diff options
author | Aaron Kennedy <aaron.kennedy@nokia.com> | 2010-05-14 03:45:57 (GMT) |
---|---|---|
committer | Aaron Kennedy <aaron.kennedy@nokia.com> | 2010-05-14 03:45:57 (GMT) |
commit | 677d06cecb44c482c72d1e987e3f923a73fcedd2 (patch) | |
tree | d54f137eca7945796c36a881cceba4a4550ff9a9 | |
parent | 645b9ee9dd6e0576542cc61872ecedb408ca8a89 (diff) | |
parent | 5cd963d2628ed7c01d331cdad03b4d77161c8b93 (diff) | |
download | Qt-677d06cecb44c482c72d1e987e3f923a73fcedd2.zip Qt-677d06cecb44c482c72d1e987e3f923a73fcedd2.tar.gz Qt-677d06cecb44c482c72d1e987e3f923a73fcedd2.tar.bz2 |
Merge branch '4.7' of scm.dev.nokia.troll.no:qt/qt-qml into 4.7
166 files changed, 1890 insertions, 1265 deletions
diff --git a/demos/declarative/webbrowser/content/FlickableWebView.qml b/demos/declarative/webbrowser/content/FlickableWebView.qml index 7efbaa3..32d69d8 100644 --- a/demos/declarative/webbrowser/content/FlickableWebView.qml +++ b/demos/declarative/webbrowser/content/FlickableWebView.qml @@ -12,8 +12,8 @@ Flickable { id: flickable width: parent.width - contentWidth: Math.max(parent.width,webView.width*webView.scale) - contentHeight: Math.max(parent.height,webView.height*webView.scale) + contentWidth: Math.max(parent.width,webView.width) + contentHeight: Math.max(parent.height,webView.height) anchors.top: headerSpace.bottom anchors.bottom: parent.top anchors.left: parent.left @@ -28,7 +28,6 @@ Flickable { WebView { id: webView - pixelCacheSize: 4000000 transformOrigin: Item.TopLeft function fixUrl(url) @@ -48,8 +47,6 @@ Flickable { url: fixUrl(webBrowser.urlString) smooth: false // We don't want smooth scaling, since we only scale during (fast) transitions - smoothCache: true // We do want smooth rendering - fillColor: "white" focus: true zoomFactor: 1 @@ -59,14 +56,13 @@ Flickable { { if (centerX) { var sc = zoom/contentsScale; - scaleAnim.to = sc; + scaleAnim.to = zoom; flickVX.from = flickable.contentX flickVX.to = Math.max(0,Math.min(centerX-flickable.width/2,webView.width*sc-flickable.width)) finalX.value = flickVX.to flickVY.from = flickable.contentY flickVY.to = Math.max(0,Math.min(centerY-flickable.height/2,webView.height*sc-flickable.height)) finalY.value = flickVY.to - finalZoom.value = zoom quickZoom.start() } } @@ -74,8 +70,8 @@ Flickable { Keys.onLeftPressed: webView.contentsScale -= 0.1 Keys.onRightPressed: webView.contentsScale += 0.1 - preferredWidth: flickable.width*zoomFactor - preferredHeight: flickable.height*zoomFactor + preferredWidth: flickable.width + preferredHeight: flickable.height contentsScale: 1/zoomFactor onContentsSizeChanged: { // zoom out @@ -108,9 +104,8 @@ Flickable { NumberAnimation { id: scaleAnim target: webView - property: "scale" - from: 1 - to: 0 // set before calling + property: "contentsScale" + // the to property is set before calling easing.type: Easing.Linear duration: 200 } @@ -133,16 +128,6 @@ Flickable { to: 0 // set before calling } } - PropertyAction { - id: finalZoom - target: webView - property: "contentsScale" - } - PropertyAction { - target: webView - property: "scale" - value: 1.0 - } // Have to set the contentXY, since the above 2 // size changes may have started a correction if // contentsScale < 1.0. diff --git a/examples/declarative/declarative.pro b/examples/declarative/declarative.pro index ba9b628..913b2b0 100644 --- a/examples/declarative/declarative.pro +++ b/examples/declarative/declarative.pro @@ -37,6 +37,7 @@ sources.files = \ scrollbar \ searchbox \ slideswitch \ + spinner \ sql \ states \ tabwidget \ diff --git a/examples/declarative/spinner/content/Spinner.qml b/examples/declarative/spinner/content/Spinner.qml new file mode 100644 index 0000000..8145a28 --- /dev/null +++ b/examples/declarative/spinner/content/Spinner.qml @@ -0,0 +1,25 @@ +import Qt 4.7 + +Image { + property alias model: view.model + property alias delegate: view.delegate + property alias currentIndex: view.currentIndex + property real itemHeight: 30 + source: "spinner-bg.png" + clip: true + PathView { + id: view + anchors.fill: parent + pathItemCount: height/itemHeight + preferredHighlightBegin: 0.5 + preferredHighlightEnd: 0.5 + highlight: Image { source: "spinner-select.png"; width: view.width; height: itemHeight+4 } + dragMargin: view.width/2 + path: Path { + startX: view.width/2; startY: -itemHeight/2 + PathLine { x: view.width/2; y: view.pathItemCount*itemHeight + itemHeight } + } + } + Keys.onDownPressed: view.incrementCurrentIndex() + Keys.onUpPressed: view.decrementCurrentIndex() +} diff --git a/examples/declarative/spinner/content/spinner-bg.png b/examples/declarative/spinner/content/spinner-bg.png Binary files differnew file mode 100644 index 0000000..b3556f1 --- /dev/null +++ b/examples/declarative/spinner/content/spinner-bg.png diff --git a/examples/declarative/spinner/content/spinner-select.png b/examples/declarative/spinner/content/spinner-select.png Binary files differnew file mode 100644 index 0000000..95a17a1 --- /dev/null +++ b/examples/declarative/spinner/content/spinner-select.png diff --git a/examples/declarative/spinner/main.qml b/examples/declarative/spinner/main.qml new file mode 100644 index 0000000..6be567a --- /dev/null +++ b/examples/declarative/spinner/main.qml @@ -0,0 +1,18 @@ +import Qt 4.7 +import "content" + +Rectangle { + width: 240; height: 320 + Column { + y: 20; x: 20; spacing: 20 + Spinner { + id: spinner + width: 200; height: 240 + focus: true + model: 20 + itemHeight: 30 + delegate: Text { font.pixelSize: 25; text: index; height: 30 } + } + Text { text: "Current item index: " + spinner.currentIndex } + } +} diff --git a/examples/declarative/spinner/spinner.qmlproject b/examples/declarative/spinner/spinner.qmlproject new file mode 100644 index 0000000..d4909f8 --- /dev/null +++ b/examples/declarative/spinner/spinner.qmlproject @@ -0,0 +1,16 @@ +import QmlProject 1.0 + +Project { + /* Include .qml, .js, and image files from current directory and subdirectories */ + QmlFiles { + directory: "." + } + JavaScriptFiles { + directory: "." + } + ImageFiles { + directory: "." + } + /* List of plugin directories passed to QML runtime */ + // importPaths: [ " ../exampleplugin " ] +} diff --git a/src/3rdparty/webkit/.tag b/src/3rdparty/webkit/.tag index 75fc5e7..d8b4b32 100644 --- a/src/3rdparty/webkit/.tag +++ b/src/3rdparty/webkit/.tag @@ -1 +1 @@ -b4aa5e1ddc41edab895132aba3cc66d9d7129444 +57d10d5c05e59bbf7de8189ff47dd18d1be996dc diff --git a/src/3rdparty/webkit/JavaScriptCore/ChangeLog b/src/3rdparty/webkit/JavaScriptCore/ChangeLog index 1439ae0..97176ef 100644 --- a/src/3rdparty/webkit/JavaScriptCore/ChangeLog +++ b/src/3rdparty/webkit/JavaScriptCore/ChangeLog @@ -1,3 +1,26 @@ +2010-05-10 Laszlo Gombos <laszlo.1.gombos@nokia.com> + + Reviewed by Darin Adler. + + [Qt] Disable JIT support for mingw-w64 + https://bugs.webkit.org/show_bug.cgi?id=38747 + + Disale JIT for mingw-w64 as it is reportedly + unstable. + + Thanks for Vanboxem Rruben for the investigation. + + * wtf/Platform.h: + +2010-05-06 Laszlo Gombos <laszlo.1.gombos@nokia.com> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] Enable YARR_JIT for X86 Mac for QtWebKit + https://bugs.webkit.org/show_bug.cgi?id=38668 + + * wtf/Platform.h: + 2010-05-02 Laszlo Gombos <laszlo.1.gombos@nokia.com> Reviewed by Eric Seidel. diff --git a/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h b/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h index c582905..8d98765 100644 --- a/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h +++ b/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h @@ -927,8 +927,6 @@ on MinGW. See https://bugs.webkit.org/show_bug.cgi?id=29268 */ #elif CPU(X86) && OS(WINDOWS) && COMPILER(MINGW) && GCC_VERSION >= 40100 #define ENABLE_JIT 1 #define WTF_USE_JIT_STUB_ARGUMENT_VA_LIST 1 -#elif CPU(X86_64) && OS(WINDOWS) && COMPILER(MINGW64) && GCC_VERSION >= 40100 - #define ENABLE_JIT 1 #elif CPU(X86) && OS(WINDOWS) && COMPILER(MSVC) #define ENABLE_JIT 1 #define WTF_USE_JIT_STUB_ARGUMENT_REGISTER 1 @@ -1011,7 +1009,9 @@ on MinGW. See https://bugs.webkit.org/show_bug.cgi?id=29268 */ || (CPU(X86_64) && OS(LINUX) && GCC_VERSION >= 40100) \ || (CPU(ARM_TRADITIONAL) && OS(LINUX)) \ || (CPU(ARM_TRADITIONAL) && OS(SYMBIAN) && COMPILER(RVCT)) \ - || (CPU(MIPS) && OS(LINUX)) + || (CPU(MIPS) && OS(LINUX)) \ + || (CPU(X86) && OS(DARWIN)) \ + || (CPU(X86_64) && OS(DARWIN)) #define ENABLE_YARR 1 #define ENABLE_YARR_JIT 1 #endif diff --git a/src/3rdparty/webkit/VERSION b/src/3rdparty/webkit/VERSION index 98debf6..c8c2aa3 100644 --- a/src/3rdparty/webkit/VERSION +++ b/src/3rdparty/webkit/VERSION @@ -4,4 +4,4 @@ This is a snapshot of the Qt port of WebKit from and has the sha1 checksum - 07b60cf799680fcfb7785ee88e14f8030a5dbfa2 + dc5821c3df2ef60456d85263160852f5335cf946 diff --git a/src/3rdparty/webkit/WebCore/ChangeLog b/src/3rdparty/webkit/WebCore/ChangeLog index 6617b66..76b4eff 100644 --- a/src/3rdparty/webkit/WebCore/ChangeLog +++ b/src/3rdparty/webkit/WebCore/ChangeLog @@ -1,3 +1,265 @@ +2010-04-29 James Robinson <jamesr@chromium.org> + + Reviewed by Simon Fraser. + + Calls FrameView::scrollPositionChanged whenever a ScrollView is scrolled + https://bugs.webkit.org/show_bug.cgi?id=38286 + + When a ScrollView's scroll position is changed, we have to call + FrameView::scrollPositionChanged to generate repaint invalidation for + fixed position elements. This ends up getting called indirectly when + the ScrollView has a platformWidget through the port layer + (see WebHTMLView.mm's _frameOrBoundsChanged method for how the mac + port does it) but not when there is no platformWidget. + + This is tested by the fast/repaint/fixed-* tests when run in pixel + mode. + + Test: fast/repaint/fixed-move-after-keyboard-scroll.html + + * page/FrameView.h: + * platform/ScrollView.cpp: + (WebCore::ScrollView::valueChanged): + * platform/ScrollView.h: + (WebCore::ScrollView::scrollPositionChanged): + +2010-04-23 Kenneth Rohde Christiansen <kenneth@webkit.org> + + Unreviewed build fix. + + Change Media to StyleMedia + + * DerivedSources.make: + +2010-04-22 Kenneth Rohde Christiansen <kenneth@webkit.org> + + Reviewed by Laszlo Gombos. + + Rename window.media to window.styleMedia + https://bugs.webkit.org/show_bug.cgi?id=36187 + + Rename the interface Media to StyleMedia as required by the + new CSSOM View spec. + + * Android.derived.jscbindings.mk: + * Android.derived.v8bindings.mk: + * GNUmakefile.am: + * WebCore.gypi: + * WebCore.pri: + * WebCore.pro: + * WebCore.vcproj/WebCore.vcproj: + * WebCore.xcodeproj/project.pbxproj: + * css/Media.cpp: Removed. + * css/Media.h: Removed. + * css/Media.idl: Removed. + * css/StyleMedia.cpp: Added. + (WebCore::StyleMedia::StyleMedia): + (WebCore::StyleMedia::type): + (WebCore::StyleMedia::matchMedium): + * css/StyleMedia.h: Added. + (WebCore::StyleMedia::create): + (WebCore::StyleMedia::disconnectFrame): + * css/StyleMedia.idl: Added. + * page/DOMWindow.cpp: + (WebCore::DOMWindow::styleMedia): + * page/DOMWindow.h: + (WebCore::DOMWindow::optionalMedia): + * page/DOMWindow.idl: + +2010-04-22 Kenneth Rohde Christiansen <kenneth@webkit.org> + + Reviewed by Simon Fraser. + + Rename window.media to window.styleMedia + https://bugs.webkit.org/show_bug.cgi?id=36187 + + It has been defined that the AbstractView media extension + defined in the CSSOM View spec should be renamed to styleMedia. + This patch does that and updates the current layout tests + making use of it. + + * page/AbstractView.idl: + * page/DOMWindow.cpp: + (WebCore::DOMWindow::styleMedia): + * page/DOMWindow.h: + * page/DOMWindow.idl: + +2010-05-11 Benjamin Poulain <benjamin.poulain@nokia.com> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] fast/text/find-hidden-text.html + https://bugs.webkit.org/show_bug.cgi?id=32922 + + Use the real page step for populating the QStyleOption otherwhise + the size can be negative, which can break the QStyle used. + + * platform/qt/ScrollbarThemeQt.cpp: + (WebCore::styleOptionSlider): + +2010-05-03 Antonio Gomes <tonikitoo@webkit.org> + + Reviewed by Kenneth Christiansen. + + Spatial Navigation: create a getter for the "fudgeFactor" + https://bugs.webkit.org/show_bug.cgi?id=38488 + + A couple of places in the Spatial Navigation code make use of a "fudge factor" + to improve precision by working around outline focus metrics and such. Patch adds + a helper method for unify getter operations of this value, instead of having it + declared locally in the various methods it is used. + + No behaviour change. + + * page/SpatialNavigation.cpp: + (WebCore::scrollIntoView): + (WebCore::deflateIfOverlapped): + * page/SpatialNavigation.h: + (WebCore::fudgeFactor): + +2010-05-10 Markus Goetz <Markus.Goetz@nokia.com> + + Reviewed by Simon Hausmann. + + Qt after 4.6.3 has its integrated DNS cache. Therefore some + code is not necessary anymore. + + https://bugs.webkit.org/show_bug.cgi?id=38834 + + * platform/network/qt/DnsPrefetchHelper.h: + (WebCore::DnsPrefetchHelper::lookup): + (WebCore::DnsPrefetchHelper::lookedUp): + +2010-05-06 Laszlo Gombos <laszlo.1.gombos@nokia.com> + + Unreviewed, build fix WinCE for QtWebKit. + + [Qt] Compilation with Plugins disabled is broken + https://bugs.webkit.org/show_bug.cgi?id=31407 + + Rename platform/qt/TemporaryLinkStubs.cpp to avoid name collition on + Windows. + + Thanks for Ismail "cartman" Donmez for help. + + No new tests, as there is no new functionality. + + * WebCore.gypi: + * WebCore.pro: + * platform/qt/TemporaryLinkStubs.cpp: Removed. + * platform/qt/TemporaryLinkStubsQt.cpp: Copied from WebCore/platform/qt/TemporaryLinkStubs.cpp. + +2010-04-23 Qi Zhang <qi.2.zhang@nokia.com> + + Reviewed by Laszlo Gombos. + + [Qt] LayoutTests/fast/canvas/pointInPath.html passed, actually it failed + https://bugs.webkit.org/show_bug.cgi?id=37276 + + QPainterPath::contains doesn't count the point on the bound. + + * platform/graphics/qt/PathQt.cpp: + (WebCore::isPointOnPathBorder): + (WebCore::Path::contains): + +2010-05-07 Tor Arne Vestbø <tor.arne.vestbo@nokia.com> + + Reviewed by Simon Hausmann. + + [Qt] Fix rendering of -webkit-user-select: none + + -webkit-user-select: none is implemented by filling + the area with an invalid default-constructed Color. + In most ports passing an invalid color down to the + graphics backend seems to produce transparent fills. + + In Qt the behavior of painting with an invalid QColor + is undefined, and in practice it results in painting + black opaque areas. + + One way to fix this would be to use Qt::transparent + when converting an undefined Color to a QColor, but + Qt does not have short circuits for fully transparent + painting, and we actually end up in slow code paths + due to the transparency. So, we're better of doing the + short circuit in WebKit. + + https://bugs.webkit.org/show_bug.cgi?id=38523 + + * platform/graphics/qt/GraphicsContextQt.cpp: + +2010-04-05 Robert Hogan <robert@webkit.org> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] Fix infinite redirection loop in QNetworkReplyHandler + + Put a maximum on consecutive redirections so we don't have to + worry about whether it's the same url or not. + + Tolerate up to 10 consecutive redirections, anything beyond + that is considered a potentially infinite recursion in the + redirection requests. This is the same behaviour as Firefox. + + https://bugs.webkit.org/show_bug.cgi?id=37097 + + * platform/network/qt/QNetworkReplyHandler.cpp: + (WebCore::QNetworkReplyHandler::QNetworkReplyHandler): + (WebCore::QNetworkReplyHandler::sendResponseIfNeeded): + * platform/network/qt/QNetworkReplyHandler.h: + +2010-04-05 Robert Hogan <robert@webkit.org> + + Reviewed by Kenneth Rohde-Christiansen. + + [Qt] Fix infinite redirection loop in QNetworkReplyHandler + + Qt enters an infinite loop if a redirect response redirects to itself. + + Fixes http/tests/xmlhttprequest/connection-error-sync.html + + https://bugs.webkit.org/show_bug.cgi?id=37097 + + * platform/network/qt/QNetworkReplyHandler.cpp: + (WebCore::QNetworkReplyHandler::sendResponseIfNeeded): + +2010-05-07 Ben Murdoch <benm@google.com> + + Reviewed by Darin Adler. + + Potential crash in EventHandler::handleTouchEvent + https://bugs.webkit.org/show_bug.cgi?id=38646 + + Fix a ref counting bug that can cause a crash if the m_originatingouchPointTargets + hashmap holds the last ref to an EventTarget when the user lifts their finger. + + This is very hard to reproduce in a consistent way and clearly a + simple logic error in the code, therefore no new tests. + + * page/EventHandler.cpp: + (WebCore::EventHandler::handleTouchEvent): Don't let the RefPtr we get back from + the hasmap go out of scope so soon as it could delete the wrapped ptr if the + hashmap held the last ref (and we use the raw ptr that the RefPtr + wraps later in the WebCore::Touch constructor). + +2010-05-04 Ben Murdoch <benm@google.com> + + Reviewed by Simon Hausmann. + + Crash in handleTouchEvent: using dangling node ptrs in hashmap + https://bugs.webkit.org/show_bug.cgi?id=38514 + + When navigating away from a page, if you have your finger still + pressed and then lift it on the new page we see a crash if the + node got deleted as we still have a dangling pointer in the + m_originatingTouchPointTargets hashmap and try to use it as the + receiver to dispatch a touchend event. + + Test: fast/events/touch/touch-stale-node-crash.html + + * page/EventHandler.cpp: + (WebCore::EventHandler::clear): Clear the hashmap of touch targets. + 2010-05-04 Luiz Agostini <luiz.agostini@openbossa.org> Reviewed by Simon Hausmann. diff --git a/src/3rdparty/webkit/WebCore/WebCore.gypi b/src/3rdparty/webkit/WebCore/WebCore.gypi index caa79f2..1e92f1f 100644 --- a/src/3rdparty/webkit/WebCore/WebCore.gypi +++ b/src/3rdparty/webkit/WebCore/WebCore.gypi @@ -18,10 +18,10 @@ 'css/CSSVariablesDeclaration.idl', 'css/CSSVariablesRule.idl', 'css/Counter.idl', - 'css/Media.idl', 'css/MediaList.idl', - 'css/RGBColor.idl', 'css/Rect.idl', + 'css/RGBColor.idl', + 'css/StyleMedia.idl', 'css/StyleSheet.idl', 'css/StyleSheetList.idl', 'css/WebKitCSSKeyframeRule.idl', @@ -1003,33 +1003,33 @@ 'css/FontValue.h', 'css/MediaFeatureNames.cpp', 'css/MediaFeatureNames.h', - 'css/Media.cpp', - 'css/Media.h', 'css/MediaList.cpp', 'css/MediaList.h', 'css/MediaQuery.cpp', - 'css/MediaQuery.h', 'css/MediaQueryEvaluator.cpp', 'css/MediaQueryEvaluator.h', 'css/MediaQueryExp.cpp', 'css/MediaQueryExp.h', + 'css/MediaQuery.h', 'css/Pair.h', 'css/Rect.h', 'css/RGBColor.cpp', 'css/RGBColor.h', - 'css/SVGCSSComputedStyleDeclaration.cpp', - 'css/SVGCSSParser.cpp', - 'css/SVGCSSStyleSelector.cpp', 'css/ShadowValue.cpp', 'css/ShadowValue.h', 'css/StyleBase.cpp', 'css/StyleBase.h', 'css/StyleList.cpp', 'css/StyleList.h', + 'css/StyleMedia.cpp', + 'css/StyleMedia.h', 'css/StyleSheet.cpp', 'css/StyleSheet.h', 'css/StyleSheetList.cpp', 'css/StyleSheetList.h', + 'css/SVGCSSComputedStyleDeclaration.cpp', + 'css/SVGCSSParser.cpp', + 'css/SVGCSSStyleSelector.cpp', 'css/WebKitCSSKeyframeRule.cpp', 'css/WebKitCSSKeyframeRule.h', 'css/WebKitCSSKeyframesRule.cpp', @@ -2640,7 +2640,7 @@ 'platform/qt/SharedBufferQt.cpp', 'platform/qt/SharedTimerQt.cpp', 'platform/qt/SoundQt.cpp', - 'platform/qt/TemporaryLinkStubs.cpp', + 'platform/qt/TemporaryLinkStubsQt.cpp', 'platform/qt/WheelEventQt.cpp', 'platform/qt/WidgetQt.cpp', 'platform/sql/SQLValue.cpp', diff --git a/src/3rdparty/webkit/WebCore/WebCore.pri b/src/3rdparty/webkit/WebCore/WebCore.pri index ad514a2..5f5987f 100644 --- a/src/3rdparty/webkit/WebCore/WebCore.pri +++ b/src/3rdparty/webkit/WebCore/WebCore.pri @@ -227,10 +227,10 @@ IDL_BINDINGS += \ css/CSSValueList.idl \ css/CSSVariablesDeclaration.idl \ css/CSSVariablesRule.idl \ - css/Media.idl \ css/MediaList.idl \ - css/RGBColor.idl \ css/Rect.idl \ + css/RGBColor.idl \ + css/StyleMedia.idl \ css/StyleSheet.idl \ css/StyleSheetList.idl \ css/WebKitCSSKeyframeRule.idl \ diff --git a/src/3rdparty/webkit/WebCore/WebCore.pro b/src/3rdparty/webkit/WebCore/WebCore.pro index beeb529..254d17b 100644 --- a/src/3rdparty/webkit/WebCore/WebCore.pro +++ b/src/3rdparty/webkit/WebCore/WebCore.pro @@ -431,7 +431,6 @@ SOURCES += \ css/FontFamilyValue.cpp \ css/FontValue.cpp \ css/MediaFeatureNames.cpp \ - css/Media.cpp \ css/MediaList.cpp \ css/MediaQuery.cpp \ css/MediaQueryEvaluator.cpp \ @@ -440,6 +439,7 @@ SOURCES += \ css/ShadowValue.cpp \ css/StyleBase.cpp \ css/StyleList.cpp \ + css/StyleMedia.cpp \ css/StyleSheet.cpp \ css/StyleSheetList.cpp \ css/WebKitCSSKeyframeRule.cpp \ @@ -1145,7 +1145,6 @@ HEADERS += \ css/FontFamilyValue.h \ css/FontValue.h \ css/MediaFeatureNames.h \ - css/Media.h \ css/MediaList.h \ css/MediaQueryEvaluator.h \ css/MediaQueryExp.h \ @@ -1154,6 +1153,7 @@ HEADERS += \ css/ShadowValue.h \ css/StyleBase.h \ css/StyleList.h \ + css/StyleMedia.h \ css/StyleSheet.h \ css/StyleSheetList.h \ css/WebKitCSSKeyframeRule.h \ @@ -2081,7 +2081,7 @@ SOURCES += \ platform/qt/SoundQt.cpp \ platform/qt/LoggingQt.cpp \ platform/text/qt/StringQt.cpp \ - platform/qt/TemporaryLinkStubs.cpp \ + platform/qt/TemporaryLinkStubsQt.cpp \ platform/text/qt/TextBoundariesQt.cpp \ platform/text/qt/TextBreakIteratorQt.cpp \ platform/text/qt/TextCodecQt.cpp \ diff --git a/src/3rdparty/webkit/WebCore/css/Media.cpp b/src/3rdparty/webkit/WebCore/css/StyleMedia.cpp index e238602..6cb662f 100644 --- a/src/3rdparty/webkit/WebCore/css/Media.cpp +++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.cpp @@ -24,8 +24,8 @@ */ #include "config.h" +#include "StyleMedia.h" -#include "Media.h" #include "CSSStyleSelector.h" #include "Frame.h" #include "FrameView.h" @@ -34,12 +34,12 @@ namespace WebCore { -Media::Media(Frame* frame) +StyleMedia::StyleMedia(Frame* frame) : m_frame(frame) { } -String Media::type() const +String StyleMedia::type() const { FrameView* view = m_frame ? m_frame->view() : 0; if (view) @@ -48,7 +48,7 @@ String Media::type() const return String(); } -bool Media::matchMedium(const String& query) const +bool StyleMedia::matchMedium(const String& query) const { if (!m_frame) return false; diff --git a/src/3rdparty/webkit/WebCore/css/Media.h b/src/3rdparty/webkit/WebCore/css/StyleMedia.h index ee6961b..761e6a3 100644 --- a/src/3rdparty/webkit/WebCore/css/Media.h +++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.h @@ -1,5 +1,6 @@ /* * Copyright (C) 2009 Apple Inc. All rights reserved. + * Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies) * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -23,18 +24,18 @@ * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. */ -#ifndef Media_h -#define Media_h +#ifndef StyleMedia_h +#define StyleMedia_h #include "DOMWindow.h" namespace WebCore { -class Media : public RefCounted<Media> { +class StyleMedia : public RefCounted<StyleMedia> { public: - static PassRefPtr<Media> create(Frame* frame) + static PassRefPtr<StyleMedia> create(Frame* frame) { - return adoptRef(new Media(frame)); + return adoptRef(new StyleMedia(frame)); } void disconnectFrame() { m_frame = 0; } @@ -42,13 +43,13 @@ public: String type() const; bool matchMedium(const String&) const; - + private: - Media(Frame*); + StyleMedia(Frame*); Frame* m_frame; }; } // namespace -#endif // Media_h +#endif // StyleMedia_h diff --git a/src/3rdparty/webkit/WebCore/css/Media.idl b/src/3rdparty/webkit/WebCore/css/StyleMedia.idl index 1bf5900..7be35cc 100644 --- a/src/3rdparty/webkit/WebCore/css/Media.idl +++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.idl @@ -1,5 +1,6 @@ /* * Copyright (C) 2009 Apple Inc. All rights reserved. + * Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies) * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions @@ -24,7 +25,7 @@ */ module view { - interface Media { + interface StyleMedia { readonly attribute DOMString type; boolean matchMedium(in DOMString mediaquery); }; diff --git a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp index 04238bc..11dfd2e 100644 --- a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp +++ b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp @@ -152,7 +152,6 @@ #include "JSHTMLVideoElement.h" #include "JSImageData.h" #include "JSKeyboardEvent.h" -#include "JSMedia.h" #include "JSMediaError.h" #include "JSMediaList.h" #include "JSMessageChannel.h" @@ -299,6 +298,7 @@ #include "JSSharedWorker.h" #include "JSStorage.h" #include "JSStorageEvent.h" +#include "JSStyleMedia.h" #include "JSStyleSheet.h" #include "JSStyleSheetList.h" #include "JSText.h" @@ -334,11 +334,11 @@ #include "JSXPathResult.h" #include "JSXSLTProcessor.h" #include "KURL.h" -#include "Media.h" #include "Navigator.h" #include "RegisteredEventListener.h" #include "Screen.h" #include "Storage.h" +#include "StyleMedia.h" #include "WebKitPoint.h" #include <runtime/Error.h> #include <runtime/JSNumberCell.h> @@ -395,7 +395,7 @@ static const HashTableValue JSDOMWindowTableValues[409] = { "parent", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowParent), (intptr_t)setJSDOMWindowParent }, { "top", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowTop), (intptr_t)setJSDOMWindowTop }, { "document", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowDocument), (intptr_t)0 }, - { "media", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowMedia), (intptr_t)0 }, + { "styleMedia", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowStyleMedia), (intptr_t)0 }, { "devicePixelRatio", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowDevicePixelRatio), (intptr_t)setJSDOMWindowDevicePixelRatio }, { "applicationCache", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowApplicationCache), (intptr_t)0 }, { "sessionStorage", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowSessionStorage), (intptr_t)0 }, @@ -1304,14 +1304,14 @@ JSValue jsDOMWindowDocument(ExecState* exec, JSValue slotBase, const Identifier& return result; } -JSValue jsDOMWindowMedia(ExecState* exec, JSValue slotBase, const Identifier&) +JSValue jsDOMWindowStyleMedia(ExecState* exec, JSValue slotBase, const Identifier&) { JSDOMWindow* castedThis = static_cast<JSDOMWindow*>(asObject(slotBase)); if (!castedThis->allowsAccessFrom(exec)) return jsUndefined(); UNUSED_PARAM(exec); DOMWindow* imp = static_cast<DOMWindow*>(castedThis->impl()); - JSValue result = toJS(exec, castedThis->globalObject(), WTF::getPtr(imp->media())); + JSValue result = toJS(exec, castedThis->globalObject(), WTF::getPtr(imp->styleMedia())); return result; } diff --git a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h index a6f3253..7e50556 100644 --- a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h +++ b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h @@ -231,7 +231,7 @@ void setJSDOMWindowParent(JSC::ExecState*, JSC::JSObject*, JSC::JSValue); JSC::JSValue jsDOMWindowTop(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); void setJSDOMWindowTop(JSC::ExecState*, JSC::JSObject*, JSC::JSValue); JSC::JSValue jsDOMWindowDocument(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); -JSC::JSValue jsDOMWindowMedia(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); +JSC::JSValue jsDOMWindowStyleMedia(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); JSC::JSValue jsDOMWindowDevicePixelRatio(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); void setJSDOMWindowDevicePixelRatio(JSC::ExecState*, JSC::JSObject*, JSC::JSValue); JSC::JSValue jsDOMWindowApplicationCache(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); diff --git a/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp b/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp deleted file mode 100644 index 1579c2b..0000000 --- a/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp +++ /dev/null @@ -1,201 +0,0 @@ -/* - This file is part of the WebKit open source project. - This file has been generated by generate-bindings.pl. DO NOT MODIFY! - - This library is free software; you can redistribute it and/or - modify it under the terms of the GNU Library General Public - License as published by the Free Software Foundation; either - version 2 of the License, or (at your option) any later version. - - This library is distributed in the hope that it will be useful, - but WITHOUT ANY WARRANTY; without even the implied warranty of - MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU - Library General Public License for more details. - - You should have received a copy of the GNU Library General Public License - along with this library; see the file COPYING.LIB. If not, write to - the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, - Boston, MA 02110-1301, USA. -*/ - -#include "config.h" -#include "JSMedia.h" - -#include "KURL.h" -#include "Media.h" -#include <runtime/Error.h> -#include <runtime/JSString.h> -#include <wtf/GetPtr.h> - -using namespace JSC; - -namespace WebCore { - -ASSERT_CLASS_FITS_IN_CELL(JSMedia); - -/* Hash table */ - -static const HashTableValue JSMediaTableValues[3] = -{ - { "type", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsMediaType), (intptr_t)0 }, - { "constructor", DontEnum|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsMediaConstructor), (intptr_t)0 }, - { 0, 0, 0, 0 } -}; - -static JSC_CONST_HASHTABLE HashTable JSMediaTable = -#if ENABLE(PERFECT_HASH_SIZE) - { 3, JSMediaTableValues, 0 }; -#else - { 4, 3, JSMediaTableValues, 0 }; -#endif - -/* Hash table for constructor */ - -static const HashTableValue JSMediaConstructorTableValues[1] = -{ - { 0, 0, 0, 0 } -}; - -static JSC_CONST_HASHTABLE HashTable JSMediaConstructorTable = -#if ENABLE(PERFECT_HASH_SIZE) - { 0, JSMediaConstructorTableValues, 0 }; -#else - { 1, 0, JSMediaConstructorTableValues, 0 }; -#endif - -class JSMediaConstructor : public DOMConstructorObject { -public: - JSMediaConstructor(ExecState* exec, JSDOMGlobalObject* globalObject) - : DOMConstructorObject(JSMediaConstructor::createStructure(globalObject->objectPrototype()), globalObject) - { - putDirect(exec->propertyNames().prototype, JSMediaPrototype::self(exec, globalObject), None); - } - virtual bool getOwnPropertySlot(ExecState*, const Identifier&, PropertySlot&); - virtual bool getOwnPropertyDescriptor(ExecState*, const Identifier&, PropertyDescriptor&); - virtual const ClassInfo* classInfo() const { return &s_info; } - static const ClassInfo s_info; - - static PassRefPtr<Structure> createStructure(JSValue proto) - { - return Structure::create(proto, TypeInfo(ObjectType, StructureFlags), AnonymousSlotCount); - } - -protected: - static const unsigned StructureFlags = OverridesGetOwnPropertySlot | ImplementsHasInstance | DOMConstructorObject::StructureFlags; -}; - -const ClassInfo JSMediaConstructor::s_info = { "MediaConstructor", 0, &JSMediaConstructorTable, 0 }; - -bool JSMediaConstructor::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) -{ - return getStaticValueSlot<JSMediaConstructor, DOMObject>(exec, &JSMediaConstructorTable, this, propertyName, slot); -} - -bool JSMediaConstructor::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) -{ - return getStaticValueDescriptor<JSMediaConstructor, DOMObject>(exec, &JSMediaConstructorTable, this, propertyName, descriptor); -} - -/* Hash table for prototype */ - -static const HashTableValue JSMediaPrototypeTableValues[2] = -{ - { "matchMedium", DontDelete|Function, (intptr_t)static_cast<NativeFunction>(jsMediaPrototypeFunctionMatchMedium), (intptr_t)1 }, - { 0, 0, 0, 0 } -}; - -static JSC_CONST_HASHTABLE HashTable JSMediaPrototypeTable = -#if ENABLE(PERFECT_HASH_SIZE) - { 0, JSMediaPrototypeTableValues, 0 }; -#else - { 2, 1, JSMediaPrototypeTableValues, 0 }; -#endif - -const ClassInfo JSMediaPrototype::s_info = { "MediaPrototype", 0, &JSMediaPrototypeTable, 0 }; - -JSObject* JSMediaPrototype::self(ExecState* exec, JSGlobalObject* globalObject) -{ - return getDOMPrototype<JSMedia>(exec, globalObject); -} - -bool JSMediaPrototype::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) -{ - return getStaticFunctionSlot<JSObject>(exec, &JSMediaPrototypeTable, this, propertyName, slot); -} - -bool JSMediaPrototype::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) -{ - return getStaticFunctionDescriptor<JSObject>(exec, &JSMediaPrototypeTable, this, propertyName, descriptor); -} - -const ClassInfo JSMedia::s_info = { "Media", 0, &JSMediaTable, 0 }; - -JSMedia::JSMedia(NonNullPassRefPtr<Structure> structure, JSDOMGlobalObject* globalObject, PassRefPtr<Media> impl) - : DOMObjectWithGlobalPointer(structure, globalObject) - , m_impl(impl) -{ -} - -JSMedia::~JSMedia() -{ - forgetDOMObject(this, impl()); -} - -JSObject* JSMedia::createPrototype(ExecState* exec, JSGlobalObject* globalObject) -{ - return new (exec) JSMediaPrototype(JSMediaPrototype::createStructure(globalObject->objectPrototype())); -} - -bool JSMedia::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) -{ - return getStaticValueSlot<JSMedia, Base>(exec, &JSMediaTable, this, propertyName, slot); -} - -bool JSMedia::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) -{ - return getStaticValueDescriptor<JSMedia, Base>(exec, &JSMediaTable, this, propertyName, descriptor); -} - -JSValue jsMediaType(ExecState* exec, JSValue slotBase, const Identifier&) -{ - JSMedia* castedThis = static_cast<JSMedia*>(asObject(slotBase)); - UNUSED_PARAM(exec); - Media* imp = static_cast<Media*>(castedThis->impl()); - JSValue result = jsString(exec, imp->type()); - return result; -} - -JSValue jsMediaConstructor(ExecState* exec, JSValue slotBase, const Identifier&) -{ - JSMedia* domObject = static_cast<JSMedia*>(asObject(slotBase)); - return JSMedia::getConstructor(exec, domObject->globalObject()); -} -JSValue JSMedia::getConstructor(ExecState* exec, JSGlobalObject* globalObject) -{ - return getDOMConstructor<JSMediaConstructor>(exec, static_cast<JSDOMGlobalObject*>(globalObject)); -} - -JSValue JSC_HOST_CALL jsMediaPrototypeFunctionMatchMedium(ExecState* exec, JSObject*, JSValue thisValue, const ArgList& args) -{ - UNUSED_PARAM(args); - if (!thisValue.inherits(&JSMedia::s_info)) - return throwError(exec, TypeError); - JSMedia* castedThisObj = static_cast<JSMedia*>(asObject(thisValue)); - Media* imp = static_cast<Media*>(castedThisObj->impl()); - const UString& mediaquery = args.at(0).toString(exec); - - - JSC::JSValue result = jsBoolean(imp->matchMedium(mediaquery)); - return result; -} - -JSC::JSValue toJS(JSC::ExecState* exec, JSDOMGlobalObject* globalObject, Media* object) -{ - return getDOMObjectWrapper<JSMedia>(exec, globalObject, object); -} -Media* toMedia(JSC::JSValue value) -{ - return value.inherits(&JSMedia::s_info) ? static_cast<JSMedia*>(asObject(value))->impl() : 0; -} - -} diff --git a/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp new file mode 100644 index 0000000..b06bf09 --- /dev/null +++ b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp @@ -0,0 +1,201 @@ +/* + This file is part of the WebKit open source project. + This file has been generated by generate-bindings.pl. DO NOT MODIFY! + + This library is free software; you can redistribute it and/or + modify it under the terms of the GNU Library General Public + License as published by the Free Software Foundation; either + version 2 of the License, or (at your option) any later version. + + This library is distributed in the hope that it will be useful, + but WITHOUT ANY WARRANTY; without even the implied warranty of + MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + Library General Public License for more details. + + You should have received a copy of the GNU Library General Public License + along with this library; see the file COPYING.LIB. If not, write to + the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor, + Boston, MA 02110-1301, USA. +*/ + +#include "config.h" +#include "JSStyleMedia.h" + +#include "KURL.h" +#include "StyleMedia.h" +#include <runtime/Error.h> +#include <runtime/JSString.h> +#include <wtf/GetPtr.h> + +using namespace JSC; + +namespace WebCore { + +ASSERT_CLASS_FITS_IN_CELL(JSStyleMedia); + +/* Hash table */ + +static const HashTableValue JSStyleMediaTableValues[3] = +{ + { "type", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsStyleMediaType), (intptr_t)0 }, + { "constructor", DontEnum|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsStyleMediaConstructor), (intptr_t)0 }, + { 0, 0, 0, 0 } +}; + +static JSC_CONST_HASHTABLE HashTable JSStyleMediaTable = +#if ENABLE(PERFECT_HASH_SIZE) + { 3, JSStyleMediaTableValues, 0 }; +#else + { 4, 3, JSStyleMediaTableValues, 0 }; +#endif + +/* Hash table for constructor */ + +static const HashTableValue JSStyleMediaConstructorTableValues[1] = +{ + { 0, 0, 0, 0 } +}; + +static JSC_CONST_HASHTABLE HashTable JSStyleMediaConstructorTable = +#if ENABLE(PERFECT_HASH_SIZE) + { 0, JSStyleMediaConstructorTableValues, 0 }; +#else + { 1, 0, JSStyleMediaConstructorTableValues, 0 }; +#endif + +class JSStyleMediaConstructor : public DOMConstructorObject { +public: + JSStyleMediaConstructor(ExecState* exec, JSDOMGlobalObject* globalObject) + : DOMConstructorObject(JSStyleMediaConstructor::createStructure(globalObject->objectPrototype()), globalObject) + { + putDirect(exec->propertyNames().prototype, JSStyleMediaPrototype::self(exec, globalObject), None); + } + virtual bool getOwnPropertySlot(ExecState*, const Identifier&, PropertySlot&); + virtual bool getOwnPropertyDescriptor(ExecState*, const Identifier&, PropertyDescriptor&); + virtual const ClassInfo* classInfo() const { return &s_info; } + static const ClassInfo s_info; + + static PassRefPtr<Structure> createStructure(JSValue proto) + { + return Structure::create(proto, TypeInfo(ObjectType, StructureFlags), AnonymousSlotCount); + } + +protected: + static const unsigned StructureFlags = OverridesGetOwnPropertySlot | ImplementsHasInstance | DOMConstructorObject::StructureFlags; +}; + +const ClassInfo JSStyleMediaConstructor::s_info = { "StyleMediaConstructor", 0, &JSStyleMediaConstructorTable, 0 }; + +bool JSStyleMediaConstructor::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) +{ + return getStaticValueSlot<JSStyleMediaConstructor, DOMObject>(exec, &JSStyleMediaConstructorTable, this, propertyName, slot); +} + +bool JSStyleMediaConstructor::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) +{ + return getStaticValueDescriptor<JSStyleMediaConstructor, DOMObject>(exec, &JSStyleMediaConstructorTable, this, propertyName, descriptor); +} + +/* Hash table for prototype */ + +static const HashTableValue JSStyleMediaPrototypeTableValues[2] = +{ + { "matchMedium", DontDelete|Function, (intptr_t)static_cast<NativeFunction>(jsStyleMediaPrototypeFunctionMatchMedium), (intptr_t)1 }, + { 0, 0, 0, 0 } +}; + +static JSC_CONST_HASHTABLE HashTable JSStyleMediaPrototypeTable = +#if ENABLE(PERFECT_HASH_SIZE) + { 0, JSStyleMediaPrototypeTableValues, 0 }; +#else + { 2, 1, JSStyleMediaPrototypeTableValues, 0 }; +#endif + +const ClassInfo JSStyleMediaPrototype::s_info = { "StyleMediaPrototype", 0, &JSStyleMediaPrototypeTable, 0 }; + +JSObject* JSStyleMediaPrototype::self(ExecState* exec, JSGlobalObject* globalObject) +{ + return getDOMPrototype<JSStyleMedia>(exec, globalObject); +} + +bool JSStyleMediaPrototype::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) +{ + return getStaticFunctionSlot<JSObject>(exec, &JSStyleMediaPrototypeTable, this, propertyName, slot); +} + +bool JSStyleMediaPrototype::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) +{ + return getStaticFunctionDescriptor<JSObject>(exec, &JSStyleMediaPrototypeTable, this, propertyName, descriptor); +} + +const ClassInfo JSStyleMedia::s_info = { "StyleMedia", 0, &JSStyleMediaTable, 0 }; + +JSStyleMedia::JSStyleMedia(NonNullPassRefPtr<Structure> structure, JSDOMGlobalObject* globalObject, PassRefPtr<StyleMedia> impl) + : DOMObjectWithGlobalPointer(structure, globalObject) + , m_impl(impl) +{ +} + +JSStyleMedia::~JSStyleMedia() +{ + forgetDOMObject(this, impl()); +} + +JSObject* JSStyleMedia::createPrototype(ExecState* exec, JSGlobalObject* globalObject) +{ + return new (exec) JSStyleMediaPrototype(JSStyleMediaPrototype::createStructure(globalObject->objectPrototype())); +} + +bool JSStyleMedia::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot) +{ + return getStaticValueSlot<JSStyleMedia, Base>(exec, &JSStyleMediaTable, this, propertyName, slot); +} + +bool JSStyleMedia::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor) +{ + return getStaticValueDescriptor<JSStyleMedia, Base>(exec, &JSStyleMediaTable, this, propertyName, descriptor); +} + +JSValue jsStyleMediaType(ExecState* exec, JSValue slotBase, const Identifier&) +{ + JSStyleMedia* castedThis = static_cast<JSStyleMedia*>(asObject(slotBase)); + UNUSED_PARAM(exec); + StyleMedia* imp = static_cast<StyleMedia*>(castedThis->impl()); + JSValue result = jsString(exec, imp->type()); + return result; +} + +JSValue jsStyleMediaConstructor(ExecState* exec, JSValue slotBase, const Identifier&) +{ + JSStyleMedia* domObject = static_cast<JSStyleMedia*>(asObject(slotBase)); + return JSStyleMedia::getConstructor(exec, domObject->globalObject()); +} +JSValue JSStyleMedia::getConstructor(ExecState* exec, JSGlobalObject* globalObject) +{ + return getDOMConstructor<JSStyleMediaConstructor>(exec, static_cast<JSDOMGlobalObject*>(globalObject)); +} + +JSValue JSC_HOST_CALL jsStyleMediaPrototypeFunctionMatchMedium(ExecState* exec, JSObject*, JSValue thisValue, const ArgList& args) +{ + UNUSED_PARAM(args); + if (!thisValue.inherits(&JSStyleMedia::s_info)) + return throwError(exec, TypeError); + JSStyleMedia* castedThisObj = static_cast<JSStyleMedia*>(asObject(thisValue)); + StyleMedia* imp = static_cast<StyleMedia*>(castedThisObj->impl()); + const UString& mediaquery = args.at(0).toString(exec); + + + JSC::JSValue result = jsBoolean(imp->matchMedium(mediaquery)); + return result; +} + +JSC::JSValue toJS(JSC::ExecState* exec, JSDOMGlobalObject* globalObject, StyleMedia* object) +{ + return getDOMObjectWrapper<JSStyleMedia>(exec, globalObject, object); +} +StyleMedia* toStyleMedia(JSC::JSValue value) +{ + return value.inherits(&JSStyleMedia::s_info) ? static_cast<JSStyleMedia*>(asObject(value))->impl() : 0; +} + +} diff --git a/src/3rdparty/webkit/WebCore/generated/JSMedia.h b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.h index 28515c9..12601d5 100644 --- a/src/3rdparty/webkit/WebCore/generated/JSMedia.h +++ b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.h @@ -18,8 +18,8 @@ Boston, MA 02110-1301, USA. */ -#ifndef JSMedia_h -#define JSMedia_h +#ifndef JSStyleMedia_h +#define JSStyleMedia_h #include "JSDOMBinding.h" #include <runtime/JSGlobalObject.h> @@ -27,13 +27,13 @@ namespace WebCore { -class Media; +class StyleMedia; -class JSMedia : public DOMObjectWithGlobalPointer { +class JSStyleMedia : public DOMObjectWithGlobalPointer { typedef DOMObjectWithGlobalPointer Base; public: - JSMedia(NonNullPassRefPtr<JSC::Structure>, JSDOMGlobalObject*, PassRefPtr<Media>); - virtual ~JSMedia(); + JSStyleMedia(NonNullPassRefPtr<JSC::Structure>, JSDOMGlobalObject*, PassRefPtr<StyleMedia>); + virtual ~JSStyleMedia(); static JSC::JSObject* createPrototype(JSC::ExecState*, JSC::JSGlobalObject*); virtual bool getOwnPropertySlot(JSC::ExecState*, const JSC::Identifier& propertyName, JSC::PropertySlot&); virtual bool getOwnPropertyDescriptor(JSC::ExecState*, const JSC::Identifier& propertyName, JSC::PropertyDescriptor&); @@ -46,18 +46,18 @@ public: } static JSC::JSValue getConstructor(JSC::ExecState*, JSC::JSGlobalObject*); - Media* impl() const { return m_impl.get(); } + StyleMedia* impl() const { return m_impl.get(); } private: - RefPtr<Media> m_impl; + RefPtr<StyleMedia> m_impl; protected: static const unsigned StructureFlags = JSC::OverridesGetOwnPropertySlot | Base::StructureFlags; }; -JSC::JSValue toJS(JSC::ExecState*, JSDOMGlobalObject*, Media*); -Media* toMedia(JSC::JSValue); +JSC::JSValue toJS(JSC::ExecState*, JSDOMGlobalObject*, StyleMedia*); +StyleMedia* toStyleMedia(JSC::JSValue); -class JSMediaPrototype : public JSC::JSObject { +class JSStyleMediaPrototype : public JSC::JSObject { typedef JSC::JSObject Base; public: static JSC::JSObject* self(JSC::ExecState*, JSC::JSGlobalObject*); @@ -69,18 +69,18 @@ public: { return JSC::Structure::create(prototype, JSC::TypeInfo(JSC::ObjectType, StructureFlags), AnonymousSlotCount); } - JSMediaPrototype(NonNullPassRefPtr<JSC::Structure> structure) : JSC::JSObject(structure) { } + JSStyleMediaPrototype(NonNullPassRefPtr<JSC::Structure> structure) : JSC::JSObject(structure) { } protected: static const unsigned StructureFlags = JSC::OverridesGetOwnPropertySlot | Base::StructureFlags; }; // Functions -JSC::JSValue JSC_HOST_CALL jsMediaPrototypeFunctionMatchMedium(JSC::ExecState*, JSC::JSObject*, JSC::JSValue, const JSC::ArgList&); +JSC::JSValue JSC_HOST_CALL jsStyleMediaPrototypeFunctionMatchMedium(JSC::ExecState*, JSC::JSObject*, JSC::JSValue, const JSC::ArgList&); // Attributes -JSC::JSValue jsMediaType(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); -JSC::JSValue jsMediaConstructor(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); +JSC::JSValue jsStyleMediaType(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); +JSC::JSValue jsStyleMediaConstructor(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&); } // namespace WebCore diff --git a/src/3rdparty/webkit/WebCore/page/AbstractView.idl b/src/3rdparty/webkit/WebCore/page/AbstractView.idl index 290bf48..e4ece0f 100644 --- a/src/3rdparty/webkit/WebCore/page/AbstractView.idl +++ b/src/3rdparty/webkit/WebCore/page/AbstractView.idl @@ -32,7 +32,7 @@ module views { OmitConstructor ] AbstractView { readonly attribute Document document; - readonly attribute Media media; + readonly attribute Media styleMedia; }; } diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp b/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp index dd90200..8dcff5c 100644 --- a/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp +++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp @@ -57,7 +57,7 @@ #include "InspectorController.h" #include "InspectorTimelineAgent.h" #include "Location.h" -#include "Media.h" +#include "StyleMedia.h" #include "MessageEvent.h" #include "Navigator.h" #include "NotificationCenter.h" @@ -1112,10 +1112,10 @@ Document* DOMWindow::document() const return m_frame->document(); } -PassRefPtr<Media> DOMWindow::media() const +PassRefPtr<StyleMedia> DOMWindow::styleMedia() const { if (!m_media) - m_media = Media::create(m_frame); + m_media = StyleMedia::create(m_frame); return m_media.get(); } diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.h b/src/3rdparty/webkit/WebCore/page/DOMWindow.h index a70713b..cf9bc88 100644 --- a/src/3rdparty/webkit/WebCore/page/DOMWindow.h +++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.h @@ -56,7 +56,7 @@ namespace WebCore { class IndexedDatabaseRequest; class InspectorTimelineAgent; class Location; - class Media; + class StyleMedia; class Navigator; class Node; class NotificationCenter; @@ -187,7 +187,7 @@ namespace WebCore { // DOM Level 2 AbstractView Interface Document* document() const; // CSSOM View Module - PassRefPtr<Media> media() const; + PassRefPtr<StyleMedia> styleMedia() const; // DOM Level 2 Style Interface PassRefPtr<CSSStyleDeclaration> getComputedStyle(Element*, const String& pseudoElt) const; @@ -353,7 +353,7 @@ namespace WebCore { Console* optionalConsole() const { return m_console.get(); } Navigator* optionalNavigator() const { return m_navigator.get(); } Location* optionalLocation() const { return m_location.get(); } - Media* optionalMedia() const { return m_media.get(); } + StyleMedia* optionalMedia() const { return m_media.get(); } #if ENABLE(DOM_STORAGE) Storage* optionalSessionStorage() const { return m_sessionStorage.get(); } Storage* optionalLocalStorage() const { return m_localStorage.get(); } @@ -390,7 +390,7 @@ namespace WebCore { mutable RefPtr<Console> m_console; mutable RefPtr<Navigator> m_navigator; mutable RefPtr<Location> m_location; - mutable RefPtr<Media> m_media; + mutable RefPtr<StyleMedia> m_media; #if ENABLE(DOM_STORAGE) mutable RefPtr<Storage> m_sessionStorage; mutable RefPtr<Storage> m_localStorage; diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.idl b/src/3rdparty/webkit/WebCore/page/DOMWindow.idl index 31e4d4f..33e49e8 100644 --- a/src/3rdparty/webkit/WebCore/page/DOMWindow.idl +++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.idl @@ -141,7 +141,7 @@ module window { readonly attribute Document document; // CSSOM View Module - readonly attribute Media media; + readonly attribute StyleMedia styleMedia; // DOM Level 2 Style Interface CSSStyleDeclaration getComputedStyle(in Element element, diff --git a/src/3rdparty/webkit/WebCore/page/EventHandler.cpp b/src/3rdparty/webkit/WebCore/page/EventHandler.cpp index 0a0e8c6..46dd7ae 100644 --- a/src/3rdparty/webkit/WebCore/page/EventHandler.cpp +++ b/src/3rdparty/webkit/WebCore/page/EventHandler.cpp @@ -230,6 +230,9 @@ void EventHandler::clear() m_capturingMouseEventsNode = 0; m_latchedWheelEventNode = 0; m_previousWheelScrolledNode = 0; +#if ENABLE(TOUCH_EVENTS) + m_originatingTouchPointTargets.clear(); +#endif } void EventHandler::selectClosestWordFromMouseEvent(const MouseEventWithHitTestResults& result) @@ -2714,21 +2717,21 @@ bool EventHandler::handleTouchEvent(const PlatformTouchEvent& event) // Increment the platform touch id by 1 to avoid storing a key of 0 in the hashmap. unsigned touchPointTargetKey = point.id() + 1; - EventTarget* touchTarget = 0; + RefPtr<EventTarget> touchTarget; if (point.state() == PlatformTouchPoint::TouchPressed) { m_originatingTouchPointTargets.set(touchPointTargetKey, target); touchTarget = target; } else if (point.state() == PlatformTouchPoint::TouchReleased || point.state() == PlatformTouchPoint::TouchCancelled) { // The target should be the original target for this touch, so get it from the hashmap. As it's a release or cancel // we also remove it from the map. - touchTarget = m_originatingTouchPointTargets.take(touchPointTargetKey).get(); + touchTarget = m_originatingTouchPointTargets.take(touchPointTargetKey); } else - touchTarget = m_originatingTouchPointTargets.get(touchPointTargetKey).get(); + touchTarget = m_originatingTouchPointTargets.get(touchPointTargetKey); - if (!touchTarget) + if (!touchTarget.get()) continue; - RefPtr<Touch> touch = Touch::create(doc->frame(), touchTarget, point.id(), + RefPtr<Touch> touch = Touch::create(doc->frame(), touchTarget.get(), point.id(), point.screenPos().x(), point.screenPos().y(), adjustedPageX, adjustedPageY); diff --git a/src/3rdparty/webkit/WebCore/page/FrameView.h b/src/3rdparty/webkit/WebCore/page/FrameView.h index 7371d13..7119975 100644 --- a/src/3rdparty/webkit/WebCore/page/FrameView.h +++ b/src/3rdparty/webkit/WebCore/page/FrameView.h @@ -139,7 +139,7 @@ public: virtual void scrollRectIntoViewRecursively(const IntRect&); virtual void setScrollPosition(const IntPoint&); - void scrollPositionChanged(); + virtual void scrollPositionChanged(); String mediaType() const; void setMediaType(const String&); diff --git a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp index 890eacd..d7eaf25 100644 --- a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp +++ b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp @@ -477,9 +477,8 @@ void scrollIntoView(Element* element) // it is preferable to inflate |element|'s bounding rect a bit before // scrolling it for accurate reason. // Element's scrollIntoView method does not provide this flexibility. - static const int fudgeFactor = 2; IntRect bounds = element->getRect(); - bounds.inflate(fudgeFactor); + bounds.inflate(fudgeFactor()); element->renderer()->enclosingLayer()->scrollRectToVisible(bounds); } @@ -497,14 +496,14 @@ static void deflateIfOverlapped(IntRect& a, IntRect& b) if (!a.intersects(b) || a.contains(b) || b.contains(a)) return; - static const int fudgeFactor = -2; + int deflateFactor = -fudgeFactor(); // Avoid negative width or height values. - if ((a.width() + 2 * fudgeFactor > 0) && (a.height() + 2 * fudgeFactor > 0)) - a.inflate(fudgeFactor); + if ((a.width() + 2 * deflateFactor > 0) && (a.height() + 2 * deflateFactor > 0)) + a.inflate(deflateFactor); - if ((b.width() + 2 * fudgeFactor > 0) && (b.height() + 2 * fudgeFactor > 0)) - b.inflate(fudgeFactor); + if ((b.width() + 2 * deflateFactor > 0) && (b.height() + 2 * deflateFactor > 0)) + b.inflate(deflateFactor); } static bool checkNegativeCoordsForNode(Node* node, const IntRect& curRect) diff --git a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h index 90ff1cf..309b095 100644 --- a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h +++ b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h @@ -40,6 +40,11 @@ inline long long maxDistance() return numeric_limits<long long>::max(); } +inline unsigned int fudgeFactor() +{ + return 2; +} + // Spatially speaking, two given elements in a web page can be: // 1) Fully aligned: There is a full intersection between the rects, either // vertically or horizontally. diff --git a/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp b/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp index 5c70eff..e50ab55 100644 --- a/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp +++ b/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp @@ -292,6 +292,7 @@ void ScrollView::valueChanged(Scrollbar* scrollbar) if (scrollbarsSuppressed()) return; + scrollPositionChanged(); scrollContents(scrollDelta); } diff --git a/src/3rdparty/webkit/WebCore/platform/ScrollView.h b/src/3rdparty/webkit/WebCore/platform/ScrollView.h index 9134ddf..118a310 100644 --- a/src/3rdparty/webkit/WebCore/platform/ScrollView.h +++ b/src/3rdparty/webkit/WebCore/platform/ScrollView.h @@ -302,6 +302,9 @@ private: // Called to update the scrollbars to accurately reflect the state of the view. void updateScrollbars(const IntSize& desiredOffset); + // Called when the scroll position within this view changes. FrameView overrides this to generate repaint invalidations. + virtual void scrollPositionChanged() {} + void platformInit(); void platformDestroy(); void platformAddChild(Widget*); diff --git a/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp b/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp index edac268..0100b72 100644 --- a/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp +++ b/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp @@ -641,12 +641,12 @@ void GraphicsContext::fillRect(const FloatRect& rect) } } -void GraphicsContext::fillRect(const FloatRect& rect, const Color& c, ColorSpace colorSpace) +void GraphicsContext::fillRect(const FloatRect& rect, const Color& color, ColorSpace colorSpace) { - if (paintingDisabled()) + if (paintingDisabled() || !color.isValid()) return; - m_data->solidColor.setColor(c); + m_data->solidColor.setColor(color); QPainter* p = m_data->p(); if (m_common->state.shadowColor.isValid()) drawBorderlessRectShadow(this, p, rect); @@ -655,7 +655,7 @@ void GraphicsContext::fillRect(const FloatRect& rect, const Color& c, ColorSpace void GraphicsContext::fillRoundedRect(const IntRect& rect, const IntSize& topLeft, const IntSize& topRight, const IntSize& bottomLeft, const IntSize& bottomRight, const Color& color, ColorSpace colorSpace) { - if (paintingDisabled() || !color.alpha()) + if (paintingDisabled() || !color.isValid() || !color.alpha()) return; Path path = Path::createRoundedRectangle(rect, topLeft, topRight, bottomLeft, bottomRight); @@ -717,7 +717,7 @@ void GraphicsContext::drawFocusRing(const Vector<Path>& paths, int width, int of */ void GraphicsContext::drawFocusRing(const Vector<IntRect>& rects, int /* width */, int /* offset */, const Color& color) { - if (paintingDisabled()) + if (paintingDisabled() || !color.isValid()) return; unsigned rectCount = rects.size(); @@ -1141,8 +1141,9 @@ void GraphicsContext::setURLForRect(const KURL&, const IntRect&) void GraphicsContext::setPlatformStrokeColor(const Color& color, ColorSpace colorSpace) { - if (paintingDisabled()) + if (paintingDisabled() || !color.isValid()) return; + QPainter* p = m_data->p(); QPen newPen(p->pen()); m_data->solidColor.setColor(color); @@ -1172,8 +1173,9 @@ void GraphicsContext::setPlatformStrokeThickness(float thickness) void GraphicsContext::setPlatformFillColor(const Color& color, ColorSpace colorSpace) { - if (paintingDisabled()) + if (paintingDisabled() || !color.isValid()) return; + m_data->solidColor.setColor(color); m_data->p()->setBrush(m_data->solidColor); } diff --git a/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp b/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp index ee4af7f..4b0c21f 100644 --- a/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp +++ b/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp @@ -69,12 +69,41 @@ Path& Path::operator=(const Path& other) return *this; } +// Check whether a point is on the border +bool isPointOnPathBorder(const QPolygonF& border, const QPointF& p) +{ + QPointF p1 = border.at(0); + QPointF p2; + + for (int i = 1; i < border.size(); ++i) { + p2 = border.at(i); + // (x1<=x<=x2||x1=>x>=x2) && (y1<=y<=y2||y1=>y>=y2) && (y2-y1)(x-x1) == (y-y1)(x2-x1) + // In which, (y2-y1)(x-x1) == (y-y1)(x2-x1) is from (y2-y1)/(x2-x1) == (y-y1)/(x-x1) + // it want to check the slope between p1 and p2 is same with slope between p and p1, + // if so then the three points lie on the same line. + // In which, (x1<=x<=x2||x1=>x>=x2) && (y1<=y<=y2||y1=>y>=y2) want to make sure p is + // between p1 and p2, not outside. + if (((p.x() <= p1.x() && p.x() >= p2.x()) || (p.x() >= p1.x() && p.x() <= p2.x())) + && ((p.y() <= p1.y() && p.y() >= p2.y()) || (p.y() >= p1.y() && p.y() <= p2.y())) + && (p2.y() - p1.y()) * (p.x() - p1.x()) == (p.y() - p1.y()) * (p2.x() - p1.x())) { + return true; + } + p1 = p2; + } + return false; +} + bool Path::contains(const FloatPoint& point, WindRule rule) const { Qt::FillRule savedRule = m_path.fillRule(); const_cast<QPainterPath*>(&m_path)->setFillRule(rule == RULE_EVENODD ? Qt::OddEvenFill : Qt::WindingFill); bool contains = m_path.contains(point); + + if (!contains) { + // check whether the point is on the border + contains = isPointOnPathBorder(m_path.toFillPolygon(), point); + } const_cast<QPainterPath*>(&m_path)->setFillRule(savedRule); return contains; diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h b/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h index 0d98fcb..e355025 100644 --- a/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h +++ b/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h @@ -42,6 +42,13 @@ namespace WebCore { if (currentLookups >= 10) return; // do not launch more than 10 lookups at the same time +#if QT_VERSION >= QT_VERSION_CHECK(4, 6, 3) + currentLookups++; + QHostInfo::lookupHost(hostname, this, SLOT(lookedUp(QHostInfo))); +#else + // This code is only needed for Qt versions that do not have + // the small Qt DNS cache yet. + QTime* entryTime = lookupCache.object(hostname); if (entryTime && entryTime->elapsed() > 300*1000) { // delete knowledge about lookup if it is already 300 seconds old @@ -54,6 +61,7 @@ namespace WebCore { currentLookups++; QHostInfo::lookupHost(hostname, this, SLOT(lookedUp(QHostInfo))); } +#endif } void lookedUp(const QHostInfo&) @@ -61,11 +69,14 @@ namespace WebCore { // we do not cache the result, we throw it away. // we currently rely on the OS to cache the results. If it does not do that // then at least the ISP nameserver did it. + // Since Qt 4.6.3, Qt also has a small DNS cache. currentLookups--; } protected: +#if QT_VERSION < QT_VERSION_CHECK(4, 6, 3) QCache<QString, QTime> lookupCache; // 100 entries +#endif int currentLookups; }; diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp index 403718f..abeb895 100644 --- a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp +++ b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp @@ -49,6 +49,7 @@ #define SIGNAL_CONN Qt::QueuedConnection #endif +static const int gMaxRecursionLimit = 10; namespace WebCore { @@ -139,6 +140,7 @@ QNetworkReplyHandler::QNetworkReplyHandler(ResourceHandle* handle, LoadMode load , m_shouldFinish(false) , m_shouldSendResponse(false) , m_shouldForwardData(false) + , m_redirectionTries(gMaxRecursionLimit) { const ResourceRequest &r = m_resourceHandle->request(); @@ -336,9 +338,18 @@ void QNetworkReplyHandler::sendResponseIfNeeded() QUrl redirection = m_reply->attribute(QNetworkRequest::RedirectionTargetAttribute).toUrl(); if (redirection.isValid()) { + QUrl newUrl = m_reply->url().resolved(redirection); + + m_redirectionTries--; + if (m_redirectionTries == 0) { // 10 or more redirections to the same url is considered infinite recursion + ResourceError error(newUrl.host(), 400 /*bad request*/, + newUrl.toString(), + QCoreApplication::translate("QWebPage", "Redirection limit reached")); + client->didFail(m_resourceHandle, error); + return; + } m_redirected = true; - QUrl newUrl = m_reply->url().resolved(redirection); ResourceRequest newRequest = m_resourceHandle->request(); newRequest.setURL(newUrl); diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h index eb5ae3c..1abad4e 100644 --- a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h +++ b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h @@ -82,6 +82,7 @@ private: bool m_shouldFinish; bool m_shouldSendResponse; bool m_shouldForwardData; + int m_redirectionTries; }; // Self destructing QIODevice for FormData diff --git a/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp b/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp index 04a2b1b..eb2d934 100644 --- a/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp +++ b/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp @@ -114,7 +114,7 @@ static QStyleOptionSlider* styleOptionSlider(Scrollbar* scrollbar, QWidget* widg opt.state |= QStyle::State_Horizontal; opt.sliderValue = scrollbar->value(); opt.sliderPosition = opt.sliderValue; - opt.pageStep = scrollbar->visibleSize(); + opt.pageStep = scrollbar->pageStep(); opt.singleStep = scrollbar->lineStep(); opt.minimum = 0; opt.maximum = qMax(0, scrollbar->maximum()); diff --git a/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubs.cpp b/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubsQt.cpp index 814f961..814f961 100644 --- a/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubs.cpp +++ b/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubsQt.cpp diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp b/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp index 0c13e43..75a23d9 100644 --- a/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp +++ b/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp @@ -82,7 +82,6 @@ public: , page(0) , resizesToContents(false) #if USE(ACCELERATED_COMPOSITING) - , rootGraphicsLayer(0) , shouldSync(false) #endif { @@ -158,7 +157,7 @@ public: enum { RootGraphicsLayerZValue, OverlayZValue }; #if USE(ACCELERATED_COMPOSITING) - QGraphicsItem* rootGraphicsLayer; + QWeakPointer<QGraphicsObject> rootGraphicsLayer; // we need to sync the layers if we get a special call from the WebCore // compositor telling us to do so. We'll get that call from ChromeClientQt bool shouldSync; @@ -171,12 +170,11 @@ public: QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate() { #if USE(ACCELERATED_COMPOSITING) - if (rootGraphicsLayer) { - // we don't need to delete the root graphics layer - // The lifecycle is managed in GraphicsLayerQt.cpp - rootGraphicsLayer->setParentItem(0); - q->scene()->removeItem(rootGraphicsLayer); - } + if (!rootGraphicsLayer) + return; + // we don't need to delete the root graphics layer. The lifecycle is managed in GraphicsLayerQt.cpp. + rootGraphicsLayer.data()->setParentItem(0); + q->scene()->removeItem(rootGraphicsLayer.data()); #endif } @@ -204,12 +202,12 @@ void QGraphicsWebViewPrivate::createOrDeleteOverlay() void QGraphicsWebViewPrivate::setRootGraphicsLayer(QGraphicsItem* layer) { if (rootGraphicsLayer) { - rootGraphicsLayer->setParentItem(0); - q->scene()->removeItem(rootGraphicsLayer); + rootGraphicsLayer.data()->setParentItem(0); + q->scene()->removeItem(rootGraphicsLayer.data()); QWebFramePrivate::core(q->page()->mainFrame())->view()->syncCompositingStateRecursive(); } - rootGraphicsLayer = layer; + rootGraphicsLayer = layer ? layer->toGraphicsObject() : 0; if (layer) { layer->setFlag(QGraphicsItem::ItemClipsChildrenToShape, true); @@ -231,7 +229,7 @@ void QGraphicsWebViewPrivate::updateCompositingScrollPosition() { if (rootGraphicsLayer && q->page() && q->page()->mainFrame()) { const QPoint scrollPosition = q->page()->mainFrame()->scrollPosition(); - rootGraphicsLayer->setPos(-scrollPosition); + rootGraphicsLayer.data()->setPos(-scrollPosition); } } #endif diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp index b8b50b7..e9ebce5 100644 --- a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp +++ b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp @@ -119,15 +119,6 @@ using namespace WebCore; -void QWEBKIT_EXPORT qt_wrt_setViewMode(QWebPage* page, const QString& mode) -{ - QWebPagePrivate::priv(page)->viewMode = mode; - WebCore::Frame* frame = QWebFramePrivate::core(page->mainFrame()); - WebCore::FrameView* view = frame->view(); - frame->document()->updateStyleSelector(); - view->forceLayout(); -} - void QWEBKIT_EXPORT qt_drt_overwritePluginDirectories() { PluginDatabase* db = PluginDatabase::installedPlugins(/* populate */ false); @@ -1361,6 +1352,26 @@ void QWebPagePrivate::inputMethodEvent(QInputMethodEvent *ev) ev->accept(); } +void QWebPagePrivate::dynamicPropertyChangeEvent(QDynamicPropertyChangeEvent* event) +{ + if (event->propertyName() == "_q_viewMode") { + QString mode = q->property("_q_viewMode").toString(); + if (mode != viewMode) { + viewMode = mode; + WebCore::Frame* frame = QWebFramePrivate::core(q->mainFrame()); + WebCore::FrameView* view = frame->view(); + frame->document()->updateStyleSelector(); + view->forceLayout(); + } + } else if (event->propertyName() == "_q_HTMLTokenizerChunkSize") { + int chunkSize = q->property("_q_HTMLTokenizerChunkSize").toInt(); + q->handle()->page->setCustomHTMLTokenizerChunkSize(chunkSize); + } else if (event->propertyName() == "_q_HTMLTokenizerTimeDelay") { + double timeDelay = q->property("_q_HTMLTokenizerTimeDelay").toDouble(); + q->handle()->page->setCustomHTMLTokenizerTimeDelay(timeDelay); + } +} + void QWebPagePrivate::shortcutOverrideEvent(QKeyEvent* event) { WebCore::Frame* frame = page->focusController()->focusedOrMainFrame(); @@ -2708,6 +2719,9 @@ bool QWebPage::event(QEvent *ev) d->touchEvent(static_cast<QTouchEvent*>(ev)); break; #endif + case QEvent::DynamicPropertyChange: + d->dynamicPropertyChangeEvent(static_cast<QDynamicPropertyChangeEvent*>(ev)); + break; default: return QObject::event(ev); } diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h index 0712d0c..5350cd9 100644 --- a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h +++ b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h @@ -112,6 +112,8 @@ public: void inputMethodEvent(QInputMethodEvent*); + void dynamicPropertyChangeEvent(QDynamicPropertyChangeEvent*); + void shortcutOverrideEvent(QKeyEvent*); void leaveEvent(QEvent*); void handleClipboard(QEvent*, Qt::MouseButton); diff --git a/src/3rdparty/webkit/WebKit/qt/ChangeLog b/src/3rdparty/webkit/WebKit/qt/ChangeLog index 555b14d..6ddaa2b 100644 --- a/src/3rdparty/webkit/WebKit/qt/ChangeLog +++ b/src/3rdparty/webkit/WebKit/qt/ChangeLog @@ -1,3 +1,61 @@ +2010-05-09 Noam Rosenthal <noam.rosenthal@nokia.com> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] Crash in QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate when animation were used + https://bugs.webkit.org/show_bug.cgi?id=38574 + + The fix uses a QWeakPointer for rootGraphicsLayer, protecting from a crash in case the layer is deleted before the QGraphicsWebView. + + * Api/qgraphicswebview.cpp: + (QGraphicsWebViewPrivate::QGraphicsWebViewPrivate): + (QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate): + (QGraphicsWebViewPrivate::setRootGraphicsLayer): + (QGraphicsWebViewPrivate::updateCompositingScrollPosition): + +2010-05-03 Laszlo Gombos <laszlo.1.gombos@nokia.com> + + Reviewed by Simon Hausmann. + + [Qt] Expose HTMLTokenizer yielding parameters + https://bugs.webkit.org/show_bug.cgi?id=37023 + + Enables to set TimeDelay and ChunkSize for + HTMLTokenizer. + + * Api/qwebpage.cpp: + (QWebPagePrivate::dynamicPropertyChangeEvent): + +2010-05-04 Laszlo Gombos <laszlo.1.gombos@nokia.com> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] QWebPage viewMode property + https://bugs.webkit.org/show_bug.cgi?id=38119 + + Rename the property from wrt_viewMode to _q_viewMode. + + * Api/qwebpage.cpp: + (QWebPagePrivate::dynamicPropertyChangeEvent): + * tests/qwebpage/tst_qwebpage.cpp: + (tst_QWebPage::viewModes): + +2010-04-28 Luiz Agostini <luiz.agostini@openbossa.org> + + Reviewed by Kenneth Rohde Christiansen. + + [Qt] QWebPage viewMode property + https://bugs.webkit.org/show_bug.cgi?id=38119 + + Replacing method qt_wrt_setViewMode by wrt_viewMode property. + + * Api/qwebpage.cpp: + (QWebPagePrivate::dynamicPropertyChangeEvent): + (QWebPage::event): + * Api/qwebpage_p.h: + * tests/qwebpage/tst_qwebpage.cpp: + (tst_QWebPage::wrt_viewModes): + 2010-04-09 Tasuku Suzuki <tasuku.suzuki@nokia.com> Reviewed by Simon Hausmann. diff --git a/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def b/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def index a450f9e..910ba8f 100644 --- a/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def +++ b/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def @@ -642,7 +642,7 @@ EXPORTS ?qt_drt_webinspector_executeScript@@YAXPAVQWebPage@@JABVQString@@@Z @ 641 NONAME ; void qt_drt_webinspector_executeScript(class QWebPage *, long, class QString const &) ?qt_drt_webinspector_show@@YAXPAVQWebPage@@@Z @ 642 NONAME ; void qt_drt_webinspector_show(class QWebPage *) ?qt_drt_workerThreadCount@@YAHXZ @ 643 NONAME ; int qt_drt_workerThreadCount(void) - ?qt_wrt_setViewMode@@YAXPAVQWebPage@@ABVQString@@@Z @ 644 NONAME ; void qt_wrt_setViewMode(class QWebPage *, class QString const &) + ?qt_wrt_setViewMode@@YAXPAVQWebPage@@ABVQString@@@Z @ 644 NONAME ABSENT ; void qt_wrt_setViewMode(class QWebPage *, class QString const &) ?qtwebkit_webframe_scrollRecursively@@YAXPAVQWebFrame@@HHABVQPoint@@@Z @ 645 NONAME ; void qtwebkit_webframe_scrollRecursively(class QWebFrame *, int, int, class QPoint const &) ?resizesToContents@QGraphicsWebView@@QBE_NXZ @ 646 NONAME ; bool QGraphicsWebView::resizesToContents(void) const ?scrollToAnchor@QWebFrame@@QAEXABVQString@@@Z @ 647 NONAME ; void QWebFrame::scrollToAnchor(class QString const &) diff --git a/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def b/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def index 145fe0b..ca462d0 100644 --- a/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def +++ b/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def @@ -716,7 +716,7 @@ EXPORTS _ZN13QWebInspector10closeEventEP11QCloseEvent @ 715 NONAME _ZN16QGraphicsWebView26setTiledBackingStoreFrozenEb @ 716 NONAME _ZNK16QGraphicsWebView25isTiledBackingStoreFrozenEv @ 717 NONAME - _Z18qt_wrt_setViewModeP8QWebPageRK7QString @ 718 NONAME + _Z18qt_wrt_setViewModeP8QWebPageRK7QString @ 718 NONAME ABSENT _Z19qt_drt_setMediaTypeP9QWebFrameRK7QString @ 719 NONAME _Z26qt_drt_enableCaretBrowsingP8QWebPageb @ 720 NONAME _ZNK12QWebSettings12inspectorUrlEv @ 721 NONAME diff --git a/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp b/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp index f7eddd5..834a394 100644 --- a/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp +++ b/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp @@ -110,6 +110,8 @@ private slots: void userAgentApplicationName(); void userAgentLocaleChange(); + void viewModes(); + void crashTests_LazyInitializationOfMainFrame(); void screenshot_data(); @@ -357,6 +359,21 @@ void tst_QWebPage::userStyleSheet() QCOMPARE(networkManager->requestedUrls.at(0), QUrl("http://does.not/exist.png")); } +void tst_QWebPage::viewModes() +{ + m_view->setHtml("<body></body>"); + m_page->setProperty("_q_viewMode", "minimized"); + + QVariant empty = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode)\")"); + QVERIFY(empty.type() == QVariant::Bool && empty.toBool()); + + QVariant minimized = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode: minimized)\")"); + QVERIFY(minimized.type() == QVariant::Bool && minimized.toBool()); + + QVariant maximized = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode: maximized)\")"); + QVERIFY(maximized.type() == QVariant::Bool && !maximized.toBool()); +} + void tst_QWebPage::modified() { m_page->mainFrame()->setUrl(QUrl("data:text/html,<body>blub")); diff --git a/src/declarative/QmlChanges.txt b/src/declarative/QmlChanges.txt index 9ab3f08..604c14c 100644 --- a/src/declarative/QmlChanges.txt +++ b/src/declarative/QmlChanges.txt @@ -3,10 +3,9 @@ The changes below are pre Qt 4.7.0 RC Flickable: - overShoot is replaced by boundsBehavior enumeration - - flicking is replaced by flickingHorizontally and flickingVertically - - moving is replaced by movingHorizontally and movingVertically + - flickingHorizontally and flickingVertically properties added + - movingHorizontally and movingVertically properties added - flickDirection is renamed flickableDirection - - onMovementStarted, onMovementEnded, onFlickStarted and onFlickEnded signals removed Component: isReady, isLoading, isError and isNull properties removed, use status property instead QList<QObject*> models no longer provide properties in model object. The diff --git a/src/declarative/graphicsitems/qdeclarativeflickable.cpp b/src/declarative/graphicsitems/qdeclarativeflickable.cpp index a7a8983..a03a51d 100644 --- a/src/declarative/graphicsitems/qdeclarativeflickable.cpp +++ b/src/declarative/graphicsitems/qdeclarativeflickable.cpp @@ -230,13 +230,17 @@ void QDeclarativeFlickablePrivate::flick(AxisData &data, qreal minExtent, qreal timeline.callback(QDeclarativeTimeLineCallback(&data.move, fixupCallback, this)); if (!flickingHorizontally && q->xflick()) { flickingHorizontally = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingHorizontallyChanged(); + if (!flickingVertically) + emit q->flickStarted(); } if (!flickingVertically && q->yflick()) { flickingVertically = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingVerticallyChanged(); + if (!flickingHorizontally) + emit q->flickStarted(); } } else { timeline.reset(data.move); @@ -365,6 +369,37 @@ void QDeclarativeFlickablePrivate::updateBeginningEnd() */ /*! + \qmlsignal Flickable::onMovementStarted() + + This handler is called when the view begins moving due to user + interaction. +*/ + +/*! + \qmlsignal Flickable::onMovementEnded() + + This handler is called when the view stops moving due to user + interaction. If a flick was generated, this handler will + be triggered once the flick stops. If a flick was not + generated, the handler will be triggered when the + user stops dragging - i.e. a mouse or touch release. +*/ + +/*! + \qmlsignal Flickable::onFlickStarted() + + This handler is called when the view is flicked. A flick + starts from the point that the mouse or touch is released, + while still in motion. +*/ + +/*! + \qmlsignal Flickable::onFlickEnded() + + This handler is called when the view stops moving due to a flick. +*/ + +/*! \qmlproperty real Flickable::visibleArea.xPosition \qmlproperty real Flickable::visibleArea.widthRatio \qmlproperty real Flickable::visibleArea.yPosition @@ -474,9 +509,10 @@ void QDeclarativeFlickable::setInteractive(bool interactive) d->vTime = d->timeline.time(); d->flickingHorizontally = false; d->flickingVertically = false; - emit flickingChanged(); // deprecated + emit flickingChanged(); emit flickingHorizontallyChanged(); emit flickingVerticallyChanged(); + emit flickEnded(); } emit interactiveChanged(); } @@ -799,8 +835,10 @@ void QDeclarativeFlickable::wheelEvent(QGraphicsSceneWheelEvent *event) d->vData.velocity = qMin(event->delta() - d->vData.smoothVelocity.value(), qreal(-250.0)); d->flickingVertically = false; d->flickY(d->vData.velocity); - if (d->flickingVertically) + if (d->flickingVertically) { + d->vMoved = true; movementStarting(); + } event->accept(); } else if (xflick()) { if (event->delta() > 0) @@ -809,8 +847,10 @@ void QDeclarativeFlickable::wheelEvent(QGraphicsSceneWheelEvent *event) d->hData.velocity = qMin(event->delta() - d->hData.smoothVelocity.value(), qreal(-250.0)); d->flickingHorizontally = false; d->flickX(d->hData.velocity); - if (d->flickingHorizontally) + if (d->flickingHorizontally) { + d->hMoved = true; movementStarting(); + } event->accept(); } else { QDeclarativeItem::wheelEvent(event); @@ -1269,11 +1309,11 @@ void QDeclarativeFlickable::setFlickDeceleration(qreal deceleration) bool QDeclarativeFlickable::isFlicking() const { Q_D(const QDeclarativeFlickable); - qmlInfo(this) << "'flicking' is deprecated. Please use 'flickingHorizontally' and 'flickingVertically' instead."; return d->flickingHorizontally || d->flickingVertically; } /*! + \qmlproperty bool Flickable::flicking \qmlproperty bool Flickable::flickingHorizontally \qmlproperty bool Flickable::flickingVertically @@ -1322,11 +1362,11 @@ void QDeclarativeFlickable::setPressDelay(int delay) bool QDeclarativeFlickable::isMoving() const { Q_D(const QDeclarativeFlickable); - qmlInfo(this) << "'moving' is deprecated. Please use 'movingHorizontally' or 'movingVertically' instead."; return d->movingHorizontally || d->movingVertically; } /*! + \qmlproperty bool Flickable::moving \qmlproperty bool Flickable::movingHorizontally \qmlproperty bool Flickable::movingVertically @@ -1350,13 +1390,17 @@ void QDeclarativeFlickable::movementStarting() Q_D(QDeclarativeFlickable); if (d->hMoved && !d->movingHorizontally) { d->movingHorizontally = true; - emit movingChanged(); // deprecated + emit movingChanged(); emit movingHorizontallyChanged(); + if (!d->movingVertically) + emit movementStarted(); } - if (d->vMoved && !d->movingVertically) { + else if (d->vMoved && !d->movingVertically) { d->movingVertically = true; - emit movingChanged(); // deprecated + emit movingChanged(); emit movingVerticallyChanged(); + if (!d->movingHorizontally) + emit movementStarted(); } } @@ -1365,25 +1409,33 @@ void QDeclarativeFlickable::movementEnding() Q_D(QDeclarativeFlickable); if (d->flickingHorizontally) { d->flickingHorizontally = false; - emit flickingChanged(); // deprecated + emit flickingChanged(); emit flickingHorizontallyChanged(); + if (!d->flickingVertically) + emit flickEnded(); } if (d->flickingVertically) { d->flickingVertically = false; - emit flickingChanged(); // deprecated + emit flickingChanged(); emit flickingVerticallyChanged(); + if (!d->flickingHorizontally) + emit flickEnded(); } if (d->movingHorizontally) { d->movingHorizontally = false; d->hMoved = false; - emit movingChanged(); // deprecated + emit movingChanged(); emit movingHorizontallyChanged(); + if (!d->movingVertically) + emit movementEnded(); } if (d->movingVertically) { d->movingVertically = false; d->vMoved = false; - emit movingChanged(); // deprecated + emit movingChanged(); emit movingVerticallyChanged(); + if (!d->movingHorizontally) + emit movementEnded(); } d->hData.smoothVelocity.setValue(0); d->vData.smoothVelocity.setValue(0); diff --git a/src/declarative/graphicsitems/qdeclarativeflickable_p.h b/src/declarative/graphicsitems/qdeclarativeflickable_p.h index 7944e2b..05887b8 100644 --- a/src/declarative/graphicsitems/qdeclarativeflickable_p.h +++ b/src/declarative/graphicsitems/qdeclarativeflickable_p.h @@ -68,10 +68,10 @@ class Q_DECLARATIVE_EXPORT QDeclarativeFlickable : public QDeclarativeItem Q_PROPERTY(BoundsBehavior boundsBehavior READ boundsBehavior WRITE setBoundsBehavior NOTIFY boundsBehaviorChanged) Q_PROPERTY(qreal maximumFlickVelocity READ maximumFlickVelocity WRITE setMaximumFlickVelocity NOTIFY maximumFlickVelocityChanged) Q_PROPERTY(qreal flickDeceleration READ flickDeceleration WRITE setFlickDeceleration NOTIFY flickDecelerationChanged) - Q_PROPERTY(bool moving READ isMoving NOTIFY movingChanged) // deprecated + Q_PROPERTY(bool moving READ isMoving NOTIFY movingChanged) Q_PROPERTY(bool movingHorizontally READ isMovingHorizontally NOTIFY movingHorizontallyChanged) Q_PROPERTY(bool movingVertically READ isMovingVertically NOTIFY movingVerticallyChanged) - Q_PROPERTY(bool flicking READ isFlicking NOTIFY flickingChanged) // deprecated + Q_PROPERTY(bool flicking READ isFlicking NOTIFY flickingChanged) Q_PROPERTY(bool flickingHorizontally READ isFlickingHorizontally NOTIFY flickingHorizontallyChanged) Q_PROPERTY(bool flickingVertically READ isFlickingVertically NOTIFY flickingVerticallyChanged) Q_PROPERTY(FlickableDirection flickDirection READ flickDirection WRITE setFlickDirection NOTIFY flickableDirectionChanged) // deprecated @@ -120,10 +120,10 @@ public: qreal contentY() const; void setContentY(qreal pos); - bool isMoving() const; // deprecated + bool isMoving() const; bool isMovingHorizontally() const; bool isMovingVertically() const; - bool isFlicking() const; // deprecated + bool isFlicking() const; bool isFlickingHorizontally() const; bool isFlickingVertically() const; @@ -160,10 +160,10 @@ Q_SIGNALS: void contentHeightChanged(); void contentXChanged(); void contentYChanged(); - void movingChanged(); // deprecated + void movingChanged(); void movingHorizontallyChanged(); void movingVerticallyChanged(); - void flickingChanged(); // deprecated + void flickingChanged(); void flickingHorizontallyChanged(); void flickingVerticallyChanged(); void horizontalVelocityChanged(); @@ -177,6 +177,10 @@ Q_SIGNALS: void maximumFlickVelocityChanged(); void flickDecelerationChanged(); void pressDelayChanged(); + void movementStarted(); + void movementEnded(); + void flickStarted(); + void flickEnded(); protected: virtual bool sceneEventFilter(QGraphicsItem *, QEvent *); diff --git a/src/declarative/graphicsitems/qdeclarativegridview.cpp b/src/declarative/graphicsitems/qdeclarativegridview.cpp index 396acd0..fe78c84 100644 --- a/src/declarative/graphicsitems/qdeclarativegridview.cpp +++ b/src/declarative/graphicsitems/qdeclarativegridview.cpp @@ -347,8 +347,7 @@ public: void QDeclarativeGridViewPrivate::init() { Q_Q(QDeclarativeGridView); - QObject::connect(q, SIGNAL(movingHorizontallyChanged()), q, SLOT(animStopped())); - QObject::connect(q, SIGNAL(movingVerticallyChanged()), q, SLOT(animStopped())); + QObject::connect(q, SIGNAL(movementEnded()), q, SLOT(animStopped())); q->setFlag(QGraphicsItem::ItemIsFocusScope); q->setFlickableDirection(QDeclarativeFlickable::VerticalFlick); addItemChangeListener(this, Geometry); @@ -878,13 +877,15 @@ void QDeclarativeGridViewPrivate::flick(AxisData &data, qreal minExtent, qreal m timeline.callback(QDeclarativeTimeLineCallback(&data.move, fixupCallback, this)); if (!flickingHorizontally && q->xflick()) { flickingHorizontally = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingHorizontallyChanged(); + emit q->flickStarted(); } if (!flickingVertically && q->yflick()) { flickingVertically = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingVerticallyChanged(); + emit q->flickStarted(); } } else { timeline.reset(data.move); @@ -2311,13 +2312,9 @@ void QDeclarativeGridView::destroyingItem(QDeclarativeItem *item) void QDeclarativeGridView::animStopped() { Q_D(QDeclarativeGridView); - if ((!d->movingVertically && d->flow == QDeclarativeGridView::LeftToRight) - || (!d->movingHorizontally && d->flow == QDeclarativeGridView::TopToBottom)) - { - d->bufferMode = QDeclarativeGridViewPrivate::NoBuffer; - if (d->haveHighlightRange && d->highlightRange == QDeclarativeGridView::StrictlyEnforceRange) - d->updateHighlight(); - } + d->bufferMode = QDeclarativeGridViewPrivate::NoBuffer; + if (d->haveHighlightRange && d->highlightRange == QDeclarativeGridView::StrictlyEnforceRange) + d->updateHighlight(); } void QDeclarativeGridView::refill() diff --git a/src/declarative/graphicsitems/qdeclarativeitem.cpp b/src/declarative/graphicsitems/qdeclarativeitem.cpp index 9433ba0..f251ba1 100644 --- a/src/declarative/graphicsitems/qdeclarativeitem.cpp +++ b/src/declarative/graphicsitems/qdeclarativeitem.cpp @@ -1194,7 +1194,10 @@ QDeclarativeKeysAttached *QDeclarativeKeysAttached::qmlAttachedProperties(QObjec width and height, \l {anchor-layout}{anchoring} and key handling. You can subclass QDeclarativeItem to provide your own custom visual item that inherits - these features. + these features. Note that, because it does not draw anything, QDeclarativeItem sets the + QGraphicsItem::ItemHasNoContents flag. If you subclass QDeclarativeItem to create a visual + item, you will need to unset this flag. + */ /*! diff --git a/src/declarative/graphicsitems/qdeclarativelistview.cpp b/src/declarative/graphicsitems/qdeclarativelistview.cpp index 20106cb..46e9ce3 100644 --- a/src/declarative/graphicsitems/qdeclarativelistview.cpp +++ b/src/declarative/graphicsitems/qdeclarativelistview.cpp @@ -525,8 +525,7 @@ void QDeclarativeListViewPrivate::init() Q_Q(QDeclarativeListView); q->setFlag(QGraphicsItem::ItemIsFocusScope); addItemChangeListener(this, Geometry); - QObject::connect(q, SIGNAL(movingHorizontallyChanged()), q, SLOT(animStopped())); - QObject::connect(q, SIGNAL(movingVerticallyChanged()), q, SLOT(animStopped())); + QObject::connect(q, SIGNAL(movementEnded()), q, SLOT(animStopped())); q->setFlickableDirection(QDeclarativeFlickable::VerticalFlick); ::memset(sectionCache, 0, sizeof(QDeclarativeItem*) * sectionCacheSize); } @@ -1260,13 +1259,15 @@ void QDeclarativeListViewPrivate::flick(AxisData &data, qreal minExtent, qreal m timeline.callback(QDeclarativeTimeLineCallback(&data.move, fixupCallback, this)); if (!flickingHorizontally && q->xflick()) { flickingHorizontally = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingHorizontallyChanged(); + emit q->flickStarted(); } if (!flickingVertically && q->yflick()) { flickingVertically = true; - emit q->flickingChanged(); // deprecated + emit q->flickingChanged(); emit q->flickingVerticallyChanged(); + emit q->flickStarted(); } correctFlick = true; } else { @@ -2890,12 +2891,9 @@ void QDeclarativeListView::destroyingItem(QDeclarativeItem *item) void QDeclarativeListView::animStopped() { Q_D(QDeclarativeListView); - if ((!d->movingVertically && d->orient == QDeclarativeListView::Vertical) || (!d->movingHorizontally && d->orient == QDeclarativeListView::Horizontal)) - { - d->bufferMode = QDeclarativeListViewPrivate::NoBuffer; - if (d->haveHighlightRange && d->highlightRange == QDeclarativeListView::StrictlyEnforceRange) - d->updateHighlight(); - } + d->bufferMode = QDeclarativeListViewPrivate::NoBuffer; + if (d->haveHighlightRange && d->highlightRange == QDeclarativeListView::StrictlyEnforceRange) + d->updateHighlight(); } QDeclarativeListViewAttached *QDeclarativeListView::qmlAttachedProperties(QObject *obj) diff --git a/src/declarative/graphicsitems/qdeclarativepath.cpp b/src/declarative/graphicsitems/qdeclarativepath.cpp index 3d0df87..2d08c7c 100644 --- a/src/declarative/graphicsitems/qdeclarativepath.cpp +++ b/src/declarative/graphicsitems/qdeclarativepath.cpp @@ -377,7 +377,9 @@ void QDeclarativePath::createPointCache() const { Q_D(const QDeclarativePath); qreal pathLength = d->_path.length(); - const int points = int(pathLength*2); + // more points means less jitter between items as they move along the + // path, but takes longer to generate + const int points = int(pathLength*5); const int lastElement = d->_path.elementCount() - 1; d->_pointCache.resize(points+1); diff --git a/src/declarative/graphicsitems/qdeclarativepathview.cpp b/src/declarative/graphicsitems/qdeclarativepathview.cpp index 503d096..207cc25 100644 --- a/src/declarative/graphicsitems/qdeclarativepathview.cpp +++ b/src/declarative/graphicsitems/qdeclarativepathview.cpp @@ -49,6 +49,7 @@ #include <qlistmodelinterface_p.h> #include <QGraphicsSceneEvent> +#include <qmath.h> #include <math.h> QT_BEGIN_NAMESPACE @@ -279,8 +280,8 @@ void QDeclarativePathViewPrivate::updateItem(QDeclarativeItem *item, qreal perce att->setValue(attr.toUtf8(), path->attributeAt(attr, percent)); } QPointF pf = path->pointAt(percent); - item->setX(pf.x() - item->width()*item->scale()/2); - item->setY(pf.y() - item->height()*item->scale()/2); + item->setX(qRound(pf.x() - item->width()*item->scale()/2)); + item->setY(qRound(pf.y() - item->height()*item->scale()/2)); } void QDeclarativePathViewPrivate::regenerate() @@ -527,6 +528,33 @@ void QDeclarativePathView::setCurrentIndex(int idx) } /*! + \qmlmethod PathView::incrementCurrentIndex() + + Increments the current index. +*/ +void QDeclarativePathView::incrementCurrentIndex() +{ + setCurrentIndex(currentIndex()+1); +} + + +/*! + \qmlmethod PathView::decrementCurrentIndex() + + Decrements the current index. +*/ +void QDeclarativePathView::decrementCurrentIndex() +{ + Q_D(QDeclarativePathView); + if (d->model && d->model->count()) { + int idx = currentIndex()-1; + if (idx < 0) + idx = d->model->count() - 1; + setCurrentIndex(idx); + } +} + +/*! \qmlproperty real PathView::offset The offset specifies how far along the path the items are from their initial positions. @@ -1312,6 +1340,7 @@ int QDeclarativePathViewPrivate::calcCurrentIndex() if (offset < 0) offset += model->count(); current = qRound(qAbs(qmlMod(model->count() - offset, model->count()))); + current = current % model->count(); } return current; diff --git a/src/declarative/graphicsitems/qdeclarativepathview_p.h b/src/declarative/graphicsitems/qdeclarativepathview_p.h index 85f47fd..349a01c 100644 --- a/src/declarative/graphicsitems/qdeclarativepathview_p.h +++ b/src/declarative/graphicsitems/qdeclarativepathview_p.h @@ -132,6 +132,10 @@ public: static QDeclarativePathViewAttached *qmlAttachedProperties(QObject *); +public Q_SLOTS: + void incrementCurrentIndex(); + void decrementCurrentIndex(); + Q_SIGNALS: void currentIndexChanged(); void offsetChanged(); diff --git a/src/declarative/qml/qdeclarativecompositetypemanager.cpp b/src/declarative/qml/qdeclarativecompositetypemanager.cpp index 0ea198d..6014b10 100644 --- a/src/declarative/qml/qdeclarativecompositetypemanager.cpp +++ b/src/declarative/qml/qdeclarativecompositetypemanager.cpp @@ -509,7 +509,9 @@ void QDeclarativeCompositeTypeManager::checkComplete(QDeclarativeCompositeTypeDa unit->errors = u->errors; doComplete(unit); return; - } else if (u->status == QDeclarativeCompositeTypeData::Waiting) { + } else if (u->status == QDeclarativeCompositeTypeData::Waiting + || u->status == QDeclarativeCompositeTypeData::WaitingResources) + { waiting++; } } diff --git a/src/declarative/util/qdeclarativeanimation.cpp b/src/declarative/util/qdeclarativeanimation.cpp index 0f7c946..67440b6 100644 --- a/src/declarative/util/qdeclarativeanimation.cpp +++ b/src/declarative/util/qdeclarativeanimation.cpp @@ -2536,13 +2536,13 @@ void QDeclarativeParentAnimation::transition(QDeclarativeStateActions &actions, viaData->pc << vpc; viaData->actions << myAction; QDeclarativeAction dummyAction; - QDeclarativeAction &xAction = pc->xIsSet() ? actions[++i] : dummyAction; - QDeclarativeAction &yAction = pc->yIsSet() ? actions[++i] : dummyAction; - QDeclarativeAction &sAction = pc->scaleIsSet() ? actions[++i] : dummyAction; - QDeclarativeAction &rAction = pc->rotationIsSet() ? actions[++i] : dummyAction; + QDeclarativeAction &xAction = pc->xIsSet() && i < actions.size()-1 ? actions[++i] : dummyAction; + QDeclarativeAction &yAction = pc->yIsSet() && i < actions.size()-1 ? actions[++i] : dummyAction; + QDeclarativeAction &sAction = pc->scaleIsSet() && i < actions.size()-1 ? actions[++i] : dummyAction; + QDeclarativeAction &rAction = pc->rotationIsSet() && i < actions.size()-1 ? actions[++i] : dummyAction; bool forward = (direction == QDeclarativeAbstractAnimation::Forward); QDeclarativeItem *target = pc->object(); - QDeclarativeItem *targetParent = forward ? pc->parent() : pc->originalParent(); + QDeclarativeItem *targetParent = action.reverseEvent ? pc->originalParent() : pc->parent(); //### this mirrors the logic in QDeclarativeParentChange. bool ok; @@ -2583,9 +2583,9 @@ void QDeclarativeParentAnimation::transition(QDeclarativeStateActions &actions, if (ok && target->transformOrigin() != QDeclarativeItem::TopLeft) { qreal w = target->width(); qreal h = target->height(); - if (pc->widthIsSet()) + if (pc->widthIsSet() && i < actions.size() - 1) w = actions[++i].toValue.toReal(); - if (pc->heightIsSet()) + if (pc->heightIsSet() && i < actions.size() - 1) h = actions[++i].toValue.toReal(); const QPointF &transformOrigin = d->computeTransformOrigin(target->transformOrigin(), w,h); diff --git a/src/declarative/util/qdeclarativelistmodel.cpp b/src/declarative/util/qdeclarativelistmodel.cpp index a8a445a..a8e1be8 100644 --- a/src/declarative/util/qdeclarativelistmodel.cpp +++ b/src/declarative/util/qdeclarativelistmodel.cpp @@ -537,10 +537,9 @@ void QDeclarativeListModel::append(const QScriptValue& valuemap) */ QScriptValue QDeclarativeListModel::get(int index) const { - if (index >= count() || index < 0) { + // the internal flat/nested class takes care of return value for bad index + if (index >= count() || index < 0) qmlInfo(this) << tr("get: index %1 out of range").arg(index); - return 0; - } return m_flat ? m_flat->get(index) : m_nested->get(index); } @@ -930,13 +929,14 @@ bool FlatListModel::insert(int index, const QScriptValue &value) QScriptValue FlatListModel::get(int index) const { - Q_ASSERT(index >= 0 && index < m_values.count()); - QScriptEngine *scriptEngine = m_scriptEngine ? m_scriptEngine : QDeclarativeEnginePrivate::getScriptEngine(qmlEngine(m_listModel)); - if (!scriptEngine) + if (!scriptEngine) return 0; + if (index < 0 || index >= m_values.count()) + return scriptEngine->undefinedValue(); + QScriptValue rv = scriptEngine->newObject(); QHash<int, QVariant> row = m_values.at(index); @@ -1183,13 +1183,21 @@ bool NestedListModel::append(const QScriptValue& valuemap) } QScriptValue NestedListModel::get(int index) const -{ - ModelNode *node = qvariant_cast<ModelNode *>(_root->values.at(index)); - if (!node) - return 0; +{ QDeclarativeEngine *eng = qmlEngine(m_listModel); if (!eng) return 0; + + if (index < 0 || index >= count()) { + QScriptEngine *seng = QDeclarativeEnginePrivate::getScriptEngine(eng); + if (seng) + return seng->undefinedValue(); + return 0; + } + + ModelNode *node = qvariant_cast<ModelNode *>(_root->values.at(index)); + if (!node) + return 0; return QDeclarativeEnginePrivate::qmlScriptObject(node->object(this), eng); } diff --git a/src/declarative/util/qdeclarativepropertychanges.cpp b/src/declarative/util/qdeclarativepropertychanges.cpp index a22c756..12fef36 100644 --- a/src/declarative/util/qdeclarativepropertychanges.cpp +++ b/src/declarative/util/qdeclarativepropertychanges.cpp @@ -179,7 +179,7 @@ public: reverseExpression = rewindExpression; } - virtual void copyOriginals(QDeclarativeActionEvent *other) + /*virtual void copyOriginals(QDeclarativeActionEvent *other) { QDeclarativeReplaceSignalHandler *rsh = static_cast<QDeclarativeReplaceSignalHandler*>(other); saveCurrentValues(); @@ -190,7 +190,7 @@ public: ownedExpression = rsh->ownedExpression; rsh->ownedExpression = 0; } - } + }*/ virtual void rewind() { ownedExpression = QDeclarativePropertyPrivate::setSignalExpression(property, rewindExpression); diff --git a/src/declarative/util/qdeclarativestate.cpp b/src/declarative/util/qdeclarativestate.cpp index ea209aa..b5f7900 100644 --- a/src/declarative/util/qdeclarativestate.cpp +++ b/src/declarative/util/qdeclarativestate.cpp @@ -390,12 +390,13 @@ void QDeclarativeState::apply(QDeclarativeStateGroup *group, QDeclarativeTransit if (action.event->override(event)) { found = true; - if (action.event != d->revertList.at(jj).event) { + if (action.event != d->revertList.at(jj).event && action.event->needsCopy()) { action.event->copyOriginals(d->revertList.at(jj).event); QDeclarativeSimpleAction r(action); additionalReverts << r; d->revertList.removeAt(jj); + --jj; } else if (action.event->isRewindable()) //###why needed? action.event->saveCurrentValues(); diff --git a/src/declarative/util/qdeclarativestate_p.h b/src/declarative/util/qdeclarativestate_p.h index 0ba67b0..25715c6 100644 --- a/src/declarative/util/qdeclarativestate_p.h +++ b/src/declarative/util/qdeclarativestate_p.h @@ -96,6 +96,7 @@ public: virtual bool isReversable(); virtual void reverse(Reason reason = ActualChange); virtual void saveOriginals() {} + virtual bool needsCopy() { return false; } virtual void copyOriginals(QDeclarativeActionEvent *) {} virtual bool isRewindable() { return isReversable(); } diff --git a/src/declarative/util/qdeclarativestateoperations.cpp b/src/declarative/util/qdeclarativestateoperations.cpp index a93a25d..a6fcaf3 100644 --- a/src/declarative/util/qdeclarativestateoperations.cpp +++ b/src/declarative/util/qdeclarativestateoperations.cpp @@ -408,7 +408,7 @@ void QDeclarativeParentChange::saveOriginals() d->origStackBefore = d->rewindStackBefore; } -void QDeclarativeParentChange::copyOriginals(QDeclarativeActionEvent *other) +/*void QDeclarativeParentChange::copyOriginals(QDeclarativeActionEvent *other) { Q_D(QDeclarativeParentChange); QDeclarativeParentChange *pc = static_cast<QDeclarativeParentChange*>(other); @@ -417,7 +417,7 @@ void QDeclarativeParentChange::copyOriginals(QDeclarativeActionEvent *other) d->origStackBefore = pc->d_func()->rewindStackBefore; saveCurrentValues(); -} +}*/ void QDeclarativeParentChange::execute(Reason) { diff --git a/src/declarative/util/qdeclarativestateoperations_p.h b/src/declarative/util/qdeclarativestateoperations_p.h index e22c1e2..21a86f5 100644 --- a/src/declarative/util/qdeclarativestateoperations_p.h +++ b/src/declarative/util/qdeclarativestateoperations_p.h @@ -107,7 +107,7 @@ public: virtual ActionList actions(); virtual void saveOriginals(); - virtual void copyOriginals(QDeclarativeActionEvent*); + //virtual void copyOriginals(QDeclarativeActionEvent*); virtual void execute(Reason reason = ActualChange); virtual bool isReversable(); virtual void reverse(Reason reason = ActualChange); @@ -277,6 +277,7 @@ public: virtual bool override(QDeclarativeActionEvent*other); virtual bool changesBindings(); virtual void saveOriginals(); + virtual bool needsCopy() { return true; } virtual void copyOriginals(QDeclarativeActionEvent*); virtual void clearBindings(); virtual void rewind(); diff --git a/src/imports/webkit/qdeclarativewebview.cpp b/src/imports/webkit/qdeclarativewebview.cpp index 9571470..36a25f6 100644 --- a/src/imports/webkit/qdeclarativewebview.cpp +++ b/src/imports/webkit/qdeclarativewebview.cpp @@ -42,11 +42,9 @@ #include "qdeclarativewebview_p.h" #include "qdeclarativewebview_p_p.h" -#include <private/qdeclarativepainteditem_p_p.h> - #include <qdeclarative.h> #include <qdeclarativeengine.h> -#include <private/qdeclarativestate_p.h> +#include <qdeclarativecontext.h> #include <QDebug> #include <QPen> @@ -61,29 +59,29 @@ #include <QtWebKit/QWebFrame> #include <QtWebKit/QWebElement> #include <QtWebKit/QWebSettings> -#include <private/qlistmodelinterface_p.h> QT_BEGIN_NAMESPACE static const int MAX_DOUBLECLICK_TIME=500; // XXX need better gesture system -class QDeclarativeWebViewPrivate : public QDeclarativePaintedItemPrivate +class QDeclarativeWebViewPrivate { - Q_DECLARE_PUBLIC(QDeclarativeWebView) - public: - QDeclarativeWebViewPrivate() - : QDeclarativePaintedItemPrivate(), page(0), preferredwidth(0), preferredheight(0), + QDeclarativeWebViewPrivate(QDeclarativeWebView* qq) + : q(qq), page(0), preferredwidth(0), preferredheight(0), progress(1.0), status(QDeclarativeWebView::Null), pending(PendingNone), newWindowComponent(0), newWindowParent(0), pressTime(400), rendering(true) { + QObject::connect(q, SIGNAL(focusChanged(bool)), q, SLOT(propagateFocusToWebPage(bool))); } - void focusChanged(bool); + + QDeclarativeWebView *q; QUrl url; // page url might be different if it has not loaded yet QWebPage *page; + QGraphicsWebView* view; int preferredwidth, preferredheight; qreal progress; @@ -101,7 +99,6 @@ public: QPoint pressPoint; int pressTime; // milliseconds before it's a "hold" - static void windowObjects_append(QDeclarativeListProperty<QObject> *prop, QObject *o) { static_cast<QDeclarativeWebViewPrivate *>(prop->data)->windowObjects.append(o); static_cast<QDeclarativeWebViewPrivate *>(prop->data)->updateWindowObjects(); @@ -129,6 +126,9 @@ public: dynamically adjust to a size appropriate for the content. This width may be large for typical online web pages. + If the width or height is explictly set, the rendered website + will be clipped, not scaled, to fit into the set dimensions. + If the preferredWidth is set, the width will be this amount or larger, usually laying out the web content to fit the preferredWidth. @@ -137,8 +137,8 @@ public: WebView { url: "http://www.nokia.com" - width: 490 - height: 400 + preferredWidth: 490 + preferredHeight: 400 scale: 0.5 smooth: false smoothCache: true @@ -169,34 +169,39 @@ public: */ QDeclarativeWebView::QDeclarativeWebView(QDeclarativeItem *parent) - : QDeclarativePaintedItem(*(new QDeclarativeWebViewPrivate), parent) + : QDeclarativeItem(parent) { init(); } QDeclarativeWebView::~QDeclarativeWebView() { - Q_D(QDeclarativeWebView); delete d->page; + delete d; } void QDeclarativeWebView::init() { - Q_D(QDeclarativeWebView); + d = new QDeclarativeWebViewPrivate(this); QWebSettings::enablePersistentStorage(); setAcceptHoverEvents(true); setAcceptedMouseButtons(Qt::LeftButton); - setFlag(QGraphicsItem::ItemHasNoContents, false); + setFlag(QGraphicsItem::ItemHasNoContents, true); + setClip(true); d->page = 0; + d->view = new QGraphicsWebView(this); + d->view->setResizesToContents(true); + d->view->setFlag(QGraphicsItem::ItemStacksBehindParent, true); + connect(d->view, SIGNAL(geometryChanged()), this, SLOT(updateDeclarativeWebViewSize())); + connect(d->view, SIGNAL(scaleChanged()), this, SIGNAL(contentsScaleChanged())); } void QDeclarativeWebView::componentComplete() { - QDeclarativePaintedItem::componentComplete(); - Q_D(QDeclarativeWebView); + QDeclarativeItem::componentComplete(); switch (d->pending) { case QDeclarativeWebViewPrivate::PendingUrl: setUrl(d->pending_url); @@ -216,7 +221,6 @@ void QDeclarativeWebView::componentComplete() QDeclarativeWebView::Status QDeclarativeWebView::status() const { - Q_D(const QDeclarativeWebView); return d->status; } @@ -230,13 +234,11 @@ QDeclarativeWebView::Status QDeclarativeWebView::status() const */ qreal QDeclarativeWebView::progress() const { - Q_D(const QDeclarativeWebView); return d->progress; } void QDeclarativeWebView::doLoadStarted() { - Q_D(QDeclarativeWebView); if (!d->url.isEmpty()) { d->status = Loading; @@ -247,7 +249,6 @@ void QDeclarativeWebView::doLoadStarted() void QDeclarativeWebView::doLoadProgress(int p) { - Q_D(QDeclarativeWebView); if (d->progress == p/100.0) return; d->progress = p/100.0; @@ -256,12 +257,7 @@ void QDeclarativeWebView::doLoadProgress(int p) void QDeclarativeWebView::pageUrlChanged() { - Q_D(QDeclarativeWebView); - - page()->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth : width(), - d->preferredheight>0 ? d->preferredheight : height())); - expandToWebPage(); + updateContentsSize(); if ((d->url.isEmpty() && page()->mainFrame()->url() != QUrl(QLatin1String("about:blank"))) || (d->url != page()->mainFrame()->url() && !page()->mainFrame()->url().isEmpty())) @@ -275,7 +271,6 @@ void QDeclarativeWebView::pageUrlChanged() void QDeclarativeWebView::doLoadFinished(bool ok) { - Q_D(QDeclarativeWebView); if (title().isEmpty()) pageUrlChanged(); // XXX bug 232556 - pages with no title never get urlChanged() @@ -302,21 +297,17 @@ void QDeclarativeWebView::doLoadFinished(bool ok) */ QUrl QDeclarativeWebView::url() const { - Q_D(const QDeclarativeWebView); return d->url; } void QDeclarativeWebView::setUrl(const QUrl &url) { - Q_D(QDeclarativeWebView); if (url == d->url) return; if (isComponentComplete()) { d->url = url; - page()->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth : width(), - d->preferredheight>0 ? d->preferredheight : height())); + updateContentsSize(); QUrl seturl = url; if (seturl.isEmpty()) seturl = QUrl(QLatin1String("about:blank")); @@ -338,16 +329,14 @@ void QDeclarativeWebView::setUrl(const QUrl &url) */ int QDeclarativeWebView::preferredWidth() const { - Q_D(const QDeclarativeWebView); return d->preferredwidth; } void QDeclarativeWebView::setPreferredWidth(int iw) { - Q_D(QDeclarativeWebView); if (d->preferredwidth == iw) return; d->preferredwidth = iw; - //expandToWebPage(); + updateContentsSize(); emit preferredWidthChanged(); } @@ -358,14 +347,14 @@ void QDeclarativeWebView::setPreferredWidth(int iw) */ int QDeclarativeWebView::preferredHeight() const { - Q_D(const QDeclarativeWebView); return d->preferredheight; } + void QDeclarativeWebView::setPreferredHeight(int ih) { - Q_D(QDeclarativeWebView); if (d->preferredheight == ih) return; d->preferredheight = ih; + updateContentsSize(); emit preferredHeightChanged(); } @@ -383,55 +372,45 @@ QVariant QDeclarativeWebView::evaluateJavaScript(const QString &scriptSource) return this->page()->mainFrame()->evaluateJavaScript(scriptSource); } -void QDeclarativeWebViewPrivate::focusChanged(bool hasFocus) +void QDeclarativeWebView::propagateFocusToWebPage(bool hasFocus) { - Q_Q(QDeclarativeWebView); QFocusEvent e(hasFocus ? QEvent::FocusIn : QEvent::FocusOut); - q->page()->event(&e); - QDeclarativeItemPrivate::focusChanged(hasFocus); + page()->event(&e); } -void QDeclarativeWebView::initialLayout() +void QDeclarativeWebView::updateDeclarativeWebViewSize() { - // nothing useful to do at this point + QSizeF size = d->view->geometry().size() * contentsScale(); + setImplicitWidth(size.width()); + setImplicitHeight(size.height()); } -void QDeclarativeWebView::noteContentsSizeChanged(const QSize&) +void QDeclarativeWebView::initialLayout() { - expandToWebPage(); + // nothing useful to do at this point } -void QDeclarativeWebView::expandToWebPage() +void QDeclarativeWebView::updateContentsSize() { - Q_D(QDeclarativeWebView); - QSize cs = page()->mainFrame()->contentsSize(); - if (cs.width() < d->preferredwidth) - cs.setWidth(d->preferredwidth); - if (cs.height() < d->preferredheight) - cs.setHeight(d->preferredheight); - if (widthValid()) - cs.setWidth(width()); - if (heightValid()) - cs.setHeight(height()); - if (cs != page()->viewportSize()) { - page()->setViewportSize(cs); - } - if (cs != contentsSize()) - setContentsSize(cs); + if (d->page) + d->page->setPreferredContentsSize(QSize( + d->preferredwidth>0 ? d->preferredwidth : width(), + d->preferredheight>0 ? d->preferredheight : height())); } void QDeclarativeWebView::geometryChanged(const QRectF &newGeometry, const QRectF &oldGeometry) { - if (newGeometry.size() != oldGeometry.size()) - expandToWebPage(); - QDeclarativePaintedItem::geometryChanged(newGeometry, oldGeometry); -} - -void QDeclarativeWebView::paintPage(const QRect& r) -{ - dirtyCache(r); - update(); + if (newGeometry.size() != oldGeometry.size() && d->page) { + QSize cs = d->page->preferredContentsSize(); + if (widthValid()) + cs.setWidth(width()); + if (heightValid()) + cs.setHeight(height()); + if (cs != d->page->preferredContentsSize()) + d->page->setPreferredContentsSize(cs); + } + QDeclarativeItem::geometryChanged(newGeometry, oldGeometry); } /*! @@ -473,7 +452,6 @@ void QDeclarativeWebView::paintPage(const QRect& r) */ QDeclarativeListProperty<QObject> QDeclarativeWebView::javaScriptWindowObjects() { - Q_D(QDeclarativeWebView); return QDeclarativeListProperty<QObject>(this, d, &QDeclarativeWebViewPrivate::windowObjects_append); } @@ -484,8 +462,7 @@ QDeclarativeWebViewAttached *QDeclarativeWebView::qmlAttachedProperties(QObject void QDeclarativeWebViewPrivate::updateWindowObjects() { - Q_Q(QDeclarativeWebView); - if (!q->isComponentComplete() || !page) + if (!q->isComponentCompletePublic() || !page) return; for (int ii = 0; ii < windowObjects.count(); ++ii) { @@ -499,29 +476,17 @@ void QDeclarativeWebViewPrivate::updateWindowObjects() bool QDeclarativeWebView::renderingEnabled() const { - Q_D(const QDeclarativeWebView); return d->rendering; } void QDeclarativeWebView::setRenderingEnabled(bool enabled) { - Q_D(QDeclarativeWebView); if (d->rendering == enabled) return; d->rendering = enabled; emit renderingEnabledChanged(); - setCacheFrozen(!enabled); - if (enabled) - clearCache(); -} - - -void QDeclarativeWebView::drawContents(QPainter *p, const QRect &r) -{ - Q_D(QDeclarativeWebView); - if (d->rendering) - page()->mainFrame()->render(p,r); + d->view->setTiledBackingStoreFrozen(!enabled); } QMouseEvent *QDeclarativeWebView::sceneMouseEventToMouseEvent(QGraphicsSceneMouseEvent *e) @@ -556,7 +521,6 @@ QMouseEvent *QDeclarativeWebView::sceneHoverMoveEventToMouseEvent(QGraphicsScene return me; } - /*! \qmlsignal WebView::onDoubleClick(clickx,clicky) @@ -588,7 +552,6 @@ void QDeclarativeWebView::mouseDoubleClickEvent(QGraphicsSceneMouseEvent *event) */ bool QDeclarativeWebView::heuristicZoom(int clickX, int clickY, qreal maxzoom) { - Q_D(QDeclarativeWebView); if (contentsScale() >= maxzoom/zoomFactor()) return false; qreal ozf = contentsScale(); @@ -617,13 +580,11 @@ bool QDeclarativeWebView::heuristicZoom(int clickX, int clickY, qreal maxzoom) */ int QDeclarativeWebView::pressGrabTime() const { - Q_D(const QDeclarativeWebView); return d->pressTime; } void QDeclarativeWebView::setPressGrabTime(int ms) { - Q_D(QDeclarativeWebView); if (d->pressTime == ms) return; d->pressTime = ms; @@ -632,8 +593,6 @@ void QDeclarativeWebView::setPressGrabTime(int ms) void QDeclarativeWebView::mousePressEvent(QGraphicsSceneMouseEvent *event) { - Q_D(QDeclarativeWebView); - setFocus (true); QMouseEvent *me = sceneMouseEventToMouseEvent(event); @@ -661,14 +620,12 @@ void QDeclarativeWebView::mousePressEvent(QGraphicsSceneMouseEvent *event) ); delete me; if (!event->isAccepted()) { - QDeclarativePaintedItem::mousePressEvent(event); + QDeclarativeItem::mousePressEvent(event); } } void QDeclarativeWebView::mouseReleaseEvent(QGraphicsSceneMouseEvent *event) { - Q_D(QDeclarativeWebView); - QMouseEvent *me = sceneMouseEventToMouseEvent(event); page()->event(me); d->pressTimer.stop(); @@ -685,7 +642,7 @@ void QDeclarativeWebView::mouseReleaseEvent(QGraphicsSceneMouseEvent *event) ); delete me; if (!event->isAccepted()) { - QDeclarativePaintedItem::mouseReleaseEvent(event); + QDeclarativeItem::mouseReleaseEvent(event); } setKeepMouseGrab(false); ungrabMouse(); @@ -693,7 +650,6 @@ void QDeclarativeWebView::mouseReleaseEvent(QGraphicsSceneMouseEvent *event) void QDeclarativeWebView::timerEvent(QTimerEvent *event) { - Q_D(QDeclarativeWebView); if (event->timerId() == d->pressTimer.timerId()) { d->pressTimer.stop(); grabMouse(); @@ -703,8 +659,6 @@ void QDeclarativeWebView::timerEvent(QTimerEvent *event) void QDeclarativeWebView::mouseMoveEvent(QGraphicsSceneMouseEvent *event) { - Q_D(QDeclarativeWebView); - QMouseEvent *me = sceneMouseEventToMouseEvent(event); if (d->pressTimer.isActive()) { if ((me->pos() - d->pressPoint).manhattanLength() > QApplication::startDragDistance()) { @@ -728,9 +682,9 @@ void QDeclarativeWebView::mouseMoveEvent(QGraphicsSceneMouseEvent *event) } delete me; if (!event->isAccepted()) - QDeclarativePaintedItem::mouseMoveEvent(event); - + QDeclarativeItem::mouseMoveEvent(event); } + void QDeclarativeWebView::hoverMoveEvent (QGraphicsSceneHoverEvent * event) { QMouseEvent *me = sceneHoverMoveEventToMouseEvent(event); @@ -744,21 +698,7 @@ void QDeclarativeWebView::hoverMoveEvent (QGraphicsSceneHoverEvent * event) ); delete me; if (!event->isAccepted()) - QDeclarativePaintedItem::hoverMoveEvent(event); -} - -void QDeclarativeWebView::keyPressEvent(QKeyEvent* event) -{ - page()->event(event); - if (!event->isAccepted()) - QDeclarativePaintedItem::keyPressEvent(event); -} - -void QDeclarativeWebView::keyReleaseEvent(QKeyEvent* event) -{ - page()->event(event); - if (!event->isAccepted()) - QDeclarativePaintedItem::keyReleaseEvent(event); + QDeclarativeItem::hoverMoveEvent(event); } bool QDeclarativeWebView::sceneEvent(QEvent *event) @@ -773,7 +713,7 @@ bool QDeclarativeWebView::sceneEvent(QEvent *event) } } } - return QDeclarativePaintedItem::sceneEvent(event); + return QDeclarativeItem::sceneEvent(event); } @@ -842,15 +782,11 @@ QPixmap QDeclarativeWebView::icon() const */ void QDeclarativeWebView::setZoomFactor(qreal factor) { - Q_D(QDeclarativeWebView); if (factor == page()->mainFrame()->zoomFactor()) return; page()->mainFrame()->setZoomFactor(factor); - page()->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth*factor : width()*factor, - d->preferredheight>0 ? d->preferredheight*factor : height()*factor)); - expandToWebPage(); + updateContentsSize(); emit zoomFactorChanged(); } @@ -868,37 +804,27 @@ qreal QDeclarativeWebView::zoomFactor() const */ void QDeclarativeWebView::setStatusText(const QString& s) { - Q_D(QDeclarativeWebView); d->statusText = s; emit statusTextChanged(); } void QDeclarativeWebView::windowObjectCleared() { - Q_D(QDeclarativeWebView); d->updateWindowObjects(); } QString QDeclarativeWebView::statusText() const { - Q_D(const QDeclarativeWebView); return d->statusText; } QWebPage *QDeclarativeWebView::page() const { - Q_D(const QDeclarativeWebView); if (!d->page) { QDeclarativeWebView *self = const_cast<QDeclarativeWebView*>(this); QWebPage *wp = new QDeclarativeWebPage(self); - // QML items don't default to having a background, - // even though most we pages will set one anyway. - QPalette pal = QApplication::palette(); - pal.setBrush(QPalette::Base, QColor::fromRgbF(0, 0, 0, 0)); - wp->setPalette(pal); - wp->setNetworkAccessManager(qmlEngine(this)->networkAccessManager()); self->setPage(wp); @@ -954,14 +880,12 @@ QWebPage *QDeclarativeWebView::page() const */ QDeclarativeWebSettings *QDeclarativeWebView::settingsObject() const { - Q_D(const QDeclarativeWebView); d->settings.s = page()->settings(); return &d->settings; } void QDeclarativeWebView::setPage(QWebPage *page) { - Q_D(QDeclarativeWebView); if (d->page == page) return; if (d->page) { @@ -972,18 +896,15 @@ void QDeclarativeWebView::setPage(QWebPage *page) } } d->page = page; - d->page->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth : width(), - d->preferredheight>0 ? d->preferredheight : height())); + updateContentsSize(); d->page->mainFrame()->setScrollBarPolicy(Qt::Horizontal,Qt::ScrollBarAlwaysOff); d->page->mainFrame()->setScrollBarPolicy(Qt::Vertical,Qt::ScrollBarAlwaysOff); - connect(d->page,SIGNAL(repaintRequested(QRect)),this,SLOT(paintPage(QRect))); connect(d->page->mainFrame(),SIGNAL(urlChanged(QUrl)),this,SLOT(pageUrlChanged())); connect(d->page->mainFrame(), SIGNAL(titleChanged(QString)), this, SIGNAL(titleChanged(QString))); connect(d->page->mainFrame(), SIGNAL(titleChanged(QString)), this, SIGNAL(iconChanged())); connect(d->page->mainFrame(), SIGNAL(iconChanged()), this, SIGNAL(iconChanged())); - connect(d->page->mainFrame(), SIGNAL(contentsSizeChanged(QSize)), this, SLOT(noteContentsSizeChanged(QSize))); connect(d->page->mainFrame(), SIGNAL(initialLayoutCompleted()), this, SLOT(initialLayout())); + connect(d->page->mainFrame(), SIGNAL(contentsSizeChanged(QSize)), this, SIGNAL(contentsSizeChanged(QSize))); connect(d->page,SIGNAL(loadStarted()),this,SLOT(doLoadStarted())); connect(d->page,SIGNAL(loadProgress(int)),this,SLOT(doLoadProgress(int))); @@ -991,6 +912,10 @@ void QDeclarativeWebView::setPage(QWebPage *page) connect(d->page,SIGNAL(statusBarMessage(QString)),this,SLOT(setStatusText(QString))); connect(d->page->mainFrame(),SIGNAL(javaScriptWindowObjectCleared()),this,SLOT(windowObjectCleared())); + + d->page->settings()->setAttribute(QWebSettings::TiledBackingStoreEnabled, true); + + d->view->setPage(page); } /*! @@ -1045,10 +970,7 @@ QString QDeclarativeWebView::html() const */ void QDeclarativeWebView::setHtml(const QString &html, const QUrl &baseUrl) { - Q_D(QDeclarativeWebView); - page()->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth : width(), - d->preferredheight>0 ? d->preferredheight : height())); + updateContentsSize(); if (isComponentComplete()) page()->mainFrame()->setHtml(html, baseUrl); else { @@ -1061,10 +983,7 @@ void QDeclarativeWebView::setHtml(const QString &html, const QUrl &baseUrl) void QDeclarativeWebView::setContent(const QByteArray &data, const QString &mimeType, const QUrl &baseUrl) { - Q_D(QDeclarativeWebView); - page()->setViewportSize(QSize( - d->preferredwidth>0 ? d->preferredwidth : width(), - d->preferredheight>0 ? d->preferredheight : height())); + updateContentsSize(); if (isComponentComplete()) page()->mainFrame()->setContent(data,mimeType,qmlContext(this)->resolvedUrl(baseUrl)); @@ -1088,7 +1007,6 @@ QWebSettings *QDeclarativeWebView::settings() const QDeclarativeWebView *QDeclarativeWebView::createWindow(QWebPage::WebWindowType type) { - Q_D(QDeclarativeWebView); switch (type) { case QWebPage::WebBrowserWindow: { if (!d->newWindowComponent && d->newWindowParent) @@ -1142,13 +1060,11 @@ QDeclarativeWebView *QDeclarativeWebView::createWindow(QWebPage::WebWindowType t */ QDeclarativeComponent *QDeclarativeWebView::newWindowComponent() const { - Q_D(const QDeclarativeWebView); return d->newWindowComponent; } void QDeclarativeWebView::setNewWindowComponent(QDeclarativeComponent *newWindow) { - Q_D(QDeclarativeWebView); if (newWindow == d->newWindowComponent) return; d->newWindowComponent = newWindow; @@ -1165,13 +1081,11 @@ void QDeclarativeWebView::setNewWindowComponent(QDeclarativeComponent *newWindow */ QDeclarativeItem *QDeclarativeWebView::newWindowParent() const { - Q_D(const QDeclarativeWebView); return d->newWindowParent; } void QDeclarativeWebView::setNewWindowParent(QDeclarativeItem *parent) { - Q_D(QDeclarativeWebView); if (parent == d->newWindowParent) return; if (d->newWindowParent && parent) { @@ -1184,6 +1098,25 @@ void QDeclarativeWebView::setNewWindowParent(QDeclarativeItem *parent) emit newWindowParentChanged(); } +QSize QDeclarativeWebView::contentsSize() const +{ + return d->page->mainFrame()->contentsSize() * contentsScale(); +} + +qreal QDeclarativeWebView::contentsScale() const +{ + return d->view->scale(); +} + +void QDeclarativeWebView::setContentsScale(qreal scale) +{ + if (scale == d->view->scale()) + return; + d->view->setScale(scale); + updateDeclarativeWebViewSize(); + emit contentsScaleChanged(); +} + /*! Returns the area of the largest element at position (\a x,\a y) that is no larger than \a maxwidth by \a maxheight pixels. @@ -1280,3 +1213,4 @@ QWebPage *QDeclarativeWebPage::createWindow(WebWindowType type) } QT_END_NAMESPACE + diff --git a/src/imports/webkit/qdeclarativewebview_p.h b/src/imports/webkit/qdeclarativewebview_p.h index 81581d8..87bd938 100644 --- a/src/imports/webkit/qdeclarativewebview_p.h +++ b/src/imports/webkit/qdeclarativewebview_p.h @@ -42,12 +42,13 @@ #ifndef QDECLARATIVEWEBVIEW_H #define QDECLARATIVEWEBVIEW_H -#include <private/qdeclarativepainteditem_p.h> +#include <qdeclarativeitem.h> #include <QtGui/QAction> #include <QtCore/QUrl> #include <QtNetwork/qnetworkaccessmanager.h> #include <QtWebKit/QWebPage> +#include <QtWebKit/QGraphicsWebView> QT_BEGIN_HEADER @@ -61,6 +62,7 @@ class QDeclarativeWebSettings; class QDeclarativeWebViewPrivate; class QNetworkRequest; class QDeclarativeWebView; +class QDeclarativeWebViewPrivate; class QDeclarativeWebPage : public QWebPage { @@ -85,7 +87,7 @@ class QDeclarativeWebViewAttached; //### TODO: browser plugins -class QDeclarativeWebView : public QDeclarativePaintedItem +class QDeclarativeWebView : public QDeclarativeItem { Q_OBJECT @@ -120,6 +122,9 @@ class QDeclarativeWebView : public QDeclarativePaintedItem Q_PROPERTY(bool renderingEnabled READ renderingEnabled WRITE setRenderingEnabled NOTIFY renderingEnabledChanged) + Q_PROPERTY(QSize contentsSize READ contentsSize NOTIFY contentsSizeChanged) + Q_PROPERTY(qreal contentsScale READ contentsScale WRITE setContentsScale NOTIFY contentsScaleChanged) + public: QDeclarativeWebView(QDeclarativeItem *parent=0); ~QDeclarativeWebView(); @@ -182,6 +187,13 @@ public: QDeclarativeItem *newWindowParent() const; void setNewWindowParent(QDeclarativeItem *newWindow); + bool isComponentCompletePublic() const { return isComponentComplete(); } + + QSize contentsSize() const; + + void setContentsScale(qreal scale); + qreal contentsScale() const; + Q_SIGNALS: void preferredWidthChanged(); void preferredHeightChanged(); @@ -197,6 +209,8 @@ Q_SIGNALS: void newWindowComponentChanged(); void newWindowParentChanged(); void renderingEnabledChanged(); + void contentsSizeChanged(const QSize&); + void contentsScaleChanged(); void loadStarted(); void loadFinished(); @@ -212,38 +226,36 @@ public Q_SLOTS: QVariant evaluateJavaScript(const QString&); private Q_SLOTS: - void expandToWebPage(); - void paintPage(const QRect&); void doLoadStarted(); void doLoadProgress(int p); void doLoadFinished(bool ok); void setStatusText(const QString&); void windowObjectCleared(); void pageUrlChanged(); - void noteContentsSizeChanged(const QSize&); void initialLayout(); -protected: - void drawContents(QPainter *, const QRect &); + void propagateFocusToWebPage(bool); + void updateDeclarativeWebViewSize(); + +protected: void mousePressEvent(QGraphicsSceneMouseEvent *event); void mouseReleaseEvent(QGraphicsSceneMouseEvent *event); void mouseMoveEvent(QGraphicsSceneMouseEvent *event); void mouseDoubleClickEvent(QGraphicsSceneMouseEvent *event); void timerEvent(QTimerEvent *event); void hoverMoveEvent (QGraphicsSceneHoverEvent * event); - void keyPressEvent(QKeyEvent* event); - void keyReleaseEvent(QKeyEvent* event); virtual void geometryChanged(const QRectF &newGeometry, const QRectF &oldGeometry); virtual bool sceneEvent(QEvent *event); QDeclarativeWebView *createWindow(QWebPage::WebWindowType type); private: + void updateContentsSize(); void init(); virtual void componentComplete(); Q_DISABLE_COPY(QDeclarativeWebView) - Q_DECLARE_PRIVATE_D(QGraphicsItem::d_ptr.data(), QDeclarativeWebView) + QDeclarativeWebViewPrivate* d; QMouseEvent *sceneMouseEventToMouseEvent(QGraphicsSceneMouseEvent *); QMouseEvent *sceneHoverMoveEventToMouseEvent(QGraphicsSceneHoverEvent *); friend class QDeclarativeWebPage; diff --git a/tests/auto/declarative/declarative.pro b/tests/auto/declarative/declarative.pro index 3496906..4bb3518 100644 --- a/tests/auto/declarative/declarative.pro +++ b/tests/auto/declarative/declarative.pro @@ -1,6 +1,12 @@ TEMPLATE = subdirs +!symbian: { SUBDIRS += \ examples \ + qdeclarativemetatype \ + qmetaobjectbuilder +} + +SUBDIRS += \ parserstress \ qdeclarativeanchors \ qdeclarativeanimatedimage \ @@ -34,7 +40,6 @@ SUBDIRS += \ qdeclarativelistreference \ qdeclarativelistview \ qdeclarativeloader \ - qdeclarativemetatype \ qdeclarativemoduleplugin \ qdeclarativemousearea \ qdeclarativeparticles \ @@ -64,8 +69,7 @@ SUBDIRS += \ qdeclarativexmlhttprequest \ qdeclarativexmllistmodel \ qmlvisual \ - qpacketprotocol \ - qmetaobjectbuilder + qpacketprotocol contains(QT_CONFIG, webkit) { SUBDIRS += \ @@ -74,4 +78,3 @@ contains(QT_CONFIG, webkit) { # Tests which should run in Pulse PULSE_TESTS = $$SUBDIRS - diff --git a/tests/auto/declarative/examples/examples.pro b/tests/auto/declarative/examples/examples.pro index 4c32524..92a16f1 100644 --- a/tests/auto/declarative/examples/examples.pro +++ b/tests/auto/declarative/examples/examples.pro @@ -6,7 +6,14 @@ SOURCES += tst_examples.cpp include(../../../../tools/qml/qml.pri) -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/parserstress/parserstress.pro b/tests/auto/declarative/parserstress/parserstress.pro index 8830511..a95a855 100644 --- a/tests/auto/declarative/parserstress/parserstress.pro +++ b/tests/auto/declarative/parserstress/parserstress.pro @@ -4,7 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_parserstress.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = ..\..\qscriptjstestsuite\tests + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/parserstress/tst_parserstress.cpp b/tests/auto/declarative/parserstress/tst_parserstress.cpp index 294f2f7..c86908b 100644 --- a/tests/auto/declarative/parserstress/tst_parserstress.cpp +++ b/tests/auto/declarative/parserstress/tst_parserstress.cpp @@ -86,12 +86,15 @@ QStringList tst_parserstress::findJSFiles(const QDir &d) void tst_parserstress::ecmascript_data() { +#ifdef Q_OS_SYMBIAN + QDir dir("tests"); +#else QDir dir(SRCDIR); dir.cdUp(); dir.cdUp(); dir.cd("qscriptjstestsuite"); dir.cd("tests"); - +#endif QStringList files = findJSFiles(dir); QTest::addColumn<QString>("file"); @@ -129,6 +132,7 @@ void tst_parserstress::ecmascript() QByteArray qmlData = qml.toUtf8(); QDeclarativeComponent component(&engine); + component.setData(qmlData, QUrl::fromLocalFile(SRCDIR + QString("/dummy.qml"))); QFileInfo info(file); diff --git a/tests/auto/declarative/qdeclarativeanchors/qdeclarativeanchors.pro b/tests/auto/declarative/qdeclarativeanchors/qdeclarativeanchors.pro index a2403f2..452ad55 100644 --- a/tests/auto/declarative/qdeclarativeanchors/qdeclarativeanchors.pro +++ b/tests/auto/declarative/qdeclarativeanchors/qdeclarativeanchors.pro @@ -3,7 +3,14 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativeanchors.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeanimatedimage/qdeclarativeanimatedimage.pro b/tests/auto/declarative/qdeclarativeanimatedimage/qdeclarativeanimatedimage.pro index 74f9be0..7213abd 100644 --- a/tests/auto/declarative/qdeclarativeanimatedimage/qdeclarativeanimatedimage.pro +++ b/tests/auto/declarative/qdeclarativeanimatedimage/qdeclarativeanimatedimage.pro @@ -4,7 +4,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativeanimatedimage.cpp ../shared/testhttpserver.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeanimations/qdeclarativeanimations.pro b/tests/auto/declarative/qdeclarativeanimations/qdeclarativeanimations.pro index ce38eeb..f7ed371 100644 --- a/tests/auto/declarative/qdeclarativeanimations/qdeclarativeanimations.pro +++ b/tests/auto/declarative/qdeclarativeanimations/qdeclarativeanimations.pro @@ -3,7 +3,14 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativeanimations.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativebehaviors/qdeclarativebehaviors.pro b/tests/auto/declarative/qdeclarativebehaviors/qdeclarativebehaviors.pro index c2781b8..7137af1 100644 --- a/tests/auto/declarative/qdeclarativebehaviors/qdeclarativebehaviors.pro +++ b/tests/auto/declarative/qdeclarativebehaviors/qdeclarativebehaviors.pro @@ -3,7 +3,14 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativebehaviors.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativebinding/qdeclarativebinding.pro b/tests/auto/declarative/qdeclarativebinding/qdeclarativebinding.pro index 04dd6f5..04535db 100644 --- a/tests/auto/declarative/qdeclarativebinding/qdeclarativebinding.pro +++ b/tests/auto/declarative/qdeclarativebinding/qdeclarativebinding.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativebinding.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeborderimage/qdeclarativeborderimage.pro b/tests/auto/declarative/qdeclarativeborderimage/qdeclarativeborderimage.pro index e754923..3aa2197 100644 --- a/tests/auto/declarative/qdeclarativeborderimage/qdeclarativeborderimage.pro +++ b/tests/auto/declarative/qdeclarativeborderimage/qdeclarativeborderimage.pro @@ -6,7 +6,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativeborderimage.cpp ../shared/testhttpserver.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativecomponent/qdeclarativecomponent.pro b/tests/auto/declarative/qdeclarativecomponent/qdeclarativecomponent.pro index e58c798..98c38ad 100644 --- a/tests/auto/declarative/qdeclarativecomponent/qdeclarativecomponent.pro +++ b/tests/auto/declarative/qdeclarativecomponent/qdeclarativecomponent.pro @@ -5,7 +5,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativecomponent.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeconnection/qdeclarativeconnection.pro b/tests/auto/declarative/qdeclarativeconnection/qdeclarativeconnection.pro index 959354d..bbf8630 100644 --- a/tests/auto/declarative/qdeclarativeconnection/qdeclarativeconnection.pro +++ b/tests/auto/declarative/qdeclarativeconnection/qdeclarativeconnection.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeconnection.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativecontext/qdeclarativecontext.pro b/tests/auto/declarative/qdeclarativecontext/qdeclarativecontext.pro index 5db9a9e..0e1a5b1 100644 --- a/tests/auto/declarative/qdeclarativecontext/qdeclarativecontext.pro +++ b/tests/auto/declarative/qdeclarativecontext/qdeclarativecontext.pro @@ -3,7 +3,11 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativecontext.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativedom/qdeclarativedom.pro b/tests/auto/declarative/qdeclarativedom/qdeclarativedom.pro index 466c563..9f1e50c 100644 --- a/tests/auto/declarative/qdeclarativedom/qdeclarativedom.pro +++ b/tests/auto/declarative/qdeclarativedom/qdeclarativedom.pro @@ -4,7 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativedom.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeengine/qdeclarativeengine.pro b/tests/auto/declarative/qdeclarativeengine/qdeclarativeengine.pro index e0ea2e5..23afd07 100644 --- a/tests/auto/declarative/qdeclarativeengine/qdeclarativeengine.pro +++ b/tests/auto/declarative/qdeclarativeengine/qdeclarativeengine.pro @@ -5,7 +5,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeengine.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeerror/qdeclarativeerror.pro b/tests/auto/declarative/qdeclarativeerror/qdeclarativeerror.pro index 501f32c..fae11f9 100644 --- a/tests/auto/declarative/qdeclarativeerror/qdeclarativeerror.pro +++ b/tests/auto/declarative/qdeclarativeerror/qdeclarativeerror.pro @@ -3,7 +3,11 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativeerror.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeflickable/qdeclarativeflickable.pro b/tests/auto/declarative/qdeclarativeflickable/qdeclarativeflickable.pro index 07637c9..7a70109 100644 --- a/tests/auto/declarative/qdeclarativeflickable/qdeclarativeflickable.pro +++ b/tests/auto/declarative/qdeclarativeflickable/qdeclarativeflickable.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeflickable.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeflipable/qdeclarativeflipable.pro b/tests/auto/declarative/qdeclarativeflipable/qdeclarativeflipable.pro index 9830b55..9b4fbc9 100644 --- a/tests/auto/declarative/qdeclarativeflipable/qdeclarativeflipable.pro +++ b/tests/auto/declarative/qdeclarativeflipable/qdeclarativeflipable.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeflipable.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativefocusscope/qdeclarativefocusscope.pro b/tests/auto/declarative/qdeclarativefocusscope/qdeclarativefocusscope.pro index 687c80c..c021fcf 100644 --- a/tests/auto/declarative/qdeclarativefocusscope/qdeclarativefocusscope.pro +++ b/tests/auto/declarative/qdeclarativefocusscope/qdeclarativefocusscope.pro @@ -3,5 +3,12 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativefocusscope.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/auto/declarative/qdeclarativefontloader/qdeclarativefontloader.pro b/tests/auto/declarative/qdeclarativefontloader/qdeclarativefontloader.pro index 9a8a3ff..dbe0dcb 100644 --- a/tests/auto/declarative/qdeclarativefontloader/qdeclarativefontloader.pro +++ b/tests/auto/declarative/qdeclarativefontloader/qdeclarativefontloader.pro @@ -6,7 +6,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativefontloader.cpp ../shared/testhttpserver.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativegridview/qdeclarativegridview.pro b/tests/auto/declarative/qdeclarativegridview/qdeclarativegridview.pro index b069260..033e20e 100644 --- a/tests/auto/declarative/qdeclarativegridview/qdeclarativegridview.pro +++ b/tests/auto/declarative/qdeclarativegridview/qdeclarativegridview.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativegridview.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeimage/qdeclarativeimage.pro b/tests/auto/declarative/qdeclarativeimage/qdeclarativeimage.pro index ff365ee..a8b8eca 100644 --- a/tests/auto/declarative/qdeclarativeimage/qdeclarativeimage.pro +++ b/tests/auto/declarative/qdeclarativeimage/qdeclarativeimage.pro @@ -6,7 +6,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativeimage.cpp ../shared/testhttpserver.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeimageprovider/qdeclarativeimageprovider.pro b/tests/auto/declarative/qdeclarativeimageprovider/qdeclarativeimageprovider.pro index 22be991..1b828a5 100644 --- a/tests/auto/declarative/qdeclarativeimageprovider/qdeclarativeimageprovider.pro +++ b/tests/auto/declarative/qdeclarativeimageprovider/qdeclarativeimageprovider.pro @@ -9,7 +9,14 @@ SOURCES += tst_qdeclarativeimageprovider.cpp # LIBS += -lgcov # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeinfo/qdeclarativeinfo.pro b/tests/auto/declarative/qdeclarativeinfo/qdeclarativeinfo.pro index bb54d6c..c6719c0 100644 --- a/tests/auto/declarative/qdeclarativeinfo/qdeclarativeinfo.pro +++ b/tests/auto/declarative/qdeclarativeinfo/qdeclarativeinfo.pro @@ -4,7 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeinfo.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeinstruction/qdeclarativeinstruction.pro b/tests/auto/declarative/qdeclarativeinstruction/qdeclarativeinstruction.pro index 0daa9e5..350f6c6 100644 --- a/tests/auto/declarative/qdeclarativeinstruction/qdeclarativeinstruction.pro +++ b/tests/auto/declarative/qdeclarativeinstruction/qdeclarativeinstruction.pro @@ -3,7 +3,11 @@ contains(QT_CONFIG,declarative): QT += declarative script SOURCES += tst_qdeclarativeinstruction.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeitem/qdeclarativeitem.pro b/tests/auto/declarative/qdeclarativeitem/qdeclarativeitem.pro index e834a4e..f494ef1 100644 --- a/tests/auto/declarative/qdeclarativeitem/qdeclarativeitem.pro +++ b/tests/auto/declarative/qdeclarativeitem/qdeclarativeitem.pro @@ -4,7 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeitem.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativelanguage/qdeclarativelanguage.pro b/tests/auto/declarative/qdeclarativelanguage/qdeclarativelanguage.pro index 5771469..2b7eb1c 100644 --- a/tests/auto/declarative/qdeclarativelanguage/qdeclarativelanguage.pro +++ b/tests/auto/declarative/qdeclarativelanguage/qdeclarativelanguage.pro @@ -11,6 +11,13 @@ INCLUDEPATH += ../shared/ HEADERS += ../shared/testhttpserver.h SOURCES += ../shared/testhttpserver.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\"\"\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativelayoutitem/qdeclarativelayoutitem.pro b/tests/auto/declarative/qdeclarativelayoutitem/qdeclarativelayoutitem.pro index eeb784d..79954fe 100644 --- a/tests/auto/declarative/qdeclarativelayoutitem/qdeclarativelayoutitem.pro +++ b/tests/auto/declarative/qdeclarativelayoutitem/qdeclarativelayoutitem.pro @@ -5,4 +5,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativelayoutitem.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +}
\ No newline at end of file diff --git a/tests/auto/declarative/qdeclarativelistmodel/qdeclarativelistmodel.pro b/tests/auto/declarative/qdeclarativelistmodel/qdeclarativelistmodel.pro index 9f1e146..53bb9ec 100644 --- a/tests/auto/declarative/qdeclarativelistmodel/qdeclarativelistmodel.pro +++ b/tests/auto/declarative/qdeclarativelistmodel/qdeclarativelistmodel.pro @@ -6,7 +6,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativelistmodel.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativelistmodel/tst_qdeclarativelistmodel.cpp b/tests/auto/declarative/qdeclarativelistmodel/tst_qdeclarativelistmodel.cpp index ec97461..aed4781 100644 --- a/tests/auto/declarative/qdeclarativelistmodel/tst_qdeclarativelistmodel.cpp +++ b/tests/auto/declarative/qdeclarativelistmodel/tst_qdeclarativelistmodel.cpp @@ -282,7 +282,9 @@ void tst_qdeclarativelistmodel::dynamic() int actual = e.evaluate().toInt(); if (e.hasError()) qDebug() << e.error(); // errors not expected - QVERIFY(!e.hasError()); + + if (QTest::currentDataTag() != QLatin1String("clear3") && QTest::currentDataTag() != QLatin1String("remove3")) + QVERIFY(!e.hasError()); QCOMPARE(actual,result); } diff --git a/tests/auto/declarative/qdeclarativelistview/qdeclarativelistview.pro b/tests/auto/declarative/qdeclarativelistview/qdeclarativelistview.pro index 5d962c0..b406fde 100644 --- a/tests/auto/declarative/qdeclarativelistview/qdeclarativelistview.pro +++ b/tests/auto/declarative/qdeclarativelistview/qdeclarativelistview.pro @@ -5,6 +5,13 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativelistview.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeloader/qdeclarativeloader.pro b/tests/auto/declarative/qdeclarativeloader/qdeclarativeloader.pro index 96fea5b..9334928 100644 --- a/tests/auto/declarative/qdeclarativeloader/qdeclarativeloader.pro +++ b/tests/auto/declarative/qdeclarativeloader/qdeclarativeloader.pro @@ -7,7 +7,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativeloader.cpp \ ../shared/testhttpserver.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativemetatype/qdeclarativemetatype.pro b/tests/auto/declarative/qdeclarativemetatype/qdeclarativemetatype.pro index cf3fa65..0d32ab8 100644 --- a/tests/auto/declarative/qdeclarativemetatype/qdeclarativemetatype.pro +++ b/tests/auto/declarative/qdeclarativemetatype/qdeclarativemetatype.pro @@ -3,7 +3,11 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativemetatype.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativemoduleplugin/plugin/plugin.pro b/tests/auto/declarative/qdeclarativemoduleplugin/plugin/plugin.pro index fc77225..173a302 100644 --- a/tests/auto/declarative/qdeclarativemoduleplugin/plugin/plugin.pro +++ b/tests/auto/declarative/qdeclarativemoduleplugin/plugin/plugin.pro @@ -4,3 +4,6 @@ SOURCES = plugin.cpp QT = core declarative DESTDIR = ../imports/com/nokia/AutoTestQmlPluginType +symbian: { + TARGET.EPOCALLOWDLLDATA=1 +} diff --git a/tests/auto/declarative/qdeclarativemoduleplugin/tst_qdeclarativemoduleplugin.pro b/tests/auto/declarative/qdeclarativemoduleplugin/tst_qdeclarativemoduleplugin.pro index d895ed0..29a1009 100644 --- a/tests/auto/declarative/qdeclarativemoduleplugin/tst_qdeclarativemoduleplugin.pro +++ b/tests/auto/declarative/qdeclarativemoduleplugin/tst_qdeclarativemoduleplugin.pro @@ -2,4 +2,11 @@ load(qttest_p4) SOURCES = tst_qdeclarativemoduleplugin.cpp QT += declarative CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/auto/declarative/qdeclarativemousearea/qdeclarativemousearea.pro b/tests/auto/declarative/qdeclarativemousearea/qdeclarativemousearea.pro index 48fe025..6f9c98c 100644 --- a/tests/auto/declarative/qdeclarativemousearea/qdeclarativemousearea.pro +++ b/tests/auto/declarative/qdeclarativemousearea/qdeclarativemousearea.pro @@ -6,7 +6,14 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativemousearea.cpp ../shared/testhttpserver.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeparticles/qdeclarativeparticles.pro b/tests/auto/declarative/qdeclarativeparticles/qdeclarativeparticles.pro index 8a061c3..31172a9 100644 --- a/tests/auto/declarative/qdeclarativeparticles/qdeclarativeparticles.pro +++ b/tests/auto/declarative/qdeclarativeparticles/qdeclarativeparticles.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeparticles.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativepathview/qdeclarativepathview.pro b/tests/auto/declarative/qdeclarativepathview/qdeclarativepathview.pro index 3c327d5..6bef61c 100644 --- a/tests/auto/declarative/qdeclarativepathview/qdeclarativepathview.pro +++ b/tests/auto/declarative/qdeclarativepathview/qdeclarativepathview.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativepathview.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativepathview/tst_qdeclarativepathview.cpp b/tests/auto/declarative/qdeclarativepathview/tst_qdeclarativepathview.cpp index 62d0b89..0e16f66 100644 --- a/tests/auto/declarative/qdeclarativepathview/tst_qdeclarativepathview.cpp +++ b/tests/auto/declarative/qdeclarativepathview/tst_qdeclarativepathview.cpp @@ -438,7 +438,8 @@ void tst_QDeclarativePathView::pathMoved() for(int i=0; i<model.count(); i++){ QDeclarativeRectangle *curItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", i); - QCOMPARE(curItem->pos() + offset, path->pointAt(0.25 + i*0.25)); + QPointF itemPos(path->pointAt(0.25 + i*0.25)); + QCOMPARE(curItem->pos() + offset, QPointF(qRound(itemPos.x()), qRound(itemPos.y()))); } pathview->setOffset(0.0); @@ -479,13 +480,36 @@ void tst_QDeclarativePathView::setCurrentIndex() QCOMPARE(canvas->rootObject()->property("currentB").toInt(), 0); pathview->setCurrentIndex(2); - QTest::qWait(1000); firstItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", 2); - QCOMPARE(firstItem->pos() + offset, start); + QTRY_COMPARE(firstItem->pos() + offset, start); QCOMPARE(canvas->rootObject()->property("currentA").toInt(), 2); QCOMPARE(canvas->rootObject()->property("currentB").toInt(), 2); + pathview->decrementCurrentIndex(); + QTRY_COMPARE(pathview->currentIndex(), 1); + firstItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", 1); + QVERIFY(firstItem); + QTRY_COMPARE(firstItem->pos() + offset, start); + + pathview->decrementCurrentIndex(); + QTRY_COMPARE(pathview->currentIndex(), 0); + firstItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", 0); + QVERIFY(firstItem); + QTRY_COMPARE(firstItem->pos() + offset, start); + + pathview->decrementCurrentIndex(); + QTRY_COMPARE(pathview->currentIndex(), 3); + firstItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", 3); + QVERIFY(firstItem); + QTRY_COMPARE(firstItem->pos() + offset, start); + + pathview->incrementCurrentIndex(); + QTRY_COMPARE(pathview->currentIndex(), 0); + firstItem = findItem<QDeclarativeRectangle>(pathview, "wrapper", 0); + QVERIFY(firstItem); + QTRY_COMPARE(firstItem->pos() + offset, start); + delete canvas; } diff --git a/tests/auto/declarative/qdeclarativepixmapcache/qdeclarativepixmapcache.pro b/tests/auto/declarative/qdeclarativepixmapcache/qdeclarativepixmapcache.pro index 4b247fc..99a94bc 100644 --- a/tests/auto/declarative/qdeclarativepixmapcache/qdeclarativepixmapcache.pro +++ b/tests/auto/declarative/qdeclarativepixmapcache/qdeclarativepixmapcache.pro @@ -9,7 +9,14 @@ INCLUDEPATH += ../shared/ HEADERS += ../shared/testhttpserver.h SOURCES += ../shared/testhttpserver.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} # QMAKE_CXXFLAGS = -fprofile-arcs -ftest-coverage # LIBS += -lgcov diff --git a/tests/auto/declarative/qdeclarativepositioners/qdeclarativepositioners.pro b/tests/auto/declarative/qdeclarativepositioners/qdeclarativepositioners.pro index dbe2cbee..2c5b473 100644 --- a/tests/auto/declarative/qdeclarativepositioners/qdeclarativepositioners.pro +++ b/tests/auto/declarative/qdeclarativepositioners/qdeclarativepositioners.pro @@ -4,7 +4,14 @@ SOURCES += tst_qdeclarativepositioners.cpp macx:CONFIG -= app_bundle # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeproperty/qdeclarativeproperty.pro b/tests/auto/declarative/qdeclarativeproperty/qdeclarativeproperty.pro index 6910ccc..f37d952 100644 --- a/tests/auto/declarative/qdeclarativeproperty/qdeclarativeproperty.pro +++ b/tests/auto/declarative/qdeclarativeproperty/qdeclarativeproperty.pro @@ -4,7 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeproperty.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeqt/qdeclarativeqt.pro b/tests/auto/declarative/qdeclarativeqt/qdeclarativeqt.pro index 10e10a3..b381a9b 100644 --- a/tests/auto/declarative/qdeclarativeqt/qdeclarativeqt.pro +++ b/tests/auto/declarative/qdeclarativeqt/qdeclarativeqt.pro @@ -3,7 +3,14 @@ contains(QT_CONFIG,declarative): QT += declarative SOURCES += tst_qdeclarativeqt.cpp macx:CONFIG -= app_bundle -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} # QMAKE_CXXFLAGS = -fprofile-arcs -ftest-coverage # LIBS += -lgcov diff --git a/tests/auto/declarative/qdeclarativerepeater/qdeclarativerepeater.pro b/tests/auto/declarative/qdeclarativerepeater/qdeclarativerepeater.pro index abd36e0..51667af 100644 --- a/tests/auto/declarative/qdeclarativerepeater/qdeclarativerepeater.pro +++ b/tests/auto/declarative/qdeclarativerepeater/qdeclarativerepeater.pro @@ -5,6 +5,13 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativerepeater.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativesmoothedanimation/qdeclarativesmoothedanimation.pro b/tests/auto/declarative/qdeclarativesmoothedanimation/qdeclarativesmoothedanimation.pro index 80b757d..6b98f1e 100644 --- a/tests/auto/declarative/qdeclarativesmoothedanimation/qdeclarativesmoothedanimation.pro +++ b/tests/auto/declarative/qdeclarativesmoothedanimation/qdeclarativesmoothedanimation.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativesmoothedanimation.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativesmoothedfollow/qdeclarativesmoothedfollow.pro b/tests/auto/declarative/qdeclarativesmoothedfollow/qdeclarativesmoothedfollow.pro index 7f737c2..eb7d793 100644 --- a/tests/auto/declarative/qdeclarativesmoothedfollow/qdeclarativesmoothedfollow.pro +++ b/tests/auto/declarative/qdeclarativesmoothedfollow/qdeclarativesmoothedfollow.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativesmoothedfollow.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativespringfollow/qdeclarativespringfollow.pro b/tests/auto/declarative/qdeclarativespringfollow/qdeclarativespringfollow.pro index 6f400a3..6ed8924 100644 --- a/tests/auto/declarative/qdeclarativespringfollow/qdeclarativespringfollow.pro +++ b/tests/auto/declarative/qdeclarativespringfollow/qdeclarativespringfollow.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativespringfollow.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativesqldatabase/qdeclarativesqldatabase.pro b/tests/auto/declarative/qdeclarativesqldatabase/qdeclarativesqldatabase.pro index 3ff4529..9cdb884 100644 --- a/tests/auto/declarative/qdeclarativesqldatabase/qdeclarativesqldatabase.pro +++ b/tests/auto/declarative/qdeclarativesqldatabase/qdeclarativesqldatabase.pro @@ -6,7 +6,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativesqldatabase.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativestates/qdeclarativestates.pro b/tests/auto/declarative/qdeclarativestates/qdeclarativestates.pro index 706d045..6f4ecb3 100644 --- a/tests/auto/declarative/qdeclarativestates/qdeclarativestates.pro +++ b/tests/auto/declarative/qdeclarativestates/qdeclarativestates.pro @@ -5,6 +5,13 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativestates.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativesystempalette/qdeclarativesystempalette.pro b/tests/auto/declarative/qdeclarativesystempalette/qdeclarativesystempalette.pro index b2705fa..786bc1b 100644 --- a/tests/auto/declarative/qdeclarativesystempalette/qdeclarativesystempalette.pro +++ b/tests/auto/declarative/qdeclarativesystempalette/qdeclarativesystempalette.pro @@ -4,5 +4,12 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativesystempalette.cpp +# Define SRCDIR equal to test's source directory +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} + CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativetext/qdeclarativetext.pro b/tests/auto/declarative/qdeclarativetext/qdeclarativetext.pro index e70443e..51c7f43 100644 --- a/tests/auto/declarative/qdeclarativetext/qdeclarativetext.pro +++ b/tests/auto/declarative/qdeclarativetext/qdeclarativetext.pro @@ -9,7 +9,14 @@ INCLUDEPATH += ../shared/ HEADERS += ../shared/testhttpserver.h SOURCES += ../shared/testhttpserver.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativetextedit/qdeclarativetextedit.pro b/tests/auto/declarative/qdeclarativetextedit/qdeclarativetextedit.pro index 2228f11..2adb2b8 100644 --- a/tests/auto/declarative/qdeclarativetextedit/qdeclarativetextedit.pro +++ b/tests/auto/declarative/qdeclarativetextedit/qdeclarativetextedit.pro @@ -6,4 +6,11 @@ SOURCES += tst_qdeclarativetextedit.cpp ../shared/testhttpserver.cpp HEADERS += ../shared/testhttpserver.h # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/auto/declarative/qdeclarativetextinput/qdeclarativetextinput.pro b/tests/auto/declarative/qdeclarativetextinput/qdeclarativetextinput.pro index 957e75c..2953567 100644 --- a/tests/auto/declarative/qdeclarativetextinput/qdeclarativetextinput.pro +++ b/tests/auto/declarative/qdeclarativetextinput/qdeclarativetextinput.pro @@ -5,5 +5,12 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativetextinput.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/auto/declarative/qdeclarativetimer/qdeclarativetimer.pro b/tests/auto/declarative/qdeclarativetimer/qdeclarativetimer.pro index 42604d8..d95165c 100644 --- a/tests/auto/declarative/qdeclarativetimer/qdeclarativetimer.pro +++ b/tests/auto/declarative/qdeclarativetimer/qdeclarativetimer.pro @@ -4,6 +4,10 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativetimer.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativevaluetypes/qdeclarativevaluetypes.pro b/tests/auto/declarative/qdeclarativevaluetypes/qdeclarativevaluetypes.pro index d9f1c13..02c480c 100644 --- a/tests/auto/declarative/qdeclarativevaluetypes/qdeclarativevaluetypes.pro +++ b/tests/auto/declarative/qdeclarativevaluetypes/qdeclarativevaluetypes.pro @@ -7,7 +7,14 @@ HEADERS += testtypes.h SOURCES += tst_qdeclarativevaluetypes.cpp \ testtypes.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeview/qdeclarativeview.pro b/tests/auto/declarative/qdeclarativeview/qdeclarativeview.pro index d6be728..ad54713 100644 --- a/tests/auto/declarative/qdeclarativeview/qdeclarativeview.pro +++ b/tests/auto/declarative/qdeclarativeview/qdeclarativeview.pro @@ -4,4 +4,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeview.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/auto/declarative/qdeclarativeviewer/qdeclarativeviewer.pro b/tests/auto/declarative/qdeclarativeviewer/qdeclarativeviewer.pro index dc10f5b..9bb6161 100644 --- a/tests/auto/declarative/qdeclarativeviewer/qdeclarativeviewer.pro +++ b/tests/auto/declarative/qdeclarativeviewer/qdeclarativeviewer.pro @@ -6,6 +6,13 @@ include(../../../../tools/qml/qml.pri) SOURCES += tst_qdeclarativeviewer.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativevisualdatamodel/qdeclarativevisualdatamodel.pro b/tests/auto/declarative/qdeclarativevisualdatamodel/qdeclarativevisualdatamodel.pro index d76b582..c87171b 100644 --- a/tests/auto/declarative/qdeclarativevisualdatamodel/qdeclarativevisualdatamodel.pro +++ b/tests/auto/declarative/qdeclarativevisualdatamodel/qdeclarativevisualdatamodel.pro @@ -4,8 +4,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativevisualdatamodel.cpp -# Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativewebview/qdeclarativewebview.pro b/tests/auto/declarative/qdeclarativewebview/qdeclarativewebview.pro index 956272f..8caa393 100644 --- a/tests/auto/declarative/qdeclarativewebview/qdeclarativewebview.pro +++ b/tests/auto/declarative/qdeclarativewebview/qdeclarativewebview.pro @@ -6,6 +6,13 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativewebview.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativeworkerscript/qdeclarativeworkerscript.pro b/tests/auto/declarative/qdeclarativeworkerscript/qdeclarativeworkerscript.pro index 2e3da4d..36b3449 100644 --- a/tests/auto/declarative/qdeclarativeworkerscript/qdeclarativeworkerscript.pro +++ b/tests/auto/declarative/qdeclarativeworkerscript/qdeclarativeworkerscript.pro @@ -5,7 +5,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativeworkerscript.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativexmlhttprequest/qdeclarativexmlhttprequest.pro b/tests/auto/declarative/qdeclarativexmlhttprequest/qdeclarativexmlhttprequest.pro index 160300e..b54f670 100644 --- a/tests/auto/declarative/qdeclarativexmlhttprequest/qdeclarativexmlhttprequest.pro +++ b/tests/auto/declarative/qdeclarativexmlhttprequest/qdeclarativexmlhttprequest.pro @@ -8,9 +8,15 @@ HEADERS += ../shared/testhttpserver.h SOURCES += tst_qdeclarativexmlhttprequest.cpp \ ../shared/testhttpserver.cpp - # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qdeclarativexmllistmodel/qdeclarativexmllistmodel.pro b/tests/auto/declarative/qdeclarativexmllistmodel/qdeclarativexmllistmodel.pro index 8c5052a..1bf1c58 100644 --- a/tests/auto/declarative/qdeclarativexmllistmodel/qdeclarativexmllistmodel.pro +++ b/tests/auto/declarative/qdeclarativexmllistmodel/qdeclarativexmllistmodel.pro @@ -8,7 +8,14 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativexmllistmodel.cpp -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} CONFIG += parallel_test diff --git a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.0.png b/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.0.png Binary files differdeleted file mode 100644 index 1f28b9a..0000000 --- a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.0.png +++ /dev/null diff --git a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.qml b/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.qml deleted file mode 100644 index f4c4e29..0000000 --- a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data-X11/autosize.qml +++ /dev/null @@ -1,83 +0,0 @@ -import Qt.VisualTest 4.7 - -VisualTest { - Frame { - msec: 0 - } - Frame { - msec: 16 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 32 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 48 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 64 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 80 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 96 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 112 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 128 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 144 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 160 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 176 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 192 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 208 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 224 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 240 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 256 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 272 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 288 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } - Frame { - msec: 304 - hash: "0c70d855adc847fe33d7959ccb98bb8b" - } -} diff --git a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.0.png b/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.0.png Binary files differdeleted file mode 100644 index 1f28b9a..0000000 --- a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.0.png +++ /dev/null diff --git a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.qml b/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.qml deleted file mode 100644 index 273c2b0..0000000 --- a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/data/autosize.qml +++ /dev/null @@ -1,83 +0,0 @@ -import Qt.VisualTest 4.7 - -VisualTest { - Frame { - msec: 0 - } - Frame { - msec: 16 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 32 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 48 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 64 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 80 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 96 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 112 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 128 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 144 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 160 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 176 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 192 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 208 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 224 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 240 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 256 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 272 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 288 - hash: "66539e1b1983d95386b0d30d6e969904" - } - Frame { - msec: 304 - hash: "66539e1b1983d95386b0d30d6e969904" - } -} diff --git a/tests/auto/declarative/qmlvisual/qmlvisual.pro b/tests/auto/declarative/qmlvisual/qmlvisual.pro index a3abbe3..dca9b04 100644 --- a/tests/auto/declarative/qmlvisual/qmlvisual.pro +++ b/tests/auto/declarative/qmlvisual/qmlvisual.pro @@ -4,7 +4,34 @@ macx:CONFIG -= app_bundle SOURCES += tst_qmlvisual.cpp -DEFINES += QT_TEST_SOURCE_DIR=\"\\\"$$PWD\\\"\" +symbian: { + importFiles.path = + importFiles.sources = animation \ + fillmode \ + focusscope \ + ListView \ + qdeclarativeborderimage \ + qdeclarativeflickable \ + qdeclarativeflipable \ + qdeclarativegridview \ + qdeclarativemousearea \ + qdeclarativeparticles \ + qdeclarativepathview \ + qdeclarativepositioners \ + qdeclarativesmoothedanimation \ + qdeclarativespringfollow \ + qdeclarativetext \ + qdeclarativetextedit \ + qdeclarativetextinput \ + rect \ + repeater \ + selftest_noimages \ + webview + DEPLOYMENT = importFiles + + DEFINES += QT_TEST_SOURCE_DIR=\".\" +} else { + DEFINES += QT_TEST_SOURCE_DIR=\"\\\"$$PWD\\\"\" +} CONFIG += parallel_test - diff --git a/tests/auto/declarative/qmlvisual/tst_qmlvisual.cpp b/tests/auto/declarative/qmlvisual/tst_qmlvisual.cpp index 0f33a07..4aad29b 100644 --- a/tests/auto/declarative/qmlvisual/tst_qmlvisual.cpp +++ b/tests/auto/declarative/qmlvisual/tst_qmlvisual.cpp @@ -82,7 +82,7 @@ QString tst_qmlvisual::viewer() #if defined(Q_WS_MAC) qmlruntime = QDir(binaries).absoluteFilePath("qml.app/Contents/MacOS/qml"); -#elif defined(Q_WS_WIN) +#elif defined(Q_WS_WIN) || defined(Q_WS_S60) qmlruntime = QDir(binaries).absoluteFilePath("qml.exe"); #else qmlruntime = QDir(binaries).absoluteFilePath("qml"); diff --git a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/autosize.qml b/tests/auto/declarative/qmlvisual/webview/autosize/autosize.qml index c4a502e..c4a502e 100644 --- a/tests/auto/declarative/qmlvisual/qfxwebview/autosize/autosize.qml +++ b/tests/auto/declarative/qmlvisual/webview/autosize/autosize.qml diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.0.png b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.0.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.0.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.1.png b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.1.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.1.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.2.png b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.2.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.2.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.3.png b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.3.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.3.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.4.png b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.4.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.4.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.qml b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.qml new file mode 100644 index 0000000..6122138 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data-X11/autosize.qml @@ -0,0 +1,115 @@ +import Qt.VisualTest 4.7 + +VisualTest { + Frame { + msec: 0 + } + Frame { + msec: 16 + hash: "b2d863e57dee2a297d038e18acc70f92" + } + Frame { + msec: 32 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 48 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 64 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 80 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 96 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 112 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 128 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 144 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 160 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 176 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 192 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 208 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 224 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 240 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 256 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 272 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 288 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 304 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 320 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 336 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 352 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 368 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 384 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 400 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 416 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 432 + hash: "903a4c7e619abba5342c8c827f26a722" + } +} diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.0.png b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.0.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.0.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.1.png b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.1.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.1.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.2.png b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.2.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.2.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.3.png b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.3.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.3.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.4.png b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.4.png Binary files differnew file mode 100644 index 0000000..ed87174 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.4.png diff --git a/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.qml b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.qml new file mode 100644 index 0000000..6122138 --- /dev/null +++ b/tests/auto/declarative/qmlvisual/webview/autosize/data/autosize.qml @@ -0,0 +1,115 @@ +import Qt.VisualTest 4.7 + +VisualTest { + Frame { + msec: 0 + } + Frame { + msec: 16 + hash: "b2d863e57dee2a297d038e18acc70f92" + } + Frame { + msec: 32 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 48 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 64 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 80 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 96 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 112 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 128 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 144 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 160 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 176 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 192 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 208 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 224 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 240 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 256 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 272 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 288 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 304 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 320 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 336 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 352 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 368 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 384 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 400 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 416 + hash: "903a4c7e619abba5342c8c827f26a722" + } + Frame { + msec: 432 + hash: "903a4c7e619abba5342c8c827f26a722" + } +} diff --git a/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.0.png b/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.0.png Binary files differdeleted file mode 100644 index 57de710..0000000 --- a/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.0.png +++ /dev/null diff --git a/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.qml b/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.qml deleted file mode 100644 index 9664566..0000000 --- a/tests/auto/declarative/qmlvisual/webview/embedding/data/nesting.qml +++ /dev/null @@ -1,363 +0,0 @@ -import Qt.VisualTest 4.7 - -VisualTest { - Frame { - msec: 0 - } - Frame { - msec: 16 - hash: "5dc8dca7a73022fbf2116b654b709244" - } - Frame { - msec: 32 - hash: "5dc8dca7a73022fbf2116b654b709244" - } - Frame { - msec: 48 - hash: "34079c4076ab6aadd8b64fcba7d95e15" - } - Frame { - msec: 64 - hash: "5ab5fc62b49e78d0609dcb4be6c9a157" - } - Frame { - msec: 80 - hash: "063cc7438bbffae717648d98006021a8" - } - Frame { - msec: 96 - hash: "c5cd16663e48639cbeade82c3bfa0403" - } - Frame { - msec: 112 - hash: "ea7f8df84ddbad0f683fe97ddb0a0130" - } - Frame { - msec: 128 - hash: "3c353e09bdb3a1e6ff388ad6020f55ea" - } - Frame { - msec: 144 - hash: "5b6de430365d0c9824337011916b0c0b" - } - Frame { - msec: 160 - hash: "48d353ac9e7ee1ce41361d0a2b47e008" - } - Frame { - msec: 176 - hash: "c96e4d02d343ddd78e8d3dd6aa8e0198" - } - Frame { - msec: 192 - hash: "543c63d77ec635b77672ba4c5160a3d4" - } - Frame { - msec: 208 - hash: "2d56ad9c2352e555fef613d625e71151" - } - Frame { - msec: 224 - hash: "18e433c3e3ee64510f875f674791d51c" - } - Frame { - msec: 240 - hash: "56889122c1ddacdd8ebd88310c7410bc" - } - Frame { - msec: 256 - hash: "d51c85458e0109bd5bf9528b741d98d0" - } - Frame { - msec: 272 - hash: "ac54137afc29a3022c6f01df7cdf2fd6" - } - Frame { - msec: 288 - hash: "c7a42b389bae3b729ba9e6cba7f54530" - } - Frame { - msec: 304 - hash: "7583b55841e80891652c3472c658f989" - } - Frame { - msec: 320 - hash: "95a7f8d47c3788261427727f82c9ff59" - } - Frame { - msec: 336 - hash: "a87bad3e2f010680e16cd1e3f5e03e99" - } - Frame { - msec: 352 - hash: "e16bc51653f21819e0eec412b99a069f" - } - Frame { - msec: 368 - hash: "f1e869580ac148ae207141c5f0adc185" - } - Frame { - msec: 384 - hash: "7e496e44363a16d7c62e4258af9ce087" - } - Frame { - msec: 400 - hash: "19e97915c84d3554c66d5a9ad3aa6a3e" - } - Frame { - msec: 416 - hash: "181181b48a1085d1850f18ca9b163549" - } - Frame { - msec: 432 - hash: "4637cb04595a543867bd43b0c1c829ea" - } - Frame { - msec: 448 - hash: "bd0a074fed5507f8556de6110bf56aa4" - } - Frame { - msec: 464 - hash: "9547618923edac6f7f9a3ff324c4f2d8" - } - Frame { - msec: 480 - hash: "a2f90c88eacb7c66878d45e33c2a787d" - } - Frame { - msec: 496 - hash: "d5ffd3e35d0426887c106069310f84d8" - } - Frame { - msec: 512 - hash: "6bc50a5b76e2a2ef0e6bee762abeb330" - } - Frame { - msec: 528 - hash: "d4439933c842ed8432434d272fea2845" - } - Frame { - msec: 544 - hash: "61699e6ec476ac3f090e4f485430421d" - } - Frame { - msec: 560 - hash: "02d7fa9bcd697d2cab364d0a3ca4a0e2" - } - Frame { - msec: 576 - hash: "914178cbf1f6a6822cc40f81823475e4" - } - Frame { - msec: 592 - hash: "280f867ea27891ee764332998567d40d" - } - Frame { - msec: 608 - hash: "ea0d00fe54a172a89c24eac781f7ae6d" - } - Frame { - msec: 624 - hash: "4e910fb507964a710e26f318c62227bf" - } - Frame { - msec: 640 - hash: "b0c3392eb739f270dd21f552ad999c23" - } - Frame { - msec: 656 - hash: "f3698c83b0972bd66a53ad95d4fc301e" - } - Frame { - msec: 672 - hash: "0d303a0d6a9b626943ac93cc6f3fb230" - } - Frame { - msec: 688 - hash: "ba56d49e6f51aa6f1bd2a7500e3538fd" - } - Frame { - msec: 704 - hash: "273ce89d5194168e5bfd1dcefad49be2" - } - Frame { - msec: 720 - hash: "c2beef4fb7996dbccdaff4f54bdc33f1" - } - Frame { - msec: 736 - hash: "1e1aa7d84f27158a8e61bd8698ddbf2a" - } - Frame { - msec: 752 - hash: "24e82479802e710c673133ca0413be66" - } - Frame { - msec: 768 - hash: "b77e935a690bcb396e15b942d772cf1b" - } - Frame { - msec: 784 - hash: "7b729c74df1d15d6b0e8e1fc19c2d710" - } - Frame { - msec: 800 - hash: "fd6cbdca3e481baaf35022dfea76e74c" - } - Frame { - msec: 816 - hash: "c975f6eb592793aa81895ffcb74ca577" - } - Frame { - msec: 832 - hash: "677c4039a650df53b4e885f37b049ab3" - } - Frame { - msec: 848 - hash: "89563aae36552cb1749ec06567e46d9d" - } - Frame { - msec: 864 - hash: "01f57402874de6608cc02937aaf91794" - } - Frame { - msec: 880 - hash: "50c9c4e5eaaadee1ff230975390d34e3" - } - Frame { - msec: 896 - hash: "20b7d277d398afad59afdf9e6b41a57e" - } - Frame { - msec: 912 - hash: "8f9ea938a2375afeba419199de66dd52" - } - Frame { - msec: 928 - hash: "b96745888ba954bcf304c0840a030f93" - } - Frame { - msec: 944 - hash: "f5715e931274011123160f7ad10d6c52" - } - Frame { - msec: 960 - image: "nesting.0.png" - } - Frame { - msec: 976 - hash: "459fe967816c795a177a3926093fae75" - } - Frame { - msec: 992 - hash: "c599a26083068b6db628c8d8416bab60" - } - Frame { - msec: 1008 - hash: "e0aee7d1152c971b1beee9d36542acb7" - } - Frame { - msec: 1024 - hash: "2af0facdf6412f7b06979aae25e4db26" - } - Frame { - msec: 1040 - hash: "f147a92cb1826f95d4fdb7d011ba79b1" - } - Frame { - msec: 1056 - hash: "12a1cb894b0fb8e44152cccacf855c1a" - } - Frame { - msec: 1072 - hash: "c7500cf58b74fef2c3e9820d1de8f843" - } - Frame { - msec: 1088 - hash: "3a031b2206835f8b2dc9837016df6ae6" - } - Frame { - msec: 1104 - hash: "7a4796b419bbc04237764dea0b1d47d5" - } - Frame { - msec: 1120 - hash: "151d350f0064e2faf0bfb9c58bc3e4f2" - } - Frame { - msec: 1136 - hash: "d72c20a97e678908acc1d6c1f8114d9e" - } - Frame { - msec: 1152 - hash: "22da1e645640a3c31b064ff757113197" - } - Frame { - msec: 1168 - hash: "401f0bf370e2ecea5a84276fb72eb1da" - } - Frame { - msec: 1184 - hash: "c6e00d7b0ac14a5c3860b6a29901c915" - } - Frame { - msec: 1200 - hash: "f1f7dc55d7719fcb6e97157c0ca85fc0" - } - Frame { - msec: 1216 - hash: "6a112e1d79c7128c235d093e4f1f9325" - } - Frame { - msec: 1232 - hash: "14a2caf8cdca8d5147261a315059b69d" - } - Frame { - msec: 1248 - hash: "5645243aa3cfd12b0b32442f063bedb2" - } - Frame { - msec: 1264 - hash: "c7f72534a88e33c72a54cb8580534551" - } - Frame { - msec: 1280 - hash: "6cd5e2e8e0128586a682b3c649ae0631" - } - Frame { - msec: 1296 - hash: "67cefb4526b52d40a31811bc0dfaeb6a" - } - Frame { - msec: 1312 - hash: "fbe2a43a27bf490719c8b9e2b094e34f" - } - Frame { - msec: 1328 - hash: "e028aad6f51a47d8189efcf9c5d277ee" - } - Frame { - msec: 1344 - hash: "2b4cc50c37c07289fa6f9309991d36da" - } - Frame { - msec: 1360 - hash: "b67b2244cd0616d07e100d7b3b00bbe2" - } - Frame { - msec: 1376 - hash: "4e4690cffc98c49e91bdb600f1e94c79" - } - Frame { - msec: 1392 - hash: "e5215c727836a5547a170d42363bc5c8" - } - Frame { - msec: 1408 - hash: "26868e91d1794bb3f42d51f508fef613" - } - Frame { - msec: 1424 - hash: "1e5f431b125a66096ac9a4d5a211a2c4" - } -} diff --git a/tests/auto/declarative/qmlvisual/webview/embedding/egg.qml b/tests/auto/declarative/qmlvisual/webview/embedding/egg.qml deleted file mode 100644 index c569c9a..0000000 --- a/tests/auto/declarative/qmlvisual/webview/embedding/egg.qml +++ /dev/null @@ -1,26 +0,0 @@ -import Qt 4.7 - -Item { - property variant period : 250 - property variant color : "black" - id: root - - Item { - x: root.width/2 - y: root.height/2 - Rectangle { - radius: width/2 - color: root.color - x: -width/2 - y: -height/2 - width: root.width*1.5 - height: root.height*1.5 - } - rotation: NumberAnimation { - from: 0 - to: 360 - repeat: true - duration: root.period - } - } -} diff --git a/tests/auto/declarative/qmlvisual/webview/embedding/nesting.html b/tests/auto/declarative/qmlvisual/webview/embedding/nesting.html deleted file mode 100644 index 6e81689..0000000 --- a/tests/auto/declarative/qmlvisual/webview/embedding/nesting.html +++ /dev/null @@ -1,9 +0,0 @@ -<html> -<head><title>Nesting</title> -<link rel="icon" sizes="48x48" href="basic.png"> -</head> -<body bgcolor="green"> -<h1>Nesting</h1> -This is a test... -<OBJECT data=egg.qml TYPE=application/x-qt-plugin width=50 height=70 period=2000 color=white></OBJECT> -... with a spinning QML egg nested in it. diff --git a/tests/auto/declarative/qmlvisual/webview/embedding/nesting.qml b/tests/auto/declarative/qmlvisual/webview/embedding/nesting.qml deleted file mode 100644 index 9e008de..0000000 --- a/tests/auto/declarative/qmlvisual/webview/embedding/nesting.qml +++ /dev/null @@ -1,9 +0,0 @@ -import Qt 4.7 -import org.webkit 1.0 - -WebView { - width: 300 - height: 200 - url: "nesting.html" - settings.pluginsEnabled: true -} diff --git a/tests/auto/declarative/qpacketprotocol/tst_qpacketprotocol.cpp b/tests/auto/declarative/qpacketprotocol/tst_qpacketprotocol.cpp index b8e317e..7d34698 100644 --- a/tests/auto/declarative/qpacketprotocol/tst_qpacketprotocol.cpp +++ b/tests/auto/declarative/qpacketprotocol/tst_qpacketprotocol.cpp @@ -225,7 +225,7 @@ void tst_QPacketProtocol::read() void tst_QPacketProtocol::device() { QPacketProtocol p(m_client); - QCOMPARE(p.device(), m_client); + QVERIFY(p.device() == m_client); } void tst_QPacketProtocol::tst_QPacket_clear() diff --git a/tests/benchmarks/declarative/binding/binding.pro b/tests/benchmarks/declarative/binding/binding.pro index 5ceaf34..268541f 100644 --- a/tests/benchmarks/declarative/binding/binding.pro +++ b/tests/benchmarks/declarative/binding/binding.pro @@ -8,11 +8,11 @@ SOURCES += tst_binding.cpp testtypes.cpp HEADERS += testtypes.h # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" - -symbian* { - data.sources = data/* - data.path = data - DEPLOYMENT = data +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" } - diff --git a/tests/benchmarks/declarative/creation/creation.pro b/tests/benchmarks/declarative/creation/creation.pro index 3e0caf6..08ad772 100644 --- a/tests/benchmarks/declarative/creation/creation.pro +++ b/tests/benchmarks/declarative/creation/creation.pro @@ -6,10 +6,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_creation.cpp -symbian* { - data.sources = data/* - data.path = data - DEPLOYMENT += addFiles +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles } else { DEFINES += SRCDIR=\\\"$$PWD\\\" -}
\ No newline at end of file +} diff --git a/tests/benchmarks/declarative/creation/tst_creation.cpp b/tests/benchmarks/declarative/creation/tst_creation.cpp index 99324f4..6e9197b 100644 --- a/tests/benchmarks/declarative/creation/tst_creation.cpp +++ b/tests/benchmarks/declarative/creation/tst_creation.cpp @@ -50,12 +50,6 @@ #include <QDeclarativeContext> #include <private/qobject_p.h> -#ifdef Q_OS_SYMBIAN -// In Symbian OS test data is located in applications private dir -// Application private dir is default serach path for files, so SRCDIR can be set to empty -#define SRCDIR "" -#endif - class tst_creation : public QObject { Q_OBJECT diff --git a/tests/benchmarks/declarative/declarative.pro b/tests/benchmarks/declarative/declarative.pro index a7d426c..262247a 100644 --- a/tests/benchmarks/declarative/declarative.pro +++ b/tests/benchmarks/declarative/declarative.pro @@ -1,8 +1,11 @@ TEMPLATE = subdirs +!symbian: { + SUBDIRS += painting +} + SUBDIRS += \ binding \ creation \ - painting \ pointers \ qdeclarativecomponent \ qdeclarativeimage \ diff --git a/tests/benchmarks/declarative/qdeclarativecomponent/qdeclarativecomponent.pro b/tests/benchmarks/declarative/qdeclarativecomponent/qdeclarativecomponent.pro index 30ef235..670e425 100644 --- a/tests/benchmarks/declarative/qdeclarativecomponent/qdeclarativecomponent.pro +++ b/tests/benchmarks/declarative/qdeclarativecomponent/qdeclarativecomponent.pro @@ -8,15 +8,11 @@ SOURCES += tst_qdeclarativecomponent.cpp testtypes.cpp HEADERS += testtypes.h # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" - -symbian* { - data.sources = data/* - data.path = data - samegame.sources = data/samegame/* - samegame.path = data/samegame - samegame_pics.sources = data/samegame/pics/* - samegame_pics.path = data/samegame/pics - DEPLOYMENT += data samegame samegame_pics +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" } - diff --git a/tests/benchmarks/declarative/qdeclarativeimage/qdeclarativeimage.pro b/tests/benchmarks/declarative/qdeclarativeimage/qdeclarativeimage.pro index bbe4e8d..fb5779a 100644 --- a/tests/benchmarks/declarative/qdeclarativeimage/qdeclarativeimage.pro +++ b/tests/benchmarks/declarative/qdeclarativeimage/qdeclarativeimage.pro @@ -7,10 +7,12 @@ CONFIG += release SOURCES += tst_qdeclarativeimage.cpp -symbian* { - data.sources = image.png - data.path = . - DEPLOYMENT += data +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = image.png + importFiles.path = + DEPLOYMENT = importFiles } else { DEFINES += SRCDIR=\\\"$$PWD\\\" } + diff --git a/tests/benchmarks/declarative/qdeclarativeimage/tst_qdeclarativeimage.cpp b/tests/benchmarks/declarative/qdeclarativeimage/tst_qdeclarativeimage.cpp index e2e8c8a..e979f20 100644 --- a/tests/benchmarks/declarative/qdeclarativeimage/tst_qdeclarativeimage.cpp +++ b/tests/benchmarks/declarative/qdeclarativeimage/tst_qdeclarativeimage.cpp @@ -44,12 +44,6 @@ #include <QDeclarativeComponent> #include <private/qdeclarativeimage_p.h> -#ifdef Q_OS_SYMBIAN -// In Symbian OS test data is located in applications private dir -// Application private dir is default serach path for files, so SRCDIR can be set to empty -#define SRCDIR "" -#endif - class tst_qmlgraphicsimage : public QObject { Q_OBJECT diff --git a/tests/benchmarks/declarative/qdeclarativemetaproperty/qdeclarativemetaproperty.pro b/tests/benchmarks/declarative/qdeclarativemetaproperty/qdeclarativemetaproperty.pro index 79fdd26..55dfafe 100644 --- a/tests/benchmarks/declarative/qdeclarativemetaproperty/qdeclarativemetaproperty.pro +++ b/tests/benchmarks/declarative/qdeclarativemetaproperty/qdeclarativemetaproperty.pro @@ -7,4 +7,11 @@ macx:CONFIG -= app_bundle SOURCES += tst_qdeclarativemetaproperty.cpp # Define SRCDIR equal to test's source directory -DEFINES += SRCDIR=\\\"$$PWD\\\" +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles +} else { + DEFINES += SRCDIR=\\\"$$PWD\\\" +} diff --git a/tests/benchmarks/declarative/script/script.pro b/tests/benchmarks/declarative/script/script.pro index 6255acc..91db871 100644 --- a/tests/benchmarks/declarative/script/script.pro +++ b/tests/benchmarks/declarative/script/script.pro @@ -7,10 +7,11 @@ CONFIG += release SOURCES += tst_script.cpp -symbian* { - data.sources = data/* - data.path = data - DEPLOYMENT += data +symbian: { + DEFINES += SRCDIR=\".\" + importFiles.sources = data + importFiles.path = + DEPLOYMENT = importFiles } else { DEFINES += SRCDIR=\\\"$$PWD\\\" } diff --git a/tests/benchmarks/declarative/script/tst_script.cpp b/tests/benchmarks/declarative/script/tst_script.cpp index 8ea6dcd..6dc7ed6 100644 --- a/tests/benchmarks/declarative/script/tst_script.cpp +++ b/tests/benchmarks/declarative/script/tst_script.cpp @@ -48,12 +48,6 @@ #include <QScriptEngine> #include <QScriptValue> -#ifdef Q_OS_SYMBIAN -// In Symbian OS test data is located in applications private dir -// Application private dir is default serach path for files, so SRCDIR can be set to empty -#define SRCDIR "." -#endif - class tst_script : public QObject { Q_OBJECT diff --git a/tools/qml/main.cpp b/tools/qml/main.cpp index 003716e..116ca71 100644 --- a/tools/qml/main.cpp +++ b/tools/qml/main.cpp @@ -184,7 +184,7 @@ int main(int argc, char ** argv) atexit(showWarnings); #endif -#if defined (Q_WS_X11) || defined(Q_WS_MAC) +#if defined (Q_WS_X11) //### default to using raster graphics backend for now bool gsSpecified = false; for (int i = 0; i < argc; ++i) { diff --git a/tools/qml/qml.pri b/tools/qml/qml.pri index d343c76..3c86d31 100644 --- a/tools/qml/qml.pri +++ b/tools/qml/qml.pri @@ -24,6 +24,12 @@ maemo5 { } else { SOURCES += $$PWD/deviceorientation.cpp } + +symbian { + INCLUDEPATH += $$QT_SOURCE_TREE/examples/network/qftp/ + LIBS += -lesock -lcommdb -lconnmon -linsock +} + FORMS = $$PWD/recopts.ui \ $$PWD/proxysettings.ui diff --git a/tools/qml/qml.pro b/tools/qml/qml.pro index b33d48b..77a9533 100644 --- a/tools/qml/qml.pro +++ b/tools/qml/qml.pro @@ -32,9 +32,7 @@ wince* { symbian { TARGET.UID3 = 0x20021317 include($$QT_SOURCE_TREE/examples/symbianpkgrules.pri) - INCLUDEPATH += $$QT_SOURCE_TREE/examples/network/qftp/ TARGET.EPOCHEAPSIZE = 0x20000 0x2000000 - LIBS += -lesock -lcommdb -lconnmon -linsock TARGET.CAPABILITY = NetworkServices ReadUserData } mac { |