 32,216,216,216,216, 32,204,216,216,216,216,216,204, 32,216,216, 32,118,216,216,216,167, 32, 32, 32,130,216,216,216,118, 32, 32,118,216,216,216,191, 32, 32,216,216,216, 32, 32, 44, 57, 32, 32, 81,216,216,216,167, 32,255, 32,167,216,216,216, 81, 32, - 32, 32,189,213,213,213,116, 32, 32, 80,213,213,213,213, 32, 32, 44,201,213,213,213, 68, 32, 32, 68,213,213,213,213, 44, 32, 32, 32,165,213,213,213,165,213,213,213,201, 44, 32,213,213,213, 32,129,213,213,213,213,213,141, 32,213,213, 32, 80,213,213,213,213,165,116,153,213,213,213,213,116, 32, 32, 56,213,213,213,213,153, 56, 32, 32, 32, 44,104,189,116, 32, 32, 80,213,213,213,165, 32,255, 32,165,213,213,213, 80, 32, - 32, 32,139,210,210,210,210,174,174,210,210,210,210,210, 32, 32, 32,127,210,210,210,198,127,127,198,210,210,210,127, 32,210, 32,115,210,210,210,174, 44,139,210,210,210,163, 32, 32,210,210, 32, 68,210,210,210,210,210, 91, 32,210,210,210, 32,174,210,210,210,210,210,210,210,210,210,210,115, 32,210, 32,127,210,210,210,210,210,174,163,163,210,210,210,115, 32, 32, 79,210,210,210,163, 32,255, 32,163,210,210,210, 79, 32, - 32, 32, 55,194,206,206,206,206,206,194,206,206,206,206, 32, 32, 32, 44,171,206,206,206,206,206,206,206,206,171, 44, 32, 32, 67,206,206,206,206, 67, 32, 44,183,206,206,206,113, 32,206,206,206, 32,183,206,206,206,194, 32,206,206,206,206, 32, 67,194,206,206,206,206,206,171,206,206,206,113, 32,206, 32, 32,136,206,206,206,206,206,206,206,206,206,206,113, 32, 32, 78,206,206,206,160, 32,255, 32,160,206,206,206, 78, 32, - 32, 32, 32,100,192,203,203,203,157, 55,203,203,203,203, 32, 32,203, 32, 43,135,203,203,203,203,203,203,135, 43, 32, 32, 43,180,203,203,203,112, 32,203, 32, 66,203,203,203,203, 66, 32,203,203, 32,157,203,203,203,135, 32,203,203,203,203,203, 32, 43,112,157,157,123, 55,112,203,203,203,112, 32,203,203, 32, 32, 78,146,203,203,203,203,203,203,169,123, 55, 32, 32, 78,203,203,203,157, 32,255, 32,157,203,203,203, 78, 32, - 32, 32, 32, 32, 54,110,110, 88, 32, 32, 32, 32, 32, 32, 32, 32,200,200, 32, 32, 54, 99,110,110, 99, 54, 32, 32,200,200, 32, 32, 32, 32, 32, 32, 32,200,200, 32, 32, 32, 32, 32, 32,200,200, 32, 54,200,200,200,200, 77, 32,200,200,200,200,200, 32, 32, 32, 32, 32, 32, 32,166,200,200,200, 88, 32,200,200,200,200, 32, 32, 32, 66, 77, 77, 77, 32, 32, 32, 32,200,200, 32, 32, 32, 32, 32, 32,255, 32, 32, 32, 32, 32, 32,255, - 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32, 32,198,198,198,198, 32, 32, 32, 32, 32, 32,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198,198, 32,109,198,198,198,176, 32,198,198,198,198,198, 32, 98,121, 76, 32, 32, 54,109,198,198,198,198, 43, 32,198,198,198,198,198,198,198, 32, 32, 32, 32,198,198,198,198,198,198,198,198,198,198,198,198,255,255,255,255,255,255,255,255, - 32, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 33,159,191,191,191,117, 36, 41, 41, 41, 41, 41, 34,108,191,191,191,191,191,191,191,191,191,117, 36, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41,255, - 32, 41, 97,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, 78, 38, 64,190,192,192,192, 66, 66, 41, 41, 85,128, 65, 34,107,190,192,192,192,192,192,192,192,139, 48, 39, 41, 41,105,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, 97, 41,255, - 32, 41, 97,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, 96, 36, 95,147,148,148,139, 55, 41, 41, 85,121,128, 91, 38, 75,137,158,190,190,190,170,139, 97, 49, 37, 41, 41,105,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, 97, 41,255, - 32, 41, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 41, 36, 45, 45, 45, 48, 38, 41, 41, 76, 76, 76, 76, 76, 37, 34, 42, 33, 33, 33, 39, 48, 59, 41, 41, 41, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 76, 41,255, - 32, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41, 41,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, - 255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255 -}; - -// doxygen logo alpha map -static unsigned char doxygen_a_png[3224] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 66, 66, 66, 66, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0,145,247,247,247,247,145, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0,247,247,247,247,247,247, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0,247,247,247,247,247,247, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0,247,247,247,247,247,247, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 16,115,181,181,132,247,247,247,247,247,247, 0, 0, 0, 0, 0, 99,148,181,181,148, 99, 0, 0, 0, 0, 16, 66, 66, 66, 66, 16, 0, 0, 0, 0, 66, 66, 66, 66, 33, 66, 66, 66, 66, 16, 0, 0, 0, 16, 66, 66, 66, 66, 0, 0, 0, 0, 99,165,181,148, 66, 33, 66, 66, 66, 33, 0, 0, 0, 0, 0, 0, 82,132,181,181,181,115, 66, 0, 0, 0, 0, 0, 16, 66, 66, 66, 49, 0, 66,148,181,148, 49, 0, 0, 0, - 0, 0, 0,129,247,247,247,247,247,247,247,247,247,247,247, 0, 0, 0,112,214,247,247,247,247,247,247,214,112, 0, 16,247,247,247,247,247,247, 46, 0, 0,145,247,247,247,247,247,247,247,247,247,247, 16, 0, 16,247,247,247,247,247, 66, 0, 63,165,247,247,247,247,247,247,247,247,247,247, 33, 0, 0, 0, 96,198,247,247,247,247,247,247,247,165, 63, 0, 0, 16,247,247,247,247,247,145,247,247,247,247,247,145, 0, 0, - 0, 0,112,247,247,247,247,247,247,247,247,247,247,247,247, 0, 0,129,247,247,247,247,247,247,247,247,247,247,129, 0,181,247,247,247,247,247,148, 0,129,247,247,247,247,247,247,247,247,247,247,247,115, 0,115,247,247,247,247,247,165, 30,247,247,247,247,247,247,247,247,247,247,247,247,115, 0, 0,129,247,247,247,247,247,247,247,247,247,247,247, 63, 0, 66,247,247,247,247,247,247,247,247,247,247,247,247, 96, 0, - 0, 16,247,247,247,247,247,247,247,247,247,247,247,247,247, 0, 79,247,247,247,247,247,247,247,247,247,247,247,247, 79, 79,247,247,247,247,247,247,129,247,247,247,247,247,247,129,247,247,247,247,247,198, 0,181,247,247,247,247,247, 99,145,247,247,247,247,247,247,247,247,247,247,247,247,115, 0, 96,247,247,247,247,247,247,247,247,247,247,247,247,165, 0, 66,247,247,247,247,247,247,247,247,247,247,247,247,198, 0, - 0,115,247,247,247,247,247,247,247,247,247,247,247,247,247, 0,181,247,247,247,247,247,247,247,247,247,247,247,247,181, 0,129,247,247,247,247,247,247,247,247,247,247,247,145, 16,247,247,247,247,247,247, 33,247,247,247,247,247,247, 33,247,247,247,247,247,247,247,247,247,247,247,247,247,115, 0,198,247,247,247,247,247,198,181,247,247,247,247,247,247, 49, 66,247,247,247,247,247,247,247,247,247,247,247,247,247, 16, - 0,214,247,247,247,247,247,129, 66,247,247,247,247,247,247, 33,247,247,247,247,247,247, 96, 96,247,247,247,247,247,247, 33, 0,145,247,247,247,247,247,247,247,247,247,198, 30, 0,165,247,247,247,247,247,115,247,247,247,247,247,165,115,247,247,247,247,247,181, 66,115,247,247,247,247,247,115, 82,247,247,247,247,247,165,115,115,148,247,247,247,247,247,115, 66,247,247,247,247,247,247,181,247,247,247,247,247,247, 66, - 16,247,247,247,247,247,231, 0, 0,247,247,247,247,247,247, 82,247,247,247,247,247,165, 0, 0,165,247,247,247,247,247, 82, 0, 30,247,247,247,247,247,247,247,247,247, 96, 0, 0, 82,247,247,247,247,247,165,247,247,247,247,247, 99,165,247,247,247,247,247, 99, 0,115,247,247,247,247,247,115,132,247,247,247,247,247,247,247,247,247,247,247,247,247,247,181, 66,247,247,247,247,247,181, 0,198,247,247,247,247,247, 66, - 66,247,247,247,247,247,181, 0, 0,247,247,247,247,247,247,115,247,247,247,247,247,115, 0, 0,115,247,247,247,247,247,115, 0, 0, 96,247,247,247,247,247,247,247,129, 0, 0, 0, 0,231,247,247,247,247,247,247,247,247,247,247, 16,181,247,247,247,247,247, 66, 0,115,247,247,247,247,247,115,181,247,247,247,247,247,247,247,247,247,247,247,247,247,247,181, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 66,247,247,247,247,247,181, 0, 0,247,247,247,247,247,247,115,247,247,247,247,247,115, 0, 0,115,247,247,247,247,247,115, 0, 0, 0,181,247,247,247,247,247,247, 30, 0, 0, 0, 0,148,247,247,247,247,247,247,247,247,247,148, 0,181,247,247,247,247,247, 66, 0,115,247,247,247,247,247,115,181,247,247,247,247,247,247,247,247,247,247,247,247,247,247,181, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 66,247,247,247,247,247,181, 0, 0,247,247,247,247,247,247,115,247,247,247,247,247,115, 0, 0,115,247,247,247,247,247,115, 0, 0,129,247,247,247,247,247,247,247,145, 0, 0, 0, 0, 82,247,247,247,247,247,247,247,247,247, 82, 0,181,247,247,247,247,247, 99, 0,115,247,247,247,247,247,115,181,247,247,247,247,247,247,247,247,247,247,247,247,247,181, 79, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 33,247,247,247,247,247,247, 14, 0,247,247,247,247,247,247, 66,247,247,247,247,247,181, 0, 0,165,247,247,247,247,247, 66, 0, 79,247,247,247,247,247,247,247,247,247,129, 0, 0, 0, 0,231,247,247,247,247,247,247,247,231, 0, 0,115,247,247,247,247,247,181,115,165,247,247,247,247,247,115,115,247,247,247,247,247,214, 63, 0, 0, 0, 16,112,247,247, 33, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 0,214,247,247,247,247,247,198,198,247,247,247,247,247,247, 16,247,247,247,247,247,247,132,132,247,247,247,247,247,247, 16, 14,181,247,247,247,247,247,247,247,247,247,247, 79, 0, 0, 0,132,247,247,247,247,247,247,247,148, 0, 0, 66,247,247,247,247,247,247,247,247,247,247,247,247,247,115, 33,247,247,247,247,247,247,247,198,181,181,247,247,247,247,115, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 0,148,247,247,247,247,247,247,247,247,247,247,247,247,247, 0,132,247,247,247,247,247,247,247,247,247,247,247,247,145, 0,145,247,247,247,247,247,247,247,247,247,247,247,181, 14, 0, 0, 49,247,247,247,247,247,247,247, 82, 0, 0, 0,198,247,247,247,247,247,247,247,247,247,247,247,247,115, 0,145,247,247,247,247,247,247,247,247,247,247,247,247,247,115, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 0, 46,247,247,247,247,247,247,247,247,247,247,247,247,247, 0, 30,247,247,247,247,247,247,247,247,247,247,247,247, 30,112,247,247,247,247,247,247, 96,247,247,247,247,247,247,145, 0, 0, 0,214,247,247,247,247,247,231, 0, 0, 0, 0, 96,247,247,247,247,247,247,247,247,247,247,247,247,115, 0, 30,148,247,247,247,247,247,247,247,247,247,247,247,247,115, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 0, 0,129,247,247,247,247,247,247,247,247,247,247,247,247, 0, 0, 96,247,247,247,247,247,247,247,247,247,247, 96, 16,247,247,247,247,247,247,145, 0,112,247,247,247,247,247,247, 49, 0, 0,181,247,247,247,247,247,148, 0, 0, 0, 0, 0,129,247,247,247,247,247,247,247,247,247,247,247,115, 0, 0, 46,148,247,247,247,247,247,247,247,247,247,247,247, 33, 66,247,247,247,247,247,181, 0,181,247,247,247,247,247, 66, - 0, 0, 0,129,247,247,247,247,181,145,247,247,247,247,145, 0, 0, 0, 46,148,247,247,247,247,247,247,148, 46, 0, 0,112,214,247,247,247,145, 14, 0, 0,145,247,247,247,247,145, 0, 0, 33,247,247,247,247,247,247, 66, 0, 0, 0, 0, 0, 99,132,115,181,181,132,198,247,247,247,247,247, 82, 0, 0, 0, 0, 66,165,247,247,247,247,247,247,198,132, 33, 0, 0,145,247,247,247,181, 79, 0, 79,181,247,247,247,145, 0, - 0, 0, 0, 0, 33,115,115, 82, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 33, 99,115,115, 99, 33, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,115,247,247,247,247,247,214, 0, 0, 0, 0, 0, 99,247,247,247,247,247,247,247,247,247,247,247,247, 16, 0, 0, 0, 0, 0, 0, 0, 49, 66, 66, 66, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0,165,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,108,224,255,255,255,255,255,255,101,164,255,255,255,143,250,255,255,255,255,255,255,255,255,255,255,255, 98,170,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,165, 0, - 0,165,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,136,251,255,255,255,255,255,255,101,130,255,255,255,153,250,255,255,255,255,255,255,255,255,255,255,121, 98,189,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,165, 0, - 0,165,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,198,252,255,255,255,255,255,164,164,255,255,255,255,176,249,251,255,255,255,255,255,255,255,255,150, 86,192,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,165, 0, - 0,165,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,164,198,255,255,255,255,201,133,164,255,255,255,255,255,145,203,255,255,255,255,255,255,255,117, 79,194,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,165, 0, - 0, 66,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102, 73, 73,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102, 47, 70,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102,102, 66, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 -}; - -// magnifying glass icon (raw png) -unsigned char mag_sel_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x14, 0x00, 0x00, 0x00, 0x13, - 0x08, 0x06, 0x00, 0x00, 0x00, 0x90, 0x8c, 0x2d, 0xb5, 0x00, 0x00, 0x00, - 0x09, 0x70, 0x48, 0x59, 0x73, 0x00, 0x00, 0x0b, 0x13, 0x00, 0x00, 0x0b, - 0x13, 0x01, 0x00, 0x9a, 0x9c, 0x18, 0x00, 0x00, 0x00, 0x20, 0x63, 0x48, - 0x52, 0x4d, 0x00, 0x00, 0x6d, 0x98, 0x00, 0x00, 0x73, 0x8e, 0x00, 0x00, - 0xe0, 0x38, 0x00, 0x00, 0x82, 0xd5, 0x00, 0x00, 0x7a, 0x07, 0x00, 0x00, - 0xca, 0xb4, 0x00, 0x00, 0x33, 0x44, 0x00, 0x00, 0x1c, 0x76, 0x84, 0x36, - 0x2a, 0xbd, 0x00, 0x00, 0x01, 0xb9, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, - 0xe4, 0x94, 0xbb, 0x8a, 0x22, 0x41, 0x14, 0x86, 0xbf, 0xda, 0x16, 0x3a, - 0x10, 0xba, 0x03, 0x2f, 0x78, 0x03, 0x51, 0x11, 0x4c, 0xd4, 0x40, 0xd4, - 0x37, 0x30, 0x31, 0x30, 0xe9, 0x07, 0xf0, 0x15, 0x14, 0x7c, 0x1e, 0x31, - 0x37, 0x33, 0x11, 0x73, 0xe9, 0x56, 0x44, 0x84, 0x36, 0xe9, 0x40, 0x50, - 0x54, 0x14, 0xc4, 0xc0, 0xa8, 0x6d, 0x50, 0x6a, 0x92, 0x1d, 0xd9, 0x9d, - 0x99, 0x75, 0x0d, 0x26, 0x58, 0xd8, 0x3f, 0xaa, 0xe2, 0xfc, 0xf5, 0xd5, - 0x39, 0x9c, 0x53, 0x25, 0xa4, 0x94, 0x7c, 0xa7, 0x7e, 0xf0, 0xcd, 0xfa, - 0xf7, 0x81, 0xbe, 0xf7, 0xc5, 0xf9, 0x7c, 0x96, 0x93, 0xc9, 0x84, 0xe5, - 0x72, 0xc9, 0x66, 0xb3, 0x21, 0x99, 0x4c, 0x92, 0xcf, 0xe7, 0xa9, 0x54, - 0x2a, 0x04, 0x02, 0x01, 0xf1, 0x2a, 0x50, 0x48, 0x29, 0x39, 0x9d, 0x4e, - 0x72, 0x30, 0x18, 0x60, 0x59, 0xd6, 0x27, 0x43, 0xb5, 0x5a, 0xa5, 0xd1, - 0x68, 0x10, 0x0c, 0x06, 0xc5, 0xcb, 0x19, 0x4e, 0xa7, 0x53, 0x2c, 0xcb, - 0x22, 0x95, 0x4a, 0x51, 0x2a, 0x95, 0xc8, 0x64, 0x32, 0xac, 0x56, 0x2b, - 0x66, 0xb3, 0x19, 0x93, 0xc9, 0x84, 0x48, 0x24, 0x42, 0xbd, 0x5e, 0x7f, - 0xbd, 0x64, 0xdb, 0xb6, 0x01, 0x28, 0x97, 0xcb, 0x54, 0x2a, 0x15, 0x34, - 0x4d, 0x13, 0xa1, 0x50, 0x48, 0x2a, 0x8a, 0xc2, 0x7a, 0xbd, 0xc6, 0xb6, - 0x6d, 0xea, 0xf5, 0x3a, 0xa3, 0xd1, 0x48, 0xf6, 0xfb, 0xfd, 0xc7, 0x61, - 0xc3, 0x30, 0xa8, 0xd5, 0x6a, 0xe2, 0x53, 0x53, 0xb6, 0xdb, 0x2d, 0x00, - 0xc5, 0x62, 0x11, 0x4d, 0xd3, 0x04, 0x80, 0xa6, 0x69, 0xa2, 0x50, 0x28, - 0xf0, 0x6b, 0x1c, 0x10, 0x86, 0x61, 0x3c, 0x60, 0x80, 0xf8, 0xb2, 0xcb, - 0x89, 0x44, 0x02, 0x00, 0xc7, 0x71, 0x00, 0xde, 0x27, 0x5d, 0xfe, 0xdc, - 0x3f, 0xe2, 0x1f, 0xa0, 0xe2, 0x8f, 0x63, 0x93, 0xcb, 0xe5, 0x00, 0x18, - 0x8f, 0xc7, 0x98, 0xa6, 0x89, 0xeb, 0xba, 0xd2, 0x34, 0x4d, 0xc6, 0xe3, - 0x31, 0x00, 0xe9, 0x74, 0x1a, 0x80, 0x5a, 0xad, 0xf6, 0x80, 0x3e, 0xed, - 0xf2, 0x7a, 0xbd, 0x96, 0xc3, 0xe1, 0x90, 0xf9, 0x7c, 0xfe, 0xa5, 0x29, - 0x1c, 0x0e, 0xd3, 0xe9, 0x74, 0xd0, 0x75, 0x5d, 0x00, 0x8c, 0x46, 0xa3, - 0x8f, 0x17, 0xfc, 0x0e, 0xf4, 0x3c, 0x4f, 0xee, 0x76, 0x3b, 0x16, 0x8b, - 0x05, 0x8e, 0xe3, 0xb0, 0xdf, 0xef, 0x89, 0xc7, 0xe3, 0xa4, 0xd3, 0x69, - 0x6c, 0xdb, 0xe6, 0x74, 0x3a, 0x11, 0x8d, 0x46, 0x69, 0xb7, 0xdb, 0x0f, - 0xe8, 0xd3, 0x0c, 0x01, 0x3c, 0xcf, 0x93, 0xae, 0xeb, 0xe2, 0x79, 0x1e, - 0xb7, 0xdb, 0x0d, 0x9f, 0xcf, 0x87, 0xa2, 0x28, 0x5c, 0x2e, 0x17, 0x7a, - 0xbd, 0x1e, 0xc7, 0xe3, 0x91, 0x58, 0x2c, 0x46, 0xab, 0xd5, 0x7a, 0x0a, - 0x7d, 0xbc, 0x14, 0x55, 0x55, 0x85, 0xaa, 0xaa, 0x9f, 0x0c, 0x7e, 0xbf, - 0x5f, 0x36, 0x9b, 0x4d, 0xba, 0xdd, 0x2e, 0xd7, 0xeb, 0x95, 0xeb, 0xf5, - 0x8a, 0xae, 0xeb, 0x7f, 0xcf, 0xf0, 0x99, 0x5c, 0xd7, 0x95, 0x87, 0xc3, - 0x81, 0xfb, 0xfd, 0x4e, 0x36, 0x9b, 0x7d, 0xad, 0xe4, 0xff, 0xe7, 0xfb, - 0x7a, 0x1b, 0x00, 0x59, 0xa8, 0xba, 0x68, 0xca, 0x4f, 0xc5, 0xa7, 0x00, - 0x00, 0x00, 0x00, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 -}; -unsigned int mag_sel_png_len = 563; - -unsigned char mag_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x14, 0x00, 0x00, 0x00, 0x13, - 0x08, 0x06, 0x00, 0x00, 0x00, 0x90, 0x8c, 0x2d, 0xb5, 0x00, 0x00, 0x00, - 0x09, 0x70, 0x48, 0x59, 0x73, 0x00, 0x00, 0x0b, 0x13, 0x00, 0x00, 0x0b, - 0x13, 0x01, 0x00, 0x9a, 0x9c, 0x18, 0x00, 0x00, 0x00, 0x20, 0x63, 0x48, - 0x52, 0x4d, 0x00, 0x00, 0x6d, 0x98, 0x00, 0x00, 0x73, 0x8e, 0x00, 0x00, - 0xe0, 0x38, 0x00, 0x00, 0x82, 0xd5, 0x00, 0x00, 0x7a, 0x07, 0x00, 0x00, - 0xca, 0xb4, 0x00, 0x00, 0x33, 0x44, 0x00, 0x00, 0x1c, 0x76, 0x84, 0x36, - 0x2a, 0xbd, 0x00, 0x00, 0x01, 0x92, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, - 0xe4, 0x94, 0xbb, 0xaa, 0xea, 0x50, 0x10, 0x86, 0xbf, 0xec, 0x08, 0x29, - 0x36, 0x24, 0x85, 0x17, 0xbc, 0x81, 0x18, 0x11, 0x6c, 0xd4, 0x42, 0x8c, - 0x0f, 0x61, 0xe1, 0x2b, 0xf8, 0x0a, 0x0a, 0x3e, 0x8f, 0xf8, 0x0c, 0x36, - 0x62, 0x1f, 0x92, 0x88, 0x88, 0x10, 0x9b, 0x14, 0x42, 0x44, 0x45, 0x41, - 0x2c, 0xac, 0x92, 0x80, 0xb2, 0x4e, 0x73, 0x94, 0x03, 0xfb, 0xb0, 0x4d, - 0xb1, 0x8b, 0x03, 0xe7, 0xaf, 0xd6, 0x62, 0xfe, 0xf5, 0x31, 0xc3, 0xcc, - 0x1a, 0x49, 0x08, 0xc1, 0x4f, 0xea, 0x83, 0x1f, 0xd6, 0xbf, 0x0f, 0x4c, - 0x3c, 0x0f, 0xd7, 0xeb, 0x55, 0x38, 0x8e, 0xc3, 0x66, 0xb3, 0x61, 0xb7, - 0xdb, 0x51, 0x2a, 0x95, 0xa8, 0xd7, 0xeb, 0x18, 0x86, 0x41, 0x32, 0x99, - 0x94, 0xe2, 0x02, 0x25, 0x21, 0x04, 0x97, 0xcb, 0x45, 0x4c, 0xa7, 0x53, - 0x6c, 0xdb, 0xfe, 0x62, 0xe8, 0x74, 0x3a, 0xf4, 0x7a, 0x3d, 0x52, 0xa9, - 0x94, 0x14, 0x3b, 0xc3, 0xc5, 0x62, 0x81, 0x6d, 0xdb, 0x94, 0xcb, 0x65, - 0x5a, 0xad, 0x16, 0x95, 0x4a, 0x85, 0xed, 0x76, 0xcb, 0x72, 0xb9, 0xc4, - 0x71, 0x1c, 0xb2, 0xd9, 0x2c, 0xdd, 0x6e, 0x37, 0x7e, 0xc9, 0xae, 0xeb, - 0x02, 0xd0, 0x6e, 0xb7, 0x31, 0x0c, 0x03, 0x55, 0x55, 0xa5, 0x74, 0x3a, - 0x2d, 0x64, 0x59, 0xc6, 0xf7, 0x7d, 0x5c, 0xd7, 0x8d, 0x0d, 0xfc, 0x00, - 0xd8, 0xef, 0xf7, 0x00, 0x34, 0x9b, 0x4d, 0x54, 0x55, 0x95, 0x00, 0x54, - 0x55, 0x95, 0x1a, 0x8d, 0x06, 0x7f, 0xc6, 0x63, 0x03, 0x8b, 0xc5, 0x22, - 0x00, 0x9e, 0xe7, 0x01, 0x3c, 0x27, 0x5d, 0xfc, 0xbe, 0xbf, 0xe2, 0xb1, - 0x81, 0xb5, 0x5a, 0x0d, 0x00, 0xd3, 0x34, 0xb1, 0x2c, 0x8b, 0x20, 0x08, - 0x84, 0x65, 0x59, 0x98, 0xa6, 0x09, 0x80, 0xae, 0xeb, 0xaf, 0x07, 0xf3, - 0xf9, 0xfc, 0x7d, 0x97, 0x7d, 0xdf, 0x17, 0xb3, 0xd9, 0x8c, 0xd5, 0x6a, - 0xf5, 0x57, 0x53, 0x26, 0x93, 0x61, 0x34, 0x1a, 0xa1, 0x69, 0x9a, 0x14, - 0x6b, 0x6c, 0xa2, 0x28, 0x12, 0x87, 0xc3, 0x81, 0xf5, 0x7a, 0x8d, 0xe7, - 0x79, 0x1c, 0x8f, 0x47, 0x0a, 0x85, 0x02, 0xba, 0xae, 0xe3, 0xba, 0x2e, - 0x97, 0xcb, 0x85, 0x5c, 0x2e, 0xc7, 0x70, 0x38, 0x7c, 0x0b, 0x95, 0x9e, - 0xcb, 0x21, 0x8a, 0x22, 0x11, 0x04, 0x01, 0x51, 0x14, 0x71, 0xbf, 0xdf, - 0x49, 0x24, 0x12, 0xc8, 0xb2, 0xcc, 0xed, 0x76, 0x63, 0x32, 0x99, 0x70, - 0x3e, 0x9f, 0xc9, 0xe7, 0xf3, 0x0c, 0x06, 0x83, 0x6f, 0xa1, 0xaf, 0x9f, - 0xa2, 0x28, 0x8a, 0xa4, 0x28, 0xca, 0x17, 0xc3, 0xe7, 0xe7, 0xa7, 0xe8, - 0xf7, 0xfb, 0x8c, 0xc7, 0x63, 0xc2, 0x30, 0x24, 0x0c, 0x43, 0x34, 0x4d, - 0x7b, 0x9f, 0xe1, 0x77, 0x0a, 0x82, 0x40, 0x9c, 0x4e, 0x27, 0x1e, 0x8f, - 0x07, 0xd5, 0x6a, 0x35, 0x5e, 0xc9, 0xff, 0xcf, 0xfa, 0xfa, 0x35, 0x00, - 0x70, 0xf3, 0xae, 0xcb, 0x89, 0xcd, 0xd2, 0x46, 0x00, 0x00, 0x00, 0x00, - 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 -}; -unsigned int mag_png_len = 524; - -unsigned char search_l_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x14, 0x00, 0x00, 0x00, 0x13, - 0x08, 0x06, 0x00, 0x00, 0x00, 0x90, 0x8c, 0x2d, 0xb5, 0x00, 0x00, 0x00, - 0x09, 0x70, 0x48, 0x59, 0x73, 0x00, 0x00, 0x0b, 0x13, 0x00, 0x00, 0x0b, - 0x13, 0x01, 0x00, 0x9a, 0x9c, 0x18, 0x00, 0x00, 0x00, 0x20, 0x63, 0x48, - 0x52, 0x4d, 0x00, 0x00, 0x6d, 0x98, 0x00, 0x00, 0x73, 0x8e, 0x00, 0x00, - 0xe0, 0x38, 0x00, 0x00, 0x82, 0xd5, 0x00, 0x00, 0x7a, 0x07, 0x00, 0x00, - 0xca, 0xb4, 0x00, 0x00, 0x33, 0x44, 0x00, 0x00, 0x1c, 0x76, 0x84, 0x36, - 0x2a, 0xbd, 0x00, 0x00, 0x01, 0xe2, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, - 0xac, 0x54, 0x3d, 0xab, 0xda, 0x50, 0x18, 0x7e, 0xce, 0xc9, 0x39, 0x31, - 0x4d, 0xfc, 0x40, 0x30, 0x46, 0x14, 0xec, 0x50, 0x44, 0x17, 0x2f, 0x9d, - 0xba, 0x15, 0xda, 0xd1, 0xa1, 0x2e, 0xdd, 0x3b, 0x14, 0x4a, 0xa1, 0x7f, - 0xa6, 0x74, 0xbd, 0x43, 0xff, 0x84, 0xfd, 0x05, 0x82, 0xda, 0xa5, 0x83, - 0x1d, 0xdc, 0x8a, 0x88, 0xa0, 0x44, 0x83, 0xc6, 0x28, 0xad, 0x1f, 0x49, - 0xde, 0x2e, 0x8d, 0x78, 0x6f, 0xaf, 0x34, 0x68, 0x9f, 0xed, 0xbc, 0x70, - 0x1e, 0x9e, 0x8f, 0xf7, 0x1c, 0x46, 0x44, 0x38, 0x45, 0xaf, 0xd7, 0x63, - 0xb6, 0x6d, 0xe7, 0x6d, 0xdb, 0x6e, 0xba, 0xae, 0xfb, 0x6e, 0xb3, 0xd9, - 0xdc, 0x6c, 0xb7, 0xdb, 0x04, 0xe7, 0x1c, 0x8c, 0x31, 0xfc, 0x0b, 0x2c, - 0x22, 0xec, 0x76, 0xbb, 0xcc, 0xf3, 0xbc, 0xcc, 0x68, 0x34, 0x7a, 0xed, - 0xba, 0xee, 0x87, 0x6c, 0x36, 0x7b, 0x93, 0xcb, 0xe5, 0x44, 0x3a, 0x9d, - 0x86, 0xa6, 0x69, 0x50, 0x14, 0x25, 0x3e, 0x61, 0xa7, 0xd3, 0x61, 0xf3, - 0xf9, 0xfc, 0xc9, 0x78, 0x3c, 0xbe, 0xd5, 0x75, 0xfd, 0x79, 0xa5, 0x52, - 0x11, 0xa6, 0x69, 0x22, 0x95, 0x4a, 0x41, 0xd3, 0x34, 0x08, 0x21, 0xc0, - 0x18, 0x8b, 0x45, 0x28, 0x00, 0x60, 0xb5, 0x5a, 0xa5, 0x27, 0x93, 0xc9, - 0xa7, 0x62, 0xb1, 0xf8, 0xb2, 0x5a, 0xad, 0x22, 0x9f, 0xcf, 0xc3, 0x30, - 0x0c, 0x48, 0x29, 0xc1, 0x39, 0x47, 0x5c, 0xbb, 0x00, 0x20, 0xda, 0xed, - 0x36, 0x9f, 0x4e, 0xa7, 0xaf, 0x4c, 0xd3, 0x7c, 0x51, 0xaf, 0xd7, 0x61, - 0x59, 0x16, 0x74, 0x5d, 0x87, 0x94, 0x12, 0x97, 0x40, 0x2c, 0x16, 0x0b, - 0x93, 0x88, 0xde, 0xd6, 0x6a, 0x35, 0xdd, 0xb2, 0x2c, 0x18, 0x86, 0x01, - 0x21, 0x04, 0x2e, 0x05, 0xf7, 0x3c, 0xaf, 0x59, 0x2e, 0x97, 0x9f, 0x45, - 0xca, 0x38, 0xe7, 0xb8, 0x06, 0x3c, 0x08, 0x82, 0x46, 0xa1, 0x50, 0x78, - 0x74, 0xad, 0xb2, 0x23, 0xa1, 0x94, 0xf2, 0x69, 0x26, 0x93, 0xe1, 0x51, - 0x66, 0xf7, 0xf7, 0xd2, 0xf7, 0xfd, 0x07, 0x2f, 0x9e, 0x9b, 0x73, 0x55, - 0x55, 0xb3, 0x91, 0x55, 0xc6, 0x18, 0xc2, 0x30, 0xbc, 0x1b, 0xf2, 0x19, - 0xd5, 0xe7, 0xe6, 0x5c, 0x4a, 0x39, 0x06, 0x70, 0x5c, 0x8b, 0xb8, 0xeb, - 0x71, 0xd6, 0x32, 0x11, 0x75, 0xf6, 0xfb, 0xfd, 0xd1, 0xea, 0xd5, 0xa5, - 0x10, 0xd1, 0xb7, 0xf5, 0x7a, 0x1d, 0x84, 0x61, 0x08, 0x22, 0xba, 0x9e, - 0x50, 0x51, 0x94, 0xaf, 0x8e, 0xe3, 0xfc, 0xdc, 0xed, 0x76, 0xf8, 0x1f, - 0xe0, 0x89, 0x44, 0xe2, 0xc7, 0x72, 0xb9, 0xfc, 0xee, 0x38, 0x0e, 0x7c, - 0xdf, 0x3f, 0x5a, 0xbf, 0xdf, 0x76, 0x6c, 0xc2, 0x46, 0xa3, 0xf1, 0x2b, - 0x08, 0x82, 0xdb, 0xe1, 0x70, 0xe8, 0x2c, 0x16, 0x0b, 0x04, 0x41, 0x00, - 0x22, 0xba, 0xb8, 0x1c, 0xfe, 0x67, 0x05, 0xbe, 0x78, 0x9e, 0xf7, 0x79, - 0x30, 0x18, 0x8c, 0x67, 0xb3, 0x19, 0x45, 0x25, 0x9d, 0x53, 0x49, 0x44, - 0x38, 0x1c, 0x0e, 0x38, 0x2d, 0xf3, 0xce, 0x6f, 0x03, 0x60, 0x29, 0x84, - 0xf8, 0xe8, 0x79, 0x9e, 0xdb, 0xef, 0xf7, 0xdf, 0x97, 0x4a, 0xa5, 0xc7, - 0xd1, 0x53, 0x54, 0x55, 0x15, 0x52, 0xca, 0xbf, 0x14, 0x0b, 0x21, 0x1e, - 0x8c, 0x87, 0x9d, 0x1e, 0x5a, 0xad, 0x96, 0x00, 0x50, 0x27, 0xa2, 0x37, - 0xaa, 0xaa, 0x36, 0x0d, 0xc3, 0x28, 0x26, 0x93, 0x49, 0xa1, 0x69, 0x9a, - 0xc2, 0x39, 0x8f, 0x95, 0xc1, 0xef, 0x01, 0x00, 0x35, 0xe5, 0xd5, 0x5e, - 0xd0, 0xed, 0x0c, 0xfd, 0x00, 0x00, 0x00, 0x00, 0x49, 0x45, 0x4e, 0x44, - 0xae, 0x42, 0x60, 0x82 -}; -unsigned int search_l_png_len = 604; - -unsigned char search_m_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x02, 0x00, 0x00, 0x00, 0x13, - 0x08, 0x02, 0x00, 0x00, 0x00, 0x35, 0x5e, 0x4b, 0x4d, 0x00, 0x00, 0x00, - 0x04, 0x67, 0x41, 0x4d, 0x41, 0x00, 0x00, 0xd6, 0xd8, 0xd4, 0x4f, 0x58, - 0x32, 0x00, 0x00, 0x00, 0x19, 0x74, 0x45, 0x58, 0x74, 0x53, 0x6f, 0x66, - 0x74, 0x77, 0x61, 0x72, 0x65, 0x00, 0x41, 0x64, 0x6f, 0x62, 0x65, 0x20, - 0x49, 0x6d, 0x61, 0x67, 0x65, 0x52, 0x65, 0x61, 0x64, 0x79, 0x71, 0xc9, - 0x65, 0x3c, 0x00, 0x00, 0x00, 0x30, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, - 0x62, 0x2c, 0x2f, 0x2f, 0x67, 0x60, 0x60, 0x60, 0x3c, 0x7e, 0xfc, 0x38, - 0x88, 0xfa, 0xf8, 0xf1, 0x23, 0x88, 0xfa, 0xff, 0xff, 0x3f, 0x90, 0x62, - 0x62, 0x00, 0x03, 0x5a, 0x50, 0x2c, 0x10, 0x1b, 0x58, 0x6e, 0xdd, 0xba, - 0x05, 0xa4, 0x00, 0x02, 0x0c, 0x00, 0xa5, 0x07, 0x0f, 0x3c, 0x7e, 0xe1, - 0x45, 0xa7, 0x00, 0x00, 0x00, 0x00, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, - 0x60, 0x82 -}; -unsigned int search_m_png_len = 158; - -unsigned char search_r_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x12, 0x00, 0x00, 0x00, 0x13, - 0x08, 0x06, 0x00, 0x00, 0x00, 0x9d, 0x92, 0x5d, 0xf2, 0x00, 0x00, 0x00, - 0x09, 0x70, 0x48, 0x59, 0x73, 0x00, 0x00, 0x0b, 0x13, 0x00, 0x00, 0x0b, - 0x13, 0x01, 0x00, 0x9a, 0x9c, 0x18, 0x00, 0x00, 0x00, 0x20, 0x63, 0x48, - 0x52, 0x4d, 0x00, 0x00, 0x6d, 0x98, 0x00, 0x00, 0x73, 0x8e, 0x00, 0x00, - 0xe0, 0x38, 0x00, 0x00, 0x82, 0xd5, 0x00, 0x00, 0x7a, 0x07, 0x00, 0x00, - 0xca, 0xb4, 0x00, 0x00, 0x33, 0x44, 0x00, 0x00, 0x1c, 0x76, 0x84, 0x36, - 0x2a, 0xbd, 0x00, 0x00, 0x01, 0xea, 0x49, 0x44, 0x41, 0x54, 0x78, 0xda, - 0xa4, 0xd4, 0xbf, 0xaa, 0x1a, 0x41, 0x14, 0x06, 0xf0, 0x6f, 0xf6, 0x9f, - 0xb2, 0x0a, 0x6b, 0xa5, 0x56, 0x8b, 0xa4, 0x92, 0xd4, 0x69, 0x7c, 0x03, - 0xb1, 0x59, 0x49, 0x11, 0x52, 0xdf, 0xbc, 0x43, 0xcc, 0x2b, 0xa4, 0x4c, - 0x97, 0x67, 0x08, 0xa4, 0x11, 0x2c, 0x52, 0x5c, 0x42, 0x24, 0x60, 0x8a, - 0x34, 0x29, 0x42, 0x50, 0x41, 0x21, 0xa0, 0x97, 0xd5, 0x55, 0xb3, 0xbb, - 0xee, 0xb2, 0xce, 0xee, 0xcc, 0x49, 0x91, 0x28, 0xc2, 0x0d, 0xe6, 0xaa, - 0xa7, 0x9d, 0xc3, 0x8f, 0x73, 0x98, 0xf9, 0x86, 0x75, 0x3a, 0x1d, 0xc2, - 0x89, 0x12, 0x42, 0x24, 0xf9, 0x7c, 0x7e, 0x5a, 0x2c, 0x16, 0x3f, 0x96, - 0x4a, 0xa5, 0x5e, 0xb5, 0x5a, 0xfd, 0x52, 0x2e, 0x97, 0xfd, 0x46, 0xa3, - 0x21, 0x8e, 0xfb, 0xd8, 0x60, 0x30, 0x38, 0x09, 0x65, 0x59, 0x86, 0x24, - 0x49, 0x10, 0x04, 0x81, 0xf0, 0x3c, 0x6f, 0xb3, 0xd9, 0x6c, 0x7e, 0x58, - 0x96, 0x75, 0x5b, 0xab, 0xd5, 0xde, 0x34, 0x9b, 0xcd, 0x5f, 0x07, 0xc8, - 0xf7, 0xfd, 0x93, 0x90, 0x94, 0xf2, 0x80, 0x85, 0x61, 0x88, 0xe5, 0x72, - 0x49, 0xe3, 0xf1, 0x58, 0xc6, 0x71, 0xfc, 0xc1, 0xb6, 0xed, 0xe7, 0x8e, - 0xe3, 0x84, 0x00, 0xc0, 0xa4, 0x94, 0x27, 0x21, 0x22, 0x82, 0x94, 0x12, - 0x52, 0x4a, 0xa4, 0x69, 0x8a, 0x28, 0x8a, 0xb0, 0x58, 0x2c, 0x30, 0x1c, - 0x0e, 0x85, 0xeb, 0xba, 0xef, 0x6b, 0xb5, 0xda, 0x4d, 0xab, 0xd5, 0x8a, - 0x34, 0xc6, 0xd8, 0x29, 0x07, 0x8c, 0x31, 0x28, 0x8a, 0x02, 0x22, 0x82, - 0xae, 0xeb, 0x30, 0x0c, 0x03, 0xb9, 0x5c, 0x0e, 0x86, 0x61, 0xa8, 0x52, - 0xca, 0xa7, 0xf3, 0xf9, 0xfc, 0x67, 0xbf, 0xdf, 0x7f, 0xa5, 0xe0, 0x81, - 0xc5, 0x18, 0x03, 0x63, 0x0c, 0x9a, 0xa6, 0xa1, 0x50, 0x28, 0xa0, 0x52, - 0xa9, 0xa0, 0x5e, 0xaf, 0x6b, 0x00, 0x5e, 0xac, 0xd7, 0xeb, 0x47, 0x0f, - 0x86, 0x8e, 0x41, 0x55, 0x55, 0x61, 0x9a, 0x26, 0x2a, 0x95, 0x0a, 0x6c, - 0xdb, 0xb6, 0x82, 0x20, 0x78, 0x76, 0x36, 0xb4, 0xc7, 0xf6, 0x93, 0x55, - 0xab, 0x55, 0x26, 0x84, 0x78, 0xac, 0x1c, 0x5f, 0xf3, 0xb9, 0xa5, 0xeb, - 0x3a, 0x2c, 0xcb, 0x82, 0xae, 0xeb, 0xbb, 0x03, 0xa4, 0x69, 0xda, 0xd9, - 0x53, 0x29, 0x8a, 0x02, 0xd3, 0x34, 0x99, 0x61, 0x18, 0xcb, 0x8b, 0x56, - 0x3b, 0xc6, 0xfe, 0x4e, 0x76, 0x77, 0x15, 0x44, 0x44, 0xe0, 0x9c, 0x0b, - 0x22, 0xfa, 0xaa, 0x5c, 0x83, 0x48, 0x29, 0x11, 0x86, 0xe1, 0x86, 0x88, - 0xbe, 0x5f, 0x35, 0xd1, 0x6e, 0xb7, 0x83, 0xe7, 0x79, 0x3d, 0x55, 0x55, - 0x7d, 0xd0, 0x05, 0x25, 0xa5, 0x24, 0xce, 0x39, 0x4d, 0x26, 0x93, 0x45, - 0xb7, 0xdb, 0x7d, 0x42, 0x44, 0x50, 0x2e, 0x59, 0x49, 0x08, 0x81, 0xf5, - 0x7a, 0x9d, 0x4c, 0xa7, 0xd3, 0x77, 0x42, 0x88, 0x6f, 0x00, 0xa0, 0xed, - 0x0f, 0xb3, 0x2c, 0x3b, 0xe4, 0xe9, 0x5f, 0xf9, 0x23, 0xfa, 0x93, 0x6d, - 0xce, 0x39, 0x56, 0xab, 0x95, 0x18, 0x0e, 0x87, 0x9f, 0x82, 0x20, 0x78, - 0xdd, 0x6e, 0xb7, 0xd3, 0x7b, 0xe9, 0x27, 0xa2, 0x7b, 0x08, 0x11, 0x21, - 0x4d, 0x53, 0x70, 0xce, 0x11, 0xc7, 0xb1, 0x74, 0x5d, 0xd7, 0x9f, 0xcd, - 0x66, 0x3d, 0xce, 0xf9, 0x4b, 0xc7, 0x71, 0xee, 0x0e, 0xef, 0x70, 0x34, - 0x1a, 0xe1, 0x7f, 0xff, 0x51, 0x92, 0x24, 0xd8, 0x6e, 0xb7, 0x61, 0x14, - 0x45, 0x9f, 0x39, 0xe7, 0x6f, 0x19, 0x63, 0xb7, 0x8e, 0xe3, 0x44, 0xc7, - 0x7d, 0xbf, 0x07, 0x00, 0x5f, 0x77, 0x46, 0x8c, 0x30, 0x2c, 0xd8, 0x9d, - 0x00, 0x00, 0x00, 0x00, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 -}; -unsigned int search_r_png_len = 612; - -static unsigned char close_png[] = { - 0x89, 0x50, 0x4e, 0x47, 0x0d, 0x0a, 0x1a, 0x0a, 0x00, 0x00, 0x00, 0x0d, - 0x49, 0x48, 0x44, 0x52, 0x00, 0x00, 0x00, 0x0b, 0x00, 0x00, 0x00, 0x0b, - 0x08, 0x06, 0x00, 0x00, 0x00, 0xa9, 0xac, 0x77, 0x26, 0x00, 0x00, 0x00, - 0xd8, 0x49, 0x44, 0x41, 0x54, 0x18, 0x19, 0x75, 0x51, 0xbd, 0x12, 0x46, - 0x40, 0x0c, 0xdc, 0x18, 0x15, 0x0a, 0x14, 0x14, 0x1a, 0x43, 0xeb, 0x35, - 0xbc, 0x7f, 0xa7, 0x43, 0x67, 0x06, 0x33, 0x28, 0xd0, 0xde, 0x77, 0x7b, - 0x23, 0x2a, 0xdf, 0x16, 0x97, 0x9f, 0xdb, 0xcb, 0x26, 0x39, 0xc1, 0x83, - 0x7d, 0xdf, 0xcd, 0xb2, 0x2c, 0xd8, 0xb6, 0x0d, 0xe7, 0x79, 0x22, 0x8a, - 0x22, 0xc4, 0x71, 0x8c, 0x3c, 0xcf, 0x91, 0xa6, 0xa9, 0x90, 0xe6, 0x8e, - 0x69, 0x9a, 0xcc, 0x38, 0x8e, 0xb8, 0xae, 0x4b, 0xdf, 0xbe, 0x36, 0x0c, - 0x43, 0x94, 0x65, 0x89, 0xa2, 0x28, 0xc4, 0x3b, 0x8e, 0xe3, 0x2f, 0x91, - 0x2f, 0xa8, 0xc2, 0x42, 0x56, 0xd1, 0x78, 0xf3, 0x3c, 0xbb, 0x04, 0x2f, - 0xda, 0xb6, 0x45, 0x55, 0x55, 0x74, 0x9d, 0x65, 0x2c, 0x22, 0xb8, 0xef, - 0x1b, 0xeb, 0xba, 0xc2, 0x67, 0x8f, 0x4c, 0x10, 0x7d, 0xdf, 0xa3, 0xae, - 0x6b, 0xe7, 0xd3, 0x32, 0x56, 0x90, 0xe7, 0x53, 0x46, 0x31, 0x0c, 0x83, - 0x73, 0x95, 0xa8, 0x31, 0x93, 0x9c, 0xc7, 0xe3, 0xd4, 0x0a, 0xb6, 0xa0, - 0x44, 0x5a, 0xc6, 0xc6, 0x18, 0x77, 0xcd, 0x41, 0xbd, 0x24, 0x49, 0x94, - 0xfb, 0x12, 0x59, 0x51, 0x5b, 0xd2, 0x16, 0xed, 0xfa, 0x20, 0xdc, 0x6f, - 0xd7, 0x75, 0x9f, 0x6b, 0xd3, 0x2a, 0x41, 0x10, 0xa0, 0x69, 0x1a, 0x57, - 0x59, 0x28, 0x47, 0x99, 0x2f, 0x30, 0xcf, 0x7b, 0xfb, 0x41, 0xcf, 0x1a, - 0x2c, 0xeb, 0xeb, 0x07, 0x29, 0x9d, 0x65, 0x19, 0x6c, 0xab, 0x6e, 0x5d, - 0x3f, 0x07, 0x0a, 0x79, 0x90, 0x0e, 0x11, 0x45, 0xc2, 0x00, 0x00, 0x00, - 0x00, 0x49, 0x45, 0x4e, 0x44, 0xae, 0x42, 0x60, 0x82 -}; -static unsigned int close_png_len = 273; - - -static unsigned char closed_png[81] = -{ - 0, 0, 0, 0,142, 0, 0, 0, 0, - 0, 0, 0, 0,142,142, 0, 0, 0, - 0, 0, 0, 0,142,142,142, 0, 0, - 0, 0, 0, 0,142,142,142,142, 0, - 0, 0, 0, 0,142,142,142,142,142, - 0, 0, 0, 0,142,142,142,142, 0, - 0, 0, 0, 0,142,142,142, 0, 0, - 0, 0, 0, 0,142,142, 0, 0, 0, - 0, 0, 0, 0,142, 0, 0, 0, 0 -}; - -static unsigned char closed_a_png[81] = -{ - 0, 0, 0, 0,255, 0, 0, 0, 0, - 0, 0, 0, 0,255,255, 0, 0, 0, - 0, 0, 0, 0,255,255,255, 0, 0, - 0, 0, 0, 0,255,255,255,255, 0, - 0, 0, 0, 0,255,255,255,255,255, - 0, 0, 0, 0,255,255,255,255, 0, - 0, 0, 0, 0,255,255,255, 0, 0, - 0, 0, 0, 0,255,255, 0, 0, 0, - 0, 0, 0, 0,255, 0, 0, 0, 0 -}; - -static unsigned char open_png[81] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 142,142,142,142,142,142,142,142,142, - 0,142,142,142,142,142,142,142, 0, - 0, 0,142,142,142,142,142, 0, 0, - 0, 0, 0,142,142,142, 0, 0, 0, - 0, 0, 0, 0,142, 0, 0, 0, 0 -}; - -static unsigned char open_a_png[81] = -{ - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 0, 0, - 255,255,255,255,255,255,255,255,255, - 0,255,255,255,255,255,255,255, 0, - 0, 0,255,255,255,255,255, 0, 0, - 0, 0, 0,255,255,255, 0, 0, 0, - 0, 0, 0, 0,255, 0, 0, 0, 0 -}; - -static unsigned char bdwn_png[7*8] = -{ - 0, 0, 0,142, 0, 0, 0, - 0, 0, 0,142, 0, 0, 0, - 0, 0, 0,142, 0, 0, 0, - 142, 0, 0,142, 0, 0,142, - 142,142, 0,142, 0,142,142, - 142,142,142,142,142,142,142, - 0,142,142,142,142,142, 0, - 0, 0,142,142,142, 0, 0, -}; - -static unsigned char bdwn_a_png[7*8] = -{ - 0, 0, 0,255, 0, 0, 0, - 0, 0, 0,255, 0, 0, 0, - 0, 0, 0,255, 0, 0, 0, - 128, 0, 0,255, 0, 0,128, - 255,128, 0,255, 0,128,255, - 128,255,128,255,128,255,128, - 0,128,255,255,255,128, 0, - 0, 0,128,255,128, 0, 0, -}; - -static unsigned char sync_on_png[576] = -{ - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,138,128,128,128,128,133,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,129,205,186,128,128,128,128,160,210,134,128,128,128,128,128,128,128, - 128,128,128,128,128,128,139,217,255,181,128,128,128,128,152,255,229,147,128,128,128,128,128,128, - 128,128,128,128,128,156,236,255,255,181,128,128,128,128,152,255,255,243,164,128,128,128,128,128, - 128,128,128,128,175,249,255,255,255,223,196,198,198,197,211,255,255,255,253,186,128,128,128,128, - 128,128,133,202,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,214,137,128,128, - 128,128,135,217,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,225,140,128,128, - 128,128,128,128,189,255,255,255,255,238,224,225,225,224,232,255,255,255,255,201,131,128,128,128, - 128,128,128,128,128,167,245,255,255,183,128,128,128,128,155,255,255,250,179,128,128,128,128,128, - 128,128,128,128,128,128,150,231,255,188,128,128,128,128,161,255,238,158,128,128,128,128,128,128, - 128,128,128,128,128,128,128,136,216,188,128,128,128,128,161,223,142,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,130,141,128,128,128,128,135,132,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128 -}; - -static unsigned char sync_off_png[576] = -{ - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,138,128,128,128,128,128,128,133,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,129,205,186,128,128,128,128,128,128,160,210,134,128,128,128,128,128,128, - 128,128,128,128,128,139,217,255,181,128,128,128,128,128,128,152,255,229,147,128,128,128,128,128, - 128,128,128,128,156,236,255,255,181,128,128,128,128,128,128,152,255,255,243,164,128,128,128,128, - 128,128,128,175,249,255,255,255,223,196,198,198,128,128,197,211,255,255,255,253,186,128,128,128, - 128,128,202,255,255,255,255,255,255,255,255,225,128,128,255,255,255,255,255,255,255,214,128,128, - 128,128,217,255,255,255,255,255,255,255,255,128,128,198,255,255,255,255,255,255,255,225,128,128, - 128,128,128,189,255,255,255,255,238,224,225,128,128,225,224,232,255,255,255,255,201,128,128,128, - 128,128,128,128,167,245,255,255,183,128,128,128,128,128,128,155,255,255,250,179,128,128,128,128, - 128,128,128,128,128,150,231,255,188,128,128,128,128,128,128,161,255,238,158,128,128,128,128,128, - 128,128,128,128,128,128,136,216,188,128,128,128,128,128,128,161,223,142,128,128,128,128,128,128, - 128,128,128,128,128,128,128,130,141,128,128,128,128,128,128,135,132,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128, - 128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128,128 -}; - -static unsigned char sync_a_png[576] = -{ - 0, 0, 0, 0, 0, 0, 0, 29, 98,157,207,231,234,211,164,104, 38, 0, 0, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 21,143,234,255,255,255,255,255,255,255,255,244,155, 33, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 70,221,255,255,255,255,255,255,255,255,255,255,255,255,235, 93, 0, 0, 0, 0, - 0, 0, 0, 92,251,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,116, 0, 0, 0, - 0, 0, 68,251,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 96, 0, 0, - 0, 20,225,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,243, 41, 0, - 0,143,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,172, 1, - 28,238,255,255,255,255,255,253,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 42, - 99,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,133, - 160,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,204, - 212,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,224, - 234,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,237,255,236, - 235,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,230,255,236, - 216,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,226, - 168,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,208, - 107,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,147, - 39,245,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255, 53, - 0,159,255,255,255,255,255,255,251,255,255,255,255,255,255,255,255,255,255,255,255,255,190, 3, - 0, 31,239,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,249, 54, 0, - 0, 0, 91,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,119, 0, 0, - 0, 0, 0,116,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,145, 0, 0, 0, - 0, 0, 0, 0, 98,240,255,255,255,255,255,255,255,255,255,255,255,255,248,119, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 45,168,252,255,255,255,255,255,255,255,255,255,184, 58, 0, 0, 0, 0, 0, - 0, 0, 0, 0, 0, 0, 0, 45,131,201,222,234,236,224,204,142, 54, 0, 0, 0, 0, 0, 0, 0 -}; - - -//------------------------------------------------------------------------ - -static const char tabs_css[] = -".tabs, .tabs2, .tabs3 {\n" -" background-image: url('tab_b.png');\n" -" width: 100%;\n" -" z-index: 101;\n" -" font-size: 13px;\n" -" font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif;\n" -"}\n" -"\n" -".tabs2 {\n" -" font-size: 10px;\n" -"}\n" -".tabs3 {\n" -" font-size: 9px;\n" -"}\n" -"\n" -".tablist {\n" -" margin: 0;\n" -" padding: 0;\n" -" display: table;\n" -"}\n" -"\n" -".tablist li {\n" -" float: left;\n" -" display: table-cell;\n" -" background-image: url('tab_b.png');\n" -" line-height: 36px;\n" -" list-style: none;\n" -"}\n" -"\n" -".tablist a {\n" -" display: block;\n" -" padding: 0 20px;\n" -" font-weight: bold;\n" -" background-image:url('tab_s.png');\n" -" background-repeat:no-repeat;\n" -" background-position:right;\n" -" color: ##30;\n" -" text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);\n" -" text-decoration: none;\n" -" outline: none;\n" -"}\n" -"\n" -".tabs3 .tablist a {\n" -" padding: 0 10px;\n" -"}\n" -"\n" -".tablist a:hover {\n" -" background-image: url('tab_h.png');\n" -" background-repeat:repeat-x;\n" -" color: #fff;\n" -" text-shadow: 0px 1px 1px rgba(0, 0, 0, 1.0);\n" -" text-decoration: none;\n" -"}\n" -"\n" -".tablist li.current a {\n" -" background-image: url('tab_a.png');\n" -" background-repeat:repeat-x;\n" -" color: #fff;\n" -" text-shadow: 0px 1px 1px rgba(0, 0, 0, 1.0);\n" -"}\n" -; - -struct img_data_item -{ - const char *name; - unsigned char *content; - unsigned int len; -}; - - -static void writeImgData(const char *dir,img_data_item *data) -{ - while (data->name) - { - QCString fileName; - fileName=(QCString)dir+"/"+data->name; - QFile f(fileName); - if (f.open(IO_WriteOnly)) - { - f.writeBlock((char*)data->content, - data->len>0 ? data->len : qstrlen((char*)data->content)); - } - else - { - fprintf(stderr,"Warning: Cannot open file %s for writing\n",data->name); - } - Doxygen::indexList->addImageFile(QCString("/search/")+data->name); - data++; - } -} - -static ColoredImgDataItem colored_tab_data[] = -{ - // file_name W H luma_data alpha_data - { "tab_a.png", 1, 36, tab_a_png, 0 }, - { "tab_b.png", 1, 36, tab_b_png, 0 }, - { "tab_h.png", 1, 36, tab_h_png, 0 }, - { "tab_s.png", 1, 36, tab_s_png, 0 }, - { "nav_h.png", 1, 12, header_png, 0 }, - { "nav_f.png", 1, 56, func_header_png, 0 }, - { "bc_s.png", 8, 30, bc_s_png, bc_s_a_png }, - { "doxygen.png", 104,31, doxygen_png, doxygen_a_png }, - { "closed.png", 9, 9, closed_png, closed_a_png }, - { "open.png", 9, 9, open_png, open_a_png }, - { "bdwn.png", 7, 8, bdwn_png, bdwn_a_png }, - { "sync_on.png", 24, 24, sync_on_png, sync_a_png }, - { "sync_off.png",24, 24, sync_off_png, sync_a_png }, - { 0, 0, 0, 0, 0 } -}; - -static img_data_item search_client_data[] = -{ - // file_name raw_data num bytes - { "mag_sel.png", mag_sel_png, mag_sel_png_len }, - { "search_l.png", search_l_png, search_l_png_len }, - { "search_m.png", search_m_png, search_m_png_len }, - { "search_r.png", search_r_png, search_r_png_len }, - { "close.png", close_png, close_png_len }, - { 0, 0, 0 } -}; - -static img_data_item search_server_data[] = -{ - // file_name raw_data num bytes - { "mag.png", mag_png, mag_png_len }, - { "search_l.png", search_l_png, search_l_png_len }, - { "search_m.png", search_m_png, search_m_png_len }, - { "search_r.png", search_r_png, search_r_png_len }, - { 0, 0, 0 } -}; - -//------------------------------------------------------------------------ static void writeClientSearchBox(FTextStream &t,const char *relPath) { @@ -982,11 +172,13 @@ static QCString getSearchBox(bool serverSide, QCString relPath, bool highlightSe { QGString result; FTextStream t(&result); - if (serverSide) { + if (serverSide) + { writeServerSearchBox(t, relPath, highlightSearch); } - else { - writeClientSearchBox(t, relPath); + else + { + writeClientSearchBox(t, relPath); } return QCString(result); } @@ -1096,6 +288,7 @@ static QCString substituteHtmlKeywords(const QCString &s, { treeViewCssJs = "\n" "\n" + "\n" "\n" "\n"; + } searchCssJs += "\n"; if (!serverBasedSearch) { searchCssJs += ""; } else @@ -1124,7 +321,7 @@ static QCString substituteHtmlKeywords(const QCString &s, // OPENSEARCH_PROVIDER { searchCssJs += ""; @@ -1504,7 +701,7 @@ void HtmlGenerator::init() } else { - g_header = defaultHtmlHeader; + g_header = ResourceMgr::instance().getAsString("header.html"); } if (!Config_getString("HTML_FOOTER").isEmpty()) @@ -1514,7 +711,7 @@ void HtmlGenerator::init() } else { - g_footer = defaultHtmlFooter; + g_footer = ResourceMgr::instance().getAsString("footer.html"); } if (Config_getBool("USE_MATHJAX")) @@ -1527,54 +724,24 @@ void HtmlGenerator::init() } createSubDirs(d); - QCString fileName=dname+"/tabs.css"; - QFile f(fileName); - if (f.open(IO_WriteOnly)) - { - FTextStream t(&f); - t << replaceColorMarkers(tabs_css); - } - else - { - fprintf(stderr,"Warning: Cannot open file %s for writing\n",fileName.data()); - } - - { - QFile f(dname+"/jquery.js"); - if (f.open(IO_WriteOnly)) - { - FTextStream t(&f); - t << search_jquery_script1 << search_jquery_script2 << search_jquery_script3; - if (Config_getBool("GENERATE_TREEVIEW")) - { - t << search_jquery_script4 << search_jquery_script5; - } - if (Config_getBool("SOURCE_BROWSER")) - { - t << search_jquery_script6; - } - } - } - + ResourceMgr &mgr = ResourceMgr::instance(); + mgr.copyResource("tabs.css",dname); + mgr.copyResource("jquery.js",dname); if (Config_getBool("INTERACTIVE_SVG")) { - QFile f(dname+"/svgpan.js"); - if (f.open(IO_WriteOnly)) - { - FTextStream t(&f); - t << svgpan_script; - } + mgr.copyResource("svgpan.js",dname); } { QFile f(dname+"/dynsections.js"); if (f.open(IO_WriteOnly)) { + const Resource *res = mgr.get("dynsections.js"); FTextStream t(&f); - t << dynsections_script; + t << (const char *)res->data; if (Config_getBool("SOURCE_BROWSER") && Config_getBool("SOURCE_TOOLTIPS")) { - t << endl << + t << endl << "$(document).ready(function() {\n" " $('.code,.codeRef').each(function() {\n" " $(this).data('powertip',$('#'+$(this).attr('href').replace(/.*\\//,'').replace(/[^a-z_A-Z0-9]/g,'_')).html());\n" @@ -1591,57 +758,95 @@ void HtmlGenerator::writeTabData() { Doxygen::indexList->addStyleSheetFile("tabs.css"); QCString dname=Config_getString("HTML_OUTPUT"); - writeColoredImgData(dname,colored_tab_data); - - { - unsigned char shadow[6] = { 5, 5, 5, 5, 5, 5 }; - unsigned char shadow_alpha[6] = { 80, 60, 40, 20, 10, 0 }; - ColoredImage img(1,6,shadow,shadow_alpha,0,0,100); - img.save(dname+"/nav_g.png"); - } + ResourceMgr &mgr = ResourceMgr::instance(); + //writeColoredImgData(dname,colored_tab_data); + mgr.copyResource("tab_a.lum",dname); + mgr.copyResource("tab_b.lum",dname); + mgr.copyResource("tab_h.lum",dname); + mgr.copyResource("tab_s.lum",dname); + mgr.copyResource("nav_h.lum",dname); + mgr.copyResource("nav_f.lum",dname); + mgr.copyResource("bc_s.luma",dname); + mgr.copyResource("doxygen.luma",dname); + mgr.copyResource("closed.luma",dname); + mgr.copyResource("open.luma",dname); + mgr.copyResource("bdwn.luma",dname); + mgr.copyResource("sync_on.luma",dname); + mgr.copyResource("sync_off.luma",dname); + + //{ + // unsigned char shadow[6] = { 5, 5, 5, 5, 5, 5 }; + // unsigned char shadow_alpha[6] = { 80, 60, 40, 20, 10, 0 }; + // ColoredImage img(1,6,shadow,shadow_alpha,0,0,100); + // img.save(dname+"/nav_g.png"); + //} + mgr.copyResource("nav_g.png",dname); } void HtmlGenerator::writeSearchData(const char *dir) { static bool serverBasedSearch = Config_getBool("SERVER_BASED_SEARCH"); - writeImgData(dir,serverBasedSearch ? search_server_data : search_client_data); + //writeImgData(dir,serverBasedSearch ? search_server_data : search_client_data); + ResourceMgr &mgr = ResourceMgr::instance(); + + mgr.copyResource("search_l.png",dir); + Doxygen::indexList->addImageFile("search/search_l.png"); + mgr.copyResource("search_m.png",dir); + Doxygen::indexList->addImageFile("search/search_m.png"); + mgr.copyResource("search_r.png",dir); + Doxygen::indexList->addImageFile("search/search_r.png"); + if (serverBasedSearch) + { + mgr.copyResource("mag.png",dir); + Doxygen::indexList->addImageFile("search/mag.png"); + } + else + { + mgr.copyResource("close.png",dir); + Doxygen::indexList->addImageFile("search/close.png"); + mgr.copyResource("mag_sel.png",dir); + Doxygen::indexList->addImageFile("search/mag_sel.png"); + } + QCString searchDirName = Config_getString("HTML_OUTPUT")+"/search"; QFile f(searchDirName+"/search.css"); if (f.open(IO_WriteOnly)) { - FTextStream t(&f); - QCString searchCss = replaceColorMarkers(search_styleSheet); - searchCss = substitute(searchCss,"$doxygenversion",versionString); - if (Config_getBool("DISABLE_INDEX")) + const Resource *res = mgr.get("search.css"); + if (res) { - // move up the search box if there are no tabs - searchCss = substitute(searchCss,"margin-top: 8px;","margin-top: 0px;"); + FTextStream t(&f); + QCString searchCss = replaceColorMarkers((const char *)res->data); + searchCss = substitute(searchCss,"$doxygenversion",versionString); + if (Config_getBool("DISABLE_INDEX")) + { + // move up the search box if there are no tabs + searchCss = substitute(searchCss,"margin-top: 8px;","margin-top: 0px;"); + } + t << searchCss; + Doxygen::indexList->addStyleSheetFile("search/search.css"); } - t << searchCss; } - Doxygen::indexList->addStyleSheetFile("search/search.css"); } void HtmlGenerator::writeStyleSheetFile(QFile &file) { FTextStream t(&file); - t << replaceColorMarkers(substitute(defaultStyleSheet,"$doxygenversion",versionString)); + t << replaceColorMarkers(substitute(ResourceMgr::instance().getAsString("doxygen.css"),"$doxygenversion",versionString)); } void HtmlGenerator::writeHeaderFile(QFile &file, const char * /*cssname*/) { FTextStream t(&file); t << "" << endl; - QCString contents(defaultHtmlHeader); - t << contents; + t << ResourceMgr::instance().getAsString("header.html"); } void HtmlGenerator::writeFooterFile(QFile &file) { FTextStream t(&file); t << "" << endl; - QCString contents(defaultHtmlFooter); - t << contents; + t << ResourceMgr::instance().getAsString("footer.html"); } void HtmlGenerator::startFile(const char *name,const char *, @@ -1779,7 +984,7 @@ void HtmlGenerator::writeStyleInfo(int part) //t << "H1 { text-align: center; border-width: thin none thin none;" << endl; //t << " border-style : double; border-color : blue; padding-left : 1em; padding-right : 1em }" << endl; - t << replaceColorMarkers(substitute(defaultStyleSheet,"$doxygenversion",versionString)); + t << replaceColorMarkers(substitute(ResourceMgr::instance().getAsString("doxygen.css"),"$doxygenversion",versionString)); endPlainFile(); Doxygen::indexList->addStyleSheetFile("doxygen.css"); } @@ -3007,9 +2212,10 @@ void HtmlGenerator::writeSearchPage() static bool generateTreeView = Config_getBool("GENERATE_TREEVIEW"); static bool disableIndex = Config_getBool("DISABLE_INDEX"); static QCString projectName = Config_getString("PROJECT_NAME"); + static QCString htmlOutput = Config_getString("HTML_OUTPUT"); // OPENSEARCH_PROVIDER { - QCString configFileName = Config_getString("HTML_OUTPUT")+"/search-config.php"; + QCString configFileName = htmlOutput+"/search_config.php"; QFile cf(configFileName); if (cf.open(IO_WriteOnly)) { @@ -3035,26 +2241,11 @@ void HtmlGenerator::writeSearchPage() t << "\n"; } - QCString functionsFileName = Config_getString("HTML_OUTPUT")+"/search-functions.php"; - QFile ff(functionsFileName); - if (ff.open(IO_WriteOnly)) - { - FTextStream t(&ff); - // Write stuff from search_functions.php source file... - t << search_functions_script; - } - - QCString opensearchFileName = Config_getString("HTML_OUTPUT")+"/search-opensearch.php"; - QFile of(opensearchFileName); - if (of.open(IO_WriteOnly)) - { - FTextStream t(&of); - // Write stuff from search_opensearch.php source file... - t << search_opensearch_script; - } + ResourceMgr::instance().copyResource("search_functions.php",htmlOutput); + ResourceMgr::instance().copyResource("search_opensearch.php",htmlOutput); // OPENSEARCH_PROVIDER } - QCString fileName = Config_getString("HTML_OUTPUT")+"/search.php"; + QCString fileName = htmlOutput+"/search.php"; QFile f(fileName); if (f.open(IO_WriteOnly)) { @@ -3077,7 +2268,7 @@ void HtmlGenerator::writeSearchPage() } t << "\n"; @@ -3091,12 +2282,12 @@ void HtmlGenerator::writeSearchPage() writePageFooter(t,"Search","",""); } - QCString scriptName = Config_getString("HTML_OUTPUT")+"/search/search.js"; + QCString scriptName = htmlOutput+"/search/search.js"; QFile sf(scriptName); if (sf.open(IO_WriteOnly)) { FTextStream t(&sf); - t << extsearch_script; + t << ResourceMgr::instance().getAsString("extsearch.js"); } else { @@ -3188,7 +2379,7 @@ void HtmlGenerator::writeExternalSearchPage() } if (!first) t << endl; t << "};" << endl << endl; - t << extsearch_script; + t << ResourceMgr::instance().getAsString("extsearch.js"); t << endl; t << "$(document).ready(function() {" << endl; t << " var query = trim(getURLParameter('query'));" << endl; diff --git a/src/index.xsd b/src/index.xsd deleted file mode 100644 index d7ab2a9..0000000 --- a/src/index.xsd +++ /dev/null @@ -1,66 +0,0 @@ - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - - diff --git a/src/jquery_fx.js b/src/jquery_fx.js deleted file mode 100644 index 97e5843..0000000 --- a/src/jquery_fx.js +++ /dev/null @@ -1 +0,0 @@ -(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery); \ No newline at end of file diff --git a/src/jquery_p1.js b/src/jquery_p1.js deleted file mode 100644 index 06eb7e6..0000000 --- a/src/jquery_p1.js +++ /dev/null @@ -1,18 +0,0 @@ -/*! - * jQuery JavaScript Library v1.7.1 - * http://jquery.com/ - * - * Copyright 2011, John Resig - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * Includes Sizzle.js - * http://sizzlejs.com/ - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * - * Date: Mon Nov 21 21:11:03 2011 -0500 - */ -(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b40){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b40&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b21?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv
a";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="
";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="
t
";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="
";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType; -if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bCbA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}}); -/*! - * Sizzle CSS Selector Engine - * Copyright 2011, The Dojo Foundation - * Released under the MIT, BSD, and GPL Licenses. - * More information: http://sizzlejs.com/ - */ -(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1 -},lt:function(bS,bR,e){return bRe[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="

";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="
";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT0){for(bB=bA;bB=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},ac=a(av); -ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div
","
"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1>");try{for(var bw=0,bv=this.length;bw1&&bw0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]===""&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length; diff --git a/src/jquery_p3.js b/src/jquery_p3.js deleted file mode 100644 index c0f18ce..0000000 --- a/src/jquery_p3.js +++ /dev/null @@ -1,3 +0,0 @@ -if(bA>0){if(bv!=="border"){for(;bx)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("
").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"":"")+"");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b -})}})(window); \ No newline at end of file diff --git a/src/jquery_pt.js b/src/jquery_pt.js deleted file mode 100644 index cbc428d..0000000 --- a/src/jquery_pt.js +++ /dev/null @@ -1,8 +0,0 @@ -/*! - PowerTip - v1.2.0 - 2013-04-03 - http://stevenbenner.github.com/jquery-powertip/ - Copyright (c) 2013 Steven Benner (http://stevenbenner.com/). - Released under MIT license. - https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt -*/ -(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.topI||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.leftF){H|=p.left}if(M.left+L>F||M.right=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*! - * jQuery UI Widget 1.8.18 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*! - * jQuery UI Mouse 1.8.18 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g
');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(hl.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null; -p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*! - * jQuery hashchange event - v1.3 - 7/21/2010 - * http://benalman.com/projects/jquery-hashchange-plugin/ - * - * Copyright (c) 2010 "Cowboy" Ben Alman - * Dual licensed under the MIT and GPL licenses. - * http://benalman.com/about/license/ - */ -(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$(' + +{% endblock %} + +
+{% block title %} +
{{ page.title }}
+{% endblock %} +
+ +{% block content %} +{% endblock %} + +{% block endsplitbar %} +{% if config.GENERATE_TREEVIEW %} + +{% endif %} +{% endblock %} + +{% block footer %} +{% if config.GENERATE_TREEVIEW %} + +{% else %} +
+{% if config.HTML_TIMESTAMP %} +{{ tr.generatedAt:doxygen.date,config.PROJECT_NAME }} +{% else %} +{{ tr.generatedby }} +{% endif %} + doxygen + {{ doxygen.version }} +
+{% endif %} + + +{% endblock %} diff --git a/templates/html/htmlclass.tpl b/templates/html/htmlclass.tpl new file mode 100644 index 0000000..bb734b6 --- /dev/null +++ b/templates/html/htmlclass.tpl @@ -0,0 +1,452 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML output for class {{ compound.name }}{% endmsg %} + +{% block navpath %} +{% with navpath=compound.navigationPath %} + {% include 'htmlnavpath.tpl' %} +{% endwith %} +{% endblock %} + +{% block title %} + {# write summary links in the title area #} +
+ {% with first=True %} + {% if compound.classes %} + {{ tr.classes }} + {% set first=False %} + {% endif %} + {% if compound.allMembersList %} + {% if not first %} | {% endif %} + {{ tr.listOfAllMembers }} + {% set first=False %} + {% endif %} + {% with memberListInfo=compound.publicTypes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.unoIDLServices %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.unoIDLInterfaces %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.signals %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicStaticMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicStaticAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedTypes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedStaticMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedStaticAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.packageTypes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.packageMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.packageStaticMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.packageAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.packageStaticAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.properties %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.events %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateTypes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateStaticMethods %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateStaticAttributes %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.friends %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.related %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% endwith %} +
+ {{ block.super }} +{% endblock %} + +{% block content %} +
+{# brief description #} + {% if compound.brief %} + {{ compound.brief }} + {% if compound.hasDetails %} + {{ tr.more }} + {% endif %} + {% endif %} +{# includes #} + {% if compound.includeInfo %} +
+ {% with ii=compound.includeInfo %} + {% include 'htmlinclude.tpl' %} + {% endwith %} +
+ {% endif %} +{# inheritancegraph #} + {% if compound.hasInheritanceDiagram %} + {% with obj=compound %} + {% include 'htmldynheader.tpl' %} + {% endwith %} + {{ tr.inheritanceDiagramFor:compound.name }} +
+ {% with obj=compound %} + {% include 'htmldyncontents.tpl' %} + {% endwith %} + {{ compound.inheritanceDiagram }} + + {# TODO: legend #} + {% else %} + {# textual inheritance list #} + {% if compound.inherits|length>0 %} +

+ {% markers c in compound.inherits with tr.inheritsList:compound.inherits|length %} + {% with obj=c.class text=c.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {% if compound.inheritedBy|length>0 %} +

+ {% markers c in compound.inheritedBy with tr.inheritedByList:compound.inheritedBy|length %} + {% with obj=c.class text=c.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {% endif %} +{# collaborationgraph #} + {% if compound.hasCollaborationDiagram %} + {% with obj=compound %} + {% include 'htmldynheader.tpl' %} + {% endwith %} + {{ tr.collaborationDiagramFor:compound.name }} + + {% with obj=compound %} + {% include 'htmldyncontents.tpl' %} + {% endwith %} + {{ compound.collaborationDiagram }} + + {% endif %} +{# memberdecls #} + {# TODO: isSimple #} + {# nestedClasses #} + {% with list=compound.classes label='nested-classes' title=tr.classes local=1 %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# publicTypes #} + {% with memberListInfo=compound.publicTypes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# services #} + {% with memberListInfo=compound.unoIDLServices %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# interfaces #} + {% with memberListInfo=compound.unoIDLInterfaces %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# publicSlots #} + {% with memberListInfo=compound.publicSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# signals #} + {% with memberListInfo=compound.signals %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# publicMethods #} + {% with memberListInfo=compound.publicMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# publicStaticMethods #} + {% with memberListInfo=compound.publicStaticMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# publicAttributes #} + {% with memberListInfo=compound.publicAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# publicStaticAttributes #} + {% with memberListInfo=compound.publicStaticAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedtypes #} + {% with memberListInfo=compound.protectedTypes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedslots #} + {% with memberListInfo=compound.protectedSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedmethods #} + {% with memberListInfo=compound.protectedMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedstaticmethods #} + {% with memberListInfo=compound.protectedStaticMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedattributes #} + {% with memberListInfo=compound.protectedAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protectedstaticattributes #} + {% with memberListInfo=compound.protectedStaticAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# packagetypes #} + {% with memberListInfo=compound.packageTypes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# packagemethods #} + {% with memberListInfo=compound.packageMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# packagestaticmethods #} + {% with memberListInfo=compound.packageStaticMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# packageattributes #} + {% with memberListInfo=compound.packageAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# packagestaticattributes #} + {% with memberListInfo=compound.packageStaticAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# properties #} + {% with memberListInfo=compound.properties %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# events #} + {% with memberListInfo=compound.events %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privatetypes #} + {% with memberListInfo=compound.privateTypes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privateslots #} + {% with memberListInfo=compound.privateSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privatemethods #} + {% with memberListInfo=compound.privateMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privatestaticmethods #} + {% with memberListInfo=compound.privateStaticMethods %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privateattributes #} + {% with memberListInfo=compound.privateAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# privatestaticattributes #} + {% with memberListInfo=compound.privateStaticAttributes %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# friends #} + {% with memberListInfo=compound.friends %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# related #} + {% with memberListInfo=compound.related %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# member groups #} + {% if compound.memberGroups %} + {% for memberListInfo in compound.memberGroups %} + {% include 'htmlmemdecls.tpl' %} + {% endfor %} + {% endif %} + {# additionalInheritedMembers #} + {% if compound.additionalInheritedMembers %} +
+ + {# write additional inherited members #} + {% for info in compound.additionalInheritedMembers %} + {% include 'htmlmeminherit.tpl' %} + {% endfor %} +

+ {{ tr.additionalInheritedMembers }} +

+ {% endif %} +{# detailed description #} +{% if compound.hasDetails %} + {% if compound.anchor %} + + {% else %} + + {% endif %} +

{{ tr.detailedDesc }}

+
+ {# template specifier #} + {% if compound.language=='cpp' and compound.templateDecls %} +

{% spaceless %} + {% for targList in compound.templateDecls %} + template< + {% for targ in targList %} + {{ targ.type }}{% if targ.name %} {{ targ.name }}{% endif %}{% if targ.defVal %} = {{ targ.defVal }}{% endif %}{% if not forloop.last %}, {% endif %} + {% endfor %} + >
+ {% endfor %} + {% endspaceless %} + {{ compound.compoundType }} {{ compound.name }} +

+ {% endif %} + {# brief description #} + {% if compound.brief and config.REPEAT_BRIEF %} +

+ {{ compound.brief }} +

+ {% endif %} + {{ compound.details }} +
+ {# type constraints #} + {% with obj=compound %} + {% include 'htmltypeconstraints.tpl' %} + {% endwith %} + {# examples #} + {% if compound.examples %} +
{{ tr.examples }}
+ {% markers obj in compound.examples with tr.exampleList:compound.examples|length %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +
+ {% endif %} + {# source definition #} + {% if compound.sourceDef %} + {% markers obj in compound.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} +{% endif %} +{# member definitions #} + {# inline classes #} + {% if compound.classes %} + {# TODO write inlined simple classes: tr.classDocumentation / tr.typeDocumentation #} + {% endif %} + {# typedefs #} + {% with memberListInfo=compound.detailedTypedefs %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# enums #} + {% with memberListInfo=compound.detailedEnums %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# services #} + {% with memberListInfo=compound.detailedServices %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# interfaces #} + {% with memberListInfo=compound.detailedInterfaces %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# constructors #} + {% with memberListInfo=compound.detailedConstructors %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# functions #} + {% with memberListInfo=compound.detailedMethods %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# related #} + {% with memberListInfo=compound.detailedRelated %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# variables #} + {% with memberListInfo=compound.detailedVariables %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# properties #} + {% with memberListInfo=compound.detailedProperties %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# events #} + {% with memberListInfo=compound.detailedEvents %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} +{# used files #} + {% if config.SHOW_USED_FILES %} +
+ {{ compound.generatedFromFiles }} + + {% endif %} +
+{% endblock %} + diff --git a/templates/html/htmlclasses.tpl b/templates/html/htmlclasses.tpl new file mode 100644 index 0000000..e932c26 --- /dev/null +++ b/templates/html/htmlclasses.tpl @@ -0,0 +1,21 @@ +{% extend 'htmlbase.tpl' %} +{% block content %} +
+
+{% indexentry nav name=tr.classIndex file=page.fileName anchor='' %} +
+
+
    +{% with index=classIndex.list|alphaIndex:'name' %} + {% for section in index %} +
      {{ section.letter }}  
    + {% for cls in section.items %} +
  • {{ cls.name }}
    • + {% endfor %} + {% endfor %} +{% endwith %} +
+
+
+{% endblock %} + diff --git a/templates/html/htmlclmembers.tpl b/templates/html/htmlclmembers.tpl new file mode 100644 index 0000000..29d495e --- /dev/null +++ b/templates/html/htmlclmembers.tpl @@ -0,0 +1,20 @@ +{# inputs: page, list #} +{% extend 'htmlbase.tpl' %} +{% block tabs %} +{{ block.super }} +{% include 'htmlmembertabs.tpl %} +{% endblock %} + +{% block content %} +
+
+{% if section=='' and letter=='' %} + {{ tr.classMembersDescription }} +{% endif %} + +{% include 'htmlmemberindex.tpl' %} + +
+
+{% endblock %} + diff --git a/templates/html/htmlclmembersindex.tpl b/templates/html/htmlclmembersindex.tpl new file mode 100644 index 0000000..2f15c12 --- /dev/null +++ b/templates/html/htmlclmembersindex.tpl @@ -0,0 +1,26 @@ +{% with page=namespaceMembersIndex %} + {# all members #} + {% with list=namespaceMembersIndex.all section='' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# functions #} + {% with list=namespaceMembersIndex.functions section='_func' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# variables #} + {% with list=namespaceMembersIndex.variables section='_vars' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# typedefs #} + {% with list=namespaceMembersIndex.typedefs section='_type' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# enums #} + {% with list=namespaceMembersIndex.enums section='_enum' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# enumValues #} + {% with list=namespaceMembersIndex.enumValues section='_eval' template='htmlclmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endwith %} diff --git a/templates/html/htmldeclcomp.tpl b/templates/html/htmldeclcomp.tpl new file mode 100644 index 0000000..4bd99d2 --- /dev/null +++ b/templates/html/htmldeclcomp.tpl @@ -0,0 +1,32 @@ +{# inputs: list, label, title, local #} +{% if list %} + + {% for nc in list %} + + + + {# brief description #} + {% if nc.brief %} + + {% endif %} + + {% endfor %} +
+

{{ title }}

{% if nc.compoundType %}{{ nc.compoundType }} {% endif %} + {% if local %} + {% with obj=nc text=nc.bareName %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% else %} + {% with obj=nc text=nc.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} +
  + {{ nc.brief }} + {% if nc.hasDetails %} + {# TODO: link to group if member is grouped #} + {{ tr.more }} + {% endif %} +
 
+{% endif %} diff --git a/templates/html/htmldir.tpl b/templates/html/htmldir.tpl new file mode 100644 index 0000000..7417f7b --- /dev/null +++ b/templates/html/htmldir.tpl @@ -0,0 +1,78 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML output for directory {{ compound.name }}{% endmsg %} + +{% block navpath %} + {% if compound.navigationPath %} + + {% endif %} +{% endblock %} + +{% block title %} + {# write summary links in the title area #} +
+ {% with first=True %} + {% if compound.dirs %} + {{ tr.directories }} + {% set first=False %} + {% endif %} + {% if compound.files %} + {% if not first %} | {% endif %} + {{ tr.files }} + {% set first=False %} + {% endif %} + {% endwith %} +
+ {{ block.super }} +{% endblock %} + +{% block content %} +
+{# brief description #} + {% if compound.brief %} + {{ compound.brief }} + {% if compound.hasDetails %} + {{ tr.more }} + {% endif %} + {% endif %} +{# dir graph #} +{# TODO #} +{# member declarations #} + {# directories #} + {% with list=compound.dirs label='subdirs' title=tr.directories local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# files #} + {% with list=compound.files, label='files' title=tr.files local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} +{# end member declarations #} +{# detailed description #} +{% if compound.hasDetails %} + {# anchor #} + + {# header #} +

{{ tr.detailedDesc }}

+
+ {# brief #} + {% if compound.brief and config.REPEAT_BRIEF %} +

+ {{ compound.brief }} +

+ {% endif %} + {# details #} + {{ compound.details }} +
+{% endif %} +
+{% endblock %} + diff --git a/templates/html/htmldirtree.tpl b/templates/html/htmldirtree.tpl new file mode 100644 index 0000000..2fa266a --- /dev/null +++ b/templates/html/htmldirtree.tpl @@ -0,0 +1,46 @@ +{# input tree with maxDepth, preferredDepth, and nodes #} +
+{# level selection #} +{% if tree.maxDepth > 1 %} +
[{{ tr.detailLevel }} + {% range i from 1 to tree.maxDepth %} + {{ i }} + {% endrange %} + ]
+{% endif %} +{# the table with entries #} + +{% recursetree tree.tree %} + {% indexentry nav name=node.name file=node.fileName anchor=node.anchor %} + {% spaceless %} + tree.preferredDepth %} style="display:none;"{% endif %}> + + + {% endspaceless %} + {% opensubindex nav %} + {{ children }} + {% closesubindex nav %} +{% endrecursetree %} +
+ {% if node.is_leaf_node %} +   + {% else %} +   + + {%if node.level+1 + {% endif %} + {% if node.namespace %} + N + {% elif node.class %} + C + {% elif node.dir %} +   + {% elif node.file %} + + {% endif %} + {% with obj=node text=node.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {{ node.brief }}
+
diff --git a/templates/html/htmldyncontents.tpl b/templates/html/htmldyncontents.tpl new file mode 100644 index 0000000..37411c3 --- /dev/null +++ b/templates/html/htmldyncontents.tpl @@ -0,0 +1,7 @@ +{# input: obj which should have dynSectionId attribute #} +{% if config.HTML_DYNAMIC_SECTIONS %} +
+ +{% endblock %} + diff --git a/templates/html/htmlfiles.tpl b/templates/html/htmlfiles.tpl new file mode 100644 index 0000000..1871d4d --- /dev/null +++ b/templates/html/htmlfiles.tpl @@ -0,0 +1,15 @@ +{% extend 'htmlbase.tpl' %} +{% block content %} +
+
+{{ tr.fileListDescription }} +
+{% indexentry nav name=tr.fileList file=page.fileName anchor='' %} +{% opensubindex nav %} +{% with tree=fileTree %} + {% include 'htmldirtree.tpl' %} +{% endwith %} +{% closesubindex nav %} +
+{% endblock %} + diff --git a/templates/html/htmlflmembers.tpl b/templates/html/htmlflmembers.tpl new file mode 100644 index 0000000..e2c781a --- /dev/null +++ b/templates/html/htmlflmembers.tpl @@ -0,0 +1,20 @@ +{# inputs: page, list #} +{% extend 'htmlbase.tpl' %} +{% block tabs %} +{{ block.super }} +{% include 'htmlmembertabs.tpl %} +{% endblock %} + +{% block content %} +
+
+{% if section=='' and letter=='' %} + {{ tr.fileMembersDescription }} +{% endif %} + +{% include 'htmlmemberindex.tpl' %} + +
+
+{% endblock %} + diff --git a/templates/html/htmlinclude.tpl b/templates/html/htmlinclude.tpl new file mode 100644 index 0000000..24bfac6 --- /dev/null +++ b/templates/html/htmlinclude.tpl @@ -0,0 +1,27 @@ +{# input: ii with attributes (file,name,isImport,isLocal), compound with attribute language #} +{% spaceless %} + {% if ii.file or ii.name %} + + {% if compound.language=='java' or compound.language=='idl' %} + import  + {%else %} + {% if ii.isImport %} + #import  + {% else %} + #include  + {% endif %} + {%endif %} + {% if ii.isLocal %}"{% else %}<{% endif %} + {% if ii.name %} + {% if ii.file %} + {{ ii.name }} + {% else %} + {{ ii.name }} + {% endif %} + {% else %} + {{ ii.file.name }} + {% endif %} + {% if ii.isLocal %}"{% else %}>{% endif %} + + {% endif %} +{% endspaceless %} diff --git a/templates/html/htmlindexpages.tpl b/templates/html/htmlindexpages.tpl new file mode 100644 index 0000000..65bf1b6 --- /dev/null +++ b/templates/html/htmlindexpages.tpl @@ -0,0 +1,19 @@ +{# inputs: list, section #} +{% with letter='' %} + {# create full index page #} + {% create page.fileName|append:section|append:config.HTML_FILE_EXTENSION from template %} +{% endwith %} +{% if list|length>maxItemsForMultiPageList %} + {% opensubindex nav %} + {% with index=list|alphaIndex:'name' %} + {% for sect in index %} + {% with letter=sect.letter %} + {% set page_postfix=section|append:'_'|append:sect.label %} + {% indexentry nav name=letter file=page.fileName|append:page_postfix anchor='' %} + {# create index pages for all globals starting with a specific letter #} + {% create page.fileName|append:page_postfix|append:config.HTML_FILE_EXTENSION from template %} + {% endwith %} + {% endfor %} + {% endwith %} + {% closesubindex nav %} +{% endif %} diff --git a/templates/html/htmljsnavindex.tpl b/templates/html/htmljsnavindex.tpl new file mode 100644 index 0000000..07a9efc --- /dev/null +++ b/templates/html/htmljsnavindex.tpl @@ -0,0 +1,7 @@ +{# input idx, entries #} +var NAVTREEINDEX{{ idx }} = +{ +{% for entry in entries %} + "{{ entry.file }}{{ config.HTML_FILE_EXTENSION }}{% if entry.anchor %}#{{ entry.anchor }}{% endif %}":[{% for e in entry.path %}{% if not forloop.first %}{{ e.index }}{% if not forloop.last%},{% endif %}{% endif %}{% endfor %}]{% if not forloop.last %},{%endif %} +{% endfor %} +}; diff --git a/templates/html/htmljsnavtree.tpl b/templates/html/htmljsnavtree.tpl new file mode 100644 index 0000000..a7ad88e --- /dev/null +++ b/templates/html/htmljsnavtree.tpl @@ -0,0 +1,20 @@ +var NAVTREE = +[ +{% recursetree index.nav %} + [ "{{ node.name }}", {% if node.file %}"{{ node.file }}{{ config.HTML_FILE_EXTENSION }}{% if node.anchor %}#{{ node.anchor }}{% endif %}"{% else %}null{% endif %},{% if not node.is_leaf_node %} [ + {{ children }} + ]{% else %} null{% endif %} ]{% if not node.last %},{% endif %} +{% endrecursetree %} +]; + +var NAVTREEINDEX = +[ +{% with navlist=index.nav|flatten|listsort:config.HTML_FILE_EXTENSION|prepend:'{{file}}'|append:'#{{anchor}}' navpages=navlist|paginate:250 %} + {% for page in navpages %} + "{{ page.0.file }}{{ config.HTML_FILE_EXTENSION }}{% if page.0.anchor %}#{{ page.0.anchor }}{% endif %}"{% if not forloop.last %},{%endif %} + {% with idx=forloop.counter0 entries=page %} + {% create forloop.counter0|prepend:'navtreeindex'|append:'.js' from 'htmljsnavindex.tpl' %} + {% endwith %} + {% endfor %} +{% endwith %} +]; diff --git a/templates/html/htmllayout.tpl b/templates/html/htmllayout.tpl new file mode 100644 index 0000000..ff99fa5 --- /dev/null +++ b/templates/html/htmllayout.tpl @@ -0,0 +1,232 @@ +{% msg %}----- Start generating HTML output for from template ----{% endmsg %} + +{# ---- copy fixed resources to the output ----- #} + +{% resource 'doxygen.css' %} +{% resource 'tabs.css' %} +{% resource 'jquery.js' %} +{% resource 'dynsections.js %} +{% resource 'tab_a.lum' %} +{% resource 'tab_b.lum' %} +{% resource 'tab_h.lum' %} +{% resource 'tab_s.lum' %} +{% resource 'tab_h.lum' %} +{% resource 'bc_s.luma' %} +{% resource 'doxygen.luma' %} +{% resource 'closed.luma' %} +{% resource 'open.luma' %} +{% resource 'bdwn.luma' %} +{% resource 'sync_on.luma' %} +{% resource 'sync_off.luma' %} + +{# navigation #} +{% resource 'nav_f.lum' %} +{% resource 'nav_g.png' %} +{% resource 'nav_h.lum' %} +{% resource 'navtree.css' %} + +{# general search resources #} +{% resource 'search_l.png' as 'search/search_l.png' %} +{% resource 'search_m.png' as 'search/search_m.png' %} +{% resource 'search_r.png' as 'search/search_r.png' %} +{% if config.DISABLE_INDEX %} + {% resource 'search_noidx.css' as 'search/search.css' %} +{% else %} + {% resource 'search.css' as 'search/search.css' %} +{% endif %} + +{% if config.SERVER_BASED_SEARCH %} + {# server side search resources #} + {% resource 'mag.png' as 'search/mag.png' %} + {% resource 'extsearch.js as 'search/search.js' %} + {% resource 'search_functions.php' as 'search/search_functions.php' %} + {% resource 'search_opensearch.php' as 'search/search_opensearch.php' %} +{% else %} + {# client side search resources #} + {% resource 'mag_sel.png' as 'search/mag_sel.png' %} + {% resource 'close.png' as 'search/close.png' %} + {% resource 'search.js' as 'search/search.js' %} +{% endif %} + +{# interactive SVGs #} +{% resource 'svgpan.js' %} + +{# -------------------------------------------------- #} + +{# global constants #} +{% set maxItemsForFlatList=2 %} +{% set maxItemsForMultiPageList=4 %} + +{# global variable #} +{% set page_postfix='' %} + +{# open the global navigation index #} +{% indexentry nav name=tr.mainPage file='index' anchor='' %} +{% opensubindex nav %} + +{# ----------- HTML DOCUMENTATION PAGES ------------ #} + +{# write main page documentation #} +{% if mainPage %} + {% with page=mainPage compound=mainPage %} + {% create mainPage.fileName|append:config.HTML_FILE_EXTENSION from 'htmlpage.tpl' %} + {% endwith %} +{% endif %} + +{# write namespace documentation pages #} +{% for compound in namespaceList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmlnamespace.tpl' %} + {% endwith %} +{% endfor %} + +{# write class documentation pages #} +{% for compound in classList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmlclass.tpl' %} + {% if compound.allMembersList and not config.OPTIMIZE_OUTPUT_FOR_C %} + {% create compound.allMembersFileName|append:config.HTML_FILE_EXTENSION from 'htmlallmembers.tpl' %} + {% endif %} + {% endwith %} +{% endfor %} + +{# write the file sources #} +{% for compound in fileList %} + {% with page=compound %} + {# TODO: to deal with clang optimisation, we need to write the sources in a different order! #} + {# TODO: now writing sources has the side-effect of creating cross-references. Need to split that up! #} + {% if compound.hasSourceFile %} + {% create compound.sourceFileName|append:config.HTML_FILE_EXTENSION from 'htmlsource.tpl' %} + {% endif %} + {% endwith %} +{% endfor %} + +{# write file documentation pages #} +{% for compound in fileList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmlfile.tpl' %} + {% endwith %} +{% endfor %} + +{# write related page documentation #} +{% for compound in pageList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmlpage.tpl' %} + {% endwith %} +{% endfor %} + +{# write module documentation #} +{% for compound in moduleList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmlmodule.tpl' %} + {% endwith %} +{% endfor %} + +{# ----------- INDEXES ------------ #} + +{# --- related pages --- #} +{% if pageTree.tree %} + {% with page=pageTree %} + {% create pageTree.fileName|append:config.HTML_FILE_EXTENSION from 'htmlpages.tpl' %} + {% endwith %} +{% endif %} + +{# --- modules --- #} +{% if moduleTree.tree %} + {% with page=moduleTree %} + {% create moduleTree.fileName|append:config.HTML_FILE_EXTENSION from 'htmlmodules.tpl' %} + {% endwith %} +{% endif %} + +{# --- namespaces --- #} +{% indexentry nav name=tr.namespaces file='' anchor='' %} +{% opensubindex nav %} + + {% if namespaceTree.tree %} + {% with page=namespaceTree %} + {% create namespaceTree.fileName|append:config.HTML_FILE_EXTENSION from 'htmlnamespaces.tpl' %} + {% endwith %} + {% endif %} + + {# write symbol indices for namespace members #} + {% if namespaceMembersIndex.all %} + {% with page=namespaceMembersIndex scope='namespace' template='htmlnsmembers.tpl' %} + {% indexentry nav name=tr.namespaceMembers file=page.fileName anchor='' %} + {% include 'htmlmembersindex.tpl' %} + {% endwith %} + {% endif %} + +{% closesubindex nav %} + +{# --- classes --- #} +{% indexentry nav name=tr.classes file='' anchor='' %} +{% opensubindex nav %} + + {# write the annotated class list #} + {% if classTree.tree %} + {% with page=classTree %} + {% create classTree.fileName|append:config.HTML_FILE_EXTENSION from 'htmlannotated.tpl' %} + {% endwith %} + {% endif %} + + {# write class index #} + {% if classIndex.list %} + {% with page=classIndex %} + {% create classIndex.fileName|append:config.HTML_FILE_EXTENSION from 'htmlclasses.tpl' %} + {% endwith %} + {% endif %} + + {# TODO: write the class inheritance hierarchy #} + {% if classHierarchy.tree %} + {% with page=classHierarchy %} + {% create classHierarchy.fileName|append:config.HTML_FILE_EXTENSION from 'hierarchy.tpl' %} + {% endwith %} + {% endif %} + + {# write symbol indices for class members #} + {% if classMembersIndex.all %} + {% with page=classMembersIndex scope='class' template='htmlclmembers.tpl' %} + {% indexentry nav name=tr.classMembers file=page.fileName anchor='' %} + {% include 'htmlmembersindex.tpl' %} + {% endwith %} + {% endif %} + +{% closesubindex nav %} + +{# --- files --- #} +{% indexentry nav name=tr.files file='' anchor='' %} +{% opensubindex nav %} + + {# write the directory/file hierarchy #} + {% if fileTree.tree %} + {% with page=fileTree %} + {% create fileTree.fileName|append:config.HTML_FILE_EXTENSION from 'htmlfiles.tpl' %} + {% endwith %} + {% endif %} + + {# write symbol indices for global namespace #} + {% if globalsIndex.all %} + {% with page=globalsIndex scope='file' template='htmlflmembers.tpl' %} + {% indexentry nav name=tr.fileMembers file=page.fileName anchor='' %} + {% include 'htmlmembersindex.tpl' %} + {% endwith %} + {% endif %} + +{% closesubindex nav %} + +{# write directory documentation pages #} +{% for compound in dirList %} + {% with page=compound %} + {% create compound.fileName|append:config.HTML_FILE_EXTENSION from 'htmldir.tpl' %} + {% endwith %} +{% endfor %} + +{# close the global navigation index #} +{% closesubindex nav %} + +{# write the navigation tree data #} +{% if config.GENERATE_TREEVIEW %} + {% create 'navtreedata.js' from 'htmljsnavtree.tpl' %} +{% endif %} + +{% msg %}----- End generating HTML output for from template ----{% endmsg %} diff --git a/templates/html/htmlmemberindex.tpl b/templates/html/htmlmemberindex.tpl new file mode 100644 index 0000000..216dd31 --- /dev/null +++ b/templates/html/htmlmemberindex.tpl @@ -0,0 +1,37 @@ +{# input: list #} +{% set singleList=(list|length<=maxItemsForFlatList) or (list|length>maxItemsForMultiPageList) %} +{% if singleList %} +
    +{% endif %} +{% with index=list|alphaIndex:'name' %} + {% for section in index %} + {% if not singleList or letter=='' or section.letter==letter %} + {% if not singleList %} +

    - {{ section.letter }} -

    +
      + {% endif %} + {% for nameList in section.items|groupBy:'name' %} + {% spaceless %} + {% for item in nameList|listsort:'{{item.file.name}}' %} + {% if forloop.first %} +
    • {{ item.name }}{% if (item.isFunction or item.isSignal or item.isSlot) and not item.isObjCMethod %}(){% endif %} :  + {% endif %} + {% with obj=item scope=item|get:scope text=scope.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% if not forloop.last %},  + {% else %} +
      • + {% endif %} + {% endfor %} + {% endspaceless %} + {% endfor %} + {% if not singleList %} +
    + {% endif %} + {% endif %} + {% endfor %} +{% endwith %} +{% if singleList %} +
+{% endif %} diff --git a/templates/html/htmlmembersindex.tpl b/templates/html/htmlmembersindex.tpl new file mode 100644 index 0000000..ef891df --- /dev/null +++ b/templates/html/htmlmembersindex.tpl @@ -0,0 +1,81 @@ +{# input: page #} +{% opensubindex nav %} +{# all members #} +{% with list=page.all section='' %} + {% indexentry nav name=tr.all file=page.fileName|append:page_postfix anchor='' %} + {% include 'htmlindexpages.tpl' %} +{% endwith %} +{# functions #} +{% if page.functions %} + {% set page_postfix='_func' %} + {% indexentry nav name=tr.functions file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.functions section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# variables #} +{% if page.variables %} + {% set page_postfix='_vars' %} + {% indexentry nav name=tr.variables file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.variables section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# typedefs #} +{% if page.typedefs %} + {% set page_postfix='_type' %} + {% indexentry nav name=tr.typedefs file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.typedefs section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# enums #} +{% if page.enums %} + {% set page_postfix='_enum' %} + {% indexentry nav name=tr.enums file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.enums section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# enumValues #} +{% if page.enumValues %} + {% set page_postfix='_eval' %} + {% indexentry nav name=tr.enumValues file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.enumValues section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# macros #} +{% if page.macros %} + {% set page_postfix='_defs' %} + {% indexentry nav name=tr.macros file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.macros section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# properties #} +{% if page.properties %} + {% set page_postfix='_prop' %} + {% indexentry nav name=tr.properties file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.properties section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# events #} +{% if page.events %} + {% set page_postfix='_evnt' %} + {% indexentry nav name=tr.events file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.events section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{# related #} +{% if page.related %} + {% set page_postfix='_rela' %} + {% indexentry nav name=tr.related file=page.fileName|append:page_postfix anchor='' %} + {% with list=page.related section=page_postfix %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endif %} +{% set page_postfix='' %} +{% closesubindex nav %} diff --git a/templates/html/htmlmembertabs.tpl b/templates/html/htmlmembertabs.tpl new file mode 100644 index 0000000..93341a6 --- /dev/null +++ b/templates/html/htmlmembertabs.tpl @@ -0,0 +1,48 @@ +{# inputs page, list #} +{% if not config.DISABLE_INDEX %} +{# third row of tabs #} + +{# forth row of tabs #} +{% if list|length>maxItemsForMultiPageList %} + +{% endif %} +{% endif %} diff --git a/templates/html/htmlmemdecl.tpl b/templates/html/htmlmemdecl.tpl new file mode 100644 index 0000000..6af75ce --- /dev/null +++ b/templates/html/htmlmemdecl.tpl @@ -0,0 +1,214 @@ +{# inputs: member, inheritId= anonymousNestingLevel= #} +{% if not member.isEnumValue %} + {# start member declaration #} + + {% if member.isEnumeration %} + {% if anonymousNestingLevel>0 %} + + {% else %} + + {% endif %} + {# write optional anchor #} + {% if not member.hasDetails %} + + {% endif %} + {# write optional indent #} + {% repeat anonymousNestingLevel %}   {% endrepeat %} + enum  + {# write name #} + {% if not member.isAnonymous %} + {% with obj=member text=member.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} + {% if member.enumBaseType %} : {{ member.enumBaseType }}{% endif %} + {% if member.enumValues|length>0 and config.ENUM_VALUES_PER_LINE>0 %} + { + {% for enumVal in member.enumValues %} + {% if member.enumValues|length>config.ENUM_VALUES_PER_LINE and forloop.counter0|divisibleby:config.ENUM_VALUES_PER_LINE %} +
   + {% endif %} + {% spaceless %} + {% with obj=enumVal text=enumVal.name %} + {% include 'htmlobjlink.tpl' %} + {% if enumVal.hasOneLineInitializer %} + {{ member.initializer }} + {% endif %} + {% if not forloop.last %},{% endif %} + {% endwith %} + {% endspaceless %} + {% endfor %} + {% if member.enumValues|length>config.ENUM_VALUES_PER_LINE %} +
+ {% endif %} + } + {% endif %} + {% else %} + {% if anonymousNestingLevel>0 or member.anonymousType %} + + {% else %} + {% if member.templateArgs %} + + {% else %} + + {% endif %} + {% endif %} + {# write optional anchor #} + {% if not member.hasDetails %} + + {% endif %} + {# write optional indent #} + {% repeat anonymousNestingLevel %}   {% endrepeat %} + {# write template list #} + {% if member.templateArgs and member.language=='cpp' %} + {% spaceless %} + template< + {% for targ in member.templateArgs %} + {{ targ.type }} {{ targ.name }}{% if targ.defVal %} = {{ targ.defval }}{% endif %}{% if not forloop.last %}, {% endif %} + {% endfor %} + {% endspaceless %} > + + {% endif %} + {# write type #} + {% if member.anonymousType %} + {% with ctx=member.anonymousType anonymousNestingLevel=anonymousNestingLevel|add:1 %} + {{ ctx.compoundType }} + {% if ctx.bareName %} +  {{ ctx.bareName }} {# TODO: associated documentation is lost! #} + {% endif %} + { + {# recursively write members that can appear inside the anonymous class/struct #} + {% with memberListInfo=ctx.publicTypes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.publicMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.publicStaticMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.publicAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.publicStaticAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.protectedTypes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.protectedMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.protectedStaticMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.protectedAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.protectedStaticAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.privateTypes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.privateMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.privateStaticMethods %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.privateAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% with memberListInfo=ctx.privateStaticAttributes %} + {% include 'htmlmemlist.tpl' %} + {% endwith %} + {% endwith %} + + {% repeat anonymousNestingLevel %}   {% endrepeat %} + } + {% else %} + {% if member.isObjCMethod %} + {% if member.isStatic %}+ {% else %}- {% endif %} + {% else %} + {{ member.declType }} + {% endif %} + {% endif %} + {% spaceless %} +   + {% if anonymousNestingLevel>0 %} +    + {% else %} + + {% endif %} + {% endspaceless %} + {# write name #} + {% if not member.isAnonymous %} + {% if member.anonymousMember %} + {% with obj=member.anonymousMember text=member.anonymousMember.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% else %} + {% with obj=member text=member.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} + {% endif %} + {# write arguments #} + {% if not member.isObjCMethod %} + {{ member.declArgs }} + {% endif %} + {# write exceptions #} + {% if member.exception %} + {{ member.exception }} + {% endif %} + {# write bitfield #} + {% if member.bitfields %} + {{ member.bitfields }} + {% endif %} + {# write one-line initializer #} + {% if member.hasOneLineInitializer %} + {% if member.isDefine %}   {% endif %} + {{ member.initializer }} + {% endif %} + {# write template alias #} + {% if member.templateAlias %} + {{ member.templateAlias }} + {% endif %} + {# write obj-c implementation #} + {% if member.isObjCMethod or member.isObjCProperty %} + {% if member.isImplementation %} + [implementation] + {% endif %} + {% endif %} + {# write getter/setter property #} + {% if member.isProperty and member.propertyAttrs|length>0 %} + [ + {% for attr in member.propertyAttrs %} + {{ attr }}{% if not forloop.last %},{% endif %} + {% endfor %} + ] + {% endif %} + {# write event methods #} + {% if member.isEvent and member.eventAttrs|length>0 %} + [ + {% for attr in member.eventAttrs %} + {{ attr }}{% if not forloop.last %},{% endif %} + {% endfor %} + ] + {% endif %} + {# end member declaration #} + {% endif %} {# member.isEnumeration #} + + {# brief description #} + {% if member.brief %} +   + {{ member.brief }} + {% if member.hasDetails %} + {# TODO: link to group if member is grouped #} + {{ tr.more }} + {% endif %} +
+ {% endif %} +   +{% endif %} {# not member.isEnumValue #} diff --git a/templates/html/htmlmemdecls.tpl b/templates/html/htmlmemdecls.tpl new file mode 100644 index 0000000..846c8f3 --- /dev/null +++ b/templates/html/htmlmemdecls.tpl @@ -0,0 +1,38 @@ +{# inputs: memberListInfo or memberGroupInfo #} +{% if memberListInfo %} + {% if memberListInfo.members|length>0 or memberListInfo.memberGroups|length>0 %} + + {# section header #} + + {% if memberListInfo.subtitle %} + + {% endif %} + {# normal members #} + {% with inheritId='' anonymousNestingLevel=0 %} + {% for member in memberListInfo.members %} + {% include 'htmlmemdecl.tpl' %} + {% endfor %} + {% endwith %} + {# grouped members #} + {% for memgroup in memberListInfo.memberGroups %} + {% with memberListInfo=memgroup inheritId='' anonymousNestingLevel=0 %} + {% if memberListInfo.title!='[NOHEADER]' %} + + {% if memberListInfo.docs %} + + {% endif %} + {% endif %} + {% for member in memberListInfo.members %} + {% include 'htmlmemdecl.tpl' %} + {% endfor %} + {% endwith %} + {% endfor %} + {# inherited members #} + {% if memberListInfo.inherited %} + {% for info in memberListInfo.inherited %} + {% include 'htmlmeminherit.tpl' %} + {% endfor %} + {% endif %} +

{{ memberListInfo.title }}

{{ memberListInfo.subtitle }}
{{ memberListInfo.title }}
{{ memberListInfo.docs }}
+ {% endif %} +{% endif %} diff --git a/templates/html/htmlmemdef.tpl b/templates/html/htmlmemdef.tpl new file mode 100644 index 0000000..c469f1f --- /dev/null +++ b/templates/html/htmlmemdef.tpl @@ -0,0 +1,284 @@ +{# inputs: memberListInfo #} +{% if memberListInfo %} + {% if memberListInfo.members|length>0 %} +

{{ memberListInfo.title }}

+ {% for member in memberListInfo.members %} + {% if member.hasDetails %} {# TODO: not the same as isDetailedSectionVisible! #} + {# TODO: handle enum + anonymous members #} + {# TODO: for namespace members written in a file we need to prepend file_ #} +
+
+ {# write template declarations #} + {% if member.language=='cpp' and member.templateDecls|length>0 %} + {% for targList in member.templateDecls %} + {% spaceless %} +
+ template< + {% for targ in targList %} + {{ targ.type }}{% if targ.name %} {{ targ.name }}{% endif %}{% if targ.defVal %} = {{ targ.defVal }}{% endif %}{% if not forloop.last %}, {% endif %} + {% endfor %} + > +
+ {% endspaceless %} + {% endfor %} + {% endif %} + {# start of labels if present #} + {% if member.labels|length>0 %} +
+ {% endif %} + + + {% for arg in member.parameters %} + {% if not forloop.first %} + + {% endif %} + + {% endif %} + {% endfor %} + {% else %} + + {% for arg in member.parameters %} + {% if member.isDefine %} + {% if not forloop.first %} + + {% endif %} + + {% endif %} + {% endspaceless %} + {% else %} {# normal function/method #} + {% if forloop.first %} + + +
+ {{ member.definition }} + {# write argument list #} + {# TODO: TCL #} + {% if member.hasParameterList %} + {% if member.isObjCMethod %} +
{{ arg.namePart }}({{ arg.type }})  + {% if arg.name or arg.type=='...' %} + {% if not arg.name %}{{ arg.type }}{% else %}{{ arg.name }}{% endif %} + {% endif %} + {% if not forloop.last %} + ,
(
+ {% spaceless %} + {% if arg.type %} + {{ arg.type }} + {% endif %} + {% if not forloop.last %} + ,
+ {% endif %} + {% if arg.attrib %}{{ arg.attrib }} {% endif %} + {% if arg.type!='...' %} + {{ arg.type }} + {% endif %} +   + {% if arg.name or arg.type=='...' %} + {% if not arg.name %}{{ arg.type }}{% else %}{{ arg.name }}{% endif %} + {% endif %} + {{ arg.array }} + {% if arg.defVal %} = {{ arg.defVal }}{% endif %} + {% if not forloop.last %} + ,
+ {% endif %} + {% endif %} + {% endfor %} + {% if member.parameters|length==0 %} + + {% endif %} + {% if member.parameters|length<2 %} + ) + {% else %} +  
) + {% endif %} + {{ member.extraTypeChars }} + {% if member.hasConstQualifier %} const {% endif %} + {% if member.hasVolatileQualifier %} volatile {% endif %} + {{ member.trailingReturnType }} + {% endif %} + {% endif %} + {# one line initializer #} + {% if member.hasOneLineInitializer %} + {% if member.isDefine %}   {% endif %} + {{ member.initializer }} + {% endif %} + {# exception list #} + {% if member.exception %} + {# TODO: special exception rendering for UNO IDL... #} + {{ member.exception }} + {% endif %} +
+ {# end of labels if present #} + {% if member.labels|length>0 %} + 		{% spaceless %} + {% for label in member.labels %} + {{ label }} + {% endfor %}{% endspaceless %} +
+ {% endif %} +
+
+ {# TODO: write group include #} + {# multi-line initializer #} + {% if member.hasMultiLineInitializer %} + {% if member.isDefine %}{{ tr.defineValue }}{% else %}{{ tr.initialValue }}{% endif %} +
{{ member.initializerAsCode }}
+ {% endif %} + {# brief description #} + {% if member.brief and config.REPEAT_BRIEF and config.BRIEF_MEMBER_DESC %} +

{{ member.brief }}

+ {% endif %} + {# detailed description #} + {# TODO: VHDL #} + {{ member.details }} + {# inbody description #} + {{ member.inbodyDocs }} + {# argument list #} + {{ member.paramDocs }} + {# enum values #} + {% if member.isEnumeration and member.enumValues|length>0 %} + + + {% for enumVal in member.enumValues %} + + + + {% endfor %} +
{{ tr.enumValues }}
{{ enumVal.name }} {{ enumVal.brief }}{{ enumVal.details }}
+ {% endif %} + {# reimplements #} + {% if member.reimplements %} +

+ {% markers mem in member.reimplements with tr.reimplements %} + {% with obj=mem text=mem.class.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {% if member.implements %} +

+ {% markers mem in member.implements with tr.implements %} + {% with obj=mem text=mem.class.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {# reimplementedBy #} + {% if member.reimplementedBy %} +

+ {% markers mem in member.reimplementedBy with tr.reimplementedBy:member.reimplementedBy|length %} + {% with obj=mem text=mem.class.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {% if member.implementedBy %} +

+ {% markers mem in member.implementedBy with tr.implementedBy:member.implementedBy|length %} + {% with obj=mem text=mem.class.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +

+ {% endif %} + {# category relation #} + + {# TODO #} + + {# examples #} + {% if member.examples %} +
{{ tr.examples }}
+ {% markers obj in member.examples with tr.exampleList:member.examples|length %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} +
+ {% endif %} + {# type constraints #} + {% with obj=member %} + {% include 'htmltypeconstraints.tpl' %} + {% endwith %} + {# source def #} + {% if member.sourceDef %} + {% markers obj in member.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} + {# source refs #} + {% if member.sourceRefs|length>0 %} +

+ {% markers mem in member.sourceRefs with tr.sourceRefs:member.sourceRefs|length %} + {% if mem.sourceDef and config.REFERENCES_LINK_SOURCE %} + {% with obj=mem.sourceDef.0 text=mem.name|append:mem.functionQualifier %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% else %} + {% with obj=mem text=mem.name|append:mem.functionQualifier %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} + {% endmarkers %} +

+ {% endif %} + {# source refs by #} + {% if member.sourceRefBys|length>0%} +

+ {% markers mem in member.sourceRefBys with tr.sourceRefBys:member.sourceRefBys|length %} + {% if mem.sourceDef and config.REFERENCES_LINK_SOURCE %} + {% with obj=mem.sourceDef.0 text=mem.name|append:mem.functionQualifier %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% else %} + {% with obj=mem text=mem.name|append:mem.functionQualifier %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} + {% endmarkers %} +

+ {% endif %} + {# inline code #} + {% if member.hasSources and config.INLINE_SOURCES %} +
+ {{ member.sourceCode }} +
+ {% endif %} + {# call graph #} + {% if member.hasCallGraph %} + {% with obj=member %} + {% include 'htmldynheader.tpl' %} + {% endwith %} + {{ tr.callGraph }} +
+ {% with obj=member %} + {% include 'htmldyncontents.tpl' %} + {% endwith %} + {{ member.callGraph }} +
+ {% endif %} + {# caller graph #} + {% if member.hasCallerGraph %} + {% with obj=member %} + {% include 'htmldynheader.tpl' %} + {% endwith %} + {{ tr.callerGraph }} + + {% with obj=member %} + {% include 'htmldyncontents.tpl' %} + {% endwith %} + {{ member.callerGraph }} + + {% endif %} + + + {% endif %} + {% endfor %} {# for each member #} + {# TODO: write member group docs #} + {% endif %} +{% endif %} + diff --git a/templates/html/htmlmeminherit.tpl b/templates/html/htmlmeminherit.tpl new file mode 100644 index 0000000..830bf10 --- /dev/null +++ b/templates/html/htmlmeminherit.tpl @@ -0,0 +1,20 @@ +{# input: info (with .id .inheritedFrom and .members) #} + + +-  + {% markers mark in info.inheritedFrom with tr.inheritedFrom %} + {% if markers.id==0 %} {# the title mark #} + {{ mark }} + {% endif %} + {% if markers.id==1 %} {# the class link mark #} + {% with obj=mark text=mark.name %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endif %} + {% endmarkers %} + +{% with inheritId=info.id anonymousNestingLevel=0 %} + {% for member in info.members %} + {% include 'htmlmemdecl.tpl' %} + {% endfor %} +{% endwith %} diff --git a/templates/html/htmlmemlist.tpl b/templates/html/htmlmemlist.tpl new file mode 100644 index 0000000..30b4789 --- /dev/null +++ b/templates/html/htmlmemlist.tpl @@ -0,0 +1,15 @@ +{# input: memberListInfo #} +{% if memberListInfo %} + {% if memberListInfo.members|length>0 or memberListInfo.memberGroups|length>0 %} + {% for member in memberListInfo.members %} + {% include 'htmlmemdecl.tpl' %} + {% endfor %} + {% for memgroup in memberListInfo.memberGroups %} + {% with memberListInfo=memgroup inheritId='' %} + {% for member in memberListInfo.members %} + {% include 'htmlmemdecl.tpl' %} + {% endfor %} + {% endwith %} + {% endfor %} + {% endif %} +{% endif %} diff --git a/templates/html/htmlmemsummary.tpl b/templates/html/htmlmemsummary.tpl new file mode 100644 index 0000000..6b7481e --- /dev/null +++ b/templates/html/htmlmemsummary.tpl @@ -0,0 +1,7 @@ +{% if memberListInfo %} + {% if memberListInfo.members|length>0 %} + {% if not first %} | {% endif %} + {{ memberListInfo.title }} + {% set first=False %} + {% endif %} +{% endif %} diff --git a/templates/html/htmlmodule.tpl b/templates/html/htmlmodule.tpl new file mode 100644 index 0000000..ff97b2c --- /dev/null +++ b/templates/html/htmlmodule.tpl @@ -0,0 +1,310 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML output for module {{ compound.name }}{% endmsg %} + +{% block navpath %} +{% with navpath=compound.navigationPath %} + {% include 'htmlnavpath.tpl' %} +{% endwith %} +{% endblock %} + +{% block title %} + {# write summary links in the title area #} +
+ {% with first=True %} + {% if compound.modules %} + {{ tr.modules }} + {% set first=False %} + {% endif %} + {% if compound.dirs %} + {{ tr.dirs }} + {% set first=False %} + {% endif %} + {% if compound.files %} + {{ tr.files }} + {% set first=False %} + {% endif %} + {% if compound.classes %} + {{ tr.classes }} + {% set first=False %} + {% endif %} + {% if compound.namespaces %} + {% if not first %} | {% endif %} + {{ tr.namespaces }} + {% set first=False %} + {% endif %} + {% if compound.constantgroups %} + {% if not first %} | {% endif %} + {{ tr.constantgroups }} + {% set first=False %} + {% endif %} + {% with memberListInfo=compound.macros %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.typedefs %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.enums %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.enumvalues %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.functions %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.variables %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.signals %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.publicSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.protectedSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.privateSlots %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.events %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.properties %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.friends %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% endwith %} +
+ {{ block.super }} +{% endblock %} + +{% block content %} +
+{# brief description #} + {% if compound.brief %} + {{ compound.brief }} + {% if compound.hasDetails %} + {{ tr.more }} + {% endif %} + {% endif %} +{# group graph #} + {% if compound.hasGroupGraph %} + {% with obj=compound %} + {% include 'htmldynheader.tpl' %} + {% endwith %} + {{ tr.collaborationDiagramFor:compound.name }} +
+ {% with obj=compound %} + {% include 'htmldyncontents.tpl' %} + {% endwith %} + {{ compound.groupGraph }} + + {% endif %} +{# member declarations #} + {# modules #} + {% with list=compound.modules label='modules' title=tr.modules local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# dirs #} + {% with list=compound.dirs, label='dirs' title=tr.directories local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# files #} + {% with list=compound.files, label='files' title=tr.files local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# namespaces #} + {% with list=compound.namespaces, label='namespaces' title=tr.namespaces local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# classes #} + {% with list=compound.classes label='classes' title=tr.classes local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# constantgroups #} + {% with list=compound.constantgroups, label='constantgroups' title=tr.constantgroups local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# defines #} + {% with memberListInfo=compound.macros %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# typedefs #} + {% with memberListInfo=compound.typedefs %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# enums #} + {% with memberListInfo=compound.enums %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# enum values #} + {% with memberListInfo=compound.enumvalues %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# functions #} + {% with memberListInfo=compound.functions %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# variables #} + {% with memberListInfo=compound.variables %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# signals #} + {% with memberListInfo=compound.signals %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# public slots #} + {% with memberListInfo=compound.publicSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# protected slots #} + {% with memberListInfo=compound.protectedSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# private slots #} + {% with memberListInfo=compound.privateSlots %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# private events #} + {% with memberListInfo=compound.events %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# private properties #} + {% with memberListInfo=compound.properties %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# private friends #} + {% with memberListInfo=compound.friends %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# membergroups #} + {% if compound.memberGroups %} + {% for memberListInfo in compound.memberGroups %} + {% include 'htmlmemdecls.tpl' %} + {% endfor %} + {% endif %} +{# end member declarations #} +{# detailed description #} +{% if compound.hasDetails %} + {# anchor #} + + {# header #} +

{{ tr.detailedDesc }}

+
+ {# brief #} + {% if compound.brief and config.REPEAT_BRIEF %} +

+ {{ compound.brief }} +

+ {% endif %} + {# details #} + {{ compound.details }} + {# source definition #} + {% if compound.sourceDef %} + {% markers obj in compound.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} +
+{% endif %} +{# member definitions #} + {# inline classes #} + {% if compound.inlineClasses %} +

{{ tr.classDocumentation }}

+ {% for class in compound.inlineClasses %} + {# write anchor #} + +
+
+ + +
{{ class.compoundType }} {{ class.name }}
+
+
+
+ {# TODO: the stuff inside textblock can be the same as in htmlclass.tpl!! #} + {# template specifier #} + {% if class.language=='cpp' and class.templateDecls %} +

{% spaceless %} + {% for targList in class.templateDecls %} + template< + {% for targ in targList %} + {{ targ.type }}{% if targ.name %} {{ targ.name }}{% endif %}{% if targ.defVal %} = {{ targ.defVal }}{% endif %}{% if not forloop.last %}, {% endif %} + {% endfor %} + >
+ {% endfor %} + {% endspaceless %} + {{ class.classType }} {{ class.name }} +

+ {% endif %} + {# brief description #} + {% if class.brief and config.REPEAT_BRIEF %} +

{{ class.brief }}

+ {% endif %} + {# detailed docs #} + {{ class.details }} + {# source def #} + {% if class.sourceDef %} + {% markers obj in class.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} +
+ {# table with fields #} + + + {% for member in class.members %} + + + + + {% endfor %} +
{{ tr.compoundMembers }}
+ {{ member.fieldType }} + + {{ member.name }} + {% if member.isVariable and member.declArgs %}{{ member.declArgs }}{% endif %} + {{ member.bitfields }} + + {% if member.brief and not member.details %}{# only brief #} + {{ member.brief }} + {% else %} {# only details or both #} + {% if member.brief %}

{{ member.brief }}

{% endif %} + {{ member.details }} + {% endif %} +
+
+
+ {% endfor %} + {% endif %} + {# defines #} + {% with memberListInfo=compound.detailedMacros %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# typedefs #} + {% with memberListInfo=compound.detailedTypedefs %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# enums #} + {% with memberListInfo=compound.detailedEnums %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# functions #} + {% with memberListInfo=compound.detailedFunctions %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# variables #} + {% with memberListInfo=compound.detailedVariables %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} +{# end member definitions #} + +{% endblock %} + diff --git a/templates/html/htmlmodules.tpl b/templates/html/htmlmodules.tpl new file mode 100644 index 0000000..f19c225 --- /dev/null +++ b/templates/html/htmlmodules.tpl @@ -0,0 +1,15 @@ +{% extend 'htmlbase.tpl' %} +{% block content %} +
+
+{{ tr.modulesDescription }} +
+{% indexentry nav name=tr.modules file=page.fileName anchor='' %} +{% opensubindex nav %} +{% with tree=moduleTree %} + {% include 'htmldirtree.tpl' %} +{% endwith %} +{% closesubindex nav %} +
+{% endblock %} + diff --git a/templates/html/htmlnamespace.tpl b/templates/html/htmlnamespace.tpl new file mode 100644 index 0000000..e21ba9d --- /dev/null +++ b/templates/html/htmlnamespace.tpl @@ -0,0 +1,206 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML output for namespace {{ compound.name }}{% endmsg %} + +{% block navpath %} +{% with navpath=compound.navigationPath %} + {% include 'htmlnavpath.tpl' %} +{% endwith %} +{% endblock %} + +{% block title %} + {# write summary links in the title area #} +
+ {% with first=True %} + {% if compound.classes %} + {{ tr.classes }} + {% set first=False %} + {% endif %} + {% if compound.namespaces %} + {% if not first %} | {% endif %} + {{ tr.namespaces }} + {% set first=False %} + {% endif %} + {% if compound.constantgroups %} + {% if not first %} | {% endif %} + {{ tr.constantgroups }} + {% set first=False %} + {% endif %} + {% with memberListInfo=compound.typedefs %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.enums %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.functions %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% with memberListInfo=compound.variables %} + {% include 'htmlmemsummary.tpl' %} + {% endwith %} + {% endwith %} +
+ {{ block.super }} +{% endblock %} + +{% block content %} +
+{# brief description #} + {% if compound.brief %} + {{ compound.brief }} + {% if compound.hasDetails %} + {{ tr.more }} + {% endif %} + {% endif %} +{# member declarations #} + {# classes #} + {% with list=compound.classes label='nested-classes' title=tr.classes local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# namespaces #} + {% with list=compound.namespaces, label='namespaces' title=tr.namespaces local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# constantgroups #} + {% with list=compound.constantgroups, label='constantgroups' title=tr.constantgroups local=False %} + {% include 'htmldeclcomp.tpl' %} + {% endwith %} + {# typedefs #} + {% with memberListInfo=compound.typedefs %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# enums #} + {% with memberListInfo=compound.enums %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# functions #} + {% with memberListInfo=compound.functions %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# variables #} + {% with memberListInfo=compound.variables %} + {% include 'htmlmemdecls.tpl' %} + {% endwith %} + {# membergroups #} + {% if compound.memberGroups %} + {% for memberListInfo in compound.memberGroups %} + {% include 'htmlmemdecls.tpl' %} + {% endfor %} + {% endif %} +{# end member declarations #} +{# detailed description #} +{% if compound.hasDetails %} + {# anchor #} + + {# header #} +

{{ tr.detailedDesc }}

+
+ {# brief #} + {% if compound.brief and config.REPEAT_BRIEF %} +

+ {{ compound.brief }} +

+ {% endif %} + {# details #} + {{ compound.details }} + {# source definition #} + {% if compound.sourceDef %} + {% markers obj in compound.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} +
+{% endif %} +{# member definitions #} + {# inline classes #} + {% if compound.inlineClasses %} +

{{ tr.classDocumentation }}

+ {% for class in compound.inlineClasses %} + {# write anchor #} + +
+
+ + +
{{ class.compoundType }} {{ class.name }}
+
+
+
+ {# TODO: the stuff inside textblock can be the same as in htmlclass.tpl!! #} + {# template specifier #} + {% if class.language=='cpp' and class.templateDecls %} +

{% spaceless %} + {% for targList in class.templateDecls %} + template< + {% for targ in targList %} + {{ targ.type }}{% if targ.name %} {{ targ.name }}{% endif %}{% if targ.defVal %} = {{ targ.defVal }}{% endif %}{% if not forloop.last %}, {% endif %} + {% endfor %} + >
+ {% endfor %} + {% endspaceless %} + {{ class.classType }} {{ class.name }} +

+ {% endif %} + {# brief description #} + {% if class.brief and config.REPEAT_BRIEF %} +

{{ class.brief }}

+ {% endif %} + {# detailed docs #} + {{ class.details }} + {# source def #} + {% if class.sourceDef %} + {% markers obj in class.sourceDef with tr.definedAtLineInSourceFile %} + {% with text=obj.text %} + {% include 'htmlobjlink.tpl' %} + {% endwith %} + {% endmarkers %} + {% endif %} +
+ {# table with fields #} + + + {% for member in class.members %} + + + + + {% endfor %} +
{{ tr.compoundMembers }}
+ {{ member.fieldType }} + + {{ member.name }} + {% if member.isVariable and member.declArgs %}{{ member.declArgs }}{% endif %} + {{ member.bitfields }} + + {% if member.brief and not member.details %}{# only brief #} + {{ member.brief }} + {% else %} {# only details or both #} + {% if member.brief %}

{{ member.brief }}

{% endif %} + {{ member.details }} + {% endif %} +
+
+
+ {% endfor %} + {% endif %} + {# typedefs #} + {% with memberListInfo=compound.detailedTypedefs %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# enums #} + {% with memberListInfo=compound.detailedEnums %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# functions #} + {% with memberListInfo=compound.detailedFunctions %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} + {# variables #} + {% with memberListInfo=compound.detailedVariables %} + {% include 'htmlmemdef.tpl' %} + {% endwith %} +{# end member definitions #} +
+{% endblock %} + diff --git a/templates/html/htmlnamespaces.tpl b/templates/html/htmlnamespaces.tpl new file mode 100644 index 0000000..4767d13 --- /dev/null +++ b/templates/html/htmlnamespaces.tpl @@ -0,0 +1,15 @@ +{% extend 'htmlbase.tpl' %} +{% block content %} +
+
+{{ tr.namespaceListDescription }} +
+{% indexentry nav name=tr.namespaceList file=page.fileName anchor='' %} +{% opensubindex nav %} +{% with tree=namespaceTree %} + {% include 'htmldirtree.tpl' %} +{% endwith %} +{% closesubindex nav %} +
+{% endblock %} + diff --git a/templates/html/htmlnavpath.tpl b/templates/html/htmlnavpath.tpl new file mode 100644 index 0000000..5df06e1 --- /dev/null +++ b/templates/html/htmlnavpath.tpl @@ -0,0 +1,14 @@ +{# input: navpath which is a list of links #} +{% if navpath %} + +{% endif %} diff --git a/templates/html/htmlnavtree.tpl b/templates/html/htmlnavtree.tpl new file mode 100644 index 0000000..8da89a2 --- /dev/null +++ b/templates/html/htmlnavtree.tpl @@ -0,0 +1,22 @@ +var NAVTREE = +[ + [ "{% if mainPage.title %}mainPage.title|jsstring{% else %}{{ tr.mainPage }}{% endif %}", + "index{{ config.HTML_FILE_EXTENSION }}", + ] +]; + +var NAVTREEINDEX = +[ +{# write first entry of each sub index #} +{% for entries in navTree.subindices %} + "{{ entries[0].url }}"{% if not forloop.last %},{% endif %} +{% endfor %} + ] +]; + +{# write all sub indices #} +{% for entries in navTree.subindices %} + {% with idx=forloop.counter0 %} + {% create idx|prepend:'navtreeindex'|append:'.js' from htmlnavindex.tpl' %} + {% endwith %} +{% endfor %} diff --git a/templates/html/htmlnsmembers.tpl b/templates/html/htmlnsmembers.tpl new file mode 100644 index 0000000..3f4c0bd --- /dev/null +++ b/templates/html/htmlnsmembers.tpl @@ -0,0 +1,20 @@ +{# inputs: page, list #} +{% extend 'htmlbase.tpl' %} +{% block tabs %} +{{ block.super }} +{% include 'htmlmembertabs.tpl' %} +{% endblock %} + +{% block content %} +
+
+{% if section=='' and letter=='' %} + {{ tr.namespaceMembersDescription }} +{% endif %} + +{% include 'htmlmemberindex.tpl' %} + +
+
+{% endblock %} + diff --git a/templates/html/htmlnsmembersindex.tpl b/templates/html/htmlnsmembersindex.tpl new file mode 100644 index 0000000..dc3bfd4 --- /dev/null +++ b/templates/html/htmlnsmembersindex.tpl @@ -0,0 +1,26 @@ +{% with page=namespaceMembersIndex %} + {# all members #} + {% with list=namespaceMembersIndex.all section='' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# functions #} + {% with list=namespaceMembersIndex.functions section='_func' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# variables #} + {% with list=namespaceMembersIndex.variables section='_vars' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# typedefs #} + {% with list=namespaceMembersIndex.typedefs section='_type' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# enums #} + {% with list=namespaceMembersIndex.enums section='_enum' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} + {# enumValues #} + {% with list=namespaceMembersIndex.enumValues section='_eval' template='htmlnsmembers.tpl' %} + {% include 'htmlindexpages.tpl' %} + {% endwith %} +{% endwith %} diff --git a/templates/html/htmlobjlink.tpl b/templates/html/htmlobjlink.tpl new file mode 100644 index 0000000..51a281f --- /dev/null +++ b/templates/html/htmlobjlink.tpl @@ -0,0 +1,6 @@ +{# inputs: obj (with .isLinkable .anchor .fileName), text, config, page.relPath #} +{% if obj.isLinkable %} +{{ text }} +{% else %} +{{ text }} +{% endif %} diff --git a/templates/html/htmlpage.tpl b/templates/html/htmlpage.tpl new file mode 100644 index 0000000..1e6a5b1 --- /dev/null +++ b/templates/html/htmlpage.tpl @@ -0,0 +1,14 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML output for page {{ compound.name }}{% endmsg %} + +{% block navpath %} +{% with navpath=compound.navigationPath %} + {% include 'htmlnavpath.tpl' %} +{% endwith %} +{% endblock %} + +{% block content %} +
+{{ compound.details }} +
+{% endblock %} diff --git a/templates/html/htmlpages.tpl b/templates/html/htmlpages.tpl new file mode 100644 index 0000000..cc00bf5 --- /dev/null +++ b/templates/html/htmlpages.tpl @@ -0,0 +1,15 @@ +{% extend 'htmlbase.tpl' %} +{% block content %} +
+
+{{ tr.relatedPagesDesc }} +
+{% indexentry nav name=tr.pages file=page.fileName anchor='' %} +{% opensubindex nav %} +{% with tree=pageTree %} + {% include 'htmldirtree.tpl' %} +{% endwith %} +{% closesubindex nav %} +
+{% endblock %} + diff --git a/templates/html/htmlsource.tpl b/templates/html/htmlsource.tpl new file mode 100644 index 0000000..cb4e65d --- /dev/null +++ b/templates/html/htmlsource.tpl @@ -0,0 +1,37 @@ +{% extend 'htmlbase.tpl' %} +{% msg %}Generating HTML source code for file {{ compound.name }}{% endmsg %} + +{% block navpath %} + {% if compound.navigationPath %} + + {% endif %} +{% endblock %} + +{% block title %} + {# write summary links in the title area #} +
{{ compound.name }} + {% if compound.version %} ({{ compound.version }}){% endif %} +
+{% endblock %} + +{% block content %} +
+
+{{ tr.gotoDocumentation }} +
+
+{{ compound.sources }} +
+
+{% endblock %} + diff --git a/templates/html/htmltabs.tpl b/templates/html/htmltabs.tpl new file mode 100644 index 0000000..90c62b4 --- /dev/null +++ b/templates/html/htmltabs.tpl @@ -0,0 +1,92 @@ +{# main navigation row #} + +{# second navigation row #} + diff --git a/templates/html/htmltypeconstraints.tpl b/templates/html/htmltypeconstraints.tpl new file mode 100644 index 0000000..12c9581 --- /dev/null +++ b/templates/html/htmltypeconstraints.tpl @@ -0,0 +1,13 @@ +{# obj should be a class or member #} +{% if obj.typeConstraints|length>0 %} +
+
{{ tr.typeConstraints }}
+
+ {% for arg in obj.typeConstraints %} + + + + + {% endfor %} +
{{ arg.name }} {{ arg.type }} {{ arg.docs }}
+{% endif %} diff --git a/templates/html/jquery.js b/templates/html/jquery.js new file mode 100644 index 0000000..1f4d0b4 --- /dev/null +++ b/templates/html/jquery.js @@ -0,0 +1,68 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b40){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b40&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b21?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv
a";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="
";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="
t
";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="
";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bCbA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bRe[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="

";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="
";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT0){for(bB=bA;bB=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/",""],legend:[1,"
","
"],thead:[1,"","
"],tr:[2,"","
"],td:[3,"","
"],col:[2,"","
"],area:[1,"",""],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div
","
"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1>");try{for(var bw=0,bv=this.length;bw1&&bw0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]===""&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length;if(bA>0){if(bv!=="border"){for(;bx)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("
").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"":"")+"");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*! + * jQuery UI 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*! + * jQuery UI Widget 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*! + * jQuery UI Mouse 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('
').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g
');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(hl.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*! + * jQuery hashchange event - v1.3 - 7/21/2010 + * http://benalman.com/projects/jquery-hashchange-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ +(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('