diff options
author | Benjamin Poulain <benjamin.poulain@nokia.com> | 2010-02-23 17:45:41 (GMT) |
---|---|---|
committer | Benjamin Poulain <benjamin.poulain@nokia.com> | 2010-02-23 17:45:41 (GMT) |
commit | 615972e09981a0916422716b4f6572c6401789da (patch) | |
tree | 82203c15bceebd5426c823852ef5c85ad025e92b /src/gui | |
parent | 60fd302e8d88b92ade59d68872c99310128c3a6c (diff) | |
parent | de4332a4728e739b37e9c7b04c021e150e096270 (diff) | |
download | Qt-615972e09981a0916422716b4f6572c6401789da.zip Qt-615972e09981a0916422716b4f6572c6401789da.tar.gz Qt-615972e09981a0916422716b4f6572c6401789da.tar.bz2 |
Merge branch 'master' of scm.dev.nokia.troll.no:qt/oslo-staging-1
Diffstat (limited to 'src/gui')
162 files changed, 3871 insertions, 1372 deletions
diff --git a/src/gui/dialogs/qcolordialog.cpp b/src/gui/dialogs/qcolordialog.cpp index 83ecc30..e6abf7f 100644 --- a/src/gui/dialogs/qcolordialog.cpp +++ b/src/gui/dialogs/qcolordialog.cpp @@ -1078,8 +1078,7 @@ QColorShower::QColorShower(QColorDialog *parent) #ifdef QT_SMALL_COLORDIALOG # ifdef Q_WS_S60 - QS60Data s60Data = QS60Data(); - const bool nonTouchUI = !s60Data.hasTouchscreen; + const bool nonTouchUI = !S60->hasTouchscreen; # elif defined Q_WS_MAEMO_5 const bool nonTouchUI = false; # endif @@ -1506,8 +1505,7 @@ void QColorDialogPrivate::init(const QColor &initial) #if defined(QT_SMALL_COLORDIALOG) # if defined(Q_WS_S60) - QS60Data s60Data = QS60Data(); - const bool nonTouchUI = !s60Data.hasTouchscreen; + const bool nonTouchUI = !S60->hasTouchscreen; # elif defined(Q_WS_MAEMO_5) const bool nonTouchUI = false; # endif diff --git a/src/gui/dialogs/qdialog.cpp b/src/gui/dialogs/qdialog.cpp index 9ff2ad8..fb0dba4 100644 --- a/src/gui/dialogs/qdialog.cpp +++ b/src/gui/dialogs/qdialog.cpp @@ -648,13 +648,14 @@ void QDialog::contextMenuEvent(QContextMenuEvent *e) while (w && w->whatsThis().size() == 0 && !w->testAttribute(Qt::WA_CustomWhatsThis)) w = w->isWindow() ? 0 : w->parentWidget(); if (w) { - QMenu p(this); - QAction *wt = p.addAction(tr("What's This?")); - if (p.exec(e->globalPos()) == wt) { + QWeakPointer<QMenu> p = new QMenu(this); + QAction *wt = p.data()->addAction(tr("What's This?")); + if (p.data()->exec(e->globalPos()) == wt) { QHelpEvent e(QEvent::WhatsThis, w->rect().center(), w->mapToGlobal(w->rect().center())); QApplication::sendEvent(w, &e); } + delete p.data(); } #endif } diff --git a/src/gui/dialogs/qfiledialog.cpp b/src/gui/dialogs/qfiledialog.cpp index 21650bb..089e04a 100644 --- a/src/gui/dialogs/qfiledialog.cpp +++ b/src/gui/dialogs/qfiledialog.cpp @@ -229,11 +229,10 @@ Q_GUI_EXPORT _qt_filedialog_save_filename_hook qt_filedialog_save_filename_hook \value ReadOnly Indicates that the model is readonly. \value HideNameFilterDetails Indicates if the is hidden or not. - This value is obsolete and does nothing since Qt 4.5: \value DontUseSheet In previous versions of Qt, the static functions would create a sheet by default if the static function - was given a parent. This is no longer supported in Qt 4.5, The + was given a parent. This is no longer supported and does nothing in Qt 4.5, The static functions will always be an application modal dialog. If you want to use sheets, use QFileDialog::open() instead. diff --git a/src/gui/dialogs/qfiledialog_win_p.h b/src/gui/dialogs/qfiledialog_win_p.h index 527ab3f..44b7e43 100644 --- a/src/gui/dialogs/qfiledialog_win_p.h +++ b/src/gui/dialogs/qfiledialog_win_p.h @@ -1,6 +1,6 @@ /**************************************************************************** ** -** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies). +** Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies). ** All rights reserved. ** Contact: Nokia Corporation (qt-info@nokia.com) ** diff --git a/src/gui/dialogs/qfilesystemmodel.cpp b/src/gui/dialogs/qfilesystemmodel.cpp index 0e1837b..ba0a560 100644 --- a/src/gui/dialogs/qfilesystemmodel.cpp +++ b/src/gui/dialogs/qfilesystemmodel.cpp @@ -51,6 +51,9 @@ #ifdef Q_OS_WIN #include <qt_windows.h> #endif +#ifdef Q_OS_WIN32 +#include <QtCore/QVarLengthArray> +#endif QT_BEGIN_NAMESPACE @@ -278,53 +281,38 @@ QFileSystemModelPrivate::QFileSystemNode *QFileSystemModelPrivate::node(const QM return indexNode; } -#ifdef Q_OS_WIN +#ifdef Q_OS_WIN32 static QString qt_GetLongPathName(const QString &strShortPath) { - QString longPath; - int i = 0; - if (strShortPath == QLatin1String(".") - || (strShortPath.startsWith(QLatin1String("//"))) - || (strShortPath.startsWith(QLatin1String("\\\\")))) // unc + if (strShortPath.isEmpty() + || strShortPath == QLatin1String(".") || strShortPath == QLatin1String("..")) return strShortPath; - QString::const_iterator it = strShortPath.constBegin(); - QString::const_iterator constEnd = strShortPath.constEnd(); - do { - bool isSep = (*it == QLatin1Char('\\') || *it == QLatin1Char('/')); - if (isSep || it == constEnd) { - QString section = (it == constEnd ? strShortPath : strShortPath.left(i)); - // FindFirstFile does not handle volumes ("C:"), so we have to catch that ourselves. - if (section.endsWith(QLatin1Char(':'))) { - longPath.append(section.toUpper()); - } else { - HANDLE h; -#ifndef Q_OS_WINCE - //We add the extend length prefix to handle long path - QString longSection = QLatin1String("\\\\?\\")+QDir::toNativeSeparators(section); -#else - QString longSection = QDir::toNativeSeparators(section); -#endif - WIN32_FIND_DATA findData; - h = ::FindFirstFile((wchar_t*)longSection.utf16(), &findData); - if (h != INVALID_HANDLE_VALUE) { - longPath.append(QString::fromWCharArray(findData.cFileName)); - ::FindClose(h); - } else { - longPath.append(section); - break; - } - } - if (it != constEnd) - longPath.append(*it); - else - break; - } - ++it; - if (isSep && it == constEnd) // break out if the last character is a separator - break; - ++i; - } while (true); - return longPath; + if (strShortPath.length() == 2 && strShortPath.endsWith(QLatin1Char(':'))) + return strShortPath.toUpper(); + const QString absPath = QDir(strShortPath).absolutePath(); + if (absPath.startsWith(QLatin1String("//")) + || absPath.startsWith(QLatin1String("\\\\"))) // unc + return QDir::fromNativeSeparators(absPath); + if (absPath.startsWith(QLatin1Char('/'))) + return QString(); + const QString inputString = QLatin1String("\\\\?\\") + QDir::toNativeSeparators(absPath); + QVarLengthArray<TCHAR, MAX_PATH> buffer(MAX_PATH); + DWORD result = ::GetLongPathName((wchar_t*)inputString.utf16(), + buffer.data(), + buffer.size()); + if (result > DWORD(buffer.size())) { + buffer.resize(result); + result = ::GetLongPathName((wchar_t*)inputString.utf16(), + buffer.data(), + buffer.size()); + } + if (result > 4) { + QString longPath = QString::fromWCharArray(buffer.data() + 4); // ignoring prefix + longPath[0] = longPath.at(0).toUpper(); // capital drive letters + return QDir::fromNativeSeparators(longPath); + } else { + return QDir::fromNativeSeparators(strShortPath); + } } #endif @@ -342,7 +330,7 @@ QFileSystemModelPrivate::QFileSystemNode *QFileSystemModelPrivate::node(const QS // Construct the nodes up to the new root path if they need to be built QString absolutePath; -#ifdef Q_OS_WIN +#ifdef Q_OS_WIN32 QString longPath = qt_GetLongPathName(path); #else QString longPath = path; @@ -1357,7 +1345,11 @@ QModelIndex QFileSystemModel::setRootPath(const QString &newPath) { Q_D(QFileSystemModel); #ifdef Q_OS_WIN - QString longNewPath = QDir::fromNativeSeparators(qt_GetLongPathName(newPath)); +#ifdef Q_OS_WIN32 + QString longNewPath = qt_GetLongPathName(newPath); +#else + QString longNewPath = QDir::fromNativeSeparators(newPath); +#endif #else QString longNewPath = newPath; #endif diff --git a/src/gui/dialogs/qmessagebox.cpp b/src/gui/dialogs/qmessagebox.cpp index d1b2e3f..ed437ff 100644 --- a/src/gui/dialogs/qmessagebox.cpp +++ b/src/gui/dialogs/qmessagebox.cpp @@ -92,8 +92,8 @@ public: { #ifndef QT_NO_CONTEXTMENU QMenu *menu = createStandardContextMenu(); - menu->exec(e->globalPos()); - delete menu; + menu->setAttribute(Qt::WA_DeleteOnClose); + menu->popup(e->globalPos()); #else Q_UNUSED(e); #endif diff --git a/src/gui/dialogs/qprintdialog_qws.cpp b/src/gui/dialogs/qprintdialog_qws.cpp index 6b531a2..1336c04 100644 --- a/src/gui/dialogs/qprintdialog_qws.cpp +++ b/src/gui/dialogs/qprintdialog_qws.cpp @@ -163,7 +163,7 @@ void QPrintDialogPrivate::_q_okClicked() printer->setPaperSize(pageSize); printer->setPageOrder(pageOrder2); printer->setColorMode(colorMode2); - printer->setNumCopies(numCopies); + printer->setCopyCount(numCopies); switch ((rangeCombo->itemData(rangeCombo->currentIndex())).toInt()){ case (int)QPrintDialog::AllPages: @@ -479,8 +479,8 @@ void QPrintDialogPrivate::setPrinter(QPrinter *p, bool pickUpSettings) printGray->setChecked(true); // number of copies - copies->setValue(p->numCopies()); - _q_setNumCopies(p->numCopies()); + copies->setValue(p->copyCount()); + _q_setNumCopies(p->copyCount()); } if (p) { diff --git a/src/gui/dialogs/qprintdialog_unix.cpp b/src/gui/dialogs/qprintdialog_unix.cpp index 23f5831..2d169cf 100644 --- a/src/gui/dialogs/qprintdialog_unix.cpp +++ b/src/gui/dialogs/qprintdialog_unix.cpp @@ -72,8 +72,6 @@ QT_BEGIN_NAMESPACE -extern int qt_printerRealNumCopies(QPaintEngine *); - class QOptionTreeItem; class QPPDOptionsModel; @@ -439,7 +437,7 @@ void QPrintDialogPrivate::applyPrinterProperties(QPrinter *p) case QPrinter::DuplexShortSide: options.duplexShort->setChecked(true); break; } - options.copies->setValue(qt_printerRealNumCopies(p->paintEngine())); + options.copies->setValue(p->copyCount()); options.collate->setChecked(p->collateCopies()); options.reverse->setChecked(p->pageOrder() == QPrinter::LastPageFirst); top->d->applyPrinterProperties(p); @@ -510,7 +508,7 @@ void QPrintDialogPrivate::setupPrinter() } // copies - p->setNumCopies(options.copies->value()); + p->setCopyCount(options.copies->value()); p->setCollateCopies(options.collate->isChecked()); top->d->setupPrinter(); diff --git a/src/gui/effects/qgraphicseffect.cpp b/src/gui/effects/qgraphicseffect.cpp index 10ef5ea..ce4ce6a 100644 --- a/src/gui/effects/qgraphicseffect.cpp +++ b/src/gui/effects/qgraphicseffect.cpp @@ -699,12 +699,17 @@ void QGraphicsColorizeEffect::draw(QPainter *painter) if (sourceIsPixmap()) { // No point in drawing in device coordinates (pixmap will be scaled anyways). const QPixmap pixmap = sourcePixmap(Qt::LogicalCoordinates, &offset, NoPad); - d->filter->draw(painter, offset, pixmap); + if (!pixmap.isNull()) + d->filter->draw(painter, offset, pixmap); + return; } // Draw pixmap in deviceCoordinates to avoid pixmap scaling. const QPixmap pixmap = sourcePixmap(Qt::DeviceCoordinates, &offset); + if (pixmap.isNull()) + return; + QTransform restoreTransform = painter->worldTransform(); painter->setWorldTransform(QTransform()); d->filter->draw(painter, offset, pixmap); @@ -721,7 +726,8 @@ void QGraphicsColorizeEffect::draw(QPainter *painter) elements. The level of detail can be modified using the setBlurRadius() function. Use setBlurHints() to choose the blur hints. - By default, the blur radius is 5 pixels. + By default, the blur radius is 5 pixels. The blur radius is specified in + device coordinates. \img graphicseffect-blur.png @@ -776,6 +782,9 @@ QGraphicsBlurEffect::~QGraphicsBlurEffect() radius results in a more blurred appearance. By default, the blur radius is 5 pixels. + + The radius is given in device coordinates, meaning it is + unaffected by scale. */ qreal QGraphicsBlurEffect::blurRadius() const { @@ -858,9 +867,11 @@ void QGraphicsBlurEffect::draw(QPainter *painter) if (painter->paintEngine()->type() == QPaintEngine::OpenGL2) mode = NoPad; - // Draw pixmap in device coordinates to avoid pixmap scaling. QPoint offset; QPixmap pixmap = sourcePixmap(Qt::LogicalCoordinates, &offset, mode); + if (pixmap.isNull()) + return; + d->filter->draw(painter, offset, pixmap); } @@ -877,7 +888,8 @@ void QGraphicsBlurEffect::draw(QPainter *painter) By default, the drop shadow is a semi-transparent dark gray (QColor(63, 63, 63, 180)) shadow, blurred with a radius of 1 at an offset - of 8 pixels towards the lower right. + of 8 pixels towards the lower right. The drop shadow offset is specified + in device coordinates. \img graphicseffect-drop-shadow.png @@ -906,6 +918,9 @@ QGraphicsDropShadowEffect::~QGraphicsDropShadowEffect() By default, the offset is 8 pixels towards the lower right. + The offset is given in device coordinates, which means it is + unaffected by scale. + \sa xOffset(), yOffset(), blurRadius(), color() */ QPointF QGraphicsDropShadowEffect::offset() const @@ -1047,6 +1062,9 @@ void QGraphicsDropShadowEffect::draw(QPainter *painter) // Draw pixmap in device coordinates to avoid pixmap scaling. QPoint offset; const QPixmap pixmap = sourcePixmap(Qt::DeviceCoordinates, &offset, mode); + if (pixmap.isNull()) + return; + QTransform restoreTransform = painter->worldTransform(); painter->setWorldTransform(QTransform()); d->filter->draw(painter, offset, pixmap); diff --git a/src/gui/egl/qegl.cpp b/src/gui/egl/qegl.cpp index ae3d6c3..0ed95ea 100644 --- a/src/gui/egl/qegl.cpp +++ b/src/gui/egl/qegl.cpp @@ -54,9 +54,10 @@ QT_BEGIN_NAMESPACE static QEglContext * volatile currentGLContext = 0; static QEglContext * volatile currentVGContext = 0; +EGLDisplay QEglContext::dpy = EGL_NO_DISPLAY; + QEglContext::QEglContext() : apiType(QEgl::OpenGL) - , dpy(EGL_NO_DISPLAY) , ctx(EGL_NO_CONTEXT) , cfg(0) , currentSurface(EGL_NO_SURFACE) @@ -68,7 +69,7 @@ QEglContext::QEglContext() QEglContext::~QEglContext() { - destroy(); + destroyContext(); if (currentGLContext == this) currentGLContext = 0; @@ -86,14 +87,6 @@ bool QEglContext::isCurrent() const return current; } -// Open the EGL display associated with "device". -bool QEglContext::openDisplay(QPaintDevice *device) -{ - if (dpy == EGL_NO_DISPLAY) - dpy = defaultDisplay(device); - return (dpy != EGL_NO_DISPLAY); -} - // Choose a configuration that matches "properties". bool QEglContext::chooseConfig (const QEglProperties& properties, QEgl::PixelFormatMatch match) @@ -102,13 +95,13 @@ bool QEglContext::chooseConfig do { // Get the number of matching configurations for this set of properties. EGLint matching = 0; - if (!eglChooseConfig(dpy, props.properties(), 0, 0, &matching) || !matching) + if (!eglChooseConfig(display(), props.properties(), 0, 0, &matching) || !matching) continue; // If we want the best pixel format, then return the first // matching configuration. if (match == QEgl::BestPixelFormat) { - eglChooseConfig(dpy, props.properties(), &cfg, 1, &matching); + eglChooseConfig(display(), props.properties(), &cfg, 1, &matching); if (matching < 1) continue; return true; @@ -118,13 +111,13 @@ bool QEglContext::chooseConfig // first that matches the pixel format we wanted. EGLint size = matching; EGLConfig *configs = new EGLConfig [size]; - eglChooseConfig(dpy, props.properties(), configs, size, &matching); + eglChooseConfig(display(), props.properties(), configs, size, &matching); for (EGLint index = 0; index < size; ++index) { EGLint red, green, blue, alpha; - eglGetConfigAttrib(dpy, configs[index], EGL_RED_SIZE, &red); - eglGetConfigAttrib(dpy, configs[index], EGL_GREEN_SIZE, &green); - eglGetConfigAttrib(dpy, configs[index], EGL_BLUE_SIZE, &blue); - eglGetConfigAttrib(dpy, configs[index], EGL_ALPHA_SIZE, &alpha); + eglGetConfigAttrib(display(), configs[index], EGL_RED_SIZE, &red); + eglGetConfigAttrib(display(), configs[index], EGL_GREEN_SIZE, &green); + eglGetConfigAttrib(display(), configs[index], EGL_BLUE_SIZE, &blue); + eglGetConfigAttrib(display(), configs[index], EGL_ALPHA_SIZE, &alpha); if (red == props.value(EGL_RED_SIZE) && green == props.value(EGL_GREEN_SIZE) && blue == props.value(EGL_BLUE_SIZE) && @@ -179,7 +172,7 @@ bool QEglContext::createContext(QEglContext *shareContext, const QEglProperties if (shareContext && shareContext->ctx == EGL_NO_CONTEXT) shareContext = 0; if (shareContext) { - ctx = eglCreateContext(dpy, cfg, shareContext->ctx, contextProps.properties()); + ctx = eglCreateContext(display(), cfg, shareContext->ctx, contextProps.properties()); if (ctx == EGL_NO_CONTEXT) { qWarning() << "QEglContext::createContext(): Could not share context:" << errorString(eglGetError()); shareContext = 0; @@ -188,7 +181,7 @@ bool QEglContext::createContext(QEglContext *shareContext, const QEglProperties } } if (ctx == EGL_NO_CONTEXT) { - ctx = eglCreateContext(dpy, cfg, 0, contextProps.properties()); + ctx = eglCreateContext(display(), cfg, 0, contextProps.properties()); if (ctx == EGL_NO_CONTEXT) { qWarning() << "QEglContext::createContext(): Unable to create EGL context:" << errorString(eglGetError()); return false; @@ -204,16 +197,15 @@ void QEglContext::destroySurface(EGLSurface surface) if (surface != EGL_NO_SURFACE) { if (surface == currentSurface) doneCurrent(); - eglDestroySurface(dpy, surface); + eglDestroySurface(display(), surface); } } // Destroy the context. Note: this does not destroy the surface. -void QEglContext::destroy() +void QEglContext::destroyContext() { if (ctx != EGL_NO_CONTEXT && ownsContext) - eglDestroyContext(dpy, ctx); - dpy = EGL_NO_DISPLAY; + eglDestroyContext(display(), ctx); ctx = EGL_NO_CONTEXT; cfg = 0; } @@ -248,7 +240,7 @@ bool QEglContext::makeCurrent(EGLSurface surface) eglBindAPI(EGL_OPENVG_API); #endif - bool ok = eglMakeCurrent(dpy, surface, surface, ctx); + bool ok = eglMakeCurrent(display(), surface, surface, ctx); if (!ok) qWarning() << "QEglContext::makeCurrent():" << errorString(eglGetError()); return ok; @@ -277,7 +269,7 @@ bool QEglContext::doneCurrent() eglBindAPI(EGL_OPENVG_API); #endif - bool ok = eglMakeCurrent(dpy, EGL_NO_SURFACE, EGL_NO_SURFACE, EGL_NO_CONTEXT); + bool ok = eglMakeCurrent(display(), EGL_NO_SURFACE, EGL_NO_SURFACE, EGL_NO_CONTEXT); if (!ok) qWarning() << "QEglContext::doneCurrent():" << errorString(eglGetError()); return ok; @@ -299,7 +291,7 @@ bool QEglContext::swapBuffers(EGLSurface surface) if(ctx == EGL_NO_CONTEXT) return false; - bool ok = eglSwapBuffers(dpy, surface); + bool ok = eglSwapBuffers(display(), surface); if (!ok) qWarning() << "QEglContext::swapBuffers():" << errorString(eglGetError()); return ok; @@ -338,7 +330,7 @@ void QEglContext::waitClient() // Query the value of a configuration attribute. bool QEglContext::configAttrib(int name, EGLint *value) const { - return eglGetConfigAttrib(dpy, cfg, name, value); + return eglGetConfigAttrib(display(), cfg, name, value); } // Retrieve all of the properties on "cfg". If zero, return @@ -350,34 +342,45 @@ QEglProperties QEglContext::configProperties(EGLConfig cfg) const QEglProperties props; for (int name = 0x3020; name <= 0x304F; ++name) { EGLint value; - if (name != EGL_NONE && eglGetConfigAttrib(dpy, cfg, name, &value)) + if (name != EGL_NONE && eglGetConfigAttrib(display(), cfg, name, &value)) props.setValue(name, value); } eglGetError(); // Clear the error state. return props; } -// Initialize and return the default display. -EGLDisplay QEglContext::defaultDisplay(QPaintDevice *device) +EGLDisplay QEglContext::display() { - static EGLDisplay dpy = EGL_NO_DISPLAY; - if (dpy == EGL_NO_DISPLAY) { - dpy = getDisplay(device); + static bool openedDisplay = false; + + if (!openedDisplay) { + dpy = eglGetDisplay(nativeDisplay()); + openedDisplay = true; + if (dpy == EGL_NO_DISPLAY) { + qWarning("QEglContext::display(): Falling back to EGL_DEFAULT_DISPLAY"); + dpy = eglGetDisplay(EGLNativeDisplayType(EGL_DEFAULT_DISPLAY)); + } if (dpy == EGL_NO_DISPLAY) { - qWarning() << "QEglContext::defaultDisplay(): Cannot open EGL display"; + qWarning("QEglContext::display(): Can't even open the default display"); return EGL_NO_DISPLAY; } + if (!eglInitialize(dpy, NULL, NULL)) { - qWarning() << "QEglContext::defaultDisplay(): Cannot initialize EGL display:" << errorString(eglGetError()); + qWarning() << "QEglContext::display(): Cannot initialize EGL display:" << errorString(eglGetError()); return EGL_NO_DISPLAY; } -#ifdef EGL_OPENGL_ES_API - eglBindAPI(EGL_OPENGL_ES_API); -#endif } + return dpy; } +#if !defined(Q_WS_X11) && !defined(Q_WS_WINCE) // WinCE & X11 implement this properly +EGLNativeDisplayType QEglContext::nativeDisplay() +{ + return EGL_DEFAULT_DISPLAY; +} +#endif + // Return the error string associated with a specific code. QString QEglContext::errorString(EGLint code) { @@ -410,10 +413,10 @@ void QEglContext::dumpAllConfigs() { QEglProperties props; EGLint count = 0; - if (!eglGetConfigs(dpy, 0, 0, &count) || count < 1) + if (!eglGetConfigs(display(), 0, 0, &count) || count < 1) return; EGLConfig *configs = new EGLConfig [count]; - eglGetConfigs(dpy, configs, count, &count); + eglGetConfigs(display(), configs, count, &count); for (EGLint index = 0; index < count; ++index) { props = configProperties(configs[index]); qWarning() << props.toString(); @@ -423,7 +426,7 @@ void QEglContext::dumpAllConfigs() QString QEglContext::extensions() { - const char* exts = eglQueryString(QEglContext::defaultDisplay(0), EGL_EXTENSIONS); + const char* exts = eglQueryString(QEglContext::display(), EGL_EXTENSIONS); return QString(QLatin1String(exts)); } @@ -431,7 +434,7 @@ bool QEglContext::hasExtension(const char* extensionName) { QList<QByteArray> extensions = QByteArray(reinterpret_cast<const char *> - (eglQueryString(QEglContext::defaultDisplay(0), EGL_EXTENSIONS))).split(' '); + (eglQueryString(QEglContext::display(), EGL_EXTENSIONS))).split(' '); return extensions.contains(extensionName); } diff --git a/src/gui/egl/qegl_p.h b/src/gui/egl/qegl_p.h index a7de9c8..87ed818 100644 --- a/src/gui/egl/qegl_p.h +++ b/src/gui/egl/qegl_p.h @@ -86,14 +86,12 @@ public: QEgl::API api() const { return apiType; } void setApi(QEgl::API api) { apiType = api; } - bool openDisplay(QPaintDevice *device); bool chooseConfig(const QEglProperties& properties, QEgl::PixelFormatMatch match = QEgl::ExactPixelFormat); bool createContext(QEglContext *shareContext = 0, const QEglProperties *properties = 0); + void destroyContext(); EGLSurface createSurface(QPaintDevice *device, const QEglProperties *properties = 0); void destroySurface(EGLSurface surface); - void destroy(); - bool makeCurrent(EGLSurface surface); bool doneCurrent(); bool lazyDoneCurrent(); @@ -108,7 +106,7 @@ public: static EGLint error() { return eglGetError(); } static QString errorString(EGLint code); - EGLDisplay display() const { return dpy; } + static EGLDisplay display(); EGLContext context() const { return ctx; } void setContext(EGLContext context) { ctx = context; ownsContext = false;} @@ -118,8 +116,6 @@ public: QEglProperties configProperties(EGLConfig cfg = 0) const; - static EGLDisplay defaultDisplay(QPaintDevice *device); - void dumpAllConfigs(); static QString extensions(); @@ -127,7 +123,6 @@ public: private: QEgl::API apiType; - EGLDisplay dpy; EGLContext ctx; EGLConfig cfg; EGLSurface currentSurface; @@ -135,7 +130,8 @@ private: bool ownsContext; bool sharing; - static EGLDisplay getDisplay(QPaintDevice *device); + static EGLDisplay dpy; + static EGLNativeDisplayType nativeDisplay(); static QEglContext *currentContext(QEgl::API api); static void setCurrentContext(QEgl::API api, QEglContext *context); diff --git a/src/gui/egl/qegl_qws.cpp b/src/gui/egl/qegl_qws.cpp index e999e0b..2a61beb 100644 --- a/src/gui/egl/qegl_qws.cpp +++ b/src/gui/egl/qegl_qws.cpp @@ -64,12 +64,6 @@ EGLSurface QEglContext::createSurface(QPaintDevice *device, const QEglProperties return EGL_NO_SURFACE; } -EGLDisplay QEglContext::getDisplay(QPaintDevice *device) -{ - Q_UNUSED(device); - return eglGetDisplay(EGLNativeDisplayType(EGL_DEFAULT_DISPLAY)); -} - static QScreen *screenForDevice(QPaintDevice *device) { QScreen *screen = qt_screen; diff --git a/src/gui/egl/qegl_symbian.cpp b/src/gui/egl/qegl_symbian.cpp index 44ecd19..5a010cd 100644 --- a/src/gui/egl/qegl_symbian.cpp +++ b/src/gui/egl/qegl_symbian.cpp @@ -78,22 +78,14 @@ EGLSurface QEglContext::createSurface(QPaintDevice *device, const QEglProperties props = 0; EGLSurface surf; if (devType == QInternal::Widget) - surf = eglCreateWindowSurface(dpy, cfg, windowDrawable, 0); + surf = eglCreateWindowSurface(dpy, cfg, windowDrawable, props); else - surf = eglCreatePixmapSurface(dpy, cfg, pixmapDrawable, 0); + surf = eglCreatePixmapSurface(dpy, cfg, pixmapDrawable, props); if (surf == EGL_NO_SURFACE) qWarning("QEglContext::createSurface(): Unable to create EGL surface, error = 0x%x", eglGetError()); return surf; } -EGLDisplay QEglContext::getDisplay(QPaintDevice *device) -{ - EGLDisplay dpy = eglGetDisplay(EGL_DEFAULT_DISPLAY); - if (dpy == EGL_NO_DISPLAY) - qWarning("QEglContext::defaultDisplay(): Falling back to EGL_DEFAULT_DISPLAY"); - return dpy; -} - // Set pixel format and other properties based on a paint device. void QEglProperties::setPaintDeviceFormat(QPaintDevice *dev) { diff --git a/src/gui/egl/qegl_wince.cpp b/src/gui/egl/qegl_wince.cpp index 026a7b1..c9c9773 100644 --- a/src/gui/egl/qegl_wince.cpp +++ b/src/gui/egl/qegl_wince.cpp @@ -87,20 +87,15 @@ EGLSurface QEglContext::createSurface(QPaintDevice *device, const QEglProperties return surf; } -EGLDisplay QEglContext::getDisplay(QPaintDevice *device) +EGLNativeDisplayType QEglContext::nativeDisplay() { - EGLDisplay dpy = 0; HWND win = (static_cast<QWidget*>(device))->winId(); HDC myDc = GetDC(win); if (!myDc) { - qWarning("QEglContext::defaultDisplay(): WinCE display is not open"); + qWarning("QEglContext::nativeDisplay(): WinCE display is not open"); + return EGL_DEFAULT_DISPLAY; } - dpy = eglGetDisplay(EGLNativeDisplayType(myDc)); - if (dpy == EGL_NO_DISPLAY) { - qWarning("QEglContext::defaultDisplay(): Falling back to EGL_DEFAULT_DISPLAY"); - dpy = eglGetDisplay(EGL_DEFAULT_DISPLAY); - } - return dpy; + return EGLNativeDisplayType(myDc); } // Set pixel format and other properties based on a paint device. diff --git a/src/gui/egl/qegl_x11.cpp b/src/gui/egl/qegl_x11.cpp index 2cf4e33..634ff13 100644 --- a/src/gui/egl/qegl_x11.cpp +++ b/src/gui/egl/qegl_x11.cpp @@ -93,15 +93,14 @@ EGLSurface QEglContext::createSurface(QPaintDevice *device, const QEglProperties return surf; } -EGLDisplay QEglContext::getDisplay(QPaintDevice *device) +EGLNativeDisplayType QEglContext::nativeDisplay() { - Q_UNUSED(device); Display *xdpy = QX11Info::display(); if (!xdpy) { qWarning("QEglContext::getDisplay(): X11 display is not open"); - return EGL_NO_DISPLAY; + return EGLNativeDisplayType(EGL_DEFAULT_DISPLAY); } - return eglGetDisplay(EGLNativeDisplayType(xdpy)); + return EGLNativeDisplayType(xdpy); } static int countBits(unsigned long mask) diff --git a/src/gui/egl/qeglproperties.cpp b/src/gui/egl/qeglproperties.cpp index 2915fb9..236ec37 100644 --- a/src/gui/egl/qeglproperties.cpp +++ b/src/gui/egl/qeglproperties.cpp @@ -60,7 +60,7 @@ QEglProperties::QEglProperties(EGLConfig cfg) props.append(EGL_NONE); for (int name = 0x3020; name <= 0x304F; ++name) { EGLint value; - if (name != EGL_NONE && eglGetConfigAttrib(QEglContext::defaultDisplay(0), cfg, name, &value)) + if (name != EGL_NONE && eglGetConfigAttrib(QEglContext::display(), cfg, name, &value)) setValue(name, value); } eglGetError(); // Clear the error state. @@ -273,12 +273,12 @@ static void addTag(QString& str, const QString& tag) void QEglProperties::dumpAllConfigs() { EGLint count = 0; - eglGetConfigs(QEglContext::defaultDisplay(0), 0, 0, &count); + eglGetConfigs(QEglContext::display(), 0, 0, &count); if (count < 1) return; EGLConfig *configs = new EGLConfig [count]; - eglGetConfigs(QEglContext::defaultDisplay(0), configs, count, &count); + eglGetConfigs(QEglContext::display(), configs, count, &count); for (EGLint index = 0; index < count; ++index) qWarning() << QEglProperties(configs[index]).toString(); delete [] configs; diff --git a/src/gui/embedded/directfb.pri b/src/gui/embedded/directfb.pri index bd1d947..d6d77b4 100644 --- a/src/gui/embedded/directfb.pri +++ b/src/gui/embedded/directfb.pri @@ -15,7 +15,7 @@ #DEFINES += QT_DIRECTFB_TIMING #DEFINES += QT_NO_DIRECTFB_OPAQUE_DETECTION #DEFINES += QT_NO_DIRECTFB_STRETCHBLIT -#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT +#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT|DRAW_STATICTEXT #DEFINES += \"QT_DIRECTFB_WARN_ON_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\" #DEFINES += \"QT_DIRECTFB_DISABLE_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\" diff --git a/src/gui/graphicsview/qgraphicsitem.cpp b/src/gui/graphicsview/qgraphicsitem.cpp index ed36f87..ca20101 100644 --- a/src/gui/graphicsview/qgraphicsitem.cpp +++ b/src/gui/graphicsview/qgraphicsitem.cpp @@ -319,7 +319,7 @@ QGraphicsItem::keyPressEvent() and QGraphicsItem::keyReleaseEvent(). \value ItemClipsToShape The item clips to its own shape. The item cannot - draw or receive mouse, tablet, drag and drop or hover events outside ts + draw or receive mouse, tablet, drag and drop or hover events outside its shape. It is disabled by default. This behavior is enforced by QGraphicsView::drawItems() or QGraphicsScene::drawItems(). This flag was introduced in Qt 4.3. @@ -357,19 +357,22 @@ default, child items are stacked on top of the parent item. But setting this flag, the child will be stacked behind it. This flag is useful for drop shadow effects and for decoration objects that follow the parent - item's geometry without drawing on top of it. + item's geometry without drawing on top of it. This flag was introduced + in Qt 4.5. \value ItemUsesExtendedStyleOption The item makes use of either - \l{QStyleOptionGraphicsItem::}{exposedRect} or - \l{QStyleOptionGraphicsItem::}{matrix} in QStyleOptionGraphicsItem. By default, - the \l{QStyleOptionGraphicsItem::}{exposedRect} is initialized to the item's - boundingRect() and the \l{QStyleOptionGraphicsItem::}{matrix} is untransformed. - You can enable this flag for the style options to be set up with more - fine-grained values. - Note that QStyleOptionGraphicsItem::levelOfDetail is unaffected by this flag + \l{QStyleOptionGraphicsItem::} {exposedRect} or + \l{QStyleOptionGraphicsItem::} {matrix} in + QStyleOptionGraphicsItem. By default, the + \l{QStyleOptionGraphicsItem::} {exposedRect} is initialized to the + item's boundingRect() and the + \l{QStyleOptionGraphicsItem::}{matrix} is untransformed. You can + enable this flag for the style options to be set up with more + fine-grained values. Note that + QStyleOptionGraphicsItem::levelOfDetail is unaffected by this flag and always initialized to 1. Use - QStyleOptionGraphicsItem::levelOfDetailFromTransform() if you need a higher - value. + QStyleOptionGraphicsItem::levelOfDetailFromTransform() if you need + a higher value. This flag was introduced in Qt 4.6. \value ItemHasNoContents The item does not paint anything (i.e., calling paint() on the item has no effect). You should set this flag on items that @@ -387,9 +390,10 @@ used for Asian languages. This flag was introduced in Qt 4.6. - \value ItemNegativeZStacksBehindParent The item automatically stacks behind - it's parent if it's z-value is negative. This flag enables setZValue() to - toggle ItemStacksBehindParent. + \value ItemNegativeZStacksBehindParent The item automatically + stacks behind it's parent if it's z-value is negative. This flag + enables setZValue() to toggle ItemStacksBehindParent. This flag + was introduced in Qt 4.6. \value ItemIsPanel The item is a panel. A panel provides activation and contained focus handling. Only one panel can be active at a time (see @@ -668,6 +672,7 @@ #include <QtCore/qtimer.h> #include <QtCore/qvariant.h> #include <QtCore/qvarlengtharray.h> +#include <QtCore/qnumeric.h> #include <QtGui/qapplication.h> #include <QtGui/qbitmap.h> #include <QtGui/qpainter.h> @@ -1392,7 +1397,8 @@ QGraphicsItem::~QGraphicsItem() } delete d_ptr->transformData; - qt_dataStore()->data.remove(this); + if (QGraphicsItemCustomDataStore *dataStore = qt_dataStore()) + dataStore->data.remove(this); } /*! @@ -2569,6 +2575,7 @@ void QGraphicsItem::setOpacity(qreal opacity) if (newOpacity == d_ptr->opacity) return; + bool wasFullyTransparent = d_ptr->isOpacityNull(); d_ptr->opacity = newOpacity; // Notify change. @@ -2584,7 +2591,9 @@ void QGraphicsItem::setOpacity(qreal opacity) d_ptr->scene->d_func()->markDirty(this, QRectF(), /*invalidateChildren=*/true, /*force=*/false, - /*ignoreOpacity=*/true); + /*ignoreOpacity=*/d_ptr->isOpacityNull()); + if (wasFullyTransparent) + d_ptr->paintedViewBoundingRectsNeedRepaint = 1; } if (d_ptr->isObject) @@ -3169,8 +3178,9 @@ void QGraphicsItemPrivate::setFocusHelper(Qt::FocusReason focusReason, bool clim */ void QGraphicsItem::clearFocus() { - // Pass focus to the closest parent focus scope. - if (!d_ptr->inDestructor) { + // Pass focus to the closest parent focus scope when clearing focus + // from a focus scope. + if (!d_ptr->inDestructor && (d_ptr->flags & ItemIsFocusScope)) { QGraphicsItem *p = d_ptr->parent; while (p) { if (p->flags() & ItemIsFocusScope) { @@ -3438,6 +3448,9 @@ void QGraphicsItem::setX(qreal x) if (d_ptr->inDestructor) return; + if (qIsNaN(x)) + return; + d_ptr->setPosHelper(QPointF(x, d_ptr->pos.y())); } @@ -3462,6 +3475,9 @@ void QGraphicsItem::setY(qreal y) if (d_ptr->inDestructor) return; + if (qIsNaN(y)) + return; + d_ptr->setPosHelper(QPointF(d_ptr->pos.x(), y)); } diff --git a/src/gui/graphicsview/qgraphicsitem_p.h b/src/gui/graphicsview/qgraphicsitem_p.h index 5ad6cd5..b3ca3b5 100644 --- a/src/gui/graphicsview/qgraphicsitem_p.h +++ b/src/gui/graphicsview/qgraphicsitem_p.h @@ -358,14 +358,20 @@ public: return o; } + inline bool isOpacityNull() const + { return (opacity < qreal(0.001)); } + + static inline bool isOpacityNull(qreal opacity) + { return (opacity < qreal(0.001)); } + inline bool isFullyTransparent() const { - if (opacity < 0.001) + if (isOpacityNull()) return true; if (!parent) return false; - return calcEffectiveOpacity() < 0.001; + return isOpacityNull(calcEffectiveOpacity()); } inline qreal effectiveOpacity() const { diff --git a/src/gui/graphicsview/qgraphicsscene.cpp b/src/gui/graphicsview/qgraphicsscene.cpp index 478669e..aaae88e 100644 --- a/src/gui/graphicsview/qgraphicsscene.cpp +++ b/src/gui/graphicsview/qgraphicsscene.cpp @@ -251,6 +251,7 @@ #endif #include <private/qgraphicseffect_p.h> #include <private/qgesturemanager_p.h> +#include <private/qpathclipper_p.h> // #define GESTURE_DEBUG #ifndef GESTURE_DEBUG @@ -372,7 +373,10 @@ void QGraphicsScenePrivate::_q_emitUpdated() } } } else { - updateAll = false; + if (views.isEmpty()) { + updateAll = false; + return; + } for (int i = 0; i < views.size(); ++i) views.at(i)->d_func()->processPendingUpdates(); // It's important that we update all views before we dispatch, hence two for-loops. @@ -4605,6 +4609,7 @@ void QGraphicsScenePrivate::drawItems(QPainter *painter, const QTransform *const if (!unpolishedItems.isEmpty()) _q_polishItems(); + updateAll = false; QRectF exposedSceneRect; if (exposedRegion && indexMethod != QGraphicsScene::NoIndex) { exposedSceneRect = exposedRegion->boundingRect().adjusted(-1, -1, 1, 1); @@ -4632,7 +4637,7 @@ void QGraphicsScenePrivate::drawSubtreeRecursive(QGraphicsItem *item, QPainter * return; // Item has neither contents nor children!(?) const qreal opacity = item->d_ptr->combineOpacityFromParent(parentOpacity); - const bool itemIsFullyTransparent = (opacity < 0.0001); + const bool itemIsFullyTransparent = QGraphicsItemPrivate::isOpacityNull(opacity); if (itemIsFullyTransparent && (!itemHasChildren || item->d_ptr->childrenCombineOpacity())) return; @@ -4752,7 +4757,7 @@ void QGraphicsScenePrivate::draw(QGraphicsItem *item, QPainter *painter, const Q qreal opacity, const QTransform *effectTransform, bool wasDirtyParentSceneTransform, bool drawItem) { - const bool itemIsFullyTransparent = (opacity < 0.0001); + const bool itemIsFullyTransparent = QGraphicsItemPrivate::isOpacityNull(opacity); const bool itemClipsChildrenToShape = (item->d_ptr->flags & QGraphicsItem::ItemClipsChildrenToShape); const bool itemHasChildren = !item->d_ptr->children.isEmpty(); @@ -4767,7 +4772,12 @@ void QGraphicsScenePrivate::draw(QGraphicsItem *item, QPainter *painter, const Q painter->setWorldTransform(*transformPtr * *effectTransform); else painter->setWorldTransform(*transformPtr); - painter->setClipPath(item->shape(), Qt::IntersectClip); + QRectF clipRect; + const QPainterPath clipPath(item->shape()); + if (QPathClipper::pathToRect(clipPath, &clipRect)) + painter->setClipRect(clipRect, Qt::IntersectClip); + else + painter->setClipPath(clipPath, Qt::IntersectClip); } // Draw children behind @@ -4803,8 +4813,14 @@ void QGraphicsScenePrivate::draw(QGraphicsItem *item, QPainter *painter, const Q painter->setWorldTransform(*transformPtr); } - if (itemClipsToShape) - painter->setClipPath(item->shape(), Qt::IntersectClip); + if (itemClipsToShape) { + QRectF clipRect; + const QPainterPath clipPath(item->shape()); + if (QPathClipper::pathToRect(clipPath, &clipRect)) + painter->setClipRect(clipRect, Qt::IntersectClip); + else + painter->setClipPath(clipPath, Qt::IntersectClip); + } painter->setOpacity(opacity); if (!item->d_ptr->cacheMode && !item->d_ptr->isWidget) @@ -4982,7 +4998,8 @@ void QGraphicsScenePrivate::processDirtyItemsRecursive(QGraphicsItem *item, bool } const qreal opacity = item->d_ptr->combineOpacityFromParent(parentOpacity); - const bool itemIsFullyTransparent = !item->d_ptr->ignoreOpacity && opacity < 0.0001; + const bool itemIsFullyTransparent = !item->d_ptr->ignoreOpacity + && QGraphicsItemPrivate::isOpacityNull(opacity); if (itemIsFullyTransparent && (!itemHasChildren || item->d_ptr->childrenCombineOpacity())) { resetDirtyItem(item, /*recursive=*/itemHasChildren); return; @@ -5117,6 +5134,8 @@ void QGraphicsScenePrivate::processDirtyItemsRecursive(QGraphicsItem *item, bool } /*! + \obsolete + Paints the given \a items using the provided \a painter, after the background has been drawn, and before the foreground has been drawn. All painting is done in \e scene coordinates. Before @@ -5139,7 +5158,7 @@ void QGraphicsScenePrivate::processDirtyItemsRecursive(QGraphicsItem *item, bool \snippet doc/src/snippets/graphicssceneadditemsnippet.cpp 0 - \obsolete Since Qt 4.6, this function is not called anymore unless + Since Qt 4.6, this function is not called anymore unless the QGraphicsView::IndirectPainting flag is given as an Optimization flag. @@ -5155,6 +5174,7 @@ void QGraphicsScene::drawItems(QPainter *painter, if (!d->unpolishedItems.isEmpty()) d->_q_polishItems(); + d->updateAll = false; QTransform viewTransform = painter->worldTransform(); Q_UNUSED(options); @@ -5694,8 +5714,15 @@ void QGraphicsScenePrivate::touchEventHandler(QTouchEvent *sceneTouchEvent) item->d_ptr->acceptedTouchBeginEvent = true; bool res = sendTouchBeginEvent(item, &touchEvent) && touchEvent.isAccepted(); - if (!res) + if (!res) { + // forget about these touch points, we didn't handle them + for (int i = 0; i < touchEvent.touchPoints().count(); ++i) { + const QTouchEvent::TouchPoint &touchPoint = touchEvent.touchPoints().at(i); + itemForTouchPointId.remove(touchPoint.id()); + sceneCurrentTouchPoints.remove(touchPoint.id()); + } ignoreSceneTouchEvent = false; + } break; } default: @@ -5886,13 +5913,21 @@ void QGraphicsScenePrivate::getGestureTargets(const QSet<QGesture *> &gestures, QList<QGraphicsItem *> items = itemsAtPosition(screenPos, QPointF(), viewport); QList<QGraphicsObject *> result; for (int j = 0; j < items.size(); ++j) { - QGraphicsObject *item = items.at(j)->toGraphicsObject(); - if (!item) - continue; - QGraphicsItemPrivate *d = item->QGraphicsItem::d_func(); - if (d->gestureContext.contains(gestureType)) { - result.append(item); + QGraphicsItem *item = items.at(j); + + // Check if the item is blocked by a modal panel and use it as + // a target instead of this item. + (void) item->isBlockedByModalPanel(&item); + + if (QGraphicsObject *itemobj = item->toGraphicsObject()) { + QGraphicsItemPrivate *d = item->d_func(); + if (d->gestureContext.contains(gestureType)) { + result.append(itemobj); + } } + // Don't propagate through panels. + if (item->isPanel()) + break; } DEBUG() << "QGraphicsScenePrivate::getGestureTargets:" << gesture << result; @@ -5918,6 +5953,9 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) typedef QHash<QGraphicsObject *, QList<QGesture *> > GesturesPerItem; GesturesPerItem gesturesPerItem; + // gestures that are only supposed to propagate to parent items. + QSet<QGesture *> parentPropagatedGestures; + QSet<QGesture *> startedGestures; foreach (QGesture *gesture, allGestures) { QGraphicsObject *target = gestureTargets.value(gesture, 0); @@ -5928,6 +5966,10 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) startedGestures.insert(gesture); } else { gesturesPerItem[target].append(gesture); + Qt::GestureFlags flags = + target->QGraphicsItem::d_func()->gestureContext.value(gesture->gestureType()); + if (flags & Qt::IgnoredGesturesPropagateToParent) + parentPropagatedGestures.insert(gesture); } } @@ -6017,6 +6059,10 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) Q_ASSERT(!gestureTargets.contains(g)); gestureTargets.insert(g, receiver); gesturesPerItem[receiver].append(g); + Qt::GestureFlags flags = + receiver->QGraphicsItem::d_func()->gestureContext.value(g->gestureType()); + if (flags & Qt::IgnoredGesturesPropagateToParent) + parentPropagatedGestures.insert(g); } it = ignoredConflictedGestures.begin(); e = ignoredConflictedGestures.end(); @@ -6026,13 +6072,17 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) Q_ASSERT(!gestureTargets.contains(g)); gestureTargets.insert(g, receiver); gesturesPerItem[receiver].append(g); + Qt::GestureFlags flags = + receiver->QGraphicsItem::d_func()->gestureContext.value(g->gestureType()); + if (flags & Qt::IgnoredGesturesPropagateToParent) + parentPropagatedGestures.insert(g); } DEBUG() << "QGraphicsScenePrivate::gestureEventHandler:" << "Started gestures:" << normalGestures.keys() << "All gestures:" << gesturesPerItem.values(); - // deliver all events + // deliver all gesture events QList<QGesture *> alreadyIgnoredGestures; QHash<QGraphicsObject *, QSet<QGesture *> > itemIgnoredGestures; QList<QGraphicsObject *> targetItems = gesturesPerItem.keys(); @@ -6052,9 +6102,26 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) foreach(QGesture *g, alreadyIgnoredGestures) { QMap<Qt::GestureType, Qt::GestureFlags>::iterator contextit = gid->gestureContext.find(g->gestureType()); - bool deliver = contextit != gid->gestureContext.end() && - (g->state() == Qt::GestureStarted || - (contextit.value() & Qt::ReceivePartialGestures)); + bool deliver = false; + if (contextit != gid->gestureContext.end()) { + if (g->state() == Qt::GestureStarted) { + deliver = true; + } else { + const Qt::GestureFlags flags = contextit.value(); + if (flags & Qt::ReceivePartialGestures) { + QGraphicsObject *originalTarget = gestureTargets.value(g); + Q_ASSERT(originalTarget); + QGraphicsItemPrivate *otd = originalTarget->QGraphicsItem::d_func(); + const Qt::GestureFlags originalTargetFlags = otd->gestureContext.value(g->gestureType()); + if (originalTargetFlags & Qt::IgnoredGesturesPropagateToParent) { + // only deliver to parents of the original target item + deliver = item->isAncestorOf(originalTarget); + } else { + deliver = true; + } + } + } + } if (deliver) gestures += g; } @@ -6082,18 +6149,52 @@ void QGraphicsScenePrivate::gestureEventHandler(QGestureEvent *event) << "item has ignored the event, will propagate." << item << ignoredGestures; itemIgnoredGestures[item] += ignoredGestures; + alreadyIgnoredGestures = ignoredGestures.toList(); + + // remove gestures that are supposed to be propagated to + // parent items only. + QSet<QGesture *> parentGestures; + for (QSet<QGesture *>::iterator it = ignoredGestures.begin(); + it != ignoredGestures.end();) { + if (parentPropagatedGestures.contains(*it)) { + parentGestures.insert(*it); + it = ignoredGestures.erase(it); + } else { + ++it; + } + } + + QSet<QGraphicsObject *> itemsSet = targetItems.toSet(); + + foreach(QGesture *g, parentGestures) { + // get the original target for the gesture + QGraphicsItem *item = gestureTargets.value(g, 0); + Q_ASSERT(item); + const Qt::GestureType gestureType = g->gestureType(); + // iterate through parent items of the original gesture + // target item and collect potential receivers + do { + if (QGraphicsObject *obj = item->toGraphicsObject()) { + if (item->d_func()->gestureContext.contains(gestureType)) + itemsSet.insert(obj); + } + if (item->isPanel()) + break; + } while ((item = item->parentItem())); + } + QMap<Qt::GestureType, QGesture *> conflictedGestures; QList<QList<QGraphicsObject *> > itemsForConflictedGestures; QHash<QGesture *, QGraphicsObject *> normalGestures; getGestureTargets(ignoredGestures, viewport, &conflictedGestures, &itemsForConflictedGestures, &normalGestures); - QSet<QGraphicsObject *> itemsSet = targetItems.toSet(); for (int k = 0; k < itemsForConflictedGestures.size(); ++k) itemsSet += itemsForConflictedGestures.at(k).toSet(); + targetItems = itemsSet.toList(); + qSort(targetItems.begin(), targetItems.end(), qt_closestItemFirst); - alreadyIgnoredGestures = conflictedGestures.values(); DEBUG() << "QGraphicsScenePrivate::gestureEventHandler:" << "new targets:" << targetItems; i = -1; // start delivery again diff --git a/src/gui/graphicsview/qgraphicssceneindex.cpp b/src/gui/graphicsview/qgraphicssceneindex.cpp index 043c4eb..707c71f 100644 --- a/src/gui/graphicsview/qgraphicssceneindex.cpp +++ b/src/gui/graphicsview/qgraphicssceneindex.cpp @@ -279,7 +279,7 @@ void QGraphicsSceneIndexPrivate::recursive_items_helper(QGraphicsItem *item, QRe return; const qreal opacity = item->d_ptr->combineOpacityFromParent(parentOpacity); - const bool itemIsFullyTransparent = (opacity < 0.0001); + const bool itemIsFullyTransparent = QGraphicsItemPrivate::isOpacityNull(opacity); const bool itemHasChildren = !item->d_ptr->children.isEmpty(); if (itemIsFullyTransparent && (!itemHasChildren || item->d_ptr->childrenCombineOpacity())) return; @@ -554,7 +554,7 @@ QList<QGraphicsItem *> QGraphicsSceneIndex::estimateTopLevelItems(const QRectF & /*! \fn QList<QGraphicsItem *> QGraphicsSceneIndex::items(Qt::SortOrder order = Qt::DescendingOrder) const - + This pure virtual function all items in the index and sort them using \a order. */ diff --git a/src/gui/graphicsview/qgraphicsview.cpp b/src/gui/graphicsview/qgraphicsview.cpp index 451f183..06b7438 100644 --- a/src/gui/graphicsview/qgraphicsview.cpp +++ b/src/gui/graphicsview/qgraphicsview.cpp @@ -2748,7 +2748,6 @@ bool QGraphicsView::viewportEvent(QEvent *event) } } } - d->scene->d_func()->updateAll = false; } break; case QEvent::TouchBegin: @@ -3610,6 +3609,8 @@ void QGraphicsView::drawForeground(QPainter *painter, const QRectF &rect) } /*! + \obsolete + Draws the items \a items in the scene using \a painter, after the background and before the foreground are drawn. \a numItems is the number of items in \a items and options in \a options. \a options is a list of @@ -3618,7 +3619,7 @@ void QGraphicsView::drawForeground(QPainter *painter, const QRectF &rect) The default implementation calls the scene's drawItems() function. - \obsolete Since Qt 4.6, this function is not called anymore unless + Since Qt 4.6, this function is not called anymore unless the QGraphicsView::IndirectPainting flag is given as an Optimization flag. diff --git a/src/gui/graphicsview/qgraphicsview_p.h b/src/gui/graphicsview/qgraphicsview_p.h index 9d3edcb..729837a 100644 --- a/src/gui/graphicsview/qgraphicsview_p.h +++ b/src/gui/graphicsview/qgraphicsview_p.h @@ -65,7 +65,7 @@ QT_BEGIN_NAMESPACE -class Q_AUTOTEST_EXPORT QGraphicsViewPrivate : public QAbstractScrollAreaPrivate +class Q_GUI_EXPORT QGraphicsViewPrivate : public QAbstractScrollAreaPrivate { Q_DECLARE_PUBLIC(QGraphicsView) public: diff --git a/src/gui/gui.pro b/src/gui/gui.pro index 8ad3bac..d46f3b4 100644 --- a/src/gui/gui.pro +++ b/src/gui/gui.pro @@ -51,8 +51,27 @@ contains(DEFINES,QT_EVAL):include($$QT_SOURCE_TREE/src/corelib/eval.pri) QMAKE_DYNAMIC_LIST_FILE = $$PWD/QtGui.dynlist DEFINES += Q_INTERNAL_QAPP_SRC -symbian:TARGET.UID3=0x2001B2DD +symbian: { + TARGET.UID3=0x2001B2DD + + # ro-section in gui can exceed default allocated space, so move rw-section a little further + QMAKE_LFLAGS.ARMCC += --rw-base 0x800000 + QMAKE_LFLAGS.GCCE += -Tdata 0xC00000 + + # Partial upgrade SIS file + vendorinfo = \ + "&EN" \ + "; Localised Vendor name" \ + "%{\"Nokia, Qt\"}" \ + " " \ + "; Unique Vendor name" \ + ":\"Nokia, Qt\"" \ + " " + pu_header = "; Partial upgrade package for testing QtGui changes without reinstalling everything" \ + "$${LITERAL_HASH}{\"Qt gui\"}, (0x2001E61C), $${QT_MAJOR_VERSION},$${QT_MINOR_VERSION},$${QT_PATCH_VERSION}, TYPE=PU" + partial_upgrade.pkg_prerules = pu_header vendorinfo + partial_upgrade.sources = qtgui.dll + partial_upgrade.path = c:/sys/bin + DEPLOYMENT = partial_upgrade $$DEPLOYMENT +} -# ro-section in gui can exceed default allocated space, so more rw-section little further -symbian-sbsv2: QMAKE_LFLAGS.ARMCC += --rw-base 0x800000 -symbian: QMAKE_LFLAGS.GCCE += -Tdata 0xC00000 diff --git a/src/gui/image/image.pri b/src/gui/image/image.pri index b67be55..8d75fdd 100644 --- a/src/gui/image/image.pri +++ b/src/gui/image/image.pri @@ -96,6 +96,7 @@ SOURCES += \ unix:LIBS_PRIVATE += -lpng win32:LIBS += libpng.lib } else { + DEFINES *= QT_USE_BUNDLED_LIBPNG !isEqual(QT_ARCH, i386):!isEqual(QT_ARCH, x86_64):DEFINES += PNG_NO_ASSEMBLER_CODE INCLUDEPATH += ../3rdparty/libpng ../3rdparty/zlib SOURCES += ../3rdparty/libpng/png.c \ @@ -112,8 +113,7 @@ SOURCES += \ ../3rdparty/libpng/pngwio.c \ ../3rdparty/libpng/pngwrite.c \ ../3rdparty/libpng/pngwtran.c \ - ../3rdparty/libpng/pngwutil.c \ - ../3rdparty/libpng/pnggccrd.c + ../3rdparty/libpng/pngwutil.c } } else { DEFINES *= QT_NO_IMAGEFORMAT_PNG diff --git a/src/gui/image/qicon.cpp b/src/gui/image/qicon.cpp index ac1d303..bf6eb8d 100644 --- a/src/gui/image/qicon.cpp +++ b/src/gui/image/qicon.cpp @@ -104,6 +104,15 @@ QT_BEGIN_NAMESPACE static QBasicAtomicInt serialNumCounter = Q_BASIC_ATOMIC_INITIALIZER(1); +static void qt_cleanup_icon_cache(); +typedef QCache<QString, QIcon> IconCache; +Q_GLOBAL_STATIC_WITH_INITIALIZER(IconCache, qtIconCache, qAddPostRoutine(qt_cleanup_icon_cache)) + +static void qt_cleanup_icon_cache() +{ + qtIconCache()->clear(); +} + QIconPrivate::QIconPrivate() : engine(0), ref(1), serialNum(serialNumCounter.fetchAndAddRelaxed(1)), @@ -963,15 +972,13 @@ QString QIcon::themeName() */ QIcon QIcon::fromTheme(const QString &name, const QIcon &fallback) { - static QCache <QString, QIcon> iconCache; - QIcon icon; - if (iconCache.contains(name)) { - icon = *iconCache.object(name); + if (qtIconCache()->contains(name)) { + icon = *qtIconCache()->object(name); } else { QIcon *cachedIcon = new QIcon(new QIconLoaderEngine(name)); - iconCache.insert(name, cachedIcon); + qtIconCache()->insert(name, cachedIcon); icon = *cachedIcon; } diff --git a/src/gui/image/qimagepixmapcleanuphooks.cpp b/src/gui/image/qimagepixmapcleanuphooks.cpp index 61d538f..517fcb0 100644 --- a/src/gui/image/qimagepixmapcleanuphooks.cpp +++ b/src/gui/image/qimagepixmapcleanuphooks.cpp @@ -62,12 +62,12 @@ QImagePixmapCleanupHooks *QImagePixmapCleanupHooks::instance() return qt_image_and_pixmap_cleanup_hooks(); } -void QImagePixmapCleanupHooks::addPixmapModificationHook(_qt_pixmap_cleanup_hook_pm hook) +void QImagePixmapCleanupHooks::addPixmapDataModificationHook(_qt_pixmap_cleanup_hook_pmd hook) { pixmapModificationHooks.append(hook); } -void QImagePixmapCleanupHooks::addPixmapDestructionHook(_qt_pixmap_cleanup_hook_pm hook) +void QImagePixmapCleanupHooks::addPixmapDataDestructionHook(_qt_pixmap_cleanup_hook_pmd hook) { pixmapDestructionHooks.append(hook); } @@ -78,12 +78,12 @@ void QImagePixmapCleanupHooks::addImageHook(_qt_image_cleanup_hook_64 hook) imageHooks.append(hook); } -void QImagePixmapCleanupHooks::removePixmapModificationHook(_qt_pixmap_cleanup_hook_pm hook) +void QImagePixmapCleanupHooks::removePixmapDataModificationHook(_qt_pixmap_cleanup_hook_pmd hook) { pixmapModificationHooks.removeAll(hook); } -void QImagePixmapCleanupHooks::removePixmapDestructionHook(_qt_pixmap_cleanup_hook_pm hook) +void QImagePixmapCleanupHooks::removePixmapDataDestructionHook(_qt_pixmap_cleanup_hook_pmd hook) { pixmapDestructionHooks.removeAll(hook); } @@ -93,24 +93,24 @@ void QImagePixmapCleanupHooks::removeImageHook(_qt_image_cleanup_hook_64 hook) imageHooks.removeAll(hook); } -void QImagePixmapCleanupHooks::executePixmapModificationHooks(QPixmap* pm) +void QImagePixmapCleanupHooks::executePixmapDataModificationHooks(QPixmapData* pmd) { QImagePixmapCleanupHooks *h = qt_image_and_pixmap_cleanup_hooks(); for (int i = 0; i < h->pixmapModificationHooks.count(); ++i) - h->pixmapModificationHooks[i](pm); + h->pixmapModificationHooks[i](pmd); if (qt_pixmap_cleanup_hook_64) - qt_pixmap_cleanup_hook_64(pm->cacheKey()); + qt_pixmap_cleanup_hook_64(pmd->cacheKey()); } -void QImagePixmapCleanupHooks::executePixmapDestructionHooks(QPixmap* pm) +void QImagePixmapCleanupHooks::executePixmapDataDestructionHooks(QPixmapData* pmd) { QImagePixmapCleanupHooks *h = qt_image_and_pixmap_cleanup_hooks(); for (int i = 0; i < h->pixmapDestructionHooks.count(); ++i) - h->pixmapDestructionHooks[i](pm); + h->pixmapDestructionHooks[i](pmd); if (qt_pixmap_cleanup_hook_64) - qt_pixmap_cleanup_hook_64(pm->cacheKey()); + qt_pixmap_cleanup_hook_64(pmd->cacheKey()); } void QImagePixmapCleanupHooks::executeImageHooks(qint64 key) @@ -122,19 +122,32 @@ void QImagePixmapCleanupHooks::executeImageHooks(qint64 key) qt_image_cleanup_hook_64(key); } -void QImagePixmapCleanupHooks::enableCleanupHooks(const QPixmap &pixmap) -{ - enableCleanupHooks(const_cast<QPixmap &>(pixmap).data_ptr().data()); -} void QImagePixmapCleanupHooks::enableCleanupHooks(QPixmapData *pixmapData) { pixmapData->is_cached = true; } +void QImagePixmapCleanupHooks::enableCleanupHooks(const QPixmap &pixmap) +{ + enableCleanupHooks(const_cast<QPixmap &>(pixmap).data_ptr().data()); +} + void QImagePixmapCleanupHooks::enableCleanupHooks(const QImage &image) { const_cast<QImage &>(image).data_ptr()->is_cached = true; } +bool QImagePixmapCleanupHooks::isImageCached(const QImage &image) +{ + return const_cast<QImage &>(image).data_ptr()->is_cached; +} + +bool QImagePixmapCleanupHooks::isPixmapCached(const QPixmap &pixmap) +{ + return const_cast<QPixmap&>(pixmap).data_ptr().data()->is_cached; +} + + + QT_END_NAMESPACE diff --git a/src/gui/image/qimagepixmapcleanuphooks_p.h b/src/gui/image/qimagepixmapcleanuphooks_p.h index 7176044..eae11f4 100644 --- a/src/gui/image/qimagepixmapcleanuphooks_p.h +++ b/src/gui/image/qimagepixmapcleanuphooks_p.h @@ -58,7 +58,8 @@ QT_BEGIN_NAMESPACE typedef void (*_qt_image_cleanup_hook_64)(qint64); -typedef void (*_qt_pixmap_cleanup_hook_pm)(QPixmap*); +typedef void (*_qt_pixmap_cleanup_hook_pmd)(QPixmapData*); + class QImagePixmapCleanupHooks; @@ -71,27 +72,30 @@ public: static void enableCleanupHooks(const QPixmap &pixmap); static void enableCleanupHooks(QPixmapData *pixmapData); - // Gets called when a pixmap is about to be modified: - void addPixmapModificationHook(_qt_pixmap_cleanup_hook_pm); + static bool isImageCached(const QImage &image); + static bool isPixmapCached(const QPixmap &pixmap); + + // Gets called when a pixmap data is about to be modified: + void addPixmapDataModificationHook(_qt_pixmap_cleanup_hook_pmd); - // Gets called when a pixmap is about to be destroyed: - void addPixmapDestructionHook(_qt_pixmap_cleanup_hook_pm); + // Gets called when a pixmap data is about to be destroyed: + void addPixmapDataDestructionHook(_qt_pixmap_cleanup_hook_pmd); // Gets called when an image is about to be modified or destroyed: void addImageHook(_qt_image_cleanup_hook_64); - void removePixmapModificationHook(_qt_pixmap_cleanup_hook_pm); - void removePixmapDestructionHook(_qt_pixmap_cleanup_hook_pm); + void removePixmapDataModificationHook(_qt_pixmap_cleanup_hook_pmd); + void removePixmapDataDestructionHook(_qt_pixmap_cleanup_hook_pmd); void removeImageHook(_qt_image_cleanup_hook_64); - static void executePixmapModificationHooks(QPixmap*); - static void executePixmapDestructionHooks(QPixmap*); + static void executePixmapDataModificationHooks(QPixmapData*); + static void executePixmapDataDestructionHooks(QPixmapData*); static void executeImageHooks(qint64 key); private: QList<_qt_image_cleanup_hook_64> imageHooks; - QList<_qt_pixmap_cleanup_hook_pm> pixmapModificationHooks; - QList<_qt_pixmap_cleanup_hook_pm> pixmapDestructionHooks; + QList<_qt_pixmap_cleanup_hook_pmd> pixmapModificationHooks; + QList<_qt_pixmap_cleanup_hook_pmd> pixmapDestructionHooks; }; QT_END_NAMESPACE diff --git a/src/gui/image/qimagereader.cpp b/src/gui/image/qimagereader.cpp index c9e015c..9320cfc 100644 --- a/src/gui/image/qimagereader.cpp +++ b/src/gui/image/qimagereader.cpp @@ -263,25 +263,37 @@ static QImageIOHandler *createReadHandlerHelper(QIODevice *device, device->seek(pos); } - if (!handler && !testFormat.isEmpty() && autoDetectImageFormat && !ignoresFormatAndExtension) { + if (!handler && !testFormat.isEmpty() && !ignoresFormatAndExtension) { // check if any plugin supports the format (they are not allowed to // read from the device yet). const qint64 pos = device ? device->pos() : 0; - for (int i = 0; i < keys.size(); ++i) { - if (i != suffixPluginIndex) { - QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i))); - if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { + + if (autoDetectImageFormat) { + for (int i = 0; i < keys.size(); ++i) { + if (i != suffixPluginIndex) { + QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i))); + if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { #ifdef QIMAGEREADER_DEBUG - qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format"; + qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format"; #endif - handler = plugin->create(device, testFormat); - break; + handler = plugin->create(device, testFormat); + break; + } } } + } else { + QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(QLatin1String(testFormat))); + if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { +#ifdef QIMAGEREADER_DEBUG + qDebug() << "QImageReader::createReadHandler: the" << testFormat << "plugin can read this format"; +#endif + handler = plugin->create(device, testFormat); + } } if (device && !device->isSequential()) device->seek(pos); } + #endif // QT_NO_LIBRARY // if we don't have a handler yet, check if we have built-in support for diff --git a/src/gui/image/qpixmap.cpp b/src/gui/image/qpixmap.cpp index e51d858..ae62f06 100644 --- a/src/gui/image/qpixmap.cpp +++ b/src/gui/image/qpixmap.cpp @@ -320,8 +320,6 @@ QPixmap::QPixmap(const char * const xpm[]) QPixmap::~QPixmap() { Q_ASSERT(!data || data->ref >= 1); // Catch if ref-counting changes again - if (data && data->is_cached && data->ref == 1) // ref will be decrememnted after destructor returns - QImagePixmapCleanupHooks::executePixmapDestructionHooks(this); } /*! @@ -1025,12 +1023,8 @@ qint64 QPixmap::cacheKey() const if (isNull()) return 0; - int classKey = data->classId(); - if (classKey >= 1024) - classKey = -(classKey >> 10); - return ((((qint64) classKey) << 56) - | (((qint64) data->serialNumber()) << 32) - | ((qint64) (data->detach_no))); + Q_ASSERT(data); + return data->cacheKey(); } static void sendResizeEvents(QWidget *target) @@ -1696,10 +1690,9 @@ QPixmap QPixmap::transformed(const QMatrix &matrix, Qt::TransformationMode mode) \o The hasAlphaChannel() returns true if the pixmap has a format that - respects the alpha channel, otherwise returns false, while the - hasAlpha() function returns true if the pixmap has an alpha - channel \e or a mask (otherwise false). The mask() function returns - the mask as a QBitmap object, which can be set using setMask(). + respects the alpha channel, otherwise returns false. The hasAlpha(), + setMask() and mask() functions are legacy and should not be used. + They are potentially very slow. The createHeuristicMask() function creates and returns a 1-bpp heuristic mask (i.e. a QBitmap) for this pixmap. It works by @@ -1786,6 +1779,8 @@ QPixmap QPixmap::transformed(const QMatrix &matrix, Qt::TransformationMode mode) Returns true if this pixmap has an alpha channel, \e or has a mask, otherwise returns false. + \warning This is potentially an expensive operation. + \sa hasAlphaChannel(), mask() */ bool QPixmap::hasAlpha() const @@ -1963,7 +1958,7 @@ void QPixmap::detach() } if (data->is_cached && data->ref == 1) - QImagePixmapCleanupHooks::executePixmapModificationHooks(this); + QImagePixmapCleanupHooks::executePixmapDataModificationHooks(data.data()); #if defined(Q_WS_MAC) QMacPixmapData *macData = id == QPixmapData::MacClass ? static_cast<QMacPixmapData*>(data.data()) : 0; diff --git a/src/gui/image/qpixmap_x11.cpp b/src/gui/image/qpixmap_x11.cpp index 4de5bc4..b976376 100644 --- a/src/gui/image/qpixmap_x11.cpp +++ b/src/gui/image/qpixmap_x11.cpp @@ -68,6 +68,7 @@ #include "qx11info_x11.h" #include <private/qdrawhelper_p.h> #include <private/qimage_p.h> +#include <private/qimagepixmapcleanuphooks_p.h> #include <stdlib.h> @@ -1234,6 +1235,12 @@ void QX11PixmapData::fill(const QColor &fillColor) QX11PixmapData::~QX11PixmapData() { + // Cleanup hooks have to be called before the handles are freed + if (is_cached) { + QImagePixmapCleanupHooks::executePixmapDataDestructionHooks(this); + is_cached = false; + } + release(); } @@ -1242,8 +1249,13 @@ void QX11PixmapData::release() delete pengine; pengine = 0; - if (!X11) + if (!X11) { +#ifndef QT_NO_DEBUG + qWarning("~QX11PixmapData(): QPixmap objects must be destroyed before the QApplication" + " object, otherwise the native pixmap object will be leaked."); +#endif return; + } if (x11_mask) { #ifndef QT_NO_XRENDER diff --git a/src/gui/image/qpixmapdata.cpp b/src/gui/image/qpixmapdata.cpp index 65032da..ea4fe6b 100644 --- a/src/gui/image/qpixmapdata.cpp +++ b/src/gui/image/qpixmapdata.cpp @@ -45,6 +45,7 @@ #include <QtGui/qimagereader.h> #include <private/qgraphicssystem_p.h> #include <private/qapplication_p.h> +#include <private/qimagepixmapcleanuphooks_p.h> QT_BEGIN_NAMESPACE @@ -80,6 +81,16 @@ QPixmapData::QPixmapData(PixelType pixelType, int objectId) QPixmapData::~QPixmapData() { + // Sometimes the pixmap cleanup hooks will be called from derrived classes, which will + // then set is_cached to false. For example, on X11 QtOpenGL needs to delete the GLXPixmap + // or EGL Pixmap Surface for a given pixmap _before_ the native X11 pixmap is deleted, + // otherwise some drivers will leak the GL surface. In this case, QX11PixmapData will + // call the cleanup hooks itself before deleting the native pixmap and set is_cached to + // false. + if (is_cached) { + QImagePixmapCleanupHooks::executePixmapDataDestructionHooks(this); + is_cached = false; + } } QPixmapData *QPixmapData::createCompatiblePixmapData() const diff --git a/src/gui/image/qpixmapdata_p.h b/src/gui/image/qpixmapdata_p.h index 1125515..827fa18 100644 --- a/src/gui/image/qpixmapdata_p.h +++ b/src/gui/image/qpixmapdata_p.h @@ -117,6 +117,14 @@ public: inline int colorCount() const { return metric(QPaintDevice::PdmNumColors); } inline int depth() const { return d; } inline bool isNull() const { return is_null; } + inline qint64 cacheKey() const { + int classKey = id; + if (classKey >= 1024) + classKey = -(classKey >> 10); + return ((((qint64) classKey) << 56) + | (((qint64) ser_no) << 32) + | ((qint64) detach_no)); + } #if defined(Q_OS_SYMBIAN) virtual void* toNativeType(NativeType type); diff --git a/src/gui/image/qpixmapfilter.cpp b/src/gui/image/qpixmapfilter.cpp index 37a6a18..2792e45 100644 --- a/src/gui/image/qpixmapfilter.cpp +++ b/src/gui/image/qpixmapfilter.cpp @@ -422,6 +422,9 @@ void QPixmapConvolutionFilter::draw(QPainter *painter, const QPointF &p, const Q if(d->kernelWidth<=0 || d->kernelHeight <= 0) return; + if (src.isNull()) + return; + QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapConvolutionFilter *convolutionFilter = static_cast<QPixmapConvolutionFilter*>(filter); @@ -710,7 +713,8 @@ void expblur(QImage &img, qreal radius, bool improvedQuality = false, int transp radius *= qreal(0.5); Q_ASSERT(img.format() == QImage::Format_ARGB32_Premultiplied - || img.format() == QImage::Format_RGB32); + || img.format() == QImage::Format_RGB32 + || img.format() == QImage::Format_Indexed8); // choose the alpha such that pixels at radius distance from a fully // saturated pixel will have an alpha component of no greater than @@ -902,6 +906,9 @@ void QPixmapBlurFilter::draw(QPainter *painter, const QPointF &p, const QPixmap if (!painter->isActive()) return; + if (src.isNull()) + return; + QRectF srcRect = rect; if (srcRect.isNull()) srcRect = src.rect(); @@ -1082,6 +1089,10 @@ void QPixmapColorizeFilter::setStrength(qreal strength) void QPixmapColorizeFilter::draw(QPainter *painter, const QPointF &dest, const QPixmap &src, const QRectF &srcRect) const { Q_D(const QPixmapColorizeFilter); + + if (src.isNull()) + return; + QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapColorizeFilter *colorizeFilter = static_cast<QPixmapColorizeFilter*>(filter); @@ -1312,6 +1323,10 @@ void QPixmapDropShadowFilter::draw(QPainter *p, const QRectF &src) const { Q_D(const QPixmapDropShadowFilter); + + if (px.isNull()) + return; + QPixmapFilter *filter = p->paintEngine() && p->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(p->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapDropShadowFilter *dropShadowFilter = static_cast<QPixmapDropShadowFilter*>(filter); diff --git a/src/gui/image/qpnghandler.cpp b/src/gui/image/qpnghandler.cpp index d5406cb..dd31834 100644 --- a/src/gui/image/qpnghandler.cpp +++ b/src/gui/image/qpnghandler.cpp @@ -50,8 +50,13 @@ #include <qvariant.h> #include <qvector.h> +#ifdef QT_USE_BUNDLED_LIBPNG +#include <../../3rdparty/libpng/png.h> +#include <../../3rdparty/libpng/pngconf.h> +#else #include <png.h> #include <pngconf.h> +#endif #ifdef Q_OS_WINCE #define CALLBACK_CALL_TYPE __cdecl @@ -162,11 +167,16 @@ void setup_qt(QImage& image, png_structp png_ptr, png_infop info_ptr, float scre png_uint_32 height; int bit_depth; int color_type; + png_bytep trans_alpha = 0; + png_color_16p trans_color_p = 0; + int num_trans; + png_colorp palette = 0; + int num_palette; png_get_IHDR(png_ptr, info_ptr, &width, &height, &bit_depth, &color_type, 0, 0, 0); if (color_type == PNG_COLOR_TYPE_GRAY) { // Black & White or 8-bit grayscale - if (bit_depth == 1 && info_ptr->channels == 1) { + if (bit_depth == 1 && png_get_channels(png_ptr, info_ptr) == 1) { png_set_invert_mono(png_ptr); png_read_update_info(png_ptr, info_ptr); if (image.size() != QSize(width, height) || image.format() != QImage::Format_Mono) { @@ -207,20 +217,16 @@ void setup_qt(QImage& image, png_structp png_ptr, png_infop info_ptr, float scre int c = i*255/(ncols-1); image.setColor(i, qRgba(c,c,c,0xff)); } - if (png_get_valid(png_ptr, info_ptr, PNG_INFO_tRNS)) { -#if PNG_LIBPNG_VER_MAJOR < 1 || (PNG_LIBPNG_VER_MAJOR == 1 && PNG_LIBPNG_VER_MINOR < 4) - const int g = info_ptr->trans_values.gray; -#else - const int g = info_ptr->trans_color.gray; -#endif + if (png_get_tRNS(png_ptr, info_ptr, &trans_alpha, &num_trans, &trans_color_p) && trans_color_p) { + const int g = trans_color_p->gray; if (g < ncols) { image.setColor(g, 0); } } } } else if (color_type == PNG_COLOR_TYPE_PALETTE - && png_get_valid(png_ptr, info_ptr, PNG_INFO_PLTE) - && info_ptr->num_palette <= 256) + && png_get_PLTE(png_ptr, info_ptr, &palette, &num_palette) + && num_palette <= 256) { // 1-bit and 8-bit color if (bit_depth != 1) @@ -233,29 +239,26 @@ void setup_qt(QImage& image, png_structp png_ptr, png_infop info_ptr, float scre if (image.isNull()) return; } - image.setColorCount(info_ptr->num_palette); + png_get_PLTE(png_ptr, info_ptr, &palette, &num_palette); + image.setColorCount(num_palette); int i = 0; - if (png_get_valid(png_ptr, info_ptr, PNG_INFO_tRNS)) { - while (i < info_ptr->num_trans) { + if (png_get_tRNS(png_ptr, info_ptr, &trans_alpha, &num_trans, &trans_color_p) && trans_alpha) { + while (i < num_trans) { image.setColor(i, qRgba( - info_ptr->palette[i].red, - info_ptr->palette[i].green, - info_ptr->palette[i].blue, -#if PNG_LIBPNG_VER_MAJOR < 1 || (PNG_LIBPNG_VER_MAJOR == 1 && PNG_LIBPNG_VER_MINOR < 4) - info_ptr->trans[i] -#else - info_ptr->trans_alpha[i] -#endif + palette[i].red, + palette[i].green, + palette[i].blue, + trans_alpha[i] ) ); i++; } } - while (i < info_ptr->num_palette) { + while (i < num_palette) { image.setColor(i, qRgba( - info_ptr->palette[i].red, - info_ptr->palette[i].green, - info_ptr->palette[i].blue, + palette[i].red, + palette[i].green, + palette[i].blue, 0xff ) ); @@ -531,33 +534,36 @@ QImage::Format QPngHandlerPrivate::readImageFormat() QImage::Format format = QImage::Format_Invalid; png_uint_32 width, height; int bit_depth, color_type; - if (info_ptr->color_type == PNG_COLOR_TYPE_GRAY) { + png_colorp palette; + int num_palette; + png_get_IHDR(png_ptr, info_ptr, &width, &height, &bit_depth, &color_type, 0, 0, 0); + if (color_type == PNG_COLOR_TYPE_GRAY) { // Black & White or 8-bit grayscale - if (info_ptr->bit_depth == 1 && info_ptr->channels == 1) { + if (bit_depth == 1 && png_get_channels(png_ptr, info_ptr) == 1) { format = QImage::Format_Mono; - } else if (info_ptr->bit_depth == 16 && png_get_valid(png_ptr, info_ptr, PNG_INFO_tRNS)) { + } else if (bit_depth == 16 && png_get_valid(png_ptr, info_ptr, PNG_INFO_tRNS)) { format = QImage::Format_ARGB32; } else { format = QImage::Format_Indexed8; } - } else if (info_ptr->color_type == PNG_COLOR_TYPE_PALETTE - && png_get_valid(png_ptr, info_ptr, PNG_INFO_PLTE) - && info_ptr->num_palette <= 256) + } else if (color_type == PNG_COLOR_TYPE_PALETTE + && png_get_PLTE(png_ptr, info_ptr, &palette, &num_palette) + && num_palette <= 256) { // 1-bit and 8-bit color - if (info_ptr->bit_depth != 1) + if (bit_depth != 1) png_set_packing(png_ptr); png_read_update_info(png_ptr, info_ptr); png_get_IHDR(png_ptr, info_ptr, &width, &height, &bit_depth, &color_type, 0, 0, 0); format = bit_depth == 1 ? QImage::Format_Mono : QImage::Format_Indexed8; } else { // 32-bit - if (info_ptr->bit_depth == 16) + if (bit_depth == 16) png_set_strip_16(png_ptr); format = QImage::Format_ARGB32; // Only add filler if no alpha, or we can get 5 channel data. - if (!(info_ptr->color_type & PNG_COLOR_MASK_ALPHA) + if (!(color_type & PNG_COLOR_MASK_ALPHA) && !png_get_valid(png_ptr, info_ptr, PNG_INFO_tRNS)) { // We want 4 bytes, but it isn't an alpha channel format = QImage::Format_RGB32; @@ -648,7 +654,7 @@ static void set_text(const QImage &image, png_structp png_ptr, png_infop info_pt text_ptr[i].text = qstrdup(value.constData()); text_ptr[i].text_length = 0; text_ptr[i].itxt_length = value.size(); - text_ptr[i].lang = "UTF-8"; + text_ptr[i].lang = const_cast<char*>("UTF-8"); text_ptr[i].lang_key = qstrdup(it.key().toUtf8().constData()); #endif ++i; @@ -735,64 +741,51 @@ bool Q_INTERNAL_WIN_NO_THROW QPNGImageWriter::writeImage(const QImage& image_in, png_set_compression_level(png_ptr, quality); } - if (gamma != 0.0) { - png_set_gAMA(png_ptr, info_ptr, 1.0/gamma); - } - png_set_write_fn(png_ptr, (void*)this, qpiw_write_fn, qpiw_flush_fn); - info_ptr->channels = - (image.depth() == 32) - ? (image.format() == QImage::Format_RGB32 ? 3 : 4) - : 1; - png_set_IHDR(png_ptr, info_ptr, image.width(), image.height(), image.depth() == 1 ? 1 : 8 /* per channel */, image.depth() == 32 ? image.format() == QImage::Format_RGB32 ? PNG_COLOR_TYPE_RGB : PNG_COLOR_TYPE_RGB_ALPHA - : PNG_COLOR_TYPE_PALETTE, 0, 0, 0); + : PNG_COLOR_TYPE_PALETTE, 0, 0, 0); // also sets #channels + if (gamma != 0.0) { + png_set_gAMA(png_ptr, info_ptr, 1.0/gamma); + } - //png_set_sBIT(png_ptr, info_ptr, 8); - info_ptr->sig_bit.red = 8; - info_ptr->sig_bit.green = 8; - info_ptr->sig_bit.blue = 8; + png_color_8 sig_bit; + sig_bit.red = 8; + sig_bit.green = 8; + sig_bit.blue = 8; + sig_bit.alpha = image.hasAlphaChannel() ? 8 : 0; + png_set_sBIT(png_ptr, info_ptr, &sig_bit); if (image.format() == QImage::Format_MonoLSB) png_set_packswap(png_ptr); - png_colorp palette = 0; - png_bytep copy_trans = 0; if (image.colorCount()) { // Paletted - int num_palette = image.colorCount(); - palette = new png_color[num_palette]; - png_set_PLTE(png_ptr, info_ptr, palette, num_palette); - int* trans = new int[num_palette]; + int num_palette = qMin(256, image.colorCount()); + png_color palette[256]; + png_byte trans[256]; int num_trans = 0; for (int i=0; i<num_palette; i++) { - QRgb rgb=image.color(i); - info_ptr->palette[i].red = qRed(rgb); - info_ptr->palette[i].green = qGreen(rgb); - info_ptr->palette[i].blue = qBlue(rgb); - trans[i] = rgb >> 24; + QRgb rgba=image.color(i); + palette[i].red = qRed(rgba); + palette[i].green = qGreen(rgba); + palette[i].blue = qBlue(rgba); + trans[i] = qAlpha(rgba); if (trans[i] < 255) { num_trans = i+1; } } + png_set_PLTE(png_ptr, info_ptr, palette, num_palette); + if (num_trans) { - copy_trans = new png_byte[num_trans]; - for (int i=0; i<num_trans; i++) - copy_trans[i] = trans[i]; - png_set_tRNS(png_ptr, info_ptr, copy_trans, num_trans, 0); + png_set_tRNS(png_ptr, info_ptr, trans, num_trans, 0); } - delete [] trans; - } - - if (image.format() != QImage::Format_RGB32) { - info_ptr->sig_bit.alpha = 8; } // Swap ARGB to RGBA (normal PNG format) before saving on @@ -868,11 +861,6 @@ bool Q_INTERNAL_WIN_NO_THROW QPNGImageWriter::writeImage(const QImage& image_in, png_write_end(png_ptr, info_ptr); frames_written++; - if (palette) - delete [] palette; - if (copy_trans) - delete [] copy_trans; - png_destroy_write_struct(&png_ptr, &info_ptr); return true; @@ -958,7 +946,8 @@ QVariant QPngHandler::option(ImageOption option) const else if (option == Description) return d->description; else if (option == Size) - return QSize(d->info_ptr->width, d->info_ptr->height); + return QSize(png_get_image_width(d->png_ptr, d->info_ptr), + png_get_image_height(d->png_ptr, d->info_ptr)); else if (option == ImageFormat) return d->readImageFormat(); return 0; diff --git a/src/gui/inputmethod/qcoefepinputcontext_p.h b/src/gui/inputmethod/qcoefepinputcontext_p.h index f5034fc..d5243c3 100644 --- a/src/gui/inputmethod/qcoefepinputcontext_p.h +++ b/src/gui/inputmethod/qcoefepinputcontext_p.h @@ -96,7 +96,7 @@ protected: void timerEvent(QTimerEvent *timerEvent); private: - void commitCurrentString(bool triggeredBySymbian); + void commitCurrentString(bool cancelFepTransaction); void updateHints(bool mustUpdateInputCapabilities); void applyHints(Qt::InputMethodHints hints); void applyFormat(QList<QInputMethodEvent::Attribute> *attributes); @@ -127,7 +127,7 @@ public: private: void DoCommitFepInlineEditL(); MCoeFepAwareTextEditor_Extension1* Extension1(TBool& aSetToTrue); - void ReportAknEdStateEvent(MAknEdStateObserver::EAknEdwinStateEvent aEventType); + void ReportAknEdStateEvent(MAknEdStateObserver::EAknEdwinStateEvent aEventType); // From MCoeFepAwareTextEditor_Extension1 public: @@ -151,7 +151,6 @@ private: int m_inlinePosition; MFepInlineTextFormatRetriever *m_formatRetriever; MFepPointerEventHandlerDuringInlineEdit *m_pointerHandler; - int m_longPress; int m_cursorPos; QBasicTimer m_tempPreeditStringTimeout; bool m_hasTempPreeditString; diff --git a/src/gui/inputmethod/qcoefepinputcontext_s60.cpp b/src/gui/inputmethod/qcoefepinputcontext_s60.cpp index e5ab300..1ac8ace 100644 --- a/src/gui/inputmethod/qcoefepinputcontext_s60.cpp +++ b/src/gui/inputmethod/qcoefepinputcontext_s60.cpp @@ -71,7 +71,6 @@ QCoeFepInputContext::QCoeFepInputContext(QObject *parent) m_inlinePosition(0), m_formatRetriever(0), m_pointerHandler(0), - m_longPress(0), m_cursorPos(0), m_hasTempPreeditString(false) { @@ -101,7 +100,7 @@ QCoeFepInputContext::~QCoeFepInputContext() void QCoeFepInputContext::reset() { - commitCurrentString(false); + commitCurrentString(true); } void QCoeFepInputContext::ReportAknEdStateEvent(MAknEdStateObserver::EAknEdwinStateEvent aEventType) @@ -114,7 +113,7 @@ void QCoeFepInputContext::update() updateHints(false); // For pre-5.0 SDKs, we don't do text updates on S60 side. - if (QSysInfo::s60Version() != QSysInfo::SV_S60_5_0) { + if (QSysInfo::s60Version() < QSysInfo::SV_S60_5_0) { return; } @@ -126,7 +125,7 @@ void QCoeFepInputContext::update() void QCoeFepInputContext::setFocusWidget(QWidget *w) { - commitCurrentString(false); + commitCurrentString(true); QInputContext::setFocusWidget(w); @@ -219,7 +218,7 @@ bool QCoeFepInputContext::filterEvent(const QEvent *event) break; case Qt::Key_Select: if (!m_preeditString.isEmpty()) { - commitCurrentString(false); + commitCurrentString(true); return true; } break; @@ -231,10 +230,11 @@ bool QCoeFepInputContext::filterEvent(const QEvent *event) && focusWidget()->inputMethodHints() & Qt::ImhHiddenText && !keyEvent->text().isEmpty()) { // Send some temporary preedit text in order to make text visible for a moment. + m_cursorPos = focusWidget()->inputMethodQuery(Qt::ImCursorPosition).toInt(); m_preeditString = keyEvent->text(); QList<QInputMethodEvent::Attribute> attributes; QInputMethodEvent imEvent(m_preeditString, attributes); - QApplication::sendEvent(focusWidget(), &imEvent); + sendEvent(imEvent); m_tempPreeditStringTimeout.start(1000, this); m_hasTempPreeditString = true; update(); @@ -293,7 +293,7 @@ void QCoeFepInputContext::mouseHandler( int x, QMouseEvent *event) Q_ASSERT(focusWidget()); if (event->type() == QEvent::MouseButtonPress && event->button() == Qt::LeftButton) { - commitCurrentString(false); + commitCurrentString(true); int pos = focusWidget()->inputMethodQuery(Qt::ImCursorPosition).toInt(); QList<QInputMethodEvent::Attribute> attributes; @@ -739,31 +739,36 @@ void QCoeFepInputContext::GetScreenCoordinatesForFepL(TPoint& aLeftSideOfBaseLin void QCoeFepInputContext::DoCommitFepInlineEditL() { - commitCurrentString(true); + commitCurrentString(false); + if (QSysInfo::s60Version() > QSysInfo::SV_S60_5_0) + ReportAknEdStateEvent(QT_EAknCursorPositionChanged); + } -void QCoeFepInputContext::commitCurrentString(bool triggeredBySymbian) +void QCoeFepInputContext::commitCurrentString(bool cancelFepTransaction) { + int longPress = 0; + if (m_preeditString.size() == 0) { QWidget *w = focusWidget(); - if (triggeredBySymbian && w) { + if (!cancelFepTransaction && w) { // We must replace the last character only if the input box has already accepted one if (w->inputMethodQuery(Qt::ImCursorPosition).toInt() != m_cursorPos) - m_longPress = 1; + longPress = 1; } return; } QList<QInputMethodEvent::Attribute> attributes; QInputMethodEvent event(QLatin1String(""), attributes); - event.setCommitString(m_preeditString, 0-m_longPress, m_longPress); + event.setCommitString(m_preeditString, 0-longPress, longPress); m_preeditString.clear(); sendEvent(event); m_hasTempPreeditString = false; - m_longPress = 0; + longPress = 0; - if (!triggeredBySymbian) { + if (cancelFepTransaction) { CCoeFep* fep = CCoeEnv::Static()->Fep(); if (fep) fep->CancelTransaction(); diff --git a/src/gui/itemviews/qabstractitemview.cpp b/src/gui/itemviews/qabstractitemview.cpp index cbd9a8a..adf3ce3 100644 --- a/src/gui/itemviews/qabstractitemview.cpp +++ b/src/gui/itemviews/qabstractitemview.cpp @@ -1540,6 +1540,11 @@ bool QAbstractItemView::event(QEvent *event) case QEvent::FontChange: d->doDelayedItemsLayout(); // the size of the items will change break; +#ifdef QT_SOFTKEYS_ENABLED + case QEvent::LanguageChange: + d->doneSoftKey->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::DoneSoftKey)); + break; +#endif default: break; } diff --git a/src/gui/itemviews/qlistview.cpp b/src/gui/itemviews/qlistview.cpp index 19b1e8c..b2def39 100644 --- a/src/gui/itemviews/qlistview.cpp +++ b/src/gui/itemviews/qlistview.cpp @@ -2160,7 +2160,7 @@ void QListModeViewBase::scrollContentsBy(int dx, int dy, bool scrollElasticBand) } else { if (flowPositions.isEmpty()) return; - const int max = flowPositions.count() - 1; + const int max = scrollValueMap.count() - 1; if (vertical && flow() == QListView::TopToBottom && dy != 0) { int currentValue = qBound(0, verticalValue, max); int previousValue = qBound(0, currentValue + dy, max); diff --git a/src/gui/itemviews/qtreeview.cpp b/src/gui/itemviews/qtreeview.cpp index d0fa22d..706d2a8 100644 --- a/src/gui/itemviews/qtreeview.cpp +++ b/src/gui/itemviews/qtreeview.cpp @@ -2474,10 +2474,11 @@ void QTreeView::rowsInserted(const QModelIndex &parent, int start, int end) QVector<QTreeViewItem> insertedItems(delta); for (int i = 0; i < delta; ++i) { - insertedItems[i].index = d->model->index(i + start, 0, parent); - insertedItems[i].level = childLevel; - insertedItems[i].hasChildren = d->hasVisibleChildren(insertedItems[i].index); - insertedItems[i].hasMoreSiblings = !((i == delta - 1) && (parentRowCount == end +1)); + QTreeViewItem &item = insertedItems[i]; + item.index = d->model->index(i + start, 0, parent); + item.level = childLevel; + item.hasChildren = d->hasVisibleChildren(item.index); + item.hasMoreSiblings = !((i == delta - 1) && (parentRowCount == end +1)); } if (d->viewItems.isEmpty()) d->defaultItemHeight = indexRowSizeHint(insertedItems[0].index); diff --git a/src/gui/kernel/qaction.cpp b/src/gui/kernel/qaction.cpp index 4b7d949..8ddd051 100644 --- a/src/gui/kernel/qaction.cpp +++ b/src/gui/kernel/qaction.cpp @@ -715,6 +715,10 @@ QActionGroup *QAction::actionGroup() const it is displayed to the left of the menu text. There is no default icon. + On Symbian the icons which are passed to softkeys, i.e. to actions with + softkey role, need to have pixmap alpha channel correctly set otherwise + drawing artifacts will appear when softkey is pressed down. + If a null icon (QIcon::isNull() is passed into this function, the icon of the action is cleared. */ diff --git a/src/gui/kernel/qapplication.cpp b/src/gui/kernel/qapplication.cpp index bb6aca9..4ec2ae2 100644 --- a/src/gui/kernel/qapplication.cpp +++ b/src/gui/kernel/qapplication.cpp @@ -122,15 +122,19 @@ extern bool qt_wince_is_pocket_pc(); //qguifunctions_wince.cpp static void initResources() { #if defined(Q_WS_WINCE) + Q_INIT_RESOURCE_EXTERN(qstyle_wince) Q_INIT_RESOURCE(qstyle_wince); #elif defined(Q_OS_SYMBIAN) + Q_INIT_RESOURCE_EXTERN(qstyle_s60) Q_INIT_RESOURCE(qstyle_s60); #else + Q_INIT_RESOURCE_EXTERN(qstyle) Q_INIT_RESOURCE(qstyle); #endif - + Q_INIT_RESOURCE_EXTERN(qmessagebox) Q_INIT_RESOURCE(qmessagebox); #if !defined(QT_NO_PRINTDIALOG) + Q_INIT_RESOURCE_EXTERN(qprintdialog) Q_INIT_RESOURCE(qprintdialog); #endif @@ -5264,10 +5268,20 @@ QInputContext *QApplication::inputContext() const qic = QInputContextFactory::create(QLatin1String("xim"), that); that->d_func()->inputContext = qic; } -#elif defined(Q_WS_S60) +#elif defined(Q_OS_SYMBIAN) if (!d->inputContext) { QApplication *that = const_cast<QApplication *>(this); - that->d_func()->inputContext = QInputContextFactory::create(QString::fromLatin1("coefep"), that); + const QStringList keys = QInputContextFactory::keys(); + // Try hbim and coefep first, then try others. + if (keys.contains("hbim")) { + that->d_func()->inputContext = QInputContextFactory::create(QLatin1String("hbim"), that); + } else if (keys.contains("coefep")) { + that->d_func()->inputContext = QInputContextFactory::create(QLatin1String("coefep"), that); + } else { + for (int c = 0; c < keys.size() && !d->inputContext; ++c) { + that->d_func()->inputContext = QInputContextFactory::create(keys[c], that); + } + } } #endif return d->inputContext; diff --git a/src/gui/kernel/qapplication_mac.mm b/src/gui/kernel/qapplication_mac.mm index 3fba833..e511c3a 100644 --- a/src/gui/kernel/qapplication_mac.mm +++ b/src/gui/kernel/qapplication_mac.mm @@ -1237,7 +1237,7 @@ void qt_init(QApplicationPrivate *priv, int) // Cocoa application delegate #ifdef QT_MAC_USE_COCOA - NSApplication *cocoaApp = [NSApplication sharedApplication]; + NSApplication *cocoaApp = [QNSApplication sharedApplication]; QMacCocoaAutoReleasePool pool; NSObject *oldDelegate = [cocoaApp delegate]; QT_MANGLE_NAMESPACE(QCocoaApplicationDelegate) *newDelegate = [QT_MANGLE_NAMESPACE(QCocoaApplicationDelegate) sharedDelegate]; @@ -2168,6 +2168,7 @@ QApplicationPrivate::globalEventProcessor(EventHandlerCallRef er, EventRef event } if (wheel_deltaX || wheel_deltaY) { +#ifndef QT_NO_WHEELEVENT if (wheel_deltaX) { QWheelEvent qwe(plocal, p, wheel_deltaX, buttons, modifiers, Qt::Horizontal); QApplication::sendSpontaneousEvent(widget, &qwe); @@ -2190,6 +2191,7 @@ QApplicationPrivate::globalEventProcessor(EventHandlerCallRef er, EventRef event handled_event = false; } } +#endif // QT_NO_WHEELEVENT } else { #ifdef QMAC_SPEAK_TO_ME const int speak_keys = Qt::AltModifier | Qt::ShiftModifier; @@ -2764,6 +2766,7 @@ int QApplication::keyboardInputInterval() return QApplicationPrivate::keyboard_input_time; } +#ifndef QT_NO_WHEELEVENT void QApplication::setWheelScrollLines(int n) { QApplicationPrivate::wheel_scroll_lines = n; @@ -2773,6 +2776,7 @@ int QApplication::wheelScrollLines() { return QApplicationPrivate::wheel_scroll_lines; } +#endif void QApplication::setEffectEnabled(Qt::UIEffect effect, bool enable) { @@ -2935,9 +2939,11 @@ bool QApplicationPrivate::qt_mac_apply_settings() QApplication::cursorFlashTime()).toInt(); QApplication::setCursorFlashTime(num); +#ifndef QT_NO_WHEELEVENT num = settings.value(QLatin1String("wheelScrollLines"), QApplication::wheelScrollLines()).toInt(); QApplication::setWheelScrollLines(num); +#endif QString colorspec = settings.value(QLatin1String("colorSpec"), QVariant(QLatin1String("default"))).toString(); diff --git a/src/gui/kernel/qapplication_p.h b/src/gui/kernel/qapplication_p.h index d19d86e..e0a6103 100644 --- a/src/gui/kernel/qapplication_p.h +++ b/src/gui/kernel/qapplication_p.h @@ -427,7 +427,9 @@ public: static int cursor_flash_time; static int mouse_double_click_time; static int keyboard_input_time; +#ifndef QT_NO_WHEELEVENT static int wheel_scroll_lines; +#endif static bool animate_ui; static bool animate_menu; diff --git a/src/gui/kernel/qapplication_s60.cpp b/src/gui/kernel/qapplication_s60.cpp index 20b8030..3e2e6f6 100644 --- a/src/gui/kernel/qapplication_s60.cpp +++ b/src/gui/kernel/qapplication_s60.cpp @@ -809,12 +809,15 @@ TCoeInputCapabilities QSymbianControl::InputCapabilities() const void QSymbianControl::Draw(const TRect& controlRect) const { // Set flag to avoid calling DrawNow in window surface - QWExtra *extra = qwidget->d_func()->extraData(); - if (extra && !extra->inExpose) { - extra->inExpose = true; + QWidget *window = qwidget->window(); + Q_ASSERT(window); + QTLWExtra *topExtra = window->d_func()->maybeTopData(); + Q_ASSERT(topExtra); + if (!topExtra->inExpose) { + topExtra->inExpose = true; QRect exposeRect = qt_TRect2QRect(controlRect); qwidget->d_func()->syncBackingStore(exposeRect); - extra->inExpose = false; + topExtra->inExpose = false; } QWindowSurface *surface = qwidget->windowSurface(); @@ -924,8 +927,8 @@ void QSymbianControl::PositionChanged() cr.moveTopLeft(newPos); qwidget->data->crect = cr; QTLWExtra *top = qwidget->d_func()->maybeTopData(); - if (top) - top->normalGeometry = cr; + if (top && (qwidget->windowState() & (~Qt::WindowActive)) == Qt::WindowNoState) + top->normalGeometry.moveTopLeft(newPos); if (qwidget->isVisible()) { QMoveEvent e(newPos, oldPos); qt_sendSpontaneousEvent(qwidget, &e); @@ -960,15 +963,14 @@ void QSymbianControl::FocusChanged(TDrawNow /* aDrawNow */) qwidget->d_func()->setWindowIcon_sys(true); qwidget->d_func()->setWindowTitle_sys(qwidget->windowTitle()); #ifdef Q_WS_S60 - // If widget is fullscreen, hide status pane and button container - // otherwise show them. + // If widget is fullscreen/minimized, hide status pane and button container otherwise show them. CEikStatusPane* statusPane = S60->statusPane(); CEikButtonGroupContainer* buttonGroup = S60->buttonGroupContainer(); - bool isFullscreen = qwidget->windowState() & Qt::WindowFullScreen; - if (statusPane && (bool)statusPane->IsVisible() == isFullscreen) - statusPane->MakeVisible(!isFullscreen); - if (buttonGroup && (bool)buttonGroup->IsVisible() == isFullscreen) - buttonGroup->MakeVisible(!isFullscreen); + TBool visible = !(qwidget->windowState() & (Qt::WindowFullScreen | Qt::WindowMinimized)); + if (statusPane) + statusPane->MakeVisible(visible); + if (buttonGroup) + buttonGroup->MakeVisible(visible); #endif } else if (QApplication::activeWindow() == qwidget->window()) { if (CCoeEnv::Static()->AppUi()->IsDisplayingMenuOrDialog()) { @@ -1647,6 +1649,9 @@ int QApplicationPrivate::symbianProcessWsEvent(const QSymbianEvent *symbianEvent if (visChangedEvent->iFlags & TWsVisibilityChangedEvent::ENotVisible) { delete w->d_func()->topData()->backingStore; w->d_func()->topData()->backingStore = 0; + // In order to ensure that any resources used by the window surface + // are immediately freed, we flush the WSERV command buffer. + S60->wsSession().Flush(); } else if ((visChangedEvent->iFlags & TWsVisibilityChangedEvent::EPartiallyVisible) && !w->d_func()->maybeBackingStore()) { w->d_func()->topData()->backingStore = new QWidgetBackingStore(w); diff --git a/src/gui/kernel/qapplication_win.cpp b/src/gui/kernel/qapplication_win.cpp index 3355272..31d245f 100644 --- a/src/gui/kernel/qapplication_win.cpp +++ b/src/gui/kernel/qapplication_win.cpp @@ -928,7 +928,11 @@ const QString qt_reg_winclass(QWidget *w) // register window class uint style; bool icon; QString cname; - if (flags & Qt::MSWindowsOwnDC) { + if (qt_widget_private(w)->isGLWidget) { + cname = QLatin1String("QGLWidget"); + style = CS_DBLCLKS; + icon = true; + } else if (flags & Qt::MSWindowsOwnDC) { cname = QLatin1String("QWidgetOwnDC"); style = CS_DBLCLKS; #ifndef Q_WS_WINCE @@ -1021,7 +1025,7 @@ const QString qt_reg_winclass(QWidget *w) // register window class } wc.hCursor = 0; #ifndef Q_WS_WINCE - wc.hbrBackground = (HBRUSH)GetSysColorBrush(COLOR_WINDOW); + wc.hbrBackground = qt_widget_private(w)->isGLWidget ? 0 : (HBRUSH)GetSysColorBrush(COLOR_WINDOW); #else wc.hbrBackground = 0; #endif @@ -2547,6 +2551,17 @@ LRESULT CALLBACK QtWndProc(HWND hwnd, UINT message, WPARAM wParam, LPARAM lParam result = true; break; } +#ifndef QT_NO_CURSOR + case WM_SETCURSOR: { + QCursor *ovr = QApplication::overrideCursor(); + if (ovr) { + SetCursor(ovr->handle()); + RETURN(TRUE); + } + result = false; + break; + } +#endif default: result = false; // event was not processed break; @@ -2969,7 +2984,10 @@ bool QETWidget::translateMouseEvent(const MSG &msg) // most recent one. msgPtr->lParam = mouseMsg.lParam; msgPtr->wParam = mouseMsg.wParam; - msgPtr->pt = mouseMsg.pt; + // Extract the x,y coordinates from the lParam as we do in the WndProc + msgPtr->pt.x = GET_X_LPARAM(mouseMsg.lParam); + msgPtr->pt.y = GET_Y_LPARAM(mouseMsg.lParam); + ClientToScreen(msg.hwnd, &(msgPtr->pt)); // Remove the mouse move message PeekMessage(&mouseMsg, msg.hwnd, WM_MOUSEMOVE, WM_MOUSEMOVE, PM_REMOVE); @@ -3616,13 +3634,19 @@ bool QETWidget::translatePaintEvent(const MSG &msg) return true; setAttribute(Qt::WA_PendingUpdate, false); - const QRegion dirtyInBackingStore(qt_dirtyRegion(this)); - // Make sure the invalidated region contains the region we're about to repaint. - // BeginPaint will set the clip to the invalidated region and it is impossible - // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient - // as it may return an invalid context (especially on Windows Vista). - if (!dirtyInBackingStore.isEmpty()) - InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false); + + if (d_func()->isGLWidget) { + if (d_func()->usesDoubleBufferedGLContext) + InvalidateRect(internalWinId(), 0, false); + } else { + const QRegion dirtyInBackingStore(qt_dirtyRegion(this)); + // Make sure the invalidated region contains the region we're about to repaint. + // BeginPaint will set the clip to the invalidated region and it is impossible + // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient + // as it may return an invalid context (especially on Windows Vista). + if (!dirtyInBackingStore.isEmpty()) + InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false); + } PAINTSTRUCT ps; d_func()->hd = BeginPaint(internalWinId(), &ps); diff --git a/src/gui/kernel/qapplication_x11.cpp b/src/gui/kernel/qapplication_x11.cpp index 667db39..c6e192b 100644 --- a/src/gui/kernel/qapplication_x11.cpp +++ b/src/gui/kernel/qapplication_x11.cpp @@ -208,11 +208,8 @@ static const char * x11_atomnames = { "_MOTIF_WM_HINTS\0" "DTWM_IS_RUNNING\0" - "KDE_FULL_SESSION\0" - "KWIN_RUNNING\0" - "KWM_RUNNING\0" - "GNOME_BACKGROUND_PROPERTIES\0" "ENLIGHTENMENT_DESKTOP\0" + "_DT_SAVE_MODE\0" "_SGI_DESKS_MANAGER\0" // EWMH (aka NETWM) @@ -626,8 +623,6 @@ static int qt_x_errhandler(Display *dpy, XErrorEvent *err) || err->resourceid == XA_RGB_DEFAULT_MAP || err->resourceid == ATOM(_NET_SUPPORTED) || err->resourceid == ATOM(_NET_SUPPORTING_WM_CHECK) - || err->resourceid == ATOM(KDE_FULL_SESSION) - || err->resourceid == ATOM(KWIN_RUNNING) || err->resourceid == ATOM(XdndProxy) || err->resourceid == ATOM(XdndAware))) { // Perhaps we're running under SECURITY reduction? :/ @@ -949,10 +944,12 @@ bool QApplicationPrivate::x11_apply_settings() QApplication::cursorFlashTime()).toInt(); QApplication::setCursorFlashTime(num); +#ifndef QT_NO_WHEELEVENT num = settings.value(QLatin1String("wheelScrollLines"), QApplication::wheelScrollLines()).toInt(); QApplication::setWheelScrollLines(num); +#endif QString colorspec = settings.value(QLatin1String("colorSpec"), QVariant(QLatin1String("default"))).toString(); @@ -2220,87 +2217,36 @@ void qt_init(QApplicationPrivate *priv, int, X11->desktopEnvironment = DE_UNKNOWN; X11->desktopVersion = 0; - // See if the current window manager is using the freedesktop.org spec to give its name - Window windowManagerWindow = XNone; - Atom typeReturned; - int formatReturned; - unsigned long nitemsReturned; - unsigned long unused; - unsigned char *data = 0; - if (XGetWindowProperty(QX11Info::display(), QX11Info::appRootWindow(), - ATOM(_NET_SUPPORTING_WM_CHECK), - 0, 1024, False, XA_WINDOW, &typeReturned, - &formatReturned, &nitemsReturned, &unused, &data) - == Success) { - if (typeReturned == XA_WINDOW && formatReturned == 32) - windowManagerWindow = *((Window*) data); - if (data) - XFree(data); - - if (windowManagerWindow != XNone) { - QString wmName; - Atom utf8atom = ATOM(UTF8_STRING); - if (XGetWindowProperty(QX11Info::display(), windowManagerWindow, ATOM(_NET_WM_NAME), - 0, 1024, False, utf8atom, &typeReturned, - &formatReturned, &nitemsReturned, &unused, &data) - == Success) { - if (typeReturned == utf8atom && formatReturned == 8) - wmName = QString::fromUtf8((const char*)data); - if (data) - XFree(data); - if (wmName == QLatin1String("KWin")) - X11->desktopEnvironment = DE_KDE; - if (wmName == QLatin1String("Metacity")) - X11->desktopEnvironment = DE_GNOME; - } - } - } - - // Running a different/newer/older window manager? Try some other things - if (X11->desktopEnvironment == DE_UNKNOWN){ - Atom type; - int format; - unsigned long length, after; - uchar *data = 0; - - QString session = QString::fromLocal8Bit(qgetenv("DESKTOP_SESSION")); - if (session == QLatin1String("kde")) { - X11->desktopEnvironment = DE_KDE; - } else if (session == QLatin1String("gnome") || session == QLatin1String("xfce")) { - X11->desktopEnvironment = DE_GNOME; - } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(DTWM_IS_RUNNING), - 0, 1, False, AnyPropertyType, &type, &format, &length, - &after, &data) == Success && length) { - // DTWM is running, meaning most likely CDE is running... - X11->desktopEnvironment = DE_CDE; - } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), - ATOM(GNOME_BACKGROUND_PROPERTIES), 0, 1, False, AnyPropertyType, - &type, &format, &length, &after, &data) == Success && length) { - X11->desktopEnvironment = DE_GNOME; - } else if (!qgetenv("GNOME_DESKTOP_SESSION_ID").isEmpty()) { - X11->desktopEnvironment = DE_GNOME; - } else if ((XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(KDE_FULL_SESSION), - 0, 1, False, AnyPropertyType, &type, &format, &length, &after, &data) == Success - && length) - || (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(KWIN_RUNNING), - 0, 1, False, AnyPropertyType, &type, &format, &length, - &after, &data) == Success - && length) - || (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(KWM_RUNNING), - 0, 1, False, AnyPropertyType, &type, &format, &length, - &after, &data) == Success && length)) { - X11->desktopEnvironment = DE_KDE; - } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(_SGI_DESKS_MANAGER), - 0, 1, False, XA_WINDOW, &type, &format, &length, &after, &data) == Success - && length) { - X11->desktopEnvironment = DE_4DWM; - } - if (data) - XFree((char *)data); + Atom type; + int format; + unsigned long length, after; + uchar *data = 0; + + if (!qgetenv("KDE_FULL_SESSION").isEmpty()) { + X11->desktopEnvironment = DE_KDE; + X11->desktopVersion = qgetenv("KDE_SESSION_VERSION").toInt(); + } else if (!qgetenv("GNOME_DESKTOP_SESSION_ID").isEmpty() // Deprecated for some reason. + || qgetenv("DESKTOP_SESSION") == "gnome") { // De-facto-standardized by GNOME. + X11->desktopEnvironment = DE_GNOME; + } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(_DT_SAVE_MODE), + 0, 2, False, XA_STRING, &type, &format, &length, + &after, &data) == Success + && !strcmp(reinterpret_cast<char *>(data), "xfce4")) { + // Pretend that xfce4 is gnome, as it uses the same libraries. + // The detection above is stolen from xdg-open. + X11->desktopEnvironment = DE_GNOME; + } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(DTWM_IS_RUNNING), + 0, 1, False, AnyPropertyType, &type, &format, &length, + &after, &data) == Success && length) { + // DTWM is running, meaning most likely CDE is running... + X11->desktopEnvironment = DE_CDE; + } else if (XGetWindowProperty(X11->display, QX11Info::appRootWindow(), ATOM(_SGI_DESKS_MANAGER), + 0, 1, False, XA_WINDOW, &type, &format, &length, &after, &data) == Success + && length) { + X11->desktopEnvironment = DE_4DWM; } - - if (X11->desktopEnvironment == DE_KDE) - X11->desktopVersion = QString::fromLocal8Bit(qgetenv("KDE_SESSION_VERSION")).toInt(); + if (data) + XFree((char *)data); #if !defined(QT_NO_STYLE_GTK) if (X11->desktopEnvironment == DE_GNOME) { @@ -4406,8 +4352,10 @@ bool QETWidget::translateWheelEvent(int global_x, int global_y, int delta, QWidget* popup = qApp->activePopupWidget(); if (popup && window() != popup) popup->close(); +#ifndef QT_NO_WHEELEVENT QWheelEvent e(pos, globalPos, delta, buttons, modifiers, orient); if (QApplication::sendSpontaneousEvent(widget, &e)) +#endif return true; } @@ -4418,8 +4366,10 @@ bool QETWidget::translateWheelEvent(int global_x, int global_y, int delta, QWidget* popup = qApp->activePopupWidget(); if (popup && widget != popup) popup->hide(); +#ifndef QT_NO_WHEELEVENT QWheelEvent e(pos, globalPos, delta, buttons, modifiers, orient); if (QApplication::sendSpontaneousEvent(widget, &e)) +#endif return true; } return false; @@ -5318,6 +5268,7 @@ int QApplication::keyboardInputInterval() return QApplicationPrivate::keyboard_input_time; } +#ifndef QT_NO_WHEELEVENT void QApplication::setWheelScrollLines(int n) { QApplicationPrivate::wheel_scroll_lines = n; @@ -5327,6 +5278,7 @@ int QApplication::wheelScrollLines() { return QApplicationPrivate::wheel_scroll_lines; } +#endif void QApplication::setEffectEnabled(Qt::UIEffect effect, bool enable) { diff --git a/src/gui/kernel/qclipboard_mac.cpp b/src/gui/kernel/qclipboard_mac.cpp index f3a971d..49a6cc8 100644 --- a/src/gui/kernel/qclipboard_mac.cpp +++ b/src/gui/kernel/qclipboard_mac.cpp @@ -388,6 +388,18 @@ QMacPasteboard::setMimeData(QMimeData *mime_src) clear_helper(); QStringList formats = mime_src->formats(); +#ifdef QT_MAC_USE_COCOA + // QMimeData sub classes reimplementing the formats() might not expose the + // temporary "application/x-qt-mime-type-name" mimetype. So check the existence + // of this mime type while doing drag and drop. + QString dummyMimeType(QLatin1String("application/x-qt-mime-type-name")); + if (!formats.contains(dummyMimeType)) { + QByteArray dummyType = mime_src->data(dummyMimeType); + if (!dummyType.isEmpty()) { + formats.append(dummyMimeType); + } + } +#endif for(int f = 0; f < formats.size(); ++f) { QString mimeType = formats.at(f); for (QList<QMacPasteboardMime *>::Iterator it = availableConverters.begin(); it != availableConverters.end(); ++it) { diff --git a/src/gui/kernel/qcocoaapplication_mac.mm b/src/gui/kernel/qcocoaapplication_mac.mm index 5b98420..4962863 100644 --- a/src/gui/kernel/qcocoaapplication_mac.mm +++ b/src/gui/kernel/qcocoaapplication_mac.mm @@ -79,6 +79,8 @@ #include <private/qcocoaapplicationdelegate_mac_p.h> #include <private/qt_cocoa_helpers_mac_p.h> +QT_USE_NAMESPACE + @implementation NSApplication (QT_MANGLE_NAMESPACE(QApplicationIntegration)) - (void)QT_MANGLE_NAMESPACE(qt_setDockMenu):(NSMenu *)newMenu @@ -107,5 +109,49 @@ | NSFontPanelStrikethroughEffectModeMask; } +- (void)qt_sendPostedMessage:(NSEvent *)event +{ + // WARNING: data1 and data2 is truncated to from 64-bit to 32-bit on OS 10.5! + // That is why we need to split the address in two parts: + quint64 lower = [event data1]; + quint64 upper = [event data2]; + QCocoaPostMessageArgs *args = reinterpret_cast<QCocoaPostMessageArgs *>(lower | (upper << 32)); + [args->target performSelector:args->selector]; + delete args; +} + +- (BOOL)qt_sendEvent:(NSEvent *)event +{ + if ([event type] == NSApplicationDefined) { + switch ([event subtype]) { + case QtCocoaEventSubTypePostMessage: + [NSApp qt_sendPostedMessage:event]; + return true; + default: + break; + } + } + return false; +} + @end + +@implementation QNSApplication + +// WARNING: If Qt did not create NSApplication (this can e.g. +// happend if Qt is used as a plugin from a 3rd-party cocoa +// application), QNSApplication::sendEvent will never be called. +// SO DO NOT RELY ON THIS FUNCTION BEING AVAILABLE. +// Plugin developers that _do_ control the NSApplication sub-class +// implementation of the 3rd-party application can call qt_sendEvent +// from the sub-class event handler (like we do here) to work around +// any issues. +- (void)sendEvent:(NSEvent *)event +{ + if (![self qt_sendEvent:event]) + [super sendEvent:event]; +} + +@end + #endif diff --git a/src/gui/kernel/qcocoaapplication_mac_p.h b/src/gui/kernel/qcocoaapplication_mac_p.h index e845d58..5569feb 100644 --- a/src/gui/kernel/qcocoaapplication_mac_p.h +++ b/src/gui/kernel/qcocoaapplication_mac_p.h @@ -99,5 +99,13 @@ QT_FORWARD_DECLARE_CLASS(QApplicationPrivate) - (QApplicationPrivate *)QT_MANGLE_NAMESPACE(qt_qappPrivate); - (QT_MANGLE_NAMESPACE(QCocoaMenuLoader) *)QT_MANGLE_NAMESPACE(qt_qcocoamenuLoader); - (int)QT_MANGLE_NAMESPACE(qt_validModesForFontPanel):(NSFontPanel *)fontPanel; + +- (void)qt_sendPostedMessage:(NSEvent *)event; +- (BOOL)qt_sendEvent:(NSEvent *)event; +@end + +@interface QNSApplication : NSApplication { +} @end + #endif diff --git a/src/gui/kernel/qcocoamenuloader_mac.mm b/src/gui/kernel/qcocoamenuloader_mac.mm index 18b3772..573b763 100644 --- a/src/gui/kernel/qcocoamenuloader_mac.mm +++ b/src/gui/kernel/qcocoamenuloader_mac.mm @@ -46,6 +46,7 @@ #include <private/qcocoamenuloader_mac_p.h> #include <private/qapplication_p.h> #include <private/qt_mac_p.h> +#include <private/qmenubar_p.h> #include <qmenubar.h> QT_FORWARD_DECLARE_CLASS(QCFString) @@ -208,6 +209,11 @@ QT_USE_NAMESPACE [NSApp hide:sender]; } +- (void)qtUpdateMenubar +{ + QMenuBarPrivate::macUpdateMenuBarImmediatly(); +} + - (IBAction)qtDispatcherToQAction:(id)sender { QScopedLoopLevelCounter loopLevelCounter(QApplicationPrivate::instance()->threadData); diff --git a/src/gui/kernel/qcocoamenuloader_mac_p.h b/src/gui/kernel/qcocoamenuloader_mac_p.h index 81c136e..2504b8c 100644 --- a/src/gui/kernel/qcocoamenuloader_mac_p.h +++ b/src/gui/kernel/qcocoamenuloader_mac_p.h @@ -85,6 +85,7 @@ - (IBAction)unhideAllApplications:(id)sender; - (IBAction)hide:(id)sender; - (IBAction)qtDispatcherToQAction:(id)sender; +- (void)qtUpdateMenubar; @end #endif // QT_MAC_USE_COCOA diff --git a/src/gui/kernel/qcocoapanel_mac.mm b/src/gui/kernel/qcocoapanel_mac.mm index 3012093..0b48efd 100644 --- a/src/gui/kernel/qcocoapanel_mac.mm +++ b/src/gui/kernel/qcocoapanel_mac.mm @@ -47,6 +47,9 @@ #import <private/qcocoaview_mac_p.h> #import <private/qcocoawindowcustomthemeframe_mac_p.h> #import <private/qcocoaapplication_mac_p.h> +#include <private/qapplication_p.h> +#include <private/qbackingstore_p.h> + #include <QtGui/QWidget> diff --git a/src/gui/kernel/qcocoasharedwindowmethods_mac_p.h b/src/gui/kernel/qcocoasharedwindowmethods_mac_p.h index d8bbcd4..9fe5ae0 100644 --- a/src/gui/kernel/qcocoasharedwindowmethods_mac_p.h +++ b/src/gui/kernel/qcocoasharedwindowmethods_mac_p.h @@ -51,6 +51,9 @@ NSPanel, while QCocoaWindow needs to inherit NSWindow rather than NSPanel). ****************************************************************************/ +// WARNING: Don't include any header files from within this file. Put them +// directly into qcocoawindow_mac_p.h and qcocoapanel_mac_p.h + QT_BEGIN_NAMESPACE extern Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum); // qcocoaview.mm extern QPointer<QWidget> qt_button_down; //qapplication_mac.cpp @@ -180,8 +183,18 @@ QT_END_NAMESPACE - (void)sendEvent:(NSEvent *)event { - QWidget *widget = [[QT_MANGLE_NAMESPACE(QCocoaWindowDelegate) sharedDelegate] qt_qwidgetForWindow:self]; + if ([event type] == NSApplicationDefined) { + switch ([event subtype]) { + case QtCocoaEventSubTypePostMessage: + [NSApp qt_sendPostedMessage:event]; + return; + default: + break; + } + return; + } + QWidget *widget = [[QT_MANGLE_NAMESPACE(QCocoaWindowDelegate) sharedDelegate] qt_qwidgetForWindow:self]; // Cocoa can hold onto the window after we've disavowed its knowledge. So, // if we get sent an event afterwards just have it go through the super's // version and don't do any stuff with Qt. @@ -205,7 +218,7 @@ QT_END_NAMESPACE qt_button_down = widget; handled = qt_mac_handleMouseEvent(view, event, QEvent::MouseButtonPress, mouseButton); // Don't call super here. This prevents us from getting the mouseUp event, - // which we need to send even if the mouseDown event was not accepted. + // which we need to send even if the mouseDown event was not accepted. // (this is standard Qt behavior.) break; case NSRightMouseDown: @@ -303,9 +316,9 @@ QT_END_NAMESPACE { // The user dragged something into the window. Send a draggingEntered message // to the QWidget under the mouse. As the drag moves over the window, and over - // different widgets, we will handle enter and leave events from within + // different widgets, we will handle enter and leave events from within // draggingUpdated below. The reason why we handle this ourselves rather than - // subscribing for drag events directly in QCocoaView is that calling + // subscribing for drag events directly in QCocoaView is that calling // registerForDraggedTypes on the views will severly degrade initialization time // for an application that uses a lot of drag subscribing widgets. @@ -369,3 +382,18 @@ QT_END_NAMESPACE return dropResult; } +- (void)displayIfNeeded +{ + + QWidget *qwidget = [[QT_MANGLE_NAMESPACE(QCocoaWindowDelegate) sharedDelegate] qt_qwidgetForWindow:self]; + if (qwidget == 0) { + [super displayIfNeeded]; + return; + } + + if (QApplicationPrivate::graphicsSystem() != 0) { + if (QWidgetBackingStore *bs = qt_widget_private(qwidget)->maybeBackingStore()) + bs->sync(qwidget, qwidget->rect()); + } + [super displayIfNeeded]; +} diff --git a/src/gui/kernel/qcocoaview_mac.mm b/src/gui/kernel/qcocoaview_mac.mm index 8c5d166..455176e 100644 --- a/src/gui/kernel/qcocoaview_mac.mm +++ b/src/gui/kernel/qcocoaview_mac.mm @@ -83,21 +83,7 @@ extern bool qt_sendSpontaneousEvent(QObject *, QEvent *); // qapplication.cpp extern OSViewRef qt_mac_nativeview_for(const QWidget *w); // qwidget_mac.mm extern QPointer<QWidget> qt_mouseover; //qapplication_mac.mm extern QPointer<QWidget> qt_button_down; //qapplication_mac.cpp - -Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum) -{ - if (buttonNum == 0) - return Qt::LeftButton; - if (buttonNum == 1) - return Qt::RightButton; - if (buttonNum == 2) - return Qt::MidButton; - if (buttonNum == 3) - return Qt::XButton1; - if (buttonNum == 4) - return Qt::XButton2; - return Qt::NoButton; -} +extern Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum); struct dndenum_mapper { @@ -474,10 +460,11 @@ extern "C" { - (void)drawRect:(NSRect)aRect { if (QApplicationPrivate::graphicsSystem() != 0) { - if (QWidgetBackingStore *bs = qwidgetprivate->maybeBackingStore()) - bs->markDirty(qwidget->rect(), qwidget); - qwidgetprivate->syncBackingStore(qwidget->rect()); - return; + if (QWidgetBackingStore *bs = qwidgetprivate->maybeBackingStore()) { + // Drawing is handled on the window level + // See qcocoasharedwindowmethods_mac_p. + return; + } } CGContextRef cg = (CGContextRef)[[NSGraphicsContext currentContext] graphicsPort]; qwidgetprivate->hd = cg; @@ -488,7 +475,15 @@ extern "C" { qWarning("QWidget::repaint: Recursive repaint detected"); const QRect qrect = QRect(aRect.origin.x, aRect.origin.y, aRect.size.width, aRect.size.height); - QRegion qrgn(qrect); + QRegion qrgn; + + const NSRect *rects; + NSInteger count; + [self getRectsBeingDrawn:&rects count:&count]; + for (int i = 0; i < count; ++i) { + QRect tmpRect = QRect(rects[i].origin.x, rects[i].origin.y, rects[i].size.width, rects[i].size.height); + qrgn += tmpRect; + } if (!qwidget->isWindow() && !qobject_cast<QAbstractScrollArea *>(qwidget->parent())) { const QRegion &parentMask = qwidget->window()->mask(); @@ -785,6 +780,7 @@ extern "C" { deltaZ = qBound(-120, int([theEvent deltaZ] * 10000), 120); } +#ifndef QT_NO_WHEELEVENT if (deltaX != 0) { QWheelEvent qwe(qlocal, qglobal, deltaX, buttons, keyMods, Qt::Horizontal); qt_sendSpontaneousEvent(widgetToGetMouse, &qwe); @@ -825,6 +821,8 @@ extern "C" { wheelOK = qwe2.isAccepted(); } } +#endif //QT_NO_WHEELEVENT + if (!wheelOK) { return [super scrollWheel:theEvent]; } @@ -1361,7 +1359,7 @@ Qt::DropAction QDragManager::drag(QDrag *o) // setup the data QMacPasteboard dragBoard((CFStringRef) NSDragPboard, QMacPasteboardMime::MIME_DND); - dragPrivate()->data->setData(QLatin1String("application/x-qt-mime-type-name"), QByteArray()); + dragPrivate()->data->setData(QLatin1String("application/x-qt-mime-type-name"), QByteArray("dummy")); dragBoard.setMimeData(dragPrivate()->data); // create the image diff --git a/src/gui/kernel/qcocoawindow_mac_p.h b/src/gui/kernel/qcocoawindow_mac_p.h index 403a1a5..21f82df 100644 --- a/src/gui/kernel/qcocoawindow_mac_p.h +++ b/src/gui/kernel/qcocoawindow_mac_p.h @@ -53,6 +53,9 @@ #ifdef QT_MAC_USE_COCOA #include "qmacdefines_mac.h" #import <Cocoa/Cocoa.h> +#include <private/qapplication_p.h> +#include <private/qbackingstore_p.h> + enum { QtMacCustomizeWindow = 1 << 21 }; // This will one day be run over by diff --git a/src/gui/kernel/qdesktopwidget_s60.cpp b/src/gui/kernel/qdesktopwidget_s60.cpp index 77745ea..84e3c5d 100644 --- a/src/gui/kernel/qdesktopwidget_s60.cpp +++ b/src/gui/kernel/qdesktopwidget_s60.cpp @@ -88,24 +88,20 @@ QDesktopWidgetPrivate::~QDesktopWidgetPrivate() void QDesktopWidgetPrivate::init(QDesktopWidget *that) { - int screenCount=0; +// int screenCount=0; - if (HAL::Get(0, HALData::EDisplayNumberOfScreens, screenCount) == KErrNone) - QDesktopWidgetPrivate::screenCount = screenCount; - else - QDesktopWidgetPrivate::screenCount = 0; + // ### TODO: Implement proper multi-display support + QDesktopWidgetPrivate::screenCount = 1; +// if (HAL::Get(0, HALData::EDisplayNumberOfScreens, screenCount) == KErrNone) +// QDesktopWidgetPrivate::screenCount = screenCount; +// else +// QDesktopWidgetPrivate::screenCount = 0; rects = new QVector<QRect>(); workrects = new QVector<QRect>(); rects->resize(QDesktopWidgetPrivate::screenCount); workrects->resize(QDesktopWidgetPrivate::screenCount); - - // ### TODO: Implement proper multi-display support - rects->resize(1); - rects->replace(0, that->rect()); - workrects->resize(1); - workrects->replace(0, that->rect()); } void QDesktopWidgetPrivate::cleanup() diff --git a/src/gui/kernel/qeventdispatcher_mac.mm b/src/gui/kernel/qeventdispatcher_mac.mm index c7d042d..afea3ec 100644 --- a/src/gui/kernel/qeventdispatcher_mac.mm +++ b/src/gui/kernel/qeventdispatcher_mac.mm @@ -497,6 +497,14 @@ static bool IsMouseOrKeyEvent( NSEvent* event ) case NSOtherMouseDown: case NSOtherMouseUp: case NSOtherMouseDragged: +#if MAC_OS_X_VERSION_MAX_ALLOWED >= MAC_OS_X_VERSION_10_6 + case NSEventTypeGesture: // touch events + case NSEventTypeMagnify: + case NSEventTypeSwipe: + case NSEventTypeRotate: + case NSEventTypeBeginGesture: + case NSEventTypeEndGesture: +#endif result = true; break; @@ -565,6 +573,18 @@ bool QEventDispatcherMac::processEvents(QEventLoop::ProcessEventsFlags flags) QMacCocoaAutoReleasePool pool; NSEvent* event = 0; + // First, send all previously excluded input events, if any: + if (!(flags & QEventLoop::ExcludeUserInputEvents)) { + while (!d->queuedUserInputEvents.isEmpty()) { + event = static_cast<NSEvent *>(d->queuedUserInputEvents.takeFirst()); + if (!filterEvent(event)) { + qt_mac_send_event(flags, event, 0); + retVal = true; + } + [event release]; + } + } + // If Qt is used as a plugin, or as an extension in a native cocoa // application, we should not run or stop NSApplication; This will be // done from the application itself. And if processEvents is called @@ -598,49 +618,33 @@ bool QEventDispatcherMac::processEvents(QEventLoop::ProcessEventsFlags flags) // We cannot block the thread (and run in a tight loop). // Instead we will process all current pending events and return. d->ensureNSAppInitialized(); - do { - bool releaseEvent = false; - - if (!(flags & QEventLoop::ExcludeUserInputEvents) - && !d->queuedUserInputEvents.isEmpty()) { - // Process a pending user input event - releaseEvent = true; - event = static_cast<NSEvent *>(d->queuedUserInputEvents.takeFirst()); - } else { - if (NSModalSession session = d->currentModalSession()) { - if (flags & QEventLoop::WaitForMoreEvents) - qt_mac_waitForMoreModalSessionEvents(); - NSInteger status = [NSApp runModalSession:session]; - if (status != NSRunContinuesResponse && session == d->currentModalSessionCached) { - // INVARIANT: Someone called [NSApp stopModal:] from outside the event - // dispatcher (e.g to stop a native dialog). But that call wrongly stopped - // 'session' as well. As a result, we need to restart all internal sessions: - d->temporarilyStopAllModalSessions(); - } - retVal = true; - break; - } else { - event = [NSApp nextEventMatchingMask:NSAnyEventMask - untilDate:nil - inMode:NSDefaultRunLoopMode - dequeue: YES]; - - if (event != nil) { - if (flags & QEventLoop::ExcludeUserInputEvents) { - if (IsMouseOrKeyEvent(event)) { - [event retain]; - d->queuedUserInputEvents.append(event); - continue; - } - } - } - } + if (NSModalSession session = d->currentModalSession()) { + if (flags & QEventLoop::WaitForMoreEvents) + qt_mac_waitForMoreModalSessionEvents(); + NSInteger status = [NSApp runModalSession:session]; + if (status != NSRunContinuesResponse && session == d->currentModalSessionCached) { + // INVARIANT: Someone called [NSApp stopModal:] from outside the event + // dispatcher (e.g to stop a native dialog). But that call wrongly stopped + // 'session' as well. As a result, we need to restart all internal sessions: + d->temporarilyStopAllModalSessions(); } + retVal = true; + } else do { + event = [NSApp nextEventMatchingMask:NSAnyEventMask + untilDate:nil + inMode:NSDefaultRunLoopMode + dequeue: YES]; + if (event) { + if (flags & QEventLoop::ExcludeUserInputEvents) { + if (IsMouseOrKeyEvent(event)) { + [event retain]; + d->queuedUserInputEvents.append(event); + continue; + } + } if (!filterEvent(event) && qt_mac_send_event(flags, event, 0)) retVal = true; - if (releaseEvent) - [event release]; } } while (!d->interrupt && event != nil); @@ -1064,10 +1068,9 @@ void QEventDispatcherMacPrivate::cancelWaitForMoreEvents() // In case the event dispatcher is waiting for more // events somewhere, we post a dummy event to wake it up: QMacCocoaAutoReleasePool pool; - static const short NSAppShouldStopForQt = SHRT_MAX; [NSApp postEvent:[NSEvent otherEventWithType:NSApplicationDefined location:NSZeroPoint modifierFlags:0 timestamp:0. windowNumber:0 context:0 - subtype:NSAppShouldStopForQt data1:0 data2:0] atStart:NO]; + subtype:QtCocoaEventSubTypeWakeup data1:0 data2:0] atStart:NO]; } #endif diff --git a/src/gui/kernel/qkeymapper_x11.cpp b/src/gui/kernel/qkeymapper_x11.cpp index 70574e7..4e6c847 100644 --- a/src/gui/kernel/qkeymapper_x11.cpp +++ b/src/gui/kernel/qkeymapper_x11.cpp @@ -360,6 +360,13 @@ QList<int> QKeyMapperPrivate::possibleKeysXKB(QKeyEvent *event) if (code && code < 0xfffe) code = QChar(code).toUpper().unicode(); + + if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) { + // map shift+tab to shift+backtab + code = Qt::Key_Backtab; + text = QString(); + } + if (code == baseCode) continue; @@ -448,6 +455,13 @@ QList<int> QKeyMapperPrivate::possibleKeysCore(QKeyEvent *event) if (code && code < 0xfffe) code = QChar(code).toUpper().unicode(); + + if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) { + // map shift+tab to shift+backtab + code = Qt::Key_Backtab; + text = QString(); + } + if (code == baseCode) continue; diff --git a/src/gui/kernel/qsoftkeymanager.cpp b/src/gui/kernel/qsoftkeymanager.cpp index 6d108b0..c9a94ee 100644 --- a/src/gui/kernel/qsoftkeymanager.cpp +++ b/src/gui/kernel/qsoftkeymanager.cpp @@ -55,24 +55,24 @@ QT_BEGIN_NAMESPACE QSoftKeyManager *QSoftKeyManagerPrivate::self = 0; -const char *QSoftKeyManager::standardSoftKeyText(StandardSoftKey standardKey) +QString QSoftKeyManager::standardSoftKeyText(StandardSoftKey standardKey) { - const char *softKeyText = 0; + QString softKeyText; switch (standardKey) { case OkSoftKey: - softKeyText = QT_TRANSLATE_NOOP("QSoftKeyManager", "Ok"); + softKeyText = QSoftKeyManager::tr("Ok"); break; case SelectSoftKey: - softKeyText = QT_TRANSLATE_NOOP("QSoftKeyManager", "Select"); + softKeyText = QSoftKeyManager::tr("Select"); break; case DoneSoftKey: - softKeyText = QT_TRANSLATE_NOOP("QSoftKeyManager", "Done"); + softKeyText = QSoftKeyManager::tr("Done"); break; case MenuSoftKey: - softKeyText = QT_TRANSLATE_NOOP("QSoftKeyManager", "Options"); + softKeyText = QSoftKeyManager::tr("Options"); break; case CancelSoftKey: - softKeyText = QT_TRANSLATE_NOOP("QSoftKeyManager", "Cancel"); + softKeyText = QSoftKeyManager::tr("Cancel"); break; default: break; @@ -100,8 +100,7 @@ QSoftKeyManager::QSoftKeyManager() : QAction *QSoftKeyManager::createAction(StandardSoftKey standardKey, QWidget *actionWidget) { - const char* text = standardSoftKeyText(standardKey); - QAction *action = new QAction(QSoftKeyManager::tr(text), actionWidget); + QAction *action = new QAction(standardSoftKeyText(standardKey), actionWidget); QAction::SoftKeyRole softKeyRole = QAction::NoSoftKey; switch (standardKey) { case MenuSoftKey: // FALL-THROUGH @@ -211,13 +210,11 @@ bool QSoftKeyManager::handleUpdateSoftKeys() d->requestedSoftKeyActions.clear(); bool recursiveMerging = false; QWidget *source = softkeySource(NULL, recursiveMerging); - do { - if (source) { - bool added = appendSoftkeys(*source, level); - source = softkeySource(source, recursiveMerging); - level = added ? ++level : level; - } - } while (source); + while (source) { + if (appendSoftkeys(*source, level)) + ++level; + source = softkeySource(source, recursiveMerging); + } d->updateSoftKeys_sys(); return true; diff --git a/src/gui/kernel/qsoftkeymanager_p.h b/src/gui/kernel/qsoftkeymanager_p.h index ce902fe..a6fe17e 100644 --- a/src/gui/kernel/qsoftkeymanager_p.h +++ b/src/gui/kernel/qsoftkeymanager_p.h @@ -87,6 +87,7 @@ public: static QAction *createAction(StandardSoftKey standardKey, QWidget *actionWidget); static QAction *createKeyedAction(StandardSoftKey standardKey, Qt::Key key, QWidget *actionWidget); + static QString standardSoftKeyText(StandardSoftKey standardKey); protected: bool event(QEvent *e); @@ -94,7 +95,6 @@ protected: private: QSoftKeyManager(); static QSoftKeyManager *instance(); - static const char *standardSoftKeyText(StandardSoftKey standardKey); bool appendSoftkeys(const QWidget &source, int level); QWidget *softkeySource(QWidget *previousSource, bool& recursiveMerging); bool handleUpdateSoftKeys(); diff --git a/src/gui/kernel/qsoftkeymanager_s60.cpp b/src/gui/kernel/qsoftkeymanager_s60.cpp index 67ed8b0..8ac1e31 100644 --- a/src/gui/kernel/qsoftkeymanager_s60.cpp +++ b/src/gui/kernel/qsoftkeymanager_s60.cpp @@ -49,7 +49,7 @@ #include "private/qsoftkeymanager_p.h" #include "private/qsoftkeymanager_s60_p.h" #include "private/qobject_p.h" -//#include <eiksoftkeyimage.h> +#include <eiksoftkeyimage.h> #include <eikcmbut.h> #ifndef QT_NO_SOFTKEYMANAGER @@ -64,17 +64,20 @@ QSoftKeyManagerPrivateS60::QSoftKeyManagerPrivateS60() { cachedCbaIconSize[0] = QSize(0,0); cachedCbaIconSize[1] = QSize(0,0); - skipNextUpdate = false; + cachedCbaIconSize[2] = QSize(0,0); + cachedCbaIconSize[3] = QSize(0,0); } bool QSoftKeyManagerPrivateS60::skipCbaUpdate() { - // lets not update softkeys if + // Lets not update softkeys if // 1. We don't have application panes, i.e. cba - // 2. S60 native dialog or menu is shown - if (QApplication::testAttribute(Qt::AA_S60DontConstructApplicationPanes) || - CCoeEnv::Static()->AppUi()->IsDisplayingMenuOrDialog() || skipNextUpdate) { - skipNextUpdate = false; + // 2. Our CBA is not active, i.e. S60 native dialog or menu with custom CBA is shown + // Note: Cannot use IsDisplayingMenuOrDialog since CBA update can be triggered before + // menu/dialog CBA is actually displayed i.e. it is being costructed. + CEikButtonGroupContainer *appUiCba = S60->buttonGroupContainer(); + CEikButtonGroupContainer *currentCba = CEikButtonGroupContainer::Current(); + if (QApplication::testAttribute(Qt::AA_S60DontConstructApplicationPanes) || appUiCba != currentCba) { return true; } return false; @@ -149,6 +152,39 @@ void QSoftKeyManagerPrivateS60::setNativeSoftkey(CEikButtonGroupContainer &cba, QT_TRAP_THROWING(cba.SetCommandL(position, command, text)); } +QPoint QSoftKeyManagerPrivateS60::softkeyIconPosition(int position, QSize sourceSize, QSize targetSize) +{ + QPoint iconPosition(0,0); + switch( AknLayoutUtils::CbaLocation() ) + { + case AknLayoutUtils::EAknCbaLocationBottom: + // RSK must be moved to right, LSK in on correct position by default + if (position == RSK_POSITION) + iconPosition.setX(targetSize.width() - sourceSize.width()); + break; + case AknLayoutUtils::EAknCbaLocationRight: + case AknLayoutUtils::EAknCbaLocationLeft: + // Already in correct position + default: + break; + } + + // Align horizontally to center + iconPosition.setY((targetSize.height() - sourceSize.height()) >> 1); + return iconPosition; +} + +QPixmap QSoftKeyManagerPrivateS60::prepareSoftkeyPixmap(QPixmap src, int position, QSize targetSize) +{ + QPixmap target(targetSize); + target.fill(Qt::transparent); + QPainter p; + p.begin(&target); + p.drawPixmap(softkeyIconPosition(position, src.size(), targetSize), src); + p.end(); + return target; +} + bool QSoftKeyManagerPrivateS60::isOrientationLandscape() { // Hard to believe that there is no public API in S60 to @@ -158,15 +194,11 @@ bool QSoftKeyManagerPrivateS60::isOrientationLandscape() QSize QSoftKeyManagerPrivateS60::cbaIconSize(CEikButtonGroupContainer *cba, int position) { - Q_UNUSED(cba); - Q_UNUSED(position); - // Will be implemented when EikSoftkeyImage usage license wise is OK -/* - const int index = isOrientationLandscape() ? 0 : 1; + int index = position; + index += isOrientationLandscape() ? 0 : 1; if(cachedCbaIconSize[index].isNull()) { // Only way I figured out to get CBA icon size without RnD SDK, was - // Only way I figured out to get CBA icon size without RnD SDK, was // to set some dummy icon to CBA first and then ask CBA button CCoeControl::Size() // The returned value is cached to avoid unnecessary icon setting every time. const bool left = (position == LSK_POSITION); @@ -178,38 +210,46 @@ QSize QSoftKeyManagerPrivateS60::cbaIconSize(CEikButtonGroupContainer *cba, int setNativeSoftkey(*cba, position, command, KNullDesC()); cachedCbaIconSize[index] = qt_TSize2QSize(cba->ControlOrNull(command)->Size()); EikSoftkeyImage::SetLabel(cba, left); + + if(cachedCbaIconSize[index] == QSize(138,72)) { + // Hack for S60 5.0 (5800) landscape orientation, which return wrong icon size + cachedCbaIconSize[index] = QSize(60,60); + } } } return cachedCbaIconSize[index]; -*/ - return QSize(); } bool QSoftKeyManagerPrivateS60::setSoftkeyImage(CEikButtonGroupContainer *cba, QAction &action, int position) { bool ret = false; - Q_UNUSED(cba); - Q_UNUSED(action); - Q_UNUSED(position); - // Will be implemented when EikSoftkeyImage usage license wise is OK - /* const bool left = (position == LSK_POSITION); if(position == LSK_POSITION || position == RSK_POSITION) { QIcon icon = action.icon(); if (!icon.isNull()) { - QPixmap pm = icon.pixmap(cbaIconSize(cba, position)); - pm = pm.scaled(cbaIconSize(cba, position)); - QBitmap mask = pm.mask(); - if (mask.isNull()) { - mask = QBitmap(pm.size()); - mask.fill(Qt::color1); + // Get size of CBA icon area based on button position and orientation + QSize requiredIconSize = cbaIconSize(cba, position); + // Get pixmap out of icon based on preferred size, the aspect ratio is kept + QPixmap pmWihtAspectRatio = icon.pixmap(requiredIconSize); + // Native softkeys require that pixmap size is exactly the same as requiredIconSize + // prepareSoftkeyPixmap creates a new pixmap with requiredIconSize and blits the 'pmWihtAspectRatio' + // to correct location of it + QPixmap softkeyPixmap = prepareSoftkeyPixmap(pmWihtAspectRatio, position, requiredIconSize); + + QPixmap softkeyAlpha = softkeyPixmap.alphaChannel(); + // Alpha channel in 5.1 and older devices need to be inverted + // TODO: Switch to use toSymbianCFbsBitmap with invert when available + if(QSysInfo::s60Version() <= QSysInfo::SV_S60_5_1) { + QImage alphaImage = softkeyAlpha.toImage(); + alphaImage.invertPixels(); + softkeyAlpha = QPixmap::fromImage(alphaImage); } - CFbsBitmap* nBitmap = pm.toSymbianCFbsBitmap(); - CFbsBitmap* nMask = mask.toSymbianCFbsBitmap(); + CFbsBitmap* nBitmap = softkeyPixmap.toSymbianCFbsBitmap(); + CFbsBitmap* nMask = softkeyAlpha.toSymbianCFbsBitmap(); CEikImage* myimage = new (ELeave) CEikImage; myimage->SetPicture( nBitmap, nMask ); // nBitmap and nMask ownership transfered @@ -221,7 +261,6 @@ bool QSoftKeyManagerPrivateS60::setSoftkeyImage(CEikButtonGroupContainer *cba, EikSoftkeyImage::SetLabel(cba, left); } } - */ return ret; } @@ -272,6 +311,7 @@ bool QSoftKeyManagerPrivateS60::setRightSoftkey(CEikButtonGroupContainer &cba) if (windowType != Qt::Dialog && windowType != Qt::Popup) { QString text(QSoftKeyManager::tr("Exit")); TPtrC nativeText = qt_QString2TPtrC(text); + EikSoftkeyImage::SetLabel(&cba, false); setNativeSoftkey(cba, RSK_POSITION, EAknSoftkeyExit, nativeText); return true; } @@ -303,7 +343,6 @@ void QSoftKeyManagerPrivateS60::setSoftkeys(CEikButtonGroupContainer &cba) void QSoftKeyManagerPrivateS60::updateSoftKeys_sys() { - //bool status = CCoeEnv::Static()->AppUi()->IsDisplayingMenuOrDialog(); if (skipCbaUpdate()) return; @@ -346,9 +385,6 @@ bool QSoftKeyManagerPrivateS60::handleCommand(int command) } qt_symbian_next_menu_from_action(actionContainer); QT_TRAP_THROWING(S60->menuBar()->TryDisplayMenuBarL()); - // TODO: hack remove, it can happen that IsDisplayingMenuOrDialog return false - // in updateSoftKeys_sys, and we will override menu CBA with our own - skipNextUpdate = true; } else { Q_ASSERT(action->softKeyRole() != QAction::NoSoftKey); QWidget *actionParent = action->parentWidget(); diff --git a/src/gui/kernel/qsoftkeymanager_s60_p.h b/src/gui/kernel/qsoftkeymanager_s60_p.h index 46e3596..823a2db 100644 --- a/src/gui/kernel/qsoftkeymanager_s60_p.h +++ b/src/gui/kernel/qsoftkeymanager_s60_p.h @@ -84,6 +84,8 @@ private: QAction *highestPrioritySoftkey(QAction::SoftKeyRole role); static bool actionPriorityMoreThan(const QAction* item1, const QAction* item2); void setNativeSoftkey(CEikButtonGroupContainer &cba, TInt position, TInt command, const TDesC& text); + QPoint softkeyIconPosition(int position, QSize sourceSize, QSize targetSize); + QPixmap prepareSoftkeyPixmap(QPixmap src, int position, QSize targetSize); bool isOrientationLandscape(); QSize cbaIconSize(CEikButtonGroupContainer *cba, int position); bool setSoftkeyImage(CEikButtonGroupContainer *cba, QAction &action, int position); @@ -95,8 +97,7 @@ private: private: QHash<int, QAction*> realSoftKeyActions; - QSize cachedCbaIconSize[2]; - bool skipNextUpdate; + QSize cachedCbaIconSize[4]; }; diff --git a/src/gui/kernel/qt_cocoa_helpers_mac.mm b/src/gui/kernel/qt_cocoa_helpers_mac.mm index 377e5a0..e9fdbda 100644 --- a/src/gui/kernel/qt_cocoa_helpers_mac.mm +++ b/src/gui/kernel/qt_cocoa_helpers_mac.mm @@ -83,6 +83,7 @@ #include <private/qt_cocoa_helpers_mac_p.h> #include <private/qt_mac_p.h> #include <private/qapplication_p.h> +#include <private/qcocoaapplication_mac_p.h> #include <private/qcocoawindow_mac_p.h> #include <private/qcocoaview_mac_p.h> #include <private/qkeymapper_p.h> @@ -137,7 +138,6 @@ void QMacWindowFader::performFade() } extern bool qt_sendSpontaneousEvent(QObject *receiver, QEvent *event); // qapplication.cpp; -extern Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum); // qcocoaview.mm extern QWidget * mac_mouse_grabber; extern QPointer<QWidget> qt_button_down; //qapplication_mac.cpp @@ -647,6 +647,21 @@ bool qt_dispatchKeyEventWithCocoa(void * /*NSEvent * */ keyEvent, QWidget *widge } #endif +Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum) +{ + if (buttonNum == 0) + return Qt::LeftButton; + if (buttonNum == 1) + return Qt::RightButton; + if (buttonNum == 2) + return Qt::MidButton; + if (buttonNum == 3) + return Qt::XButton1; + if (buttonNum == 4) + return Qt::XButton2; + return Qt::NoButton; +} + // Helper to share code between QCocoaWindow and QCocoaView bool qt_dispatchKeyEvent(void * /*NSEvent * */ keyEvent, QWidget *widgetToGetEvent) { @@ -955,7 +970,7 @@ bool qt_mac_handleMouseEvent(void * /* NSView * */view, void * /* NSEvent * */ev #ifndef QT_NAMESPACE Q_ASSERT(clickCount > 0); #endif - if (clickCount % 2 == 0) + if (clickCount % 2 == 0 && buttons == button) eventType = QEvent::MouseButtonDblClick; if (button == Qt::LeftButton && (keyMods & Qt::MetaModifier)) { button = Qt::RightButton; @@ -967,6 +982,7 @@ bool qt_mac_handleMouseEvent(void * /* NSView * */view, void * /* NSEvent * */ev button = Qt::RightButton; [theView qt_setLeftButtonIsRightButton: false]; } + qt_button_down = 0; break; } [QT_MANGLE_NAMESPACE(QCocoaView) currentMouseEvent]->localPoint = localPoint; @@ -1162,7 +1178,7 @@ CGContextRef qt_mac_graphicsContextFor(QWidget *widget) CGrafPtr port = GetWindowPort(qt_mac_window_for(widget)); QDBeginCGContext(port, &context); #else - CGContextRef context = (CGContextRef)[[NSGraphicsContext graphicsContextWithWindow:qt_mac_window_for(widget)] graphicsPort]; + CGContextRef context = reinterpret_cast<CGContextRef>([[qt_mac_window_for(widget) graphicsContext] graphicsPort]); #endif return context; } @@ -1279,22 +1295,42 @@ void qt_cocoaChangeOverrideCursor(const QCursor &cursor) QMacCocoaAutoReleasePool pool; [static_cast<NSCursor *>(qt_mac_nsCursorForQCursor(cursor)) set]; } -#endif -@implementation DebugNSApplication { -} -- (void)sendEvent:(NSEvent *)event +// WARNING: If Qt did not create NSApplication (e.g. in case it is +// used as a plugin), and at the same time, there is no window on +// screen (or the window that the event is sendt to becomes hidden etc +// before the event gets delivered), the message will not be performed. +bool qt_cocoaPostMessage(id target, SEL selector) { - NSLog(@"NSAppDebug: sendEvent: %@", event); - return [super sendEvent:event]; -} + if (!target) + return false; -- (BOOL)sendAction:(SEL)anAction to:(id)aTarget from:(id)sender -{ - NSLog(@"NSAppDebug: sendAction: %s to %@ from %@", anAction, aTarget, sender); - return [super sendAction:anAction to:aTarget from:sender]; + NSInteger windowNumber = 0; + if (![NSApp isMemberOfClass:[QNSApplication class]]) { + // INVARIANT: Cocoa is not using our NSApplication subclass. That means + // we don't control the main event handler either. So target the event + // for one of the windows on screen: + NSWindow *nswin = [NSApp mainWindow]; + if (!nswin) { + nswin = [NSApp keyWindow]; + if (!nswin) + return false; + } + windowNumber = [nswin windowNumber]; + } + + // WARNING: data1 and data2 is truncated to from 64-bit to 32-bit on OS 10.5! + // That is why we need to split the address in two parts: + QCocoaPostMessageArgs *args = new QCocoaPostMessageArgs(target, selector); + quint32 lower = quintptr(args); + quint32 upper = quintptr(args) >> 32; + NSEvent *e = [NSEvent otherEventWithType:NSApplicationDefined + location:NSZeroPoint modifierFlags:0 timestamp:0 windowNumber:windowNumber + context:nil subtype:QtCocoaEventSubTypePostMessage data1:lower data2:upper]; + [NSApp postEvent:e atStart:NO]; + return true; } -@end +#endif QMacCocoaAutoReleasePool::QMacCocoaAutoReleasePool() { diff --git a/src/gui/kernel/qt_cocoa_helpers_mac_p.h b/src/gui/kernel/qt_cocoa_helpers_mac_p.h index ace8255..c43ea55 100644 --- a/src/gui/kernel/qt_cocoa_helpers_mac_p.h +++ b/src/gui/kernel/qt_cocoa_helpers_mac_p.h @@ -114,6 +114,12 @@ typedef struct CGPoint NSPoint; #endif QT_BEGIN_NAMESPACE + +enum { + QtCocoaEventSubTypeWakeup = SHRT_MAX, + QtCocoaEventSubTypePostMessage = SHRT_MAX-1 +}; + Qt::MouseButtons qt_mac_get_buttons(int buttons); Qt::MouseButton qt_mac_get_button(EventMouseButton button); void macWindowFade(void * /*OSWindowRef*/ window, float durationSeconds = 0.15); @@ -182,8 +188,23 @@ inline QString qt_mac_NSStringToQString(const NSString *nsstr) inline NSString *qt_mac_QStringToNSString(const QString &qstr) { return [reinterpret_cast<const NSString *>(QCFString::toCFStringRef(qstr)) autorelease]; } -@interface DebugNSApplication : NSApplication {} -@end +#ifdef QT_MAC_USE_COCOA +class QCocoaPostMessageArgs { +public: + id target; + SEL selector; + QCocoaPostMessageArgs(id target, SEL selector) : target(target), selector(selector) + { + [target retain]; + } + + ~QCocoaPostMessageArgs() + { + [target release]; + } +}; +bool qt_cocoaPostMessage(id target, SEL selector); +#endif #endif diff --git a/src/gui/kernel/qt_x11_p.h b/src/gui/kernel/qt_x11_p.h index b2ce754..167557b 100644 --- a/src/gui/kernel/qt_x11_p.h +++ b/src/gui/kernel/qt_x11_p.h @@ -564,11 +564,8 @@ struct QX11Data _MOTIF_WM_HINTS, DTWM_IS_RUNNING, - KDE_FULL_SESSION, - KWIN_RUNNING, - KWM_RUNNING, - GNOME_BACKGROUND_PROPERTIES, ENLIGHTENMENT_DESKTOP, + _DT_SAVE_MODE, _SGI_DESKS_MANAGER, // EWMH (aka NETWM) diff --git a/src/gui/kernel/qwidget.cpp b/src/gui/kernel/qwidget.cpp index 884447d..d433048 100644 --- a/src/gui/kernel/qwidget.cpp +++ b/src/gui/kernel/qwidget.cpp @@ -192,6 +192,7 @@ QWidgetPrivate::QWidgetPrivate(int version) , inDirtyList(0) , isScrolled(0) , isMoved(0) + , isGLWidget(0) , usesDoubleBufferedGLContext(0) #if defined(Q_WS_X11) , picture(0) @@ -200,7 +201,6 @@ QWidgetPrivate::QWidgetPrivate(int version) , nativeGesturePanEnabled(0) #elif defined(Q_WS_MAC) , needWindowChange(0) - , isGLWidget(0) , window_event(0) , qd_hd(0) #endif @@ -1439,6 +1439,18 @@ QWidget::~QWidget() } #endif +#ifdef Q_OS_SYMBIAN + if (d->extra && d->extra->topextra && d->extra->topextra->backingStore) { + // Okay, we are about to destroy the top-level window that owns + // the backing store. Make sure we delete the backing store right away + // before the window handle is invalid. This is important because + // the backing store will delete its window surface, which may or may + // not have a reference to this widget that will be used later to + // notify the window it no longer has a surface. + delete d->extra->topextra->backingStore; + d->extra->topextra->backingStore = 0; + } +#endif if (QWidgetBackingStore *bs = d->maybeBackingStore()) { bs->removeDirtyWidget(this); if (testAttribute(Qt::WA_StaticContents)) @@ -1660,7 +1672,13 @@ void QWidgetPrivate::syncBackingStore() repaint_sys(dirty); dirty = QRegion(); } else if (QWidgetBackingStore *bs = maybeBackingStore()) { +#ifdef QT_MAC_USE_COCOA + Q_UNUSED(bs); + void qt_mac_set_needs_display(QWidget *, QRegion); + qt_mac_set_needs_display(q_func(), QRegion()); +#else bs->sync(); +#endif } } @@ -1668,8 +1686,15 @@ void QWidgetPrivate::syncBackingStore(const QRegion ®ion) { if (paintOnScreen()) repaint_sys(region); - else if (QWidgetBackingStore *bs = maybeBackingStore()) + else if (QWidgetBackingStore *bs = maybeBackingStore()) { +#ifdef QT_MAC_USE_COCOA + Q_UNUSED(bs); + void qt_mac_set_needs_display(QWidget *, QRegion); + qt_mac_set_needs_display(q_func(), region); +#else bs->sync(q_func(), region); +#endif + } } void QWidgetPrivate::setUpdatesEnabled_helper(bool enable) @@ -6422,6 +6447,8 @@ void QWidget::setTabOrder(QWidget* first, QWidget *second) first = fp; } + if (fp == second) + return; if (QWidget *sp = second->focusProxy()) second = sp; @@ -8250,7 +8277,7 @@ bool QWidget::event(QEvent *event) } #ifdef QT_SOFTKEYS_ENABLED - if (isWindow() && isActiveWindow()) + if (isWindow()) QSoftKeyManager::updateSoftKeys(); #endif diff --git a/src/gui/kernel/qwidget_mac.mm b/src/gui/kernel/qwidget_mac.mm index 878b776..da9e9eb 100644 --- a/src/gui/kernel/qwidget_mac.mm +++ b/src/gui/kernel/qwidget_mac.mm @@ -565,6 +565,25 @@ inline static void qt_mac_set_window_group_to_popup(OSWindowRef window) } #endif +#ifdef QT_MAC_USE_COCOA +void qt_mac_set_needs_display(QWidget *widget, QRegion region) +{ + NSView *theNSView = qt_mac_nativeview_for(widget); + if (region.isEmpty()) { + [theNSView setNeedsDisplay:YES]; + return; + } + + QVector<QRect> rects = region.rects(); + for (int i = 0; i<rects.count(); ++i) { + const QRect &rect = rects.at(i); + NSRect nsrect = NSMakeRect(rect.x(), rect.y(), rect.width(), rect.height()); + [theNSView setNeedsDisplayInRect:nsrect]; + } + +} +#endif + inline static bool updateRedirectedToGraphicsProxyWidget(QWidget *widget, const QRect &rect) { if (!widget) @@ -2834,13 +2853,14 @@ void QWidgetPrivate::setParent_sys(QWidget *parent, Qt::WindowFlags f) //recreate and setup flags QObjectPrivate::setParent_helper(parent); - QPoint pt = q->pos(); bool explicitlyHidden = q->testAttribute(Qt::WA_WState_Hidden) && q->testAttribute(Qt::WA_WState_ExplicitShowHide); if (wasCreated && !qt_isGenuineQWidget(q)) return; - if ((data.window_flags & Qt::Sheet) && topData && topData->opacity == 242) + if (!q->testAttribute(Qt::WA_WState_WindowOpacitySet)) { q->setWindowOpacity(1.0f); + q->setAttribute(Qt::WA_WState_WindowOpacitySet, false); + } setWinId(0); //do after the above because they may want the id @@ -3327,38 +3347,20 @@ void QWidgetPrivate::show_sys() return; bool realWindow = isRealWindow(); +#ifndef QT_MAC_USE_COCOA if (realWindow && !q->testAttribute(Qt::WA_Moved)) { + if (qt_mac_is_macsheet(q)) + recreateMacWindow(); q->createWinId(); if (QWidget *p = q->parentWidget()) { p->createWinId(); -#ifndef QT_MAC_USE_COCOA RepositionWindow(qt_mac_window_for(q), qt_mac_window_for(p), kWindowCenterOnParentWindow); -#else - CGRect parentFrame = NSRectToCGRect([qt_mac_window_for(p) frame]); - OSWindowRef windowRef = qt_mac_window_for(q); - NSRect windowFrame = [windowRef frame]; - NSPoint parentCenter = NSMakePoint(CGRectGetMidX(parentFrame), CGRectGetMidY(parentFrame)); - [windowRef setFrameTopLeftPoint:NSMakePoint(parentCenter.x - (windowFrame.size.width / 2), - (parentCenter.y + (windowFrame.size.height / 2)))]; -#endif } else { -#ifndef QT_MAC_USE_COCOA RepositionWindow(qt_mac_window_for(q), 0, kWindowCenterOnMainScreen); -#else - // Ideally we would do a "center" here, but NSWindow's center is more equivalent to - // kWindowAlertPositionOnMainScreen instead of kWindowCenterOnMainScreen. - QRect availGeo = QApplication::desktop()->availableGeometry(q); - // Center the content only. - data.crect.moveCenter(availGeo.center()); - QRect fStrut = frameStrut(); - QRect frameRect(data.crect.x() - fStrut.left(), data.crect.y() - fStrut.top(), - fStrut.left() + fStrut.right() + data.crect.width(), - fStrut.top() + fStrut.bottom() + data.crect.height()); - NSRect cocoaFrameRect = NSMakeRect(frameRect.x(), flipYCoordinate(frameRect.bottom() + 1), frameRect.width(), frameRect.height()); - [qt_mac_window_for(q) setFrame:cocoaFrameRect display:NO]; -#endif } } +#endif + data.fstrut_dirty = true; if (realWindow) { // Delegates can change window state, so record some things earlier. @@ -4251,6 +4253,22 @@ void QWidgetPrivate::setGeometry_sys(int x, int y, int w, int h, bool isMove) setGeometry_sys_helper(x, y, w, h, isMove); } #else + if (!isMove && !q->testAttribute(Qt::WA_Moved) && !q->isVisible()) { + // INVARIANT: The location of the window has not yet been set. The default will + // instead be to center it on the desktop, or over the parent, if any. Since we now + // resize the window, we need to adjust the top left position to keep the window + // centeralized. And we need to to this now (and before show) in case the positioning + // of other windows (e.g. sub-windows) depend on this position: + if (QWidget *p = q->parentWidget()) { + x = p->geometry().center().x() - (w / 2); + y = p->geometry().center().y() - (h / 2); + } else { + QRect availGeo = QApplication::desktop()->availableGeometry(q); + x = availGeo.center().x() - (w / 2); + y = availGeo.center().y() - (h / 2); + } + } + QSize olds = q->size(); const bool isResize = (olds != QSize(w, h)); NSWindow *window = qt_mac_window_for(q); diff --git a/src/gui/kernel/qwidget_p.h b/src/gui/kernel/qwidget_p.h index ff8f276..75b4c12 100644 --- a/src/gui/kernel/qwidget_p.h +++ b/src/gui/kernel/qwidget_p.h @@ -174,6 +174,8 @@ struct QTLWExtra { #ifndef QT_NO_QWS_MANAGER QWSManager *qwsManager; #endif +#elif defined(Q_OS_SYMBIAN) + uint inExpose : 1; // Prevents drawing recursion #endif }; @@ -230,7 +232,6 @@ struct QWExtra { #endif #elif defined(Q_OS_SYMBIAN) // <----------------------------------------------------- Symbian uint activated : 1; // RWindowBase::Activated has been called - uint inExpose : 1; // Prevents drawing recursion /** * Defines the behaviour of QSymbianControl::Draw. @@ -685,6 +686,7 @@ public: uint inDirtyList : 1; uint isScrolled : 1; uint isMoved : 1; + uint isGLWidget : 1; uint usesDoubleBufferedGLContext : 1; // *************************** Platform specific ************************************ @@ -716,7 +718,6 @@ public: #elif defined(Q_WS_MAC) // <--------------------------------------------------------- MAC // This is new stuff uint needWindowChange : 1; - uint isGLWidget : 1; // Each wiget keeps a list of all its child and grandchild OpenGL widgets. // This list is used to update the gl context whenever a parent and a granparent diff --git a/src/gui/kernel/qwidget_s60.cpp b/src/gui/kernel/qwidget_s60.cpp index 00f2213..ebd289c 100644 --- a/src/gui/kernel/qwidget_s60.cpp +++ b/src/gui/kernel/qwidget_s60.cpp @@ -878,6 +878,7 @@ void QWidgetPrivate::registerDropSite(bool /* on */) void QWidgetPrivate::createTLSysExtra() { extra->topextra->backingStore = 0; + extra->topextra->inExpose = 0; } void QWidgetPrivate::deleteTLSysExtra() @@ -891,7 +892,6 @@ void QWidgetPrivate::createSysExtra() extra->activated = 0; extra->nativePaintMode = QWExtra::Default; extra->receiveNativePaintEvents = 0; - extra->inExpose = 0; } void QWidgetPrivate::deleteSysExtra() @@ -1046,96 +1046,48 @@ void QWidget::setWindowState(Qt::WindowStates newstate) return; if (isWindow()) { -#ifdef Q_WS_S60 - // Change window decoration visibility if switching to or from fullsccreen - // In addition decoration visibility is changed when the initial has been - // WindowNoState. - // The window decoration visibility has to be changed before doing actual - // window state change since in that order the availableGeometry will return - // directly the right size and we will avoid unnecessarty redraws - if ((oldstate & Qt::WindowFullScreen) != (newstate & Qt::WindowFullScreen) || - oldstate == Qt::WindowNoState) { - CEikStatusPane* statusPane = S60->statusPane(); - CEikButtonGroupContainer* buttonGroup = S60->buttonGroupContainer(); - if (newstate & Qt::WindowFullScreen) { - if (statusPane) - statusPane->MakeVisible(false); - if (buttonGroup) - buttonGroup->MakeVisible(false); - } else { - if (statusPane) - statusPane->MakeVisible(true); - if (buttonGroup) - buttonGroup->MakeVisible(true); - } + QSymbianControl *window = static_cast<QSymbianControl *>(effectiveWinId()); + if (window && newstate & Qt::WindowMinimized) { + window->setFocusSafely(false); + window->MakeVisible(false); + } else if (window && oldstate & Qt::WindowMinimized) { + window->setFocusSafely(true); + window->MakeVisible(true); } + +#ifdef Q_WS_S60 + // Hide window decoration when switching to fullsccreen / minimized otherwise show decoration. + // The window decoration visibility has to be changed before doing actual window state + // change since in that order the availableGeometry will return directly the right size and + // we will avoid unnecessarty redraws + CEikStatusPane* statusPane = S60->statusPane(); + CEikButtonGroupContainer* buttonGroup = S60->buttonGroupContainer(); + TBool visible = !(newstate & (Qt::WindowFullScreen | Qt::WindowMinimized)); + if (statusPane) + statusPane->MakeVisible(visible); + if (buttonGroup) + buttonGroup->MakeVisible(visible); #endif // Q_WS_S60 createWinId(); Q_ASSERT(testAttribute(Qt::WA_WState_Created)); - QTLWExtra *top = d->topData(); - // Ensure the initial size is valid, since we store it as normalGeometry below. if (!testAttribute(Qt::WA_Resized) && !isVisible()) adjustSize(); - if ((oldstate & Qt::WindowMaximized) != (newstate & Qt::WindowMaximized)) { - if ((newstate & Qt::WindowMaximized)) { - const QRect normalGeometry = geometry(); + QTLWExtra *top = d->topData(); + const QRect normalGeometry = (top->normalGeometry.width() < 0) ? geometry() : top->normalGeometry; - const QRect r = top->normalGeometry; - setGeometry(qApp->desktop()->availableGeometry(this)); - top->normalGeometry = r; + if (newstate & Qt::WindowFullScreen) + setGeometry(qApp->desktop()->screenGeometry(this)); + else if (newstate & Qt::WindowMaximized) + setGeometry(qApp->desktop()->availableGeometry(this)); + else + setGeometry(normalGeometry); - if (top->normalGeometry.width() < 0) - top->normalGeometry = normalGeometry; - } else { - // restore original geometry - setGeometry(top->normalGeometry); - } - } - if ((oldstate & Qt::WindowFullScreen) != (newstate & Qt::WindowFullScreen)) { - if (newstate & Qt::WindowFullScreen) { - const QRect normalGeometry = geometry(); - const QRect r = top->normalGeometry; - setGeometry(qApp->desktop()->screenGeometry(this)); - - top->normalGeometry = r; - if (top->normalGeometry.width() < 0) - top->normalGeometry = normalGeometry; - } else { - if (newstate & Qt::WindowMaximized) { - const QRect r = top->normalGeometry; - setGeometry(qApp->desktop()->availableGeometry(this)); - top->normalGeometry = r; - } else { - setGeometry(top->normalGeometry); - } - } - } - if ((oldstate & Qt::WindowMinimized) != (newstate & Qt::WindowMinimized)) { - if (newstate & Qt::WindowMinimized) { - if (isVisible()) { - QSymbianControl *id = static_cast<QSymbianControl *>(effectiveWinId()); - if (id->IsFocused()) // Avoid unnecessary calls to FocusChanged() - id->setFocusSafely(false); - id->MakeVisible(false); - } - } else { - if (isVisible()) { - QSymbianControl *id = static_cast<QSymbianControl *>(effectiveWinId()); - id->MakeVisible(true); - if (!id->IsFocused()) // Avoid unnecessary calls to FocusChanged() - id->setFocusSafely(true); - } - const QRect normalGeometry = geometry(); - const QRect r = top->normalGeometry; - top->normalGeometry = r; - if (top->normalGeometry.width() < 0) - top->normalGeometry = normalGeometry; - } - } + //restore normal geometry + top->normalGeometry = normalGeometry; } data->window_state = newstate; @@ -1195,6 +1147,10 @@ void QWidget::destroy(bool destroyWindow, bool destroySubWindows) if (destroyWindow) { delete id; + // At this point the backing store should already be destroyed + // so we flush the command buffer to ensure that the freeing of + // those resources and deleting the window can happen "atomically" + S60->wsSession().Flush(); } } diff --git a/src/gui/kernel/qwidget_x11.cpp b/src/gui/kernel/qwidget_x11.cpp index 4684bc1..10fb009 100644 --- a/src/gui/kernel/qwidget_x11.cpp +++ b/src/gui/kernel/qwidget_x11.cpp @@ -346,11 +346,6 @@ Q_GUI_EXPORT void qt_x11_enforce_cursor(QWidget * w) qt_x11_enforce_cursor(w, false); } -static Bool checkForConfigureAndExpose(Display *, XEvent *e, XPointer) -{ - return e->type == ConfigureNotify || e->type == Expose; -} - Q_GUI_EXPORT void qt_x11_wait_for_window_manager(QWidget* w) { if (!w || (!w->isWindow() && !w->internalWinId())) @@ -363,38 +358,60 @@ Q_GUI_EXPORT void qt_x11_wait_for_window_manager(QWidget* w) if (!w->testAttribute(Qt::WA_WState_Created)) return; - if (!(w->windowFlags() & Qt::X11BypassWindowManagerHint)) { - // if the window is not override-redirect, then the window manager - // will reparent us to the frame decoration window. - while (!XCheckTypedWindowEvent(X11->display, w->effectiveWinId(), ReparentNotify, &ev)) { - if (t.elapsed() > maximumWaitTime) - return; - qApp->syncX(); // non-busy wait - } - } + WId winid = w->internalWinId(); - while (!XCheckTypedWindowEvent(X11->display, w->effectiveWinId(), MapNotify, &ev)) { - if (t.elapsed() > maximumWaitTime) - return; - qApp->syncX(); // non-busy wait - } + // first deliver events that are already in the local queue + QApplication::sendPostedEvents(); - qApp->x11ProcessEvent(&ev); + // the normal sequence is: + // ... ConfigureNotify ... ReparentNotify ... MapNotify ... Expose + // with X11BypassWindowManagerHint: + // ConfigureNotify ... MapNotify ... Expose - // ok, seems like the window manager successfully reparented us, we'll wait - // for the first paint event to arrive, while handling ConfigureNotify in - // the arrival order - while(1) - { - if (XCheckIfEvent(X11->display, &ev, checkForConfigureAndExpose, 0)) { + enum State { + Initial, Reparented, Mapped + } state = Initial; + + do { + if (XEventsQueued(X11->display, QueuedAlready)) { + XNextEvent(X11->display, &ev); qApp->x11ProcessEvent(&ev); - if (ev.type == Expose) - return; + + if (w->windowFlags() & Qt::X11BypassWindowManagerHint) { + switch (state) { + case Initial: + case Reparented: + if (ev.type == MapNotify && ev.xany.window == winid) + state = Mapped; + break; + case Mapped: + if (ev.type == Expose && ev.xany.window == winid) + return; + break; + } + } else { + switch (state) { + case Initial: + if (ev.type == ReparentNotify && ev.xany.window == winid) + state = Reparented; + break; + case Reparented: + if (ev.type == MapNotify && ev.xany.window == winid) + state = Mapped; + break; + case Mapped: + if (ev.type == Expose && ev.xany.window == winid) + return; + break; + } + } + } else { + if (!XEventsQueued(X11->display, QueuedAfterFlush)) + qApp->syncX(); // non-busy wait } if (t.elapsed() > maximumWaitTime) return; - qApp->syncX(); // non-busy wait - } + } while(1); } void qt_change_net_wm_state(const QWidget* w, bool set, Atom one, Atom two = 0) diff --git a/src/gui/painting/qbezier.cpp b/src/gui/painting/qbezier.cpp index bbffda1..ea7fe4f 100644 --- a/src/gui/painting/qbezier.cpp +++ b/src/gui/painting/qbezier.cpp @@ -112,6 +112,11 @@ QPolygonF QBezier::toPolygon() const return polygon; } +QBezier QBezier::mapBy(const QTransform &transform) const +{ + return QBezier::fromPoints(transform.map(pt1()), transform.map(pt2()), transform.map(pt3()), transform.map(pt4())); +} + //0.5 is really low static const qreal flatness = 0.5; @@ -140,6 +145,25 @@ static inline void flattenBezierWithoutInflections(QBezier &bez, } } +QBezier QBezier::getSubRange(qreal t0, qreal t1) const +{ + QBezier result; + QBezier temp; + + // cut at t1 + if (qFuzzyIsNull(t1 - qreal(1.))) { + result = *this; + } else { + temp = *this; + temp.parameterSplitLeft(t1, &result); + } + + // cut at t0 + if (!qFuzzyIsNull(t0)) + result.parameterSplitLeft(t0 / t1, &temp); + + return result; +} static inline int quadraticRoots(qreal a, qreal b, qreal c, qreal *x1, qreal *x2) @@ -1018,13 +1042,19 @@ int QBezier::stationaryYPoints(qreal &t0, qreal &t1) const const qreal b = 2 * y1 - 4 * y2 + 2 * y3; const qreal c = -y1 + y2; - qreal reciprocal = b * b - 4 * a * c; + if (qFuzzyIsNull(a)) { + if (qFuzzyIsNull(b)) + return 0; - QList<qreal> result; + t0 = -c / b; + return t0 > 0 && t0 < 1; + } + + qreal reciprocal = b * b - 4 * a * c; if (qFuzzyIsNull(reciprocal)) { t0 = -b / (2 * a); - return 1; + return t0 > 0 && t0 < 1; } else if (reciprocal > 0) { qreal temp = qSqrt(reciprocal); diff --git a/src/gui/painting/qbezier_p.h b/src/gui/painting/qbezier_p.h index 3409bc7..f015ea8 100644 --- a/src/gui/painting/qbezier_p.h +++ b/src/gui/painting/qbezier_p.h @@ -59,6 +59,7 @@ #include "QtCore/qvector.h" #include "QtCore/qlist.h" #include "QtCore/qpair.h" +#include "QtGui/qtransform.h" QT_BEGIN_NAMESPACE @@ -96,6 +97,8 @@ public: QPointF pt3() const { return QPointF(x3, y3); } QPointF pt4() const { return QPointF(x4, y4); } + QBezier mapBy(const QTransform &transform) const; + inline QPointF midPoint() const; inline QLineF midTangent() const; @@ -104,6 +107,7 @@ public: inline void parameterSplitLeft(qreal t, QBezier *left); inline void split(QBezier *firstHalf, QBezier *secondHalf) const; + int shifted(QBezier *curveSegments, int maxSegmets, qreal offset, float threshold) const; @@ -117,6 +121,8 @@ public: static bool findIntersections(const QBezier &a, const QBezier &b, QVector<QPair<qreal, qreal> > *t); + QBezier getSubRange(qreal t0, qreal t1) const; + qreal x1, y1, x2, y2, x3, y3, x4, y4; }; diff --git a/src/gui/painting/qcups.cpp b/src/gui/painting/qcups.cpp index 7903762..ac41692 100644 --- a/src/gui/painting/qcups.cpp +++ b/src/gui/painting/qcups.cpp @@ -342,7 +342,9 @@ bool QCUPSSupport::printerHasPPD(const char *printerName) { if (!isAvailable()) return false; - return _cupsGetPPD(printerName) != 0; + const char *ppdFile = _cupsGetPPD(printerName); + unlink(ppdFile); + return (ppdFile != 0); } QString QCUPSSupport::unicodeString(const char *s) diff --git a/src/gui/painting/qdrawhelper.cpp b/src/gui/painting/qdrawhelper.cpp index 40fe499..c37e49a 100644 --- a/src/gui/painting/qdrawhelper.cpp +++ b/src/gui/painting/qdrawhelper.cpp @@ -1268,32 +1268,28 @@ static const uint L2CacheLineLengthInInts = L2CacheLineLength/sizeof(uint); result = 0 d = d * cia */ +#define comp_func_Clear_impl(dest, length, const_alpha)\ +{\ + if (const_alpha == 255) {\ + QT_MEMFILL_UINT(dest, length, 0);\ + } else {\ + int ialpha = 255 - const_alpha;\ + PRELOAD_INIT(dest)\ + for (int i = 0; i < length; ++i) {\ + PRELOAD_COND(dest)\ + dest[i] = BYTE_MUL(dest[i], ialpha);\ + }\ + }\ +} + static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha) { - if (const_alpha == 255) { - QT_MEMFILL_UINT(dest, length, 0); - } else { - int ialpha = 255 - const_alpha; - PRELOAD_INIT(dest) - for (int i = 0; i < length; ++i) { - PRELOAD_COND(dest) - dest[i] = BYTE_MUL(dest[i], ialpha); - } - } + comp_func_Clear_impl(dest, length, const_alpha); } static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha) { - if (const_alpha == 255) { - QT_MEMFILL_UINT(dest, length, 0); - } else { - int ialpha = 255 - const_alpha; - PRELOAD_INIT(dest) - for (int i = 0; i < length; ++i) { - PRELOAD_COND(dest) - dest[i] = BYTE_MUL(dest[i], ialpha); - } - } + comp_func_Clear_impl(dest, length, const_alpha); } /* @@ -2409,7 +2405,11 @@ static inline int soft_light_op(int dst, int src, int da, int sa) else if (4 * dst <= da) return (dst * sa * 255 + da * (src2 - sa) * ((((16 * dst_np - 12 * 255) * dst_np + 3 * 65025) * dst_np) / 65025) + temp) / 65025; else { +# ifdef Q_CC_RVCT // needed to avoid compiler crash in RVCT 2.2 + return (dst * sa * 255 + da * (src2 - sa) * (qIntSqrtInt(dst_np * 255) - dst_np) + temp) / 65025; +# else return (dst * sa * 255 + da * (src2 - sa) * (int(sqrt(qreal(dst_np * 255))) - dst_np) + temp) / 65025; +# endif } } @@ -7897,20 +7897,43 @@ void qInitDrawhelperAsm() qDrawHelper[QImage::Format_ARGB32_Premultiplied].blendColor = qt_blend_color_argb_sse3dnow; } #endif // 3DNOW - extern void qt_blend_rgb32_on_rgb32_sse(uchar *destPixels, int dbpl, - const uchar *srcPixels, int sbpl, - int w, int h, - int const_alpha); - extern void qt_blend_argb32_on_argb32_sse(uchar *destPixels, int dbpl, - const uchar *srcPixels, int sbpl, - int w, int h, - int const_alpha); - qBlendFunctions[QImage::Format_RGB32][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse; - qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse; - qBlendFunctions[QImage::Format_RGB32][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse; - qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse; - } + +#ifdef QT_HAVE_SSE2 + if (features & SSE2) { + extern void qt_blend_rgb32_on_rgb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); + extern void qt_blend_argb32_on_argb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); + + + qBlendFunctions[QImage::Format_RGB32][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse2; + qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse2; + qBlendFunctions[QImage::Format_RGB32][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse2; + qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse2; + } else +#endif + { + extern void qt_blend_rgb32_on_rgb32_sse(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); + extern void qt_blend_argb32_on_argb32_sse(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); + + + qBlendFunctions[QImage::Format_RGB32][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse; + qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_RGB32] = qt_blend_rgb32_on_rgb32_sse; + qBlendFunctions[QImage::Format_RGB32][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse; + qBlendFunctions[QImage::Format_ARGB32_Premultiplied][QImage::Format_ARGB32_Premultiplied] = qt_blend_argb32_on_argb32_sse; + } +} #endif // SSE #ifdef QT_HAVE_IWMMXT diff --git a/src/gui/painting/qdrawhelper_mmx_p.h b/src/gui/painting/qdrawhelper_mmx_p.h index 8482262..59b3804 100644 --- a/src/gui/painting/qdrawhelper_mmx_p.h +++ b/src/gui/painting/qdrawhelper_mmx_p.h @@ -146,36 +146,30 @@ struct QMMXCommonIntrinsics result = 0 d = d * cia */ +#define comp_func_Clear_impl(dest, length, const_alpha)\ +{\ + if (const_alpha == 255) {\ + qt_memfill(static_cast<quint32*>(dest), quint32(0), length);\ + } else {\ + C_FF; C_80; C_00;\ + m64 ia = MM::negate(MM::load_alpha(const_alpha));\ + for (int i = 0; i < length; ++i) {\ + dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia));\ + }\ + MM::end();\ + }\ +} + template <class MM> static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha) { - if (!length) - return; - - if (const_alpha == 255) { - qt_memfill(static_cast<quint32*>(dest), quint32(0), length); - } else { - C_FF; C_80; C_00; - m64 ia = MM::negate(MM::load_alpha(const_alpha)); - for (int i = 0; i < length; ++i) { - dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia)); - } - } - MM::end(); + comp_func_Clear_impl(dest, length, const_alpha); } template <class MM> static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha) { - if (const_alpha == 255) { - qt_memfill(static_cast<quint32*>(dest), quint32(0), length); - } else { - C_FF; C_80; C_00; - m64 ia = MM::negate(MM::load_alpha(const_alpha)); - for (int i = 0; i < length; ++i) - dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia)); - } - MM::end(); + comp_func_Clear_impl(dest, length, const_alpha); } /* @@ -246,7 +240,10 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le C_FF; C_80; C_00; if (const_alpha == 255) { for (int i = 0; i < length; ++i) { - if ((0xff000000 & src[i]) == 0xff000000) { + const uint alphaMaskedSource = 0xff000000 & src[i]; + if (alphaMaskedSource == 0) + continue; + if (alphaMaskedSource == 0xff000000) { dest[i] = src[i]; } else { m64 s = MM::load(src[i]); @@ -257,6 +254,8 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le } else { m64 ca = MM::load_alpha(const_alpha); for (int i = 0; i < length; ++i) { + if ((0xff000000 & src[i]) == 0) + continue; m64 s = MM::byte_mul(MM::load(src[i]), ca); m64 ia = MM::negate(MM::alpha(s)); dest[i] = MM::store(MM::add(s, MM::byte_mul(MM::load(dest[i]), ia))); diff --git a/src/gui/painting/qdrawhelper_neon.cpp b/src/gui/painting/qdrawhelper_neon.cpp index 25860a0..77c5202 100644 --- a/src/gui/painting/qdrawhelper_neon.cpp +++ b/src/gui/painting/qdrawhelper_neon.cpp @@ -48,43 +48,43 @@ QT_BEGIN_NAMESPACE -static inline int16x8_t qvdiv_255_s16(int16x8_t x, int16x8_t half) +static inline uint16x8_t qvdiv_255_u16(uint16x8_t x, uint16x8_t half) { // result = (x + (x >> 8) + 0x80) >> 8 - const int16x8_t temp = vshrq_n_s16(x, 8); // x >> 8 - const int16x8_t sum_part = vaddq_s16(x, half); // x + 0x80 - const int16x8_t sum = vaddq_s16(temp, sum_part); + const uint16x8_t temp = vshrq_n_u16(x, 8); // x >> 8 + const uint16x8_t sum_part = vaddq_u16(x, half); // x + 0x80 + const uint16x8_t sum = vaddq_u16(temp, sum_part); - return vreinterpretq_s16_u16(vshrq_n_u16(vreinterpretq_u16_s16(sum), 8)); + return vshrq_n_u16(sum, 8); } -static inline int16x8_t qvbyte_mul_s16(int16x8_t x, int16x8_t alpha, int16x8_t half) +static inline uint16x8_t qvbyte_mul_u16(uint16x8_t x, uint16x8_t alpha, uint16x8_t half) { // t = qRound(x * alpha / 255.0) - const int16x8_t t = vmulq_s16(x, alpha); // t - return qvdiv_255_s16(t, half); + const uint16x8_t t = vmulq_u16(x, alpha); // t + return qvdiv_255_u16(t, half); } -static inline int16x8_t qvinterpolate_pixel_255(int16x8_t x, int16x8_t a, int16x8_t y, int16x8_t b, int16x8_t half) +static inline uint16x8_t qvinterpolate_pixel_255(uint16x8_t x, uint16x8_t a, uint16x8_t y, uint16x8_t b, uint16x8_t half) { // t = x * a + y * b - const int16x8_t ta = vmulq_s16(x, a); - const int16x8_t tb = vmulq_s16(y, b); + const uint16x8_t ta = vmulq_u16(x, a); + const uint16x8_t tb = vmulq_u16(y, b); - return qvdiv_255_s16(vaddq_s16(ta, tb), half); + return qvdiv_255_u16(vaddq_u16(ta, tb), half); } -static inline int16x8_t qvsource_over_s16(int16x8_t src16, int16x8_t dst16, int16x8_t half, int16x8_t full) +static inline uint16x8_t qvsource_over_u16(uint16x8_t src16, uint16x8_t dst16, uint16x8_t half, uint16x8_t full) { - const int16x4_t alpha16_high = vdup_lane_s16(vget_high_s16(src16), 3); - const int16x4_t alpha16_low = vdup_lane_s16(vget_low_s16(src16), 3); + const uint16x4_t alpha16_high = vdup_lane_u16(vget_high_u16(src16), 3); + const uint16x4_t alpha16_low = vdup_lane_u16(vget_low_u16(src16), 3); - const int16x8_t alpha16 = vsubq_s16(full, vcombine_s16(alpha16_low, alpha16_high)); + const uint16x8_t alpha16 = vsubq_u16(full, vcombine_u16(alpha16_low, alpha16_high)); - return vaddq_s16(src16, qvbyte_mul_s16(dst16, alpha16, half)); + return vaddq_u16(src16, qvbyte_mul_u16(dst16, alpha16, half)); } void qt_blend_argb32_on_argb32_neon(uchar *destPixels, int dbpl, @@ -94,21 +94,21 @@ void qt_blend_argb32_on_argb32_neon(uchar *destPixels, int dbpl, { const uint *src = (const uint *) srcPixels; uint *dst = (uint *) destPixels; - int16x8_t half = vdupq_n_s16(0x80); - int16x8_t full = vdupq_n_s16(0xff); + uint16x8_t half = vdupq_n_u16(0x80); + uint16x8_t full = vdupq_n_u16(0xff); if (const_alpha == 256) { for (int y = 0; y < h; ++y) { int x = 0; for (; x < w-3; x += 4) { - int32x4_t src32 = vld1q_s32((int32_t *)&src[x]); + uint32x4_t src32 = vld1q_u32((uint32_t *)&src[x]); if ((src[x] & src[x+1] & src[x+2] & src[x+3]) >= 0xff000000) { // all opaque - vst1q_s32((int32_t *)&dst[x], src32); + vst1q_u32((uint32_t *)&dst[x], src32); } else if (src[x] | src[x+1] | src[x+2] | src[x+3]) { - int32x4_t dst32 = vld1q_s32((int32_t *)&dst[x]); + uint32x4_t dst32 = vld1q_u32((uint32_t *)&dst[x]); - const uint8x16_t src8 = vreinterpretq_u8_s32(src32); - const uint8x16_t dst8 = vreinterpretq_u8_s32(dst32); + const uint8x16_t src8 = vreinterpretq_u8_u32(src32); + const uint8x16_t dst8 = vreinterpretq_u8_u32(dst32); const uint8x8_t src8_low = vget_low_u8(src8); const uint8x8_t dst8_low = vget_low_u8(dst8); @@ -116,19 +116,19 @@ void qt_blend_argb32_on_argb32_neon(uchar *destPixels, int dbpl, const uint8x8_t src8_high = vget_high_u8(src8); const uint8x8_t dst8_high = vget_high_u8(dst8); - const int16x8_t src16_low = vreinterpretq_s16_u16(vmovl_u8(src8_low)); - const int16x8_t dst16_low = vreinterpretq_s16_u16(vmovl_u8(dst8_low)); + const uint16x8_t src16_low = vmovl_u8(src8_low); + const uint16x8_t dst16_low = vmovl_u8(dst8_low); - const int16x8_t src16_high = vreinterpretq_s16_u16(vmovl_u8(src8_high)); - const int16x8_t dst16_high = vreinterpretq_s16_u16(vmovl_u8(dst8_high)); + const uint16x8_t src16_high = vmovl_u8(src8_high); + const uint16x8_t dst16_high = vmovl_u8(dst8_high); - const int16x8_t result16_low = qvsource_over_s16(src16_low, dst16_low, half, full); - const int16x8_t result16_high = qvsource_over_s16(src16_high, dst16_high, half, full); + const uint16x8_t result16_low = qvsource_over_u16(src16_low, dst16_low, half, full); + const uint16x8_t result16_high = qvsource_over_u16(src16_high, dst16_high, half, full); - const int32x2_t result32_low = vreinterpret_s32_s8(vmovn_s16(result16_low)); - const int32x2_t result32_high = vreinterpret_s32_s8(vmovn_s16(result16_high)); + const uint32x2_t result32_low = vreinterpret_u32_u8(vmovn_u16(result16_low)); + const uint32x2_t result32_high = vreinterpret_u32_u8(vmovn_u16(result16_high)); - vst1q_s32((int32_t *)&dst[x], vcombine_s32(result32_low, result32_high)); + vst1q_u32((uint32_t *)&dst[x], vcombine_u32(result32_low, result32_high)); } } for (; x<w; ++x) { @@ -143,16 +143,16 @@ void qt_blend_argb32_on_argb32_neon(uchar *destPixels, int dbpl, } } else if (const_alpha != 0) { const_alpha = (const_alpha * 255) >> 8; - int16x8_t const_alpha16 = vdupq_n_s16(const_alpha); + uint16x8_t const_alpha16 = vdupq_n_u16(const_alpha); for (int y = 0; y < h; ++y) { int x = 0; for (; x < w-3; x += 4) { if (src[x] | src[x+1] | src[x+2] | src[x+3]) { - int32x4_t src32 = vld1q_s32((int32_t *)&src[x]); - int32x4_t dst32 = vld1q_s32((int32_t *)&dst[x]); + uint32x4_t src32 = vld1q_u32((uint32_t *)&src[x]); + uint32x4_t dst32 = vld1q_u32((uint32_t *)&dst[x]); - const uint8x16_t src8 = vreinterpretq_u8_s32(src32); - const uint8x16_t dst8 = vreinterpretq_u8_s32(dst32); + const uint8x16_t src8 = vreinterpretq_u8_u32(src32); + const uint8x16_t dst8 = vreinterpretq_u8_u32(dst32); const uint8x8_t src8_low = vget_low_u8(src8); const uint8x8_t dst8_low = vget_low_u8(dst8); @@ -160,22 +160,22 @@ void qt_blend_argb32_on_argb32_neon(uchar *destPixels, int dbpl, const uint8x8_t src8_high = vget_high_u8(src8); const uint8x8_t dst8_high = vget_high_u8(dst8); - const int16x8_t src16_low = vreinterpretq_s16_u16(vmovl_u8(src8_low)); - const int16x8_t dst16_low = vreinterpretq_s16_u16(vmovl_u8(dst8_low)); + const uint16x8_t src16_low = vmovl_u8(src8_low); + const uint16x8_t dst16_low = vmovl_u8(dst8_low); - const int16x8_t src16_high = vreinterpretq_s16_u16(vmovl_u8(src8_high)); - const int16x8_t dst16_high = vreinterpretq_s16_u16(vmovl_u8(dst8_high)); + const uint16x8_t src16_high = vmovl_u8(src8_high); + const uint16x8_t dst16_high = vmovl_u8(dst8_high); - const int16x8_t srcalpha16_low = qvbyte_mul_s16(src16_low, const_alpha16, half); - const int16x8_t srcalpha16_high = qvbyte_mul_s16(src16_high, const_alpha16, half); + const uint16x8_t srcalpha16_low = qvbyte_mul_u16(src16_low, const_alpha16, half); + const uint16x8_t srcalpha16_high = qvbyte_mul_u16(src16_high, const_alpha16, half); - const int16x8_t result16_low = qvsource_over_s16(srcalpha16_low, dst16_low, half, full); - const int16x8_t result16_high = qvsource_over_s16(srcalpha16_high, dst16_high, half, full); + const uint16x8_t result16_low = qvsource_over_u16(srcalpha16_low, dst16_low, half, full); + const uint16x8_t result16_high = qvsource_over_u16(srcalpha16_high, dst16_high, half, full); - const int32x2_t result32_low = vreinterpret_s32_s8(vmovn_s16(result16_low)); - const int32x2_t result32_high = vreinterpret_s32_s8(vmovn_s16(result16_high)); + const uint32x2_t result32_low = vreinterpret_u32_u8(vmovn_u16(result16_low)); + const uint32x2_t result32_high = vreinterpret_u32_u8(vmovn_u16(result16_high)); - vst1q_s32((int32_t *)&dst[x], vcombine_s32(result32_low, result32_high)); + vst1q_u32((uint32_t *)&dst[x], vcombine_u32(result32_low, result32_high)); } } for (; x<w; ++x) { @@ -206,19 +206,19 @@ void qt_blend_rgb32_on_rgb32_neon(uchar *destPixels, int dbpl, if (const_alpha != 0) { const uint *src = (const uint *) srcPixels; uint *dst = (uint *) destPixels; - int16x8_t half = vdupq_n_s16(0x80); + uint16x8_t half = vdupq_n_u16(0x80); const_alpha = (const_alpha * 255) >> 8; int one_minus_const_alpha = 255 - const_alpha; - int16x8_t const_alpha16 = vdupq_n_s16(const_alpha); - int16x8_t one_minus_const_alpha16 = vdupq_n_s16(255 - const_alpha); + uint16x8_t const_alpha16 = vdupq_n_u16(const_alpha); + uint16x8_t one_minus_const_alpha16 = vdupq_n_u16(255 - const_alpha); for (int y = 0; y < h; ++y) { int x = 0; for (; x < w-3; x += 4) { - int32x4_t src32 = vld1q_s32((int32_t *)&src[x]); - int32x4_t dst32 = vld1q_s32((int32_t *)&dst[x]); + uint32x4_t src32 = vld1q_u32((uint32_t *)&src[x]); + uint32x4_t dst32 = vld1q_u32((uint32_t *)&dst[x]); - const uint8x16_t src8 = vreinterpretq_u8_s32(src32); - const uint8x16_t dst8 = vreinterpretq_u8_s32(dst32); + const uint8x16_t src8 = vreinterpretq_u8_u32(src32); + const uint8x16_t dst8 = vreinterpretq_u8_u32(dst32); const uint8x8_t src8_low = vget_low_u8(src8); const uint8x8_t dst8_low = vget_low_u8(dst8); @@ -226,19 +226,19 @@ void qt_blend_rgb32_on_rgb32_neon(uchar *destPixels, int dbpl, const uint8x8_t src8_high = vget_high_u8(src8); const uint8x8_t dst8_high = vget_high_u8(dst8); - const int16x8_t src16_low = vreinterpretq_s16_u16(vmovl_u8(src8_low)); - const int16x8_t dst16_low = vreinterpretq_s16_u16(vmovl_u8(dst8_low)); + const uint16x8_t src16_low = vmovl_u8(src8_low); + const uint16x8_t dst16_low = vmovl_u8(dst8_low); - const int16x8_t src16_high = vreinterpretq_s16_u16(vmovl_u8(src8_high)); - const int16x8_t dst16_high = vreinterpretq_s16_u16(vmovl_u8(dst8_high)); + const uint16x8_t src16_high = vmovl_u8(src8_high); + const uint16x8_t dst16_high = vmovl_u8(dst8_high); - const int16x8_t result16_low = qvinterpolate_pixel_255(src16_low, const_alpha16, dst16_low, one_minus_const_alpha16, half); - const int16x8_t result16_high = qvinterpolate_pixel_255(src16_high, const_alpha16, dst16_high, one_minus_const_alpha16, half); + const uint16x8_t result16_low = qvinterpolate_pixel_255(src16_low, const_alpha16, dst16_low, one_minus_const_alpha16, half); + const uint16x8_t result16_high = qvinterpolate_pixel_255(src16_high, const_alpha16, dst16_high, one_minus_const_alpha16, half); - const int32x2_t result32_low = vreinterpret_s32_s8(vmovn_s16(result16_low)); - const int32x2_t result32_high = vreinterpret_s32_s8(vmovn_s16(result16_high)); + const uint32x2_t result32_low = vreinterpret_u32_u8(vmovn_u16(result16_low)); + const uint32x2_t result32_high = vreinterpret_u32_u8(vmovn_u16(result16_high)); - vst1q_s32((int32_t *)&dst[x], vcombine_s32(result32_low, result32_high)); + vst1q_u32((uint32_t *)&dst[x], vcombine_u32(result32_low, result32_high)); } for (; x<w; ++x) { uint s = src[x]; diff --git a/src/gui/painting/qdrawhelper_p.h b/src/gui/painting/qdrawhelper_p.h index 474ebcf..df4d9c5 100644 --- a/src/gui/painting/qdrawhelper_p.h +++ b/src/gui/painting/qdrawhelper_p.h @@ -1540,6 +1540,9 @@ template<> inline void qt_memfill(quint8 *dest, quint8 color, int count) template <class T> inline void qt_memfill(T *dest, T value, int count) { + if (!count) + return; + int n = (count + 7) / 8; switch (count & 0x07) { diff --git a/src/gui/painting/qdrawhelper_sse2.cpp b/src/gui/painting/qdrawhelper_sse2.cpp index dd6fa1b..6ac64d3 100644 --- a/src/gui/painting/qdrawhelper_sse2.cpp +++ b/src/gui/painting/qdrawhelper_sse2.cpp @@ -57,6 +57,217 @@ QT_BEGIN_NAMESPACE +/* + * Multiply the components of pixelVector by alphaChannel + * Each 32bits components of alphaChannel must be in the form 0x00AA00AA + * colorMask must have 0x00ff00ff on each 32 bits component + * half must have the value 128 (0x80) for each 32 bits compnent + */ +#define BYTE_MUL_SSE2(result, pixelVector, alphaChannel, colorMask, half) \ +{ \ + /* 1. separate the colors in 2 vectors so each color is on 16 bits \ + (in order to be multiplied by the alpha \ + each 32 bit of dstVectorAG are in the form 0x00AA00GG \ + each 32 bit of dstVectorRB are in the form 0x00RR00BB */\ + __m128i pixelVectorAG = _mm_srli_epi16(pixelVector, 8); \ + __m128i pixelVectorRB = _mm_and_si128(pixelVector, colorMask); \ + \ + /* 2. multiply the vectors by the alpha channel */\ + pixelVectorAG = _mm_mullo_epi16(pixelVectorAG, alphaChannel); \ + pixelVectorRB = _mm_mullo_epi16(pixelVectorRB, alphaChannel); \ + \ + /* 3. devide by 255, that's the tricky part. \ + we do it like for BYTE_MUL(), with bit shift: X/255 ~= (X + X/256 + rounding)/256 */ \ + /** so first (X + X/256 + rounding) */\ + pixelVectorRB = _mm_add_epi16(pixelVectorRB, _mm_srli_epi16(pixelVectorRB, 8)); \ + pixelVectorRB = _mm_add_epi16(pixelVectorRB, half); \ + pixelVectorAG = _mm_add_epi16(pixelVectorAG, _mm_srli_epi16(pixelVectorAG, 8)); \ + pixelVectorAG = _mm_add_epi16(pixelVectorAG, half); \ + \ + /** second devide by 256 */\ + pixelVectorRB = _mm_srli_epi16(pixelVectorRB, 8); \ + /** for AG, we could >> 8 to divide followed by << 8 to put the \ + bytes in the correct position. By masking instead, we execute \ + only one instruction */\ + pixelVectorAG = _mm_andnot_si128(colorMask, pixelVectorAG); \ + \ + /* 4. combine the 2 pairs of colors */ \ + result = _mm_or_si128(pixelVectorAG, pixelVectorRB); \ +} + +/* + * Each 32bits components of alphaChannel must be in the form 0x00AA00AA + * oneMinusAlphaChannel must be 255 - alpha for each 32 bits component + * colorMask must have 0x00ff00ff on each 32 bits component + * half must have the value 128 (0x80) for each 32 bits compnent + */ +#define INTERPOLATE_PIXEL_255_SSE2(result, srcVector, dstVector, alphaChannel, oneMinusAlphaChannel, colorMask, half) { \ + /* interpolate AG */\ + __m128i srcVectorAG = _mm_srli_epi16(srcVector, 8); \ + __m128i dstVectorAG = _mm_srli_epi16(dstVector, 8); \ + __m128i srcVectorAGalpha = _mm_mullo_epi16(srcVectorAG, alphaChannel); \ + __m128i dstVectorAGoneMinusAlphalpha = _mm_mullo_epi16(dstVectorAG, oneMinusAlphaChannel); \ + __m128i finalAG = _mm_add_epi16(srcVectorAGalpha, dstVectorAGoneMinusAlphalpha); \ + finalAG = _mm_add_epi16(finalAG, _mm_srli_epi16(finalAG, 8)); \ + finalAG = _mm_add_epi16(finalAG, half); \ + finalAG = _mm_andnot_si128(colorMask, finalAG); \ + \ + /* interpolate RB */\ + __m128i srcVectorRB = _mm_and_si128(srcVector, colorMask); \ + __m128i dstVectorRB = _mm_and_si128(dstVector, colorMask); \ + __m128i srcVectorRBalpha = _mm_mullo_epi16(srcVectorRB, alphaChannel); \ + __m128i dstVectorRBoneMinusAlphalpha = _mm_mullo_epi16(dstVectorRB, oneMinusAlphaChannel); \ + __m128i finalRB = _mm_add_epi16(srcVectorRBalpha, dstVectorRBoneMinusAlphalpha); \ + finalRB = _mm_add_epi16(finalRB, _mm_srli_epi16(finalRB, 8)); \ + finalRB = _mm_add_epi16(finalRB, half); \ + finalRB = _mm_srli_epi16(finalRB, 8); \ + \ + /* combine */\ + result = _mm_or_si128(finalAG, finalRB); \ +} + +void qt_blend_argb32_on_argb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha) +{ + const quint32 *src = (const quint32 *) srcPixels; + quint32 *dst = (uint *) destPixels; + if (const_alpha == 256) { + const __m128i alphaMask = _mm_set1_epi32(0xff000000); + const __m128i nullVector = _mm_set1_epi32(0); + const __m128i half = _mm_set1_epi16(0x80); + const __m128i one = _mm_set1_epi16(0xff); + const __m128i colorMask = _mm_set1_epi32(0x00ff00ff); + for (int y = 0; y < h; ++y) { + int x = 0; + for (; x < w-3; x += 4) { + const __m128i srcVector = _mm_loadu_si128((__m128i *)&src[x]); + const __m128i srcVectorAlpha = _mm_and_si128(srcVector, alphaMask); + if (_mm_movemask_epi8(_mm_cmpeq_epi32(srcVectorAlpha, alphaMask)) == 0xffff) { + // all opaque + _mm_storeu_si128((__m128i *)&dst[x], srcVector); + } else if (_mm_movemask_epi8(_mm_cmpeq_epi32(srcVectorAlpha, nullVector)) != 0xffff) { + // not fully transparent + // result = s + d * (1-alpha) + + // extract the alpha channel on 2 x 16 bits + // so we have room for the multiplication + // each 32 bits will be in the form 0x00AA00AA + // with A being the 1 - alpha + __m128i alphaChannel = _mm_srli_epi32(srcVector, 24); + alphaChannel = _mm_or_si128(alphaChannel, _mm_slli_epi32(alphaChannel, 16)); + alphaChannel = _mm_sub_epi16(one, alphaChannel); + + const __m128i dstVector = _mm_loadu_si128((__m128i *)&dst[x]); + __m128i destMultipliedByOneMinusAlpha; + BYTE_MUL_SSE2(destMultipliedByOneMinusAlpha, dstVector, alphaChannel, colorMask, half); + + // result = s + d * (1-alpha) + const __m128i result = _mm_add_epi8(srcVector, destMultipliedByOneMinusAlpha); + _mm_storeu_si128((__m128i *)&dst[x], result); + } + } + for (; x<w; ++x) { + uint s = src[x]; + if (s >= 0xff000000) + dst[x] = s; + else if (s != 0) + dst[x] = s + BYTE_MUL(dst[x], qAlpha(~s)); + } + dst = (quint32 *)(((uchar *) dst) + dbpl); + src = (const quint32 *)(((const uchar *) src) + sbpl); + } + } else if (const_alpha != 0) { + // dest = (s + d * sia) * ca + d * cia + // = s * ca + d * (sia * ca + cia) + // = s * ca + d * (1 - sa*ca) + const_alpha = (const_alpha * 255) >> 8; + const __m128i nullVector = _mm_set1_epi32(0); + const __m128i half = _mm_set1_epi16(0x80); + const __m128i one = _mm_set1_epi16(0xff); + const __m128i colorMask = _mm_set1_epi32(0x00ff00ff); + const __m128i constAlphaVector = _mm_set1_epi16(const_alpha); + for (int y = 0; y < h; ++y) { + int x = 0; + for (; x < w-3; x += 4) { + __m128i srcVector = _mm_loadu_si128((__m128i *)&src[x]); + if (_mm_movemask_epi8(_mm_cmpeq_epi32(srcVector, nullVector)) != 0xffff) { + BYTE_MUL_SSE2(srcVector, srcVector, constAlphaVector, colorMask, half); + + __m128i alphaChannel = _mm_srli_epi32(srcVector, 24); + alphaChannel = _mm_or_si128(alphaChannel, _mm_slli_epi32(alphaChannel, 16)); + alphaChannel = _mm_sub_epi16(one, alphaChannel); + + const __m128i dstVector = _mm_loadu_si128((__m128i *)&dst[x]); + __m128i destMultipliedByOneMinusAlpha; + BYTE_MUL_SSE2(destMultipliedByOneMinusAlpha, dstVector, alphaChannel, colorMask, half); + + const __m128i result = _mm_add_epi8(srcVector, destMultipliedByOneMinusAlpha); + _mm_storeu_si128((__m128i *)&dst[x], result); + } + } + for (; x<w; ++x) { + quint32 s = src[x]; + if (s != 0) { + s = BYTE_MUL(s, const_alpha); + dst[x] = s + BYTE_MUL(dst[x], qAlpha(~s)); + } + } + dst = (quint32 *)(((uchar *) dst) + dbpl); + src = (const quint32 *)(((const uchar *) src) + sbpl); + } + } +} + +// qblendfunctions.cpp +void qt_blend_rgb32_on_rgb32(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); + +void qt_blend_rgb32_on_rgb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha) +{ + const quint32 *src = (const quint32 *) srcPixels; + quint32 *dst = (uint *) destPixels; + if (const_alpha != 256) { + if (const_alpha != 0) { + const __m128i nullVector = _mm_set1_epi32(0); + const __m128i half = _mm_set1_epi16(0x80); + const __m128i colorMask = _mm_set1_epi32(0x00ff00ff); + + const_alpha = (const_alpha * 255) >> 8; + int one_minus_const_alpha = 255 - const_alpha; + const __m128i constAlphaVector = _mm_set1_epi16(const_alpha); + const __m128i oneMinusConstAlpha = _mm_set1_epi16(one_minus_const_alpha); + for (int y = 0; y < h; ++y) { + int x = 0; + for (; x < w-3; x += 4) { + __m128i srcVector = _mm_loadu_si128((__m128i *)&src[x]); + if (_mm_movemask_epi8(_mm_cmpeq_epi32(srcVector, nullVector)) != 0xffff) { + const __m128i dstVector = _mm_loadu_si128((__m128i *)&dst[x]); + __m128i result; + INTERPOLATE_PIXEL_255_SSE2(result, srcVector, dstVector, constAlphaVector, oneMinusConstAlpha, colorMask, half); + _mm_storeu_si128((__m128i *)&dst[x], result); + } + } + for (; x<w; ++x) { + quint32 s = src[x]; + s = BYTE_MUL(s, const_alpha); + dst[x] = INTERPOLATE_PIXEL_255(src[x], const_alpha, dst[x], one_minus_const_alpha); + } + dst = (quint32 *)(((uchar *) dst) + dbpl); + src = (const quint32 *)(((const uchar *) src) + sbpl); + } + } + } else { + qt_blend_rgb32_on_rgb32(destPixels, dbpl, srcPixels, sbpl, w, h, const_alpha); + } +} + void qt_memfill32_sse2(quint32 *dest, quint32 value, int count) { if (count < 7) { diff --git a/src/gui/painting/qdrawhelper_x86_p.h b/src/gui/painting/qdrawhelper_x86_p.h index 30aadd0..d7282a7 100644 --- a/src/gui/painting/qdrawhelper_x86_p.h +++ b/src/gui/painting/qdrawhelper_x86_p.h @@ -114,6 +114,14 @@ void qt_bitmapblit32_sse2(QRasterBuffer *rasterBuffer, int x, int y, void qt_bitmapblit16_sse2(QRasterBuffer *rasterBuffer, int x, int y, quint32 color, const uchar *src, int width, int height, int stride); +void qt_blend_argb32_on_argb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); +void qt_blend_rgb32_on_rgb32_sse2(uchar *destPixels, int dbpl, + const uchar *srcPixels, int sbpl, + int w, int h, + int const_alpha); #endif // QT_HAVE_SSE2 #ifdef QT_HAVE_IWMMXT diff --git a/src/gui/painting/qemulationpaintengine.cpp b/src/gui/painting/qemulationpaintengine.cpp index fd42736..0510b10 100644 --- a/src/gui/painting/qemulationpaintengine.cpp +++ b/src/gui/painting/qemulationpaintengine.cpp @@ -205,6 +205,11 @@ void QEmulationPaintEngine::drawTextItem(const QPointF &p, const QTextItem &text real_engine->drawTextItem(p, textItem); } +void QEmulationPaintEngine::drawStaticTextItem(QStaticTextItem *item) +{ + real_engine->drawStaticTextItem(item); +} + void QEmulationPaintEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s) { if (state()->bgMode == Qt::OpaqueMode && pixmap.isQBitmap()) diff --git a/src/gui/painting/qemulationpaintengine_p.h b/src/gui/painting/qemulationpaintengine_p.h index 0ed641b..5835f10 100644 --- a/src/gui/painting/qemulationpaintengine_p.h +++ b/src/gui/painting/qemulationpaintengine_p.h @@ -78,6 +78,7 @@ public: virtual void drawPixmap(const QRectF &r, const QPixmap &pm, const QRectF &sr); virtual void drawTextItem(const QPointF &p, const QTextItem &textItem); + virtual void drawStaticTextItem(QStaticTextItem *item); virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s); virtual void drawImage(const QRectF &r, const QImage &pm, const QRectF &sr, Qt::ImageConversionFlags flags); diff --git a/src/gui/painting/qmath_p.h b/src/gui/painting/qmath_p.h index cd9f5ea..8a5f5ab 100644 --- a/src/gui/painting/qmath_p.h +++ b/src/gui/painting/qmath_p.h @@ -54,6 +54,7 @@ // #include <math.h> +#include <qmath.h> QT_BEGIN_NAMESPACE @@ -61,6 +62,11 @@ static const qreal Q_PI = qreal(3.14159265358979323846); // pi static const qreal Q_2PI = qreal(6.28318530717958647693); // 2*pi static const qreal Q_PI2 = qreal(1.57079632679489661923); // pi/2 +inline int qIntSqrtInt(int v) +{ + return static_cast<int>(qSqrt(static_cast<qreal>(v))); +} + QT_END_NAMESPACE #endif // QMATH_P_H diff --git a/src/gui/painting/qpaintbuffer.cpp b/src/gui/painting/qpaintbuffer.cpp index 2344c04..39b76c8 100644 --- a/src/gui/painting/qpaintbuffer.cpp +++ b/src/gui/painting/qpaintbuffer.cpp @@ -45,6 +45,8 @@ #include <private/qfontengine_p.h> #include <private/qemulationpaintengine_p.h> #include <private/qimage_p.h> +#include <qstatictext.h> +#include <private/qstatictext_p.h> #include <QDebug> @@ -306,6 +308,8 @@ public: Q_Q(QPaintBufferEngine); q->buffer->addCommand(QPaintBufferPrivate::Cmd_SystemStateChanged, QVariant(systemClip)); } + + QTransform last; }; @@ -492,6 +496,32 @@ void QPaintBufferEngine::renderHintsChanged() void QPaintBufferEngine::transformChanged() { + Q_D(QPaintBufferEngine); + const QTransform &transform = state()->matrix; + + QTransform delta; + + bool invertible = false; + if (transform.type() <= QTransform::TxScale && transform.type() == d->last.type()) + delta = transform * d->last.inverted(&invertible); + + d->last = transform; + + if (invertible && delta.type() == QTransform::TxNone) + return; + + if (invertible && delta.type() == QTransform::TxTranslate) { +#ifdef QPAINTBUFFER_DEBUG_DRAW + qDebug() << "QPaintBufferEngine: transformChanged (translate only) " << state()->matrix; +#endif + QPaintBufferCommand *cmd = + buffer->addCommand(QPaintBufferPrivate::Cmd_Translate); + + qreal data[] = { delta.dx(), delta.dy() }; + cmd->extra = buffer->addData((qreal *) data, 2); + return; + } + // ### accumulate, like in QBrush case... if (!buffer->commands.isEmpty() && buffer->commands.last().id == QPaintBufferPrivate::Cmd_SetTransform) { @@ -960,6 +990,18 @@ void QPaintBufferEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pm, con buffer->updateBoundingRect(r); } +void QPaintBufferEngine::drawStaticTextItem(QStaticTextItem *staticTextItem) +{ + QString text = QString(staticTextItem->chars, staticTextItem->numChars); + + QStaticText staticText(text); + staticText.prepare(state()->matrix, staticTextItem->font); + + QVariantList variants; + variants << QVariant(staticTextItem->font) << QVariant::fromValue(staticText); + buffer->addCommand(QPaintBufferPrivate::Cmd_DrawStaticText, QVariant(variants)); +} + void QPaintBufferEngine::drawTextItem(const QPointF &pos, const QTextItem &ti) { #ifdef QPAINTBUFFER_DEBUG_DRAW @@ -999,6 +1041,7 @@ void QPaintBufferEngine::drawTextItem(const QPointF &pos, const QTextItem &ti) void QPaintBufferEngine::setState(QPainterState *s) { + Q_D(QPaintBufferEngine); if (m_begin_detected) { #ifdef QPAINTBUFFER_DEBUG_DRAW qDebug() << "QPaintBufferEngine: setState: begin, ignoring."; @@ -1017,6 +1060,8 @@ void QPaintBufferEngine::setState(QPainterState *s) buffer->addCommand(QPaintBufferPrivate::Cmd_Restore); } + d->last = s->matrix; + QPaintEngineEx::setState(s); } @@ -1138,6 +1183,15 @@ void QPainterReplayer::process(const QPaintBufferCommand &cmd) painter->setTransform(xform * m_world_matrix); break; } + case QPaintBufferPrivate::Cmd_Translate: { + QPointF delta(d->floats.at(cmd.extra), d->floats.at(cmd.extra+1)); +#ifdef QPAINTBUFFER_DEBUG_DRAW + qDebug() << " -> Cmd_Translate, offset: " << cmd.offset << delta; +#endif + painter->translate(delta.x(), delta.y()); + return; + } + case QPaintBufferPrivate::Cmd_SetCompositionMode: { QPainter::CompositionMode mode = (QPainter::CompositionMode) cmd.extra; #ifdef QPAINTBUFFER_DEBUG_DRAW @@ -1425,6 +1479,19 @@ void QPainterReplayer::process(const QPaintBufferCommand &cmd) #endif painter->setClipRegion(region, Qt::ClipOperation(cmd.extra)); break; } + + case QPaintBufferPrivate::Cmd_DrawStaticText: { + + QVariantList variants(d->variants.at(cmd.offset).value<QVariantList>()); + + QFont font(variants.at(0).value<QFont>()); + QStaticText text(variants.at(0).value<QStaticText>()); + + painter->setFont(font); + painter->drawStaticText(QPointF(0, 0), text); + + break; + } case QPaintBufferPrivate::Cmd_DrawText: { QPointF pos(d->floats.at(cmd.extra), d->floats.at(cmd.extra+1)); @@ -1770,8 +1837,28 @@ struct QPaintBufferCacheEntry QVariant::Type type; quint64 cacheKey; }; + +struct QPaintBufferCacheEntryV2 +{ + enum Type { + ImageKey, + PixmapKey + }; + + struct Flags { + uint type : 8; + uint key : 24; + }; + + union { + Flags flags; + uint bits; + }; +}; + QT_END_NAMESPACE Q_DECLARE_METATYPE(QPaintBufferCacheEntry) +Q_DECLARE_METATYPE(QPaintBufferCacheEntryV2) QT_BEGIN_NAMESPACE QDataStream &operator<<(QDataStream &stream, const QPaintBufferCacheEntry &entry) @@ -1784,10 +1871,22 @@ QDataStream &operator>>(QDataStream &stream, QPaintBufferCacheEntry &entry) return stream >> entry.type >> entry.cacheKey; } +QDataStream &operator<<(QDataStream &stream, const QPaintBufferCacheEntryV2 &entry) +{ + return stream << entry.bits; +} + +QDataStream &operator>>(QDataStream &stream, QPaintBufferCacheEntryV2 &entry) +{ + return stream >> entry.bits; +} + static int qRegisterPaintBufferMetaTypes() { qRegisterMetaType<QPaintBufferCacheEntry>(); qRegisterMetaTypeStreamOperators<QPaintBufferCacheEntry>("QPaintBufferCacheEntry"); + qRegisterMetaType<QPaintBufferCacheEntryV2>(); + qRegisterMetaTypeStreamOperators<QPaintBufferCacheEntryV2>("QPaintBufferCacheEntryV2"); return 0; // something } @@ -1796,6 +1895,9 @@ Q_CONSTRUCTOR_FUNCTION(qRegisterPaintBufferMetaTypes) QDataStream &operator<<(QDataStream &stream, const QPaintBuffer &buffer) { + QHash<qint64, uint> pixmapKeys; + QHash<qint64, uint> imageKeys; + QHash<qint64, QPixmap> pixmaps; QHash<qint64, QImage> images; @@ -1804,19 +1906,33 @@ QDataStream &operator<<(QDataStream &stream, const QPaintBuffer &buffer) const QVariant &v = variants.at(i); if (v.type() == QVariant::Image) { const QImage image(v.value<QImage>()); - images[image.cacheKey()] = image; - QPaintBufferCacheEntry entry; - entry.type = QVariant::Image; - entry.cacheKey = image.cacheKey(); + QPaintBufferCacheEntryV2 entry; + entry.flags.type = QPaintBufferCacheEntryV2::ImageKey; + + QHash<qint64, uint>::iterator it = imageKeys.find(image.cacheKey()); + if (it != imageKeys.end()) { + entry.flags.key = *it; + } else { + imageKeys[image.cacheKey()] = entry.flags.key = images.size(); + images[images.size()] = image; + } + variants[i] = QVariant::fromValue(entry); } else if (v.type() == QVariant::Pixmap) { const QPixmap pixmap(v.value<QPixmap>()); - pixmaps[pixmap.cacheKey()] = pixmap; - QPaintBufferCacheEntry entry; - entry.type = QVariant::Pixmap; - entry.cacheKey = pixmap.cacheKey(); + QPaintBufferCacheEntryV2 entry; + entry.flags.type = QPaintBufferCacheEntryV2::PixmapKey; + + QHash<qint64, uint>::iterator it = pixmapKeys.find(pixmap.cacheKey()); + if (it != pixmapKeys.end()) { + entry.flags.key = *it; + } else { + pixmapKeys[pixmap.cacheKey()] = entry.flags.key = pixmaps.size(); + pixmaps[pixmaps.size()] = pixmap; + } + variants[i] = QVariant::fromValue(entry); } } @@ -1858,6 +1974,15 @@ QDataStream &operator>>(QDataStream &stream, QPaintBuffer &buffer) variants[i] = QVariant(images.value(entry.cacheKey)); else variants[i] = QVariant(pixmaps.value(entry.cacheKey)); + } else if (v.canConvert<QPaintBufferCacheEntryV2>()) { + QPaintBufferCacheEntryV2 entry = v.value<QPaintBufferCacheEntryV2>(); + + if (entry.flags.type == QPaintBufferCacheEntryV2::ImageKey) + variants[i] = QVariant(images.value(entry.flags.key)); + else if (entry.flags.type == QPaintBufferCacheEntryV2::PixmapKey) + variants[i] = QVariant(pixmaps.value(entry.flags.key)); + else + qWarning() << "operator<<(QDataStream &stream, QPaintBuffer &buffer): unrecognized cache entry type:" << entry.flags.type; } } diff --git a/src/gui/painting/qpaintbuffer_p.h b/src/gui/painting/qpaintbuffer_p.h index 79d7b35..0fde290 100644 --- a/src/gui/painting/qpaintbuffer_p.h +++ b/src/gui/painting/qpaintbuffer_p.h @@ -183,6 +183,10 @@ public: Cmd_DrawTiledPixmap, Cmd_SystemStateChanged, + Cmd_Translate, + Cmd_DrawStaticText, + + // new commands must be added above this line Cmd_LastCommand }; @@ -394,6 +398,7 @@ public: virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s); virtual void drawTextItem(const QPointF &pos, const QTextItem &ti); + virtual void drawStaticTextItem(QStaticTextItem *staticTextItem); virtual void setState(QPainterState *s); virtual uint flags() const {return QPaintEngineEx::DoNotEmulate;} diff --git a/src/gui/painting/qpaintengine_raster.cpp b/src/gui/painting/qpaintengine_raster.cpp index bc56ed0..60265c5 100644 --- a/src/gui/painting/qpaintengine_raster.cpp +++ b/src/gui/painting/qpaintengine_raster.cpp @@ -67,6 +67,7 @@ // #include <private/qpolygonclipper_p.h> // #include <private/qrasterizer_p.h> #include <private/qimage_p.h> +#include <private/qstatictext_p.h> #include "qpaintengine_raster_p.h" // #include "qbezier_p.h" @@ -100,10 +101,6 @@ #endif #include <limits.h> -#if defined(QT_NO_FPU) || (_MSC_VER >= 1300 && _MSC_VER < 1400) -# define FLOATING_POINT_BUGGY_OR_NO_FPU -#endif - QT_BEGIN_NAMESPACE extern bool qt_scaleForTransform(const QTransform &transform, qreal *scale); // qtransform.cpp @@ -3006,27 +3003,22 @@ void QRasterPaintEngine::alphaPenBlt(const void* src, int bpl, int depth, int rx blend(current, spans, &s->penData); } -void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti) +void QRasterPaintEngine::drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *positions, QFontEngine *fontEngine) { Q_D(QRasterPaintEngine); QRasterPaintEngineState *s = state(); - QVarLengthArray<QFixedPoint> positions; - QVarLengthArray<glyph_t> glyphs; - QTransform matrix = s->matrix; - matrix.translate(p.x(), p.y()); - ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); - - QFontEngineGlyphCache::Type glyphType = ti.fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(ti.fontEngine->glyphFormat) : d->glyphCacheType; + QFontEngineGlyphCache::Type glyphType = fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(fontEngine->glyphFormat) : d->glyphCacheType; QImageTextureGlyphCache *cache = - (QImageTextureGlyphCache *) ti.fontEngine->glyphCache(0, glyphType, s->matrix); + static_cast<QImageTextureGlyphCache *>(fontEngine->glyphCache(0, glyphType, s->matrix)); if (!cache) { cache = new QImageTextureGlyphCache(glyphType, s->matrix); - ti.fontEngine->setGlyphCache(0, cache); + fontEngine->setGlyphCache(0, cache); } - cache->populate(ti, glyphs, positions); + cache->populate(fontEngine, numGlyphs, glyphs, positions); const QImage &image = cache->image(); int bpl = image.bytesPerLine(); @@ -3044,7 +3036,7 @@ void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt & const QFixed offs = QFixed::fromReal(aliasedCoordinateDelta); const uchar *bits = image.bits(); - for (int i=0; i<glyphs.size(); ++i) { + for (int i=0; i<numGlyphs; ++i) { const QTextureGlyphCache::Coord &c = cache->coords.value(glyphs[i]); int x = qFloor(positions[i].x + offs) + c.baseLineX - margin; int y = qFloor(positions[i].y + offs) - c.baseLineY - margin; @@ -3221,6 +3213,15 @@ QRasterPaintEnginePrivate::getPenFunc(const QRectF &rect, return isUnclipped(rect, penWidth) ? data->unclipped_blend : data->blend; } +void QRasterPaintEngine::drawStaticTextItem(QStaticTextItem *textItem) +{ + ensurePen(); + ensureState(); + + drawCachedGlyphs(textItem->numGlyphs, textItem->glyphs, textItem->glyphPositions, + textItem->fontEngine); +} + /*! \reimp */ @@ -3269,7 +3270,17 @@ void QRasterPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte drawCached = false; #endif if (drawCached) { - drawCachedGlyphs(p, ti); + QRasterPaintEngineState *s = state(); + + QVarLengthArray<QFixedPoint> positions; + QVarLengthArray<glyph_t> glyphs; + + QTransform matrix = s->matrix; + matrix.translate(p.x(), p.y()); + + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + drawCachedGlyphs(glyphs.size(), glyphs.constData(), positions.constData(), ti.fontEngine); return; } @@ -3679,9 +3690,6 @@ void QRasterPaintEngine::drawEllipse(const QRectF &rect) if (((qpen_style(s->lastPen) == Qt::SolidLine && s->flags.fast_pen) || (qpen_style(s->lastPen) == Qt::NoPen && !s->flags.antialiased)) && qMax(rect.width(), rect.height()) < QT_RASTER_COORD_LIMIT -#ifdef FLOATING_POINT_BUGGY_OR_NO_FPU - && qMax(rect.width(), rect.height()) < 128 // integer math breakdown -#endif && s->matrix.type() <= QTransform::TxScale) // no shear { ensureBrush(); @@ -6054,15 +6062,9 @@ static void drawEllipse_midpoint_i(const QRect &rect, const QRect &clip, ProcessSpans pen_func, ProcessSpans brush_func, QSpanData *pen_data, QSpanData *brush_data) { -#ifdef FLOATING_POINT_BUGGY_OR_NO_FPU // no fpu, so use fixed point - const QFixed a = QFixed(rect.width()) >> 1; - const QFixed b = QFixed(rect.height()) >> 1; - QFixed d = b*b - (a*a*b) + ((a*a) >> 2); -#else const qreal a = qreal(rect.width()) / 2; const qreal b = qreal(rect.height()) / 2; qreal d = b*b - (a*a*b) + 0.25*a*a; -#endif int x = 0; int y = (rect.height() + 1) / 2; @@ -6085,12 +6087,7 @@ static void drawEllipse_midpoint_i(const QRect &rect, const QRect &clip, pen_func, brush_func, pen_data, brush_data); // region 2 -#ifdef FLOATING_POINT_BUGGY_OR_NO_FPU - d = b*b*(x + (QFixed(1) >> 1))*(x + (QFixed(1) >> 1)) - + a*a*((y - 1)*(y - 1) - b*b); -#else d = b*b*(x + 0.5)*(x + 0.5) + a*a*((y - 1)*(y - 1) - b*b); -#endif const int miny = rect.height() & 0x1; while (y > miny) { if (d < 0) { // select SE diff --git a/src/gui/painting/qpaintengine_raster_p.h b/src/gui/painting/qpaintengine_raster_p.h index a1c73cc..55eb82e 100644 --- a/src/gui/painting/qpaintengine_raster_p.h +++ b/src/gui/painting/qpaintengine_raster_p.h @@ -203,6 +203,8 @@ public: void clip(const QRect &rect, Qt::ClipOperation op); void clip(const QRegion ®ion, Qt::ClipOperation op); + void drawStaticTextItem(QStaticTextItem *textItem); + enum ClipType { RectClip, ComplexClip @@ -257,7 +259,8 @@ private: void fillRect(const QRectF &rect, QSpanData *data); void drawBitmap(const QPointF &pos, const QImage &image, QSpanData *fill); - void drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti); + void drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFixedPoint *positions, + QFontEngine *fontEngine); #if defined(Q_OS_SYMBIAN) && defined(QT_NO_FREETYPE) void drawGlyphsS60(const QPointF &p, const QTextItemInt &ti); diff --git a/src/gui/painting/qpaintengine_x11.cpp b/src/gui/painting/qpaintengine_x11.cpp index 147491e..da48fcb 100644 --- a/src/gui/painting/qpaintengine_x11.cpp +++ b/src/gui/painting/qpaintengine_x11.cpp @@ -1989,6 +1989,9 @@ void QX11PaintEngine::drawPixmap(const QRectF &r, const QPixmap &px, const QRect } XFillRectangle(d->dpy, d->hd, d->gc, x, y, sw, sh); restore_clip = true; + } else if (mono_dst && !mono_src) { + QBitmap bitmap(pixmap); + XCopyArea(d->dpy, bitmap.handle(), d->hd, d->gc, sx, sy, sw, sh, x, y); } else { XCopyArea(d->dpy, pixmap.handle(), d->hd, d->gc, sx, sy, sw, sh, x, y); } diff --git a/src/gui/painting/qpaintengineex_p.h b/src/gui/painting/qpaintengineex_p.h index fccd1dc..90c4f9f 100644 --- a/src/gui/painting/qpaintengineex_p.h +++ b/src/gui/painting/qpaintengineex_p.h @@ -70,6 +70,7 @@ QT_MODULE(Gui) class QPainterState; class QPaintEngineExPrivate; +class QStaticTextItem; struct StrokeHandler; struct QIntRect { @@ -200,6 +201,8 @@ public: virtual void updateState(const QPaintEngineState &state); + virtual void drawStaticTextItem(QStaticTextItem *) = 0; + virtual void setState(QPainterState *s); inline QPainterState *state() { return static_cast<QPainterState *>(QPaintEngine::state); } inline const QPainterState *state() const { return static_cast<const QPainterState *>(QPaintEngine::state); } diff --git a/src/gui/painting/qpainter.cpp b/src/gui/painting/qpainter.cpp index cde6a2d..e69512d 100644 --- a/src/gui/painting/qpainter.cpp +++ b/src/gui/painting/qpainter.cpp @@ -69,6 +69,8 @@ #include <private/qwidget_p.h> #include <private/qpaintengine_raster_p.h> #include <private/qmath_p.h> +#include <qstatictext.h> +#include <private/qstatictext_p.h> QT_BEGIN_NAMESPACE @@ -708,13 +710,14 @@ void QPainterPrivate::updateEmulationSpecifier(QPainterState *s) bool penTextureAlpha = false; if (penBrush.style() == Qt::TexturePattern) penTextureAlpha = qHasPixmapTexture(penBrush) - ? penBrush.texture().hasAlpha() + ? (penBrush.texture().depth() > 1) && penBrush.texture().hasAlpha() : penBrush.textureImage().hasAlphaChannel(); bool brushTextureAlpha = false; - if (s->brush.style() == Qt::TexturePattern) + if (s->brush.style() == Qt::TexturePattern) { brushTextureAlpha = qHasPixmapTexture(s->brush) - ? s->brush.texture().hasAlpha() + ? (s->brush.texture().depth() > 1) && s->brush.texture().hasAlpha() : s->brush.textureImage().hasAlphaChannel(); + } if (((penBrush.style() == Qt::TexturePattern && penTextureAlpha) || (s->brush.style() == Qt::TexturePattern && brushTextureAlpha)) && !engine->hasFeature(QPaintEngine::MaskedBrush)) @@ -1986,12 +1989,25 @@ QPaintEngine *QPainter::paintEngine() const endNativePainting(). Note that only the states the underlying paint engine changes will be reset - to their respective default states. If, for example, the OpenGL polygon - mode is changed by the user inside a beginNativePaint()/endNativePainting() - block, it will not be reset to the default state by endNativePainting(). + to their respective default states. The states we reset may change from + release to release. The following states are currently reset in the OpenGL + 2 engine: + + \list + \i blending is disabled + \i the depth, stencil and scissor tests are disabled + \i the active texture unit is reset to 0 + \i the depth mask, depth function and the clear depth are reset to their + default values + \i the stencil mask, stencil operation and stencil function are reset to + their default values + \i the current color is reset to solid white + \endlist - Here is an example that shows intermixing of painter commands - and raw OpenGL commands: + If, for example, the OpenGL polygon mode is changed by the user inside a + beginNativePaint()/endNativePainting() block, it will not be reset to the + default state by endNativePainting(). Here is an example that shows + intermixing of painter commands and raw OpenGL commands: \snippet doc/src/snippets/code/src_gui_painting_qpainter.cpp 21 @@ -5684,6 +5700,23 @@ void QPainter::drawImage(const QRectF &targetRect, const QImage &image, const QR } /*! + + \fn void QPainter::drawStaticText(const QPoint &position, const QStaticText &staticText) + + \since 4.7 + + \overload +*/ + +/*! + \fn void QPainter::drawStaticText(int x, int y, const QStaticText &staticText) + + \since 4.7 + + \overload +*/ + +/*! \fn void QPainter::drawText(const QPointF &position, const QString &text) Draws the given \a text with the currently defined text direction, @@ -5706,6 +5739,124 @@ void QPainter::drawText(const QPointF &p, const QString &str) } /*! + \since 4.7 + + Draws the given \a staticText at the given \a position. + + The text will be drawn using the font and the transformation set on the painter. If the + font and/or transformation set on the painter are different from the ones used to initialize + the layout of the QStaticText, then the layout will have to be recalculated. Use + QStaticText::prepare() to initialize \a staticText with the font and transformation with which + it will later be drawn. + + If \a position is not the same as when \a staticText was initialized, or when it was last drawn, + then there will be a slight overhead when translating the text to its new position. + + \note If the painter's transformation is not affine, then \a staticText will be drawn using regular + calls to drawText(), losing any potential performance improvement. + + \sa QStaticText +*/ +void QPainter::drawStaticText(const QPointF &position, const QStaticText &staticText) +{ + Q_D(QPainter); + if (!d->engine || staticText.text().isEmpty() || pen().style() == Qt::NoPen) + return; + + QStaticTextPrivate *staticText_d = + const_cast<QStaticTextPrivate *>(QStaticTextPrivate::get(&staticText)); + + // If we don't have an extended paint engine, or if the painter is projected, + // we go through standard code path + if (d->extended == 0 || !d->state->matrix.isAffine()) { + staticText_d->paintText(position, this); + return; + } + + // Don't recalculate entire layout because of translation, rather add the dx and dy + // into the position to move each text item the correct distance. + QPointF transformedPosition = position * d->state->matrix; + QTransform matrix = d->state->matrix; + + // The translation has been applied to transformedPosition. Remove translation + // component from matrix. + if (d->state->matrix.isTranslating()) { + qreal m11 = d->state->matrix.m11(); + qreal m12 = d->state->matrix.m12(); + qreal m13 = d->state->matrix.m13(); + qreal m21 = d->state->matrix.m21(); + qreal m22 = d->state->matrix.m22(); + qreal m23 = d->state->matrix.m23(); + qreal m33 = d->state->matrix.m33(); + + d->state->matrix.setMatrix(m11, m12, m13, + m21, m22, m23, + 0.0, 0.0, m33); + } + + // If the transform is not identical to the text transform, + // we have to relayout the text (for other transformations than plain translation) + bool staticTextNeedsReinit = false; + if (staticText_d->matrix != d->state->matrix) { + staticText_d->matrix = d->state->matrix; + staticTextNeedsReinit = true; + } + + bool restoreWhenFinished = false; + if (staticText_d->needsClipRect) { + save(); + setClipRect(QRectF(position, staticText_d->maximumSize)); + + restoreWhenFinished = true; + } + + if (font() != staticText_d->font) { + staticText_d->font = font(); + staticTextNeedsReinit = true; + } + + // Recreate the layout of the static text because the matrix or font has changed + if (staticTextNeedsReinit) + staticText_d->init(); + + if (transformedPosition != staticText_d->position) { // Translate to actual position + QFixed fx = QFixed::fromReal(transformedPosition.x()); + QFixed fy = QFixed::fromReal(transformedPosition.y()); + QFixed oldX = QFixed::fromReal(staticText_d->position.x()); + QFixed oldY = QFixed::fromReal(staticText_d->position.y()); + for (int item=0; item<staticText_d->itemCount;++item) { + QStaticTextItem *textItem = staticText_d->items + item; + for (int i=0; i<textItem->numGlyphs; ++i) { + textItem->glyphPositions[i].x += fx - oldX; + textItem->glyphPositions[i].y += fy - oldY; + } + textItem->userDataNeedsUpdate = true; + } + + staticText_d->position = transformedPosition; + } + + QPen oldPen = d->state->pen; + QColor currentColor = oldPen.color(); + for (int i=0; i<staticText_d->itemCount; ++i) { + QStaticTextItem *item = staticText_d->items + i; + if (currentColor != item->color) { + setPen(item->color); + currentColor = item->color; + } + d->extended->drawStaticTextItem(item); + } + if (currentColor != oldPen.color()) + setPen(oldPen); + + if (restoreWhenFinished) + restore(); + + if (matrix.isTranslating()) + d->state->matrix = matrix; +} + +/*! \internal */ void QPainter::drawText(const QPointF &p, const QString &str, int tf, int justificationPadding) @@ -7509,7 +7660,7 @@ QPaintDevice *QPainter::redirected(const QPaintDevice *device, QPoint *offset) return widgetPrivate->redirected(offset); } - if (*globalRedirectionAtomic() == 0) + if (!globalRedirectionAtomic() || *globalRedirectionAtomic() == 0) return 0; QMutexLocker locker(globalRedirectionsMutex()); @@ -7529,7 +7680,7 @@ QPaintDevice *QPainter::redirected(const QPaintDevice *device, QPoint *offset) void qt_painter_removePaintDevice(QPaintDevice *dev) { - if (*globalRedirectionAtomic() == 0) + if (!globalRedirectionAtomic() || *globalRedirectionAtomic() == 0) return; QMutex *mutex = 0; diff --git a/src/gui/painting/qpainter.h b/src/gui/painting/qpainter.h index ffddcba..e9fd532 100644 --- a/src/gui/painting/qpainter.h +++ b/src/gui/painting/qpainter.h @@ -78,6 +78,7 @@ class QPolygon; class QTextItem; class QMatrix; class QTransform; +class QStaticText; class QPainterPrivateDeleter; @@ -369,6 +370,10 @@ public: void setLayoutDirection(Qt::LayoutDirection direction); Qt::LayoutDirection layoutDirection() const; + void drawStaticText(const QPointF &p, const QStaticText &staticText); + inline void drawStaticText(const QPoint &p, const QStaticText &staticText); + inline void drawStaticText(int x, int y, const QStaticText &staticText); + void drawText(const QPointF &p, const QString &s); inline void drawText(const QPoint &p, const QString &s); inline void drawText(int x, int y, const QString &s); @@ -896,6 +901,16 @@ inline void QPainter::drawImage(int x, int y, const QImage &image, int sx, int s drawImage(QRectF(x, y, -1, -1), image, QRectF(sx, sy, sw, sh), flags); } +inline void QPainter::drawStaticText(const QPoint &p, const QStaticText &staticText) +{ + drawStaticText(QPointF(p), staticText); +} + +inline void QPainter::drawStaticText(int x, int y, const QStaticText &staticText) +{ + drawStaticText(QPointF(x, y), staticText); +} + inline void QPainter::drawTextItem(const QPoint &p, const QTextItem &ti) { drawTextItem(QPointF(p), ti); diff --git a/src/gui/painting/qpathclipper.cpp b/src/gui/painting/qpathclipper.cpp index 7997e77..949a820 100644 --- a/src/gui/painting/qpathclipper.cpp +++ b/src/gui/painting/qpathclipper.cpp @@ -90,8 +90,6 @@ static QPointF normalize(const QPointF &p) return p / qSqrt(p.x() * p.x() + p.y() * p.y()); } -static bool pathToRect(const QPainterPath &path, QRectF *rect = 0); - struct QIntersection { qreal alphaA; @@ -1660,7 +1658,7 @@ static bool fuzzyCompare(qreal a, qreal b) return qFuzzyCompare(a, b); } -static bool pathToRect(const QPainterPath &path, QRectF *rect) +bool QPathClipper::pathToRect(const QPainterPath &path, QRectF *rect) { if (path.elementCount() != 5) return false; @@ -1693,7 +1691,7 @@ static bool pathToRect(const QPainterPath &path, QRectF *rect) return false; if (rect) - *rect = QRectF(QPointF(x1, y1), QPointF(x2, y2)); + rect->setCoords(x1, y1, x2, y2); return true; } @@ -1707,6 +1705,9 @@ QPainterPath QPathClipper::clip(Operation operation) if (subjectPath == clipPath) return op == BoolSub ? QPainterPath() : subjectPath; + bool subjectIsRect = pathToRect(subjectPath, 0); + bool clipIsRect = pathToRect(clipPath, 0); + const QRectF clipBounds = clipPath.boundingRect(); const QRectF subjectBounds = subjectPath.boundingRect(); @@ -1734,8 +1735,7 @@ QPainterPath QPathClipper::clip(Operation operation) } if (clipBounds.contains(subjectBounds)) { - QRectF clipRect; - if (pathToRect(clipPath, &clipRect) && clipRect.contains(subjectBounds)) { + if (clipIsRect) { switch (op) { case BoolSub: return QPainterPath(); @@ -1748,17 +1748,16 @@ QPainterPath QPathClipper::clip(Operation operation) } } } else if (subjectBounds.contains(clipBounds)) { - QRectF subjectRect; - if (pathToRect(subjectPath, &subjectRect) && subjectRect.contains(clipBounds)) { + if (subjectIsRect) { switch (op) { case BoolSub: if (clipPath.fillRule() == Qt::OddEvenFill) { QPainterPath result = clipPath; - result.addRect(subjectRect); + result.addRect(subjectBounds); return result; } else { QPainterPath result = clipPath.simplified(); - result.addRect(subjectRect); + result.addRect(subjectBounds); return result; } break; @@ -1771,6 +1770,13 @@ QPainterPath QPathClipper::clip(Operation operation) } } } + + if (op == BoolAnd) { + if (subjectIsRect) + return intersect(clipPath, subjectBounds); + else if (clipIsRect) + return intersect(subjectPath, clipBounds); + } } QWingedEdge list(subjectPath, clipPath); @@ -2054,4 +2060,243 @@ bool QPathClipper::handleCrossingEdges(QWingedEdge &list, qreal y, ClipperMode m return false; } +namespace { + +QList<QPainterPath> toSubpaths(const QPainterPath &path) +{ + + QList<QPainterPath> subpaths; + if (path.isEmpty()) + return subpaths; + + QPainterPath current; + for (int i = 0; i < path.elementCount(); ++i) { + const QPainterPath::Element &e = path.elementAt(i); + switch (e.type) { + case QPainterPath::MoveToElement: + if (current.elementCount() > 1) + subpaths += current; + current = QPainterPath(); + current.moveTo(e); + break; + case QPainterPath::LineToElement: + current.lineTo(e); + break; + case QPainterPath::CurveToElement: { + current.cubicTo(e, path.elementAt(i + 1), path.elementAt(i + 2)); + i+=2; + break; + } + case QPainterPath::CurveToDataElement: + Q_ASSERT(!"toSubpaths(), bad element type"); + break; + } + } + + if (current.elementCount() > 1) + subpaths << current; + + return subpaths; +} + +enum Edge +{ + Left, Top, Right, Bottom +}; + +static bool isVertical(Edge edge) +{ + return edge == Left || edge == Right; +} + +template <Edge edge> +bool compare(const QPointF &p, qreal t) +{ + switch (edge) + { + case Left: + return p.x() < t; + case Right: + return p.x() > t; + case Top: + return p.y() < t; + default: + return p.y() > t; + } +} + +template <Edge edge> +QPointF intersectLine(const QPointF &a, const QPointF &b, qreal t) +{ + QLineF line(a, b); + switch (edge) { + case Left: // fall-through + case Right: + return line.pointAt((t - a.x()) / (b.x() - a.x())); + default: + return line.pointAt((t - a.y()) / (b.y() - a.y())); + } +} + +void addLine(QPainterPath &path, const QLineF &line) +{ + if (path.elementCount() > 0) + path.lineTo(line.p1()); + else + path.moveTo(line.p1()); + + path.lineTo(line.p2()); +} + +template <Edge edge> +void clipLine(const QPointF &a, const QPointF &b, qreal t, QPainterPath &result) +{ + bool outA = compare<edge>(a, t); + bool outB = compare<edge>(b, t); + if (outA && outB) + return; + + if (outA) + addLine(result, QLineF(intersectLine<edge>(a, b, t), b)); + else if(outB) + addLine(result, QLineF(a, intersectLine<edge>(a, b, t))); + else + addLine(result, QLineF(a, b)); +} + +void addBezier(QPainterPath &path, const QBezier &bezier) +{ + if (path.elementCount() > 0) + path.lineTo(bezier.pt1()); + else + path.moveTo(bezier.pt1()); + + path.cubicTo(bezier.pt2(), bezier.pt3(), bezier.pt4()); +} + +template <Edge edge> +void clipBezier(const QPointF &a, const QPointF &b, const QPointF &c, const QPointF &d, qreal t, QPainterPath &result) +{ + QBezier bezier = QBezier::fromPoints(a, b, c, d); + + bool outA = compare<edge>(a, t); + bool outB = compare<edge>(b, t); + bool outC = compare<edge>(c, t); + bool outD = compare<edge>(d, t); + + int outCount = int(outA) + int(outB) + int(outC) + int(outD); + + if (outCount == 4) + return; + + if (outCount == 0) { + addBezier(result, bezier); + return; + } + + QTransform flip = isVertical(edge) ? QTransform(0, 1, 1, 0, 0, 0) : QTransform(); + QBezier unflipped = bezier; + QBezier flipped = bezier.mapBy(flip); + + qreal t0 = 0, t1 = 1; + int stationary = flipped.stationaryYPoints(t0, t1); + + qreal segments[4]; + QPointF points[4]; + points[0] = unflipped.pt1(); + segments[0] = 0; + + int segmentCount = 0; + if (stationary > 0) { + ++segmentCount; + segments[segmentCount] = t0; + points[segmentCount] = unflipped.pointAt(t0); + } + if (stationary > 1) { + ++segmentCount; + segments[segmentCount] = t1; + points[segmentCount] = unflipped.pointAt(t1); + } + ++segmentCount; + segments[segmentCount] = 1; + points[segmentCount] = unflipped.pt4(); + + qreal lastIntersection = 0; + for (int i = 0; i < segmentCount; ++i) { + outA = compare<edge>(points[i], t); + outB = compare<edge>(points[i+1], t); + + if (outA != outB) { + qreal intersection = flipped.tForY(segments[i], segments[i+1], t); + + if (outB) + addBezier(result, unflipped.getSubRange(lastIntersection, intersection)); + + lastIntersection = intersection; + } + } + + if (!outB) + addBezier(result, unflipped.getSubRange(lastIntersection, 1)); +} + +// clips a single subpath against a single edge +template <Edge edge> +QPainterPath clip(const QPainterPath &path, qreal t) +{ + QPainterPath result; + for (int i = 1; i < path.elementCount(); ++i) { + const QPainterPath::Element &element = path.elementAt(i); + Q_ASSERT(!element.isMoveTo()); + if (element.isLineTo()) { + clipLine<edge>(path.elementAt(i-1), path.elementAt(i), t, result); + } else { + clipBezier<edge>(path.elementAt(i-1), path.elementAt(i), path.elementAt(i+1), path.elementAt(i+2), t, result); + i += 2; + } + } + + int last = path.elementCount() - 1; + if (QPointF(path.elementAt(last)) != QPointF(path.elementAt(0))) + clipLine<edge>(path.elementAt(last), path.elementAt(0), t, result); + + return result; +} + +QPainterPath intersectPath(const QPainterPath &path, const QRectF &rect) +{ + QList<QPainterPath> subpaths = toSubpaths(path); + + QPainterPath result; + result.setFillRule(path.fillRule()); + for (int i = 0; i < subpaths.size(); ++i) { + QPainterPath subPath = subpaths.at(i); + QRectF bounds = subPath.boundingRect(); + if (bounds.intersects(rect)) { + if (bounds.left() < rect.left()) + subPath = clip<Left>(subPath, rect.left()); + if (bounds.right() > rect.right()) + subPath = clip<Right>(subPath, rect.right()); + + bounds = subPath.boundingRect(); + + if (bounds.top() < rect.top()) + subPath = clip<Top>(subPath, rect.top()); + if (bounds.bottom() > rect.bottom()) + subPath = clip<Bottom>(subPath, rect.bottom()); + + if (subPath.elementCount() > 1) + result.addPath(subPath); + } + } + return result; +} + +} + +QPainterPath QPathClipper::intersect(const QPainterPath &path, const QRectF &rect) +{ + return intersectPath(path, rect); +} + QT_END_NAMESPACE diff --git a/src/gui/painting/qpathclipper_p.h b/src/gui/painting/qpathclipper_p.h index 0d2c049..b42dc1d 100644 --- a/src/gui/painting/qpathclipper_p.h +++ b/src/gui/painting/qpathclipper_p.h @@ -86,6 +86,9 @@ public: bool intersect(); bool contains(); + static bool pathToRect(const QPainterPath &path, QRectF *rect = 0); + static QPainterPath intersect(const QPainterPath &path, const QRectF &rect); + private: Q_DISABLE_COPY(QPathClipper) diff --git a/src/gui/painting/qpdf.cpp b/src/gui/painting/qpdf.cpp index dd516b1..dcf745f 100644 --- a/src/gui/painting/qpdf.cpp +++ b/src/gui/painting/qpdf.cpp @@ -1415,6 +1415,7 @@ void QPdfBaseEngine::setProperty(PrintEnginePropertyKey key, const QVariant &val case PPK_FullPage: d->fullPage = value.toBool(); break; + case PPK_CopyCount: // fallthrough case PPK_NumberOfCopies: d->copies = value.toInt(); break; @@ -1504,6 +1505,17 @@ QVariant QPdfBaseEngine::property(PrintEnginePropertyKey key) const case PPK_FullPage: ret = d->fullPage; break; + case PPK_CopyCount: + ret = d->copies; + break; + case PPK_SupportsMultipleCopies: +#if !defined(QT_NO_CUPS) && !defined(QT_NO_LIBRARY) + if (QCUPSSupport::isAvailable()) + ret = true; + else +#endif + ret = false; + break; case PPK_NumberOfCopies: #if !defined(QT_NO_CUPS) && !defined(QT_NO_LIBRARY) if (QCUPSSupport::isAvailable()) diff --git a/src/gui/painting/qpdf_p.h b/src/gui/painting/qpdf_p.h index f79c5cc..9c4d05d 100644 --- a/src/gui/painting/qpdf_p.h +++ b/src/gui/painting/qpdf_p.h @@ -216,8 +216,6 @@ public: private: void updateClipPath(const QPainterPath & path, Qt::ClipOperation op); - - friend int qt_printerRealNumCopies(QPaintEngine *); }; class QPdfBaseEnginePrivate : public QAlphaPaintEnginePrivate diff --git a/src/gui/painting/qprintengine.h b/src/gui/painting/qprintengine.h index 35715fb..71ff954 100644 --- a/src/gui/painting/qprintengine.h +++ b/src/gui/painting/qprintengine.h @@ -86,6 +86,8 @@ public: PPK_PaperSources, PPK_CustomPaperSize, PPK_PageMargins, + PPK_CopyCount, + PPK_SupportsMultipleCopies, PPK_PaperSize = PPK_PageSize, PPK_CustomBase = 0xff00 diff --git a/src/gui/painting/qprintengine_mac.mm b/src/gui/painting/qprintengine_mac.mm index 7195c63..3d5d1d5 100644 --- a/src/gui/painting/qprintengine_mac.mm +++ b/src/gui/painting/qprintengine_mac.mm @@ -685,6 +685,7 @@ void QMacPrintEngine::setProperty(PrintEnginePropertyKey key, const QVariant &va case PPK_FullPage: d->fullPage = value.toBool(); break; + case PPK_CopyCount: // fallthrough case PPK_NumberOfCopies: PMSetCopies(d->settings, value.toInt(), false); break; @@ -787,6 +788,15 @@ QVariant QMacPrintEngine::property(PrintEnginePropertyKey key) const case PPK_NumberOfCopies: ret = 1; break; + case PPK_CopyCount: { + UInt32 copies = 1; + PMGetCopies(d->settings, &copies); + ret = (uint) copies; + break; + } + case PPK_SupportsMultipleCopies: + ret = true; + break; case PPK_Orientation: PMOrientation orientation; PMGetOrientation(d->format, &orientation); diff --git a/src/gui/painting/qprintengine_qws.cpp b/src/gui/painting/qprintengine_qws.cpp index 2d355b8..396d712 100644 --- a/src/gui/painting/qprintengine_qws.cpp +++ b/src/gui/painting/qprintengine_qws.cpp @@ -268,9 +268,13 @@ QVariant QtopiaPrintEngine::property(PrintEnginePropertyKey key) const case PPK_FullPage: ret = d->fullPage; break; + case PPK_CopyCount: // fallthrough case PPK_NumberOfCopies: ret = d->numCopies; break; + case PPK_SupportsMultipleCopies: + ret = false; + break; case PPK_Orientation: ret = d->orientation; break; @@ -329,6 +333,7 @@ void QtopiaPrintEngine::setProperty(PrintEnginePropertyKey key, const QVariant & case PPK_FullPage: d->fullPage = value.toBool(); break; + case PPK_CopyCount: // fallthrough case PPK_NumberOfCopies: d->numCopies = value.toInt(); break; diff --git a/src/gui/painting/qprintengine_win.cpp b/src/gui/painting/qprintengine_win.cpp index 374bfa0..d029b1e 100644 --- a/src/gui/painting/qprintengine_win.cpp +++ b/src/gui/painting/qprintengine_win.cpp @@ -1240,6 +1240,7 @@ void QWin32PrintEngine::setProperty(PrintEnginePropertyKey key, const QVariant & d->updateOrigin(); break; + case PPK_CopyCount: // fallthrough case PPK_NumberOfCopies: if (!d->devMode) break; @@ -1406,6 +1407,14 @@ QVariant QWin32PrintEngine::property(PrintEnginePropertyKey key) const value = d->fullPage; break; + case PPK_CopyCount: + value = d->num_copies; + break; + + case PPK_SupportsMultipleCopies: + value = true; + break; + case PPK_NumberOfCopies: value = 1; break; diff --git a/src/gui/painting/qprintengine_win_p.h b/src/gui/painting/qprintengine_win_p.h index a3271cb..d435831 100644 --- a/src/gui/painting/qprintengine_win_p.h +++ b/src/gui/painting/qprintengine_win_p.h @@ -108,7 +108,6 @@ public: private: friend class QPrintDialog; friend class QPageSetupDialog; - friend int qt_printerRealNumCopies(QPaintEngine *); }; class QWin32PrintEnginePrivate : public QAlphaPaintEnginePrivate diff --git a/src/gui/painting/qprinter.cpp b/src/gui/painting/qprinter.cpp index 4d2b50a..edf224d 100644 --- a/src/gui/painting/qprinter.cpp +++ b/src/gui/painting/qprinter.cpp @@ -158,27 +158,6 @@ QSizeF qt_printerPaperSize(QPrinter::Orientation orientation, (qt_paperSizes[paperSize][height_index] * 72 / 25.4) / multiplier); } - -// returns the actual num copies set on a printer, not -// the number that is documented in QPrinter::numCopies() -int qt_printerRealNumCopies(QPaintEngine *engine) -{ - int numCopies = 1; - if (engine->type() == QPaintEngine::PostScript - || engine->type() == QPaintEngine::Pdf) - { - QPdfBaseEngine *base = static_cast<QPdfBaseEngine *>(engine); - numCopies = base->d_func()->copies; - } -#ifdef Q_WS_WIN - else if (engine->type() == QPaintEngine::Windows) { - QWin32PrintEngine *base = static_cast<QWin32PrintEngine *>(engine); - numCopies = base->d_func()->num_copies; - } -#endif - return numCopies; -} - void QPrinterPrivate::createDefaultEngines() { QPrinter::OutputFormat realOutputFormat = outputFormat; @@ -302,7 +281,7 @@ void QPrinterPrivate::addToManualSetList(QPrintEngine::PrintEnginePropertyKey ke printer to provide, in dots per inch (DPI). \i setFullPage() tells QPrinter whether you want to deal with the full page or just with the part the printer can draw on. - \i setNumCopies() tells QPrinter how many copies of the document + \i setCopyCount() tells QPrinter how many copies of the document it should print. \endlist @@ -748,7 +727,6 @@ void QPrinter::setOutputFormat(OutputFormat format) d->outputFormat = format; QPrintEngine *oldPrintEngine = d->printEngine; - QPaintEngine *oldPaintEngine = d->paintEngine; // same as the above - shouldn't be deleted const bool def_engine = d->use_default_engine; d->printEngine = 0; @@ -761,7 +739,7 @@ void QPrinter::setOutputFormat(OutputFormat format) // PPK_NumberOfCopies need special treatmeant since it in most cases // will return 1, disregarding the actual value that was set if (key == QPrintEngine::PPK_NumberOfCopies) - prop = QVariant(qt_printerRealNumCopies(oldPaintEngine)); + prop = QVariant(copyCount()); else prop = oldPrintEngine->property(key); if (prop.isValid()) @@ -1263,6 +1241,7 @@ QPrinter::ColorMode QPrinter::colorMode() const /*! + \obsolete Returns the number of copies to be printed. The default value is 1. On Windows, Mac OS X and X11 systems that support CUPS, this will always @@ -1275,6 +1254,8 @@ QPrinter::ColorMode QPrinter::colorMode() const buffering up the copies and in those cases the application must make an explicit call to the print code for each copy. + Use copyCount() in conjunction with supportsMultipleCopies() instead. + \sa setNumCopies(), actualNumCopies() */ @@ -1286,6 +1267,7 @@ int QPrinter::numCopies() const /*! + \obsolete \since 4.6 Returns the number of copies that will be printed. The default @@ -1294,22 +1276,26 @@ int QPrinter::numCopies() const This function always returns the actual value specified in the print dialog or using setNumCopies(). + Use copyCount() instead. + \sa setNumCopies(), numCopies() */ int QPrinter::actualNumCopies() const { - Q_D(const QPrinter); - return qt_printerRealNumCopies(d->paintEngine); + return copyCount(); } /*! + \obsolete Sets the number of copies to be printed to \a numCopies. The printer driver reads this setting and prints the specified number of copies. + Use setCopyCount() instead. + \sa numCopies() */ @@ -1321,6 +1307,58 @@ void QPrinter::setNumCopies(int numCopies) d->addToManualSetList(QPrintEngine::PPK_NumberOfCopies); } +/*! + \since 4.7 + + Sets the number of copies to be printed to \a count. + + The printer driver reads this setting and prints the specified number of + copies. + + \sa copyCount(), supportsMultipleCopies() +*/ + +void QPrinter::setCopyCount(int count) +{ + Q_D(QPrinter); + ABORT_IF_ACTIVE("QPrinter::setCopyCount;"); + d->printEngine->setProperty(QPrintEngine::PPK_CopyCount, count); + d->addToManualSetList(QPrintEngine::PPK_CopyCount); +} + +/*! + \since 4.7 + + Returns the number of copies that will be printed. The default value is 1. + + \sa setCopyCount(), supportsMultipleCopies() +*/ + +int QPrinter::copyCount() const +{ + Q_D(const QPrinter); + return d->printEngine->property(QPrintEngine::PPK_CopyCount).toInt(); +} + +/*! + \since 4.7 + + Returns true if the printer supports printing multiple copies of the same + document in one job; otherwise false is returned. + + On most systems this function will return true. However, on X11 systems + that do not support CUPS, this function will return false. That means the + application has to handle the number of copies by printing the same + document the required number of times. + + \sa setCopyCount(), copyCount() +*/ + +bool QPrinter::supportsMultipleCopies() const +{ + Q_D(const QPrinter); + return d->printEngine->property(QPrintEngine::PPK_SupportsMultipleCopies).toBool(); +} /*! \since 4.1 @@ -2262,8 +2300,8 @@ bool QPrinter::isOptionEnabled( PrinterOption option ) const \value PPK_FullPage A boolean describing if the printer should be full page or not. - \value PPK_NumberOfCopies An integer specifying the number of - copies + \value PPK_NumberOfCopies Obsolete. An integer specifying the number of + copies. Use PPK_CopyCount instead. \value PPK_Orientation Specifies a QPrinter::Orientation value. @@ -2310,6 +2348,11 @@ bool QPrinter::isOptionEnabled( PrinterOption option ) const \value PPK_PageMargins A QList<QVariant> containing the left, top, right and bottom margin values. + \value PPK_CopyCount An integer specifying the number of copies to print. + + \value PPK_SupportsMultipleCopies A boolean value indicating whether or not + the printer supports printing multiple copies in one job. + \value PPK_CustomBase Basis for extension. */ diff --git a/src/gui/painting/qprinter.h b/src/gui/painting/qprinter.h index 5aa891e..6636179 100644 --- a/src/gui/painting/qprinter.h +++ b/src/gui/painting/qprinter.h @@ -199,6 +199,10 @@ public: int actualNumCopies() const; + void setCopyCount(int); + int copyCount() const; + bool supportsMultipleCopies() const; + void setPaperSource(PaperSource); PaperSource paperSource() const; diff --git a/src/gui/painting/qtextureglyphcache.cpp b/src/gui/painting/qtextureglyphcache.cpp index 7b7f325..cf3957b 100644 --- a/src/gui/painting/qtextureglyphcache.cpp +++ b/src/gui/painting/qtextureglyphcache.cpp @@ -55,29 +55,42 @@ QT_BEGIN_NAMESPACE // #define CACHE_DEBUG -void QTextureGlyphCache::populate(const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs, - const QVarLengthArray<QFixedPoint> &) +// returns the highest number closest to v, which is a power of 2 +// NB! assumes 32 bit ints +int qt_next_power_of_two(int v) +{ + v--; + v |= v >> 1; + v |= v >> 2; + v |= v >> 4; + v |= v >> 8; + v |= v >> 16; + ++v; + return v; +} + +void QTextureGlyphCache::populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *) { #ifdef CACHE_DEBUG printf("Populating with '%s'\n", QString::fromRawData(ti.chars, ti.num_chars).toLatin1().data()); qDebug() << " -> current transformation: " << m_transform; #endif - m_current_textitem = &ti; + m_current_fontengine = fontEngine; const int margin = glyphMargin(); QHash<glyph_t, Coord> listItemCoordinates; int rowHeight = 0; // check each glyph for its metrics and get the required rowHeight. - for (int i=0; i < glyphs.size(); ++i) { + for (int i=0; i < numGlyphs; ++i) { const glyph_t glyph = glyphs[i]; if (coords.contains(glyph)) continue; if (listItemCoordinates.contains(glyph)) continue; - glyph_metrics_t metrics = ti.fontEngine->boundingBox(glyph, m_transform); + glyph_metrics_t metrics = fontEngine->boundingBox(glyph, m_transform); #ifdef CACHE_DEBUG printf("'%c' (%4x): w=%.2f, h=%.2f, xoff=%.2f, yoff=%.2f, x=%.2f, y=%.2f, ti.ascent=%.2f, ti.descent=%.2f\n", @@ -116,7 +129,7 @@ void QTextureGlyphCache::populate(const QTextItemInt &ti, rowHeight += margin * 2; if (isNull()) - createCache(QT_DEFAULT_TEXTURE_GLYPH_CACHE_WIDTH, rowHeight); + createCache(QT_DEFAULT_TEXTURE_GLYPH_CACHE_WIDTH, qt_next_power_of_two(rowHeight)); // now actually use the coords and paint the wanted glyps into cache. QHash<glyph_t, Coord>::iterator iter = listItemCoordinates.begin(); @@ -129,13 +142,9 @@ void QTextureGlyphCache::populate(const QTextItemInt &ti, m_cy = m_h; } if (m_cy + c.h > m_h) { - int new_height; - if (m_cx == 0) { // add a whole row - new_height = m_h + rowHeight; - m_cy = m_h; - } else { // just extend row - new_height = m_cy + rowHeight; - } + int new_height = m_h*2; + while (new_height < m_cy + c.h) + new_height *= 2; // if no room in the current texture - realloc a larger texture resizeTextureData(m_w, new_height); m_h = new_height; @@ -182,7 +191,7 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const break; }; - QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_textitem->fontEngine); + QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_fontengine); QFontEngineFT::QGlyphSet *gset = ft->loadTransformedGlyphSet(m_transform); if (gset && ft->loadGlyphs(gset, &g, 1, format)) { @@ -194,9 +203,9 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const } else #endif if (m_type == QFontEngineGlyphCache::Raster_RGBMask) - return m_current_textitem->fontEngine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform); + return m_current_fontengine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform); else - return m_current_textitem->fontEngine->alphaMapForGlyph(g, m_transform); + return m_current_fontengine->alphaMapForGlyph(g, m_transform); return QImage(); } diff --git a/src/gui/painting/qtextureglyphcache_p.h b/src/gui/painting/qtextureglyphcache_p.h index d347e61..803e71b 100644 --- a/src/gui/painting/qtextureglyphcache_p.h +++ b/src/gui/painting/qtextureglyphcache_p.h @@ -76,7 +76,9 @@ class Q_GUI_EXPORT QTextureGlyphCache : public QFontEngineGlyphCache { public: QTextureGlyphCache(QFontEngineGlyphCache::Type type, const QTransform &matrix) - : QFontEngineGlyphCache(matrix, type), m_w(0), m_h(0), m_cx(0), m_cy(0) { } + : QFontEngineGlyphCache(matrix, type), m_current_fontengine(0), + m_w(0), m_h(0), m_cx(0), m_cy(0) + { } virtual ~QTextureGlyphCache() { } @@ -90,9 +92,8 @@ public: int baseLineY; }; - void populate(const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs, - const QVarLengthArray<QFixedPoint> &positions); + void populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *positions); virtual void createTextureData(int width, int height) = 0; virtual void resizeTextureData(int width, int height) = 0; @@ -113,7 +114,7 @@ public: QImage textureMapForGlyph(glyph_t g) const; protected: - const QTextItemInt *m_current_textitem; + QFontEngine *m_current_fontengine; int m_w; // image width int m_h; // image height diff --git a/src/gui/painting/qwindowsurface_raster.cpp b/src/gui/painting/qwindowsurface_raster.cpp index a0d2b9b..eee6bef 100644 --- a/src/gui/painting/qwindowsurface_raster.cpp +++ b/src/gui/painting/qwindowsurface_raster.cpp @@ -295,10 +295,8 @@ void QRasterWindowSurface::flush(QWidget *widget, const QRegion &rgn, const QPoi CGContextRestoreGState(context); #ifndef QT_MAC_USE_COCOA QDEndCGContext(port, &context); -#else - CGContextFlush(context); -#endif #endif +#endif // Q_WS_MAC #ifdef Q_OS_SYMBIAN Q_UNUSED(widget); diff --git a/src/gui/painting/qwindowsurface_s60.cpp b/src/gui/painting/qwindowsurface_s60.cpp index b41dc2c..028ec48 100644 --- a/src/gui/painting/qwindowsurface_s60.cpp +++ b/src/gui/painting/qwindowsurface_s60.cpp @@ -145,12 +145,23 @@ QImage* QS60WindowSurface::buffer(const QWidget *widget) void QS60WindowSurface::flush(QWidget *widget, const QRegion ®ion, const QPoint &) { - QWExtra *extra = widget->d_func()->extraData(); - if (extra && !extra->inExpose) { - extra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again - TRect tr = qt_QRect2TRect(region.boundingRect()); + QWidget *window = widget->window(); + Q_ASSERT(window); + QTLWExtra *topExtra = window->d_func()->maybeTopData(); + Q_ASSERT(topExtra); + QRect qr = region.boundingRect(); + if (!topExtra->inExpose) { + topExtra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again + TRect tr = qt_QRect2TRect(qr); widget->winId()->DrawNow(tr); - extra->inExpose = false; + topExtra->inExpose = false; + } else { + // This handles the case when syncBackingStore updates content outside of the + // original drawing rectangle. This might happen if there are pending update() + // events at the same time as we get a Draw() from Symbian. + QRect drawRect = qt_TRect2QRect(widget->winId()->DrawableWindow()->GetDrawRect()); + if (!drawRect.contains(qr)) + widget->winId()->DrawDeferred(); } } diff --git a/src/gui/styles/qcommonstyle.cpp b/src/gui/styles/qcommonstyle.cpp index 3132dd1..f8464cc 100644 --- a/src/gui/styles/qcommonstyle.cpp +++ b/src/gui/styles/qcommonstyle.cpp @@ -1149,10 +1149,10 @@ void QCommonStylePrivate::tabLayout(const QStyleOptionTabV3 *opt, const QWidget int vpadding = proxyStyle->pixelMetric(QStyle::PM_TabBarTabVSpace, opt, widget) / 2; if (opt->shape == QTabBar::RoundedSouth || opt->shape == QTabBar::TriangularSouth) verticalShift = -verticalShift; - tr.adjust(hpadding, vpadding, horizontalShift - hpadding, verticalShift - vpadding); + tr.adjust(hpadding, verticalShift - vpadding, horizontalShift - hpadding, vpadding); bool selected = opt->state & QStyle::State_Selected; if (selected) { - tr.setBottom(tr.bottom() - verticalShift); + tr.setTop(tr.top() - verticalShift); tr.setRight(tr.right() - horizontalShift); } @@ -5761,88 +5761,88 @@ QIcon QCommonStyle::standardIconImplementation(StandardPixmap standardIcon, cons switch (standardIcon) { #ifndef QT_NO_IMAGEFORMAT_PNG case SP_FileDialogNewFolder: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/newdirectory-128.png"), QSize(128, 128)); break; case SP_FileDialogBack: return standardIconImplementation(SP_ArrowBack, option, widget); case SP_FileDialogToParent: return standardIconImplementation(SP_ArrowUp, option, widget); case SP_FileDialogDetailedView: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewdetailed-128.png"), QSize(128, 128)); break; case SP_FileDialogInfoView: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/fileinfo-128.png"), QSize(128, 128)); break; case SP_FileDialogContentsView: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filecontents-128.png"), QSize(128, 128)); break; case SP_FileDialogListView: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/viewlist-128.png"), QSize(128, 128)); break; case SP_DialogOkButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-ok-128.png"), QSize(128, 128)); break; case SP_DialogCancelButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-cancel-128.png"), QSize(128, 128)); break; case SP_DialogHelpButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-help-128.png"), QSize(128, 128)); break; case SP_DialogOpenButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-open-128.png"), QSize(128, 128)); break; case SP_DialogSaveButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-save-128.png"), QSize(128, 128)); break; case SP_DialogCloseButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-close-128.png"), QSize(128, 128)); break; case SP_DialogApplyButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-apply-128.png"), QSize(128, 128)); break; case SP_DialogResetButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-clear-128.png"), QSize(128, 128)); break; case SP_DialogDiscardButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-delete-128.png"), QSize(128, 128)); break; case SP_DialogYesButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-yes-128.png"), QSize(128, 128)); break; case SP_DialogNoButton: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/standardbutton-no-128.png"), QSize(128, 128)); break; case SP_ArrowForward: if (rtl) @@ -5853,24 +5853,24 @@ QIcon QCommonStyle::standardIconImplementation(StandardPixmap standardIcon, cons return standardIconImplementation(SP_ArrowRight, option, widget); return standardIconImplementation(SP_ArrowLeft, option, widget); case SP_ArrowLeft: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/left-128.png"), QSize(128, 128)); break; case SP_ArrowRight: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/right-128.png"), QSize(128, 128)); break; case SP_ArrowUp: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/up-128.png"), QSize(128, 128)); break; case SP_ArrowDown: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/down-128.png"), QSize(128, 128)); break; case SP_DirHomeIcon: case SP_DirIcon: @@ -5888,71 +5888,71 @@ QIcon QCommonStyle::standardIconImplementation(StandardPixmap standardIcon, cons QSize(128, 128), QIcon::Normal, QIcon::On); break; case SP_DriveCDIcon: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/cdr-128.png"), QSize(128, 128)); break; case SP_DriveDVDIcon: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/dvd-128.png"), QSize(128, 128)); break; case SP_FileIcon: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/file-128.png"), QSize(128, 128)); break; case SP_FileLinkIcon: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/filelink-128.png"), QSize(128, 128)); break; case SP_TrashIcon: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-32.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-128.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-32.png"), QSize(32, 32)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/trash-128.png"), QSize(128, 128)); break; case SP_BrowserReload: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/refresh-24.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/refresh-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/refresh-24.png"), QSize(24, 24)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/refresh-32.png"), QSize(32, 32)); break; case SP_BrowserStop: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/stop-24.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/stop-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/stop-24.png"), QSize(24, 24)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/stop-32.png"), QSize(32, 32)); break; case SP_MediaPlay: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-play-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-play-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-play-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-play-32.png"), QSize(32, 32)); break; case SP_MediaPause: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-pause-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-pause-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-pause-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-pause-32.png"), QSize(32, 32)); break; case SP_MediaStop: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-stop-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-stop-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-stop-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-stop-32.png"), QSize(32, 32)); break; case SP_MediaSeekForward: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-forward-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-forward-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-forward-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-forward-32.png"), QSize(32, 32)); break; case SP_MediaSeekBackward: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-backward-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-backward-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-backward-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-seek-backward-32.png"), QSize(32, 32)); break; case SP_MediaSkipForward: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-forward-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-forward-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-forward-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-forward-32.png"), QSize(32, 32)); break; case SP_MediaSkipBackward: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-backward-16.png")); - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-backward-32.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-backward-16.png"), QSize(16, 16)); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-skip-backward-32.png"), QSize(32, 32)); break; case SP_MediaVolume: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-volume-16.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-volume-16.png"), QSize(16, 16)); break; case SP_MediaVolumeMuted: - icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-volume-muted-16.png")); + icon.addFile(QLatin1String(":/trolltech/styles/commonstyle/images/media-volume-muted-16.png"), QSize(16, 16)); break; #endif // QT_NO_IMAGEFORMAT_PNG default: diff --git a/src/gui/styles/qmacstyle_mac.mm b/src/gui/styles/qmacstyle_mac.mm index a077cf0..40ee31d 100644 --- a/src/gui/styles/qmacstyle_mac.mm +++ b/src/gui/styles/qmacstyle_mac.mm @@ -3391,8 +3391,14 @@ void QMacStyle::drawControl(ControlElement ce, const QStyleOption *opt, QPainter if (tb->toolButtonStyle != Qt::ToolButtonIconOnly) { needText = true; if (tb->toolButtonStyle == Qt::ToolButtonTextUnderIcon) { - pr.setHeight(pixmap.size().height()); - cr.adjust(0, pr.bottom() + 1, 0, 1); + QMainWindow *mw = qobject_cast<QMainWindow *>(w->window()); + if (mw && mw->unifiedTitleAndToolBarOnMac()) { + pr.setHeight(pixmap.size().height()); + cr.adjust(0, pr.bottom() + 1, 0, 1); + } else { + pr.setHeight(pixmap.size().height() + 6); + cr.adjust(0, pr.bottom(), 0, -3); + } alignment |= Qt::AlignCenter; } else { pr.setWidth(pixmap.width() + 8); diff --git a/src/gui/styles/qs60style.cpp b/src/gui/styles/qs60style.cpp index 9025e5b..565cc2c 100644 --- a/src/gui/styles/qs60style.cpp +++ b/src/gui/styles/qs60style.cpp @@ -120,6 +120,8 @@ QPixmap *QS60StylePrivate::m_background = 0; // theme palette QPalette *QS60StylePrivate::m_themePalette = 0; +qint64 QS60StylePrivate::m_webPaletteKey = 0; + const struct QS60StylePrivate::frameElementCenter QS60StylePrivate::m_frameElementsData[] = { {SE_ButtonNormal, QS60StyleEnums::SP_QsnFrButtonTbCenter}, {SE_ButtonPressed, QS60StyleEnums::SP_QsnFrButtonTbCenterPressed}, @@ -289,6 +291,9 @@ void QS60StylePrivate::drawSkinElement(SkinElements element, QPainter *painter, case SE_Editor: drawFrame(SF_FrameLineEdit, painter, rect, flags | SF_PointNorth); break; + case SE_DropArea: + drawPart(QS60StyleEnums::SP_QgnGrafOrgBgGrid, painter, rect, flags | SF_PointNorth); + break; default: break; } @@ -804,8 +809,12 @@ void QS60StylePrivate::setThemePaletteHash(QPalette *palette) const QPalette webPalette = *palette; webPalette.setColor(QPalette::WindowText, Qt::black); webPalette.setColor(QPalette::Text, Qt::black); + webPalette.setBrush(QPalette::Base, Qt::white); + QApplication::setPalette(webPalette, "QWebView"); QApplication::setPalette(webPalette, "QGraphicsWebView"); + + m_webPaletteKey = webPalette.cacheKey(); } QSize QS60StylePrivate::partSize(QS60StyleEnums::SkinParts part, SkinElementFlags flags) @@ -844,15 +853,18 @@ QSize QS60StylePrivate::partSize(QS60StyleEnums::SkinParts part, SkinElementFlag result.setWidth(pixelMetric(PM_Custom_FrameCornerWidth)); break; - case QS60StyleEnums::SP_QsnCpScrollHandleBottomPressed: case QS60StyleEnums::SP_QsnCpScrollHandleTopPressed: - case QS60StyleEnums::SP_QsnCpScrollHandleMiddlePressed: case QS60StyleEnums::SP_QsnCpScrollBgBottom: - case QS60StyleEnums::SP_QsnCpScrollBgMiddle: case QS60StyleEnums::SP_QsnCpScrollBgTop: case QS60StyleEnums::SP_QsnCpScrollHandleBottom: - case QS60StyleEnums::SP_QsnCpScrollHandleMiddle: case QS60StyleEnums::SP_QsnCpScrollHandleTop: + case QS60StyleEnums::SP_QsnCpScrollHandleBottomPressed: + result.setHeight(pixelMetric(QStyle::PM_ScrollBarExtent)); + result.setWidth(pixelMetric(QStyle::PM_ScrollBarExtent)); + break; + case QS60StyleEnums::SP_QsnCpScrollHandleMiddlePressed: + case QS60StyleEnums::SP_QsnCpScrollBgMiddle: + case QS60StyleEnums::SP_QsnCpScrollHandleMiddle: result.setHeight(pixelMetric(QStyle::PM_ScrollBarExtent)); result.setWidth(pixelMetric(QStyle::PM_ScrollBarSliderMin)); break; @@ -890,8 +902,11 @@ QSize QS60StylePrivate::partSize(QS60StyleEnums::SkinParts part, SkinElementFlag return result; } -bool QS60StylePrivate::canDrawThemeBackground(const QBrush &backgroundBrush) +bool QS60StylePrivate::canDrawThemeBackground(const QBrush &backgroundBrush, const QWidget *widget) { + // Always return true for web pages. + if (widget && m_webPaletteKey == QApplication::palette(widget).cacheKey()) + return true; //If brush is not changed from style's default values, draw theme graphics. return (backgroundBrush.color() == Qt::transparent || backgroundBrush.style() == Qt::NoBrush) ? true : false; @@ -1895,7 +1910,7 @@ void QS60Style::drawControl(ControlElement element, const QStyleOption *option, case CE_ShapedFrame: if (const QTextEdit *textEdit = qobject_cast<const QTextEdit *>(widget)) { const QStyleOptionFrame *frame = qstyleoption_cast<const QStyleOptionFrame *>(option); - if (QS60StylePrivate::canDrawThemeBackground(frame->palette.base())) + if (QS60StylePrivate::canDrawThemeBackground(frame->palette.base(), widget)) QS60StylePrivate::drawSkinElement(QS60StylePrivate::SE_Editor, painter, option->rect, flags); else QCommonStyle::drawControl(element, option, painter, widget); @@ -2007,7 +2022,7 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti if (widget && qobject_cast<const QComboBox *>(widget->parentWidget())) break; #endif - if (QS60StylePrivate::canDrawThemeBackground(option->palette.base())) + if (QS60StylePrivate::canDrawThemeBackground(option->palette.base(), widget)) QS60StylePrivate::drawSkinElement(QS60StylePrivate::SE_FrameLineEdit, painter, option->rect, flags); else commonStyleDraws = true; @@ -2087,7 +2102,7 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti case PE_PanelButtonTool: case PE_PanelButtonBevel: case PE_FrameButtonBevel: - if (QS60StylePrivate::canDrawThemeBackground(option->palette.base())) { + if (QS60StylePrivate::canDrawThemeBackground(option->palette.base(), widget)) { const bool isPressed = option->state & State_Sunken; const QS60StylePrivate::SkinElements skinElement = isPressed ? QS60StylePrivate::SE_ButtonPressed : QS60StylePrivate::SE_ButtonNormal; @@ -2119,7 +2134,7 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti case PE_IndicatorSpinDown: case PE_IndicatorSpinUp: if (const QStyleOptionSpinBox *spinBox = qstyleoption_cast<const QStyleOptionSpinBox *>(option)) { - if (QS60StylePrivate::canDrawThemeBackground(spinBox->palette.base())) { + if (QS60StylePrivate::canDrawThemeBackground(spinBox->palette.base(), widget)) { QStyleOptionSpinBox optionSpinBox = *spinBox; const QS60StyleEnums::SkinParts part = (element == PE_IndicatorSpinUp) ? QS60StyleEnums::SP_QgnGrafScrollArrowUp : @@ -2134,7 +2149,7 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti #endif //QT_NO_SPINBOX #ifndef QT_NO_COMBOBOX if (const QStyleOptionFrame *cmb = qstyleoption_cast<const QStyleOptionFrame *>(option)) { - if (QS60StylePrivate::canDrawThemeBackground( option->palette.base())) { + if (QS60StylePrivate::canDrawThemeBackground( option->palette.base(), widget)) { // We want to draw down arrow here for comboboxes as well. QStyleOptionFrame optionsComboBox = *cmb; const QS60StyleEnums::SkinParts part = QS60StyleEnums::SP_QgnGrafScrollArrowDown; @@ -2173,7 +2188,7 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti #endif //QT_NO_MENU ) { //Need extra check since dialogs have their own theme background - if (QS60StylePrivate::canDrawThemeBackground(option->palette.base()) && + if (QS60StylePrivate::canDrawThemeBackground(option->palette.base(), widget) && option->palette.window().texture().cacheKey() == QS60StylePrivate::m_themePalette->window().texture().cacheKey()) QS60StylePrivate::drawSkinElement(QS60StylePrivate::SE_OptionsMenu, painter, option->rect, flags); @@ -2271,14 +2286,16 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti QS60StyleEnums::SkinParts skinPart = (option->state & State_Open) ? QS60StyleEnums::SP_QgnIndiHlColSuper : QS60StyleEnums::SP_QgnIndiHlExpSuper; int minDimension = qMin(option->rect.width(), option->rect.height()); - const int resizeValue = minDimension >> 1; - minDimension += resizeValue; // Adjust the icon bigger because of empty space in svg icon. QRect iconRect(option->rect.topLeft(), QSize(minDimension, minDimension)); - int verticalMagic(0); - // magic values for positioning svg icon. - if (option->rect.width() <= option->rect.height()) - verticalMagic = 3; - iconRect.translate(3, verticalMagic - resizeValue); + const int magicTweak = 3; + int resizeValue = minDimension >> 1; + if (!QS60StylePrivate::isTouchSupported()) { + minDimension += resizeValue; // Adjust the icon bigger because of empty space in svg icon. + iconRect.setSize(QSize(minDimension, minDimension)); + const int verticalMagic = (option->rect.width() <= option->rect.height()) ? magicTweak : 0; + resizeValue = verticalMagic - resizeValue; + } + iconRect.translate(magicTweak, resizeValue); QS60StylePrivate::drawSkinPart(skinPart, painter, iconRect, flags); } } @@ -2302,7 +2319,12 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti break; case PE_PanelScrollAreaCorner: break; - + case PE_IndicatorItemViewItemDrop: + if (QS60StylePrivate::isTouchSupported()) + QS60StylePrivate::drawSkinElement(QS60StylePrivate::SE_DropArea, painter, option->rect, flags); + else + commonStyleDraws = true; + break; // todo: items are below with #ifdefs "just in case". in final version, remove all non-required cases case PE_FrameLineEdit: case PE_IndicatorDockWidgetResizeHandle: @@ -2323,7 +2345,6 @@ void QS60Style::drawPrimitive(PrimitiveElement element, const QStyleOption *opti #endif //QT_NO_TOOLBAR #ifndef QT_NO_COLUMNVIEW case PE_IndicatorColumnViewArrow: - case PE_IndicatorItemViewItemDrop: #endif //QT_NO_COLUMNVIEW case PE_FrameTabBarBase: // since tabs are in S60 always in navipane, let's use common style for tab base in Qt. default: @@ -2375,10 +2396,20 @@ QSize QS60Style::sizeFromContents(ContentsType ct, const QStyleOption *opt, case CT_PushButton: sz = QCommonStyle::sizeFromContents( ct, opt, csz, widget); //FIXME properly - style should calculate the location of border frame-part - sz += QSize(2 * pixelMetric(PM_ButtonMargin), 2 * pixelMetric(PM_ButtonMargin)); - if (const QAbstractButton *buttonWidget = (qobject_cast<const QAbstractButton *>(widget))) + if (const QAbstractButton *buttonWidget = (qobject_cast<const QAbstractButton *>(widget))) { if (buttonWidget->isCheckable()) sz += QSize(pixelMetric(PM_IndicatorWidth) + pixelMetric(PM_CheckBoxLabelSpacing), 0); + const int iconHeight = (!buttonWidget->icon().isNull()) ? buttonWidget->iconSize().height() : 0; + const int textHeight = (buttonWidget->text().length() > 0) ? + buttonWidget->fontMetrics().size(Qt::TextSingleLine, buttonWidget->text()).height() : 0; + const int decoratorHeight = (buttonWidget->isCheckable()) ? pixelMetric(PM_IndicatorHeight) : 0; + + const int contentHeight = + qMax(qMax(iconHeight, decoratorHeight) + pixelMetric(PM_ButtonMargin), + textHeight + 2*pixelMetric(PM_ButtonMargin)); + sz.setHeight(contentHeight); + sz += QSize(2 * pixelMetric(PM_ButtonMargin), 0); + } break; case CT_LineEdit: if (const QStyleOptionFrame *f = qstyleoption_cast<const QStyleOptionFrame *>(opt)) @@ -2481,6 +2512,9 @@ int QS60Style::styleHint(StyleHint sh, const QStyleOption *opt, const QWidget *w case SH_FormLayoutWrapPolicy: retValue = QFormLayout::WrapLongRows; break; + case SH_ScrollBar_ContextMenu: + retValue = false; + break; default: retValue = QCommonStyle::styleHint(sh, opt, widget, hret); break; @@ -2559,11 +2593,11 @@ QRect QS60Style::subControlRect(ComplexControl control, const QStyleOptionComple if (const QStyleOptionSpinBox *spinbox = qstyleoption_cast<const QStyleOptionSpinBox *>(option)) { const int frameThickness = spinbox->frame ? pixelMetric(PM_SpinBoxFrameWidth, spinbox, widget) : 0; const int buttonMargin = spinbox->frame ? 2 : 0; - const int buttonWidth = QS60StylePrivate::pixelMetric(PM_ButtonIconSize) + 2 * buttonMargin; + const int buttonContentWidth = QS60StylePrivate::pixelMetric(PM_ButtonIconSize) + 2 * buttonMargin; QSize buttonSize; buttonSize.setHeight(qMax(8, spinbox->rect.height() - frameThickness)); //width should at least be equal to height - buttonSize.setWidth(qMax(buttonSize.height(), buttonWidth)); + buttonSize.setWidth(qMax(buttonSize.height(), buttonContentWidth)); buttonSize = buttonSize.expandedTo(QApplication::globalStrut()); const int y = frameThickness + spinbox->rect.y(); diff --git a/src/gui/styles/qs60style_p.h b/src/gui/styles/qs60style_p.h index eae2291..16d82e7 100644 --- a/src/gui/styles/qs60style_p.h +++ b/src/gui/styles/qs60style_p.h @@ -131,6 +131,7 @@ public: SP_QgnGrafBarFrameSideL, SP_QgnGrafBarFrameSideR, SP_QgnGrafBarProgress, + SP_QgnGrafOrgBgGrid, SP_QgnGrafScrollArrowDown, SP_QgnGrafScrollArrowLeft, SP_QgnGrafScrollArrowRight, @@ -428,6 +429,7 @@ public: SE_ScrollBarHandlePressedVertical, SE_ButtonInactive, SE_Editor, + SE_DropArea }; enum SkinFrameElements { @@ -540,7 +542,7 @@ public: //Checks that the current brush is transparent or has BrushStyle NoBrush, //so that theme graphic background can be drawn. - static bool canDrawThemeBackground(const QBrush &backgroundBrush); + static bool canDrawThemeBackground(const QBrush &backgroundBrush, const QWidget *widget); static int currentAnimationFrame(QS60StyleEnums::SkinParts part); #ifdef Q_WS_S60 @@ -594,6 +596,7 @@ private: QPalette m_originalPalette; QPointer<QFocusFrame> m_focusFrame; + static qint64 m_webPaletteKey; #ifdef Q_WS_S60 //list of progress bars having animation running diff --git a/src/gui/styles/qs60style_s60.cpp b/src/gui/styles/qs60style_s60.cpp index 6d9ba05..cb49fbc 100644 --- a/src/gui/styles/qs60style_s60.cpp +++ b/src/gui/styles/qs60style_s60.cpp @@ -178,6 +178,8 @@ const partMapEntry QS60StyleModeSpecifics::m_partMap[] = { /* SP_QgnGrafBarFrameSideL */ {KAknsIIDQgnGrafBarFrameSideL, EDrawIcon, ES60_All, -1,-1}, /* SP_QgnGrafBarFrameSideR */ {KAknsIIDQgnGrafBarFrameSideR, EDrawIcon, ES60_All, -1,-1}, /* SP_QgnGrafBarProgress */ {KAknsIIDQgnGrafBarProgress, EDrawIcon, ES60_All, -1,-1}, + // No drop area for 3.x non-touch devices + /* SP_QgnGrafOrgBgGrid */ {KAknsIIDNone, EDrawIcon, ES60_3_X, EAknsMajorGeneric ,0x1eba}, //KAknsIIDQgnGrafOrgBgGrid /* SP_QgnGrafScrollArrowDown */ {KAknsIIDQgnGrafScrollArrowDown, EDrawGulIcon, ES60_All, -1,-1}, /* SP_QgnGrafScrollArrowLeft */ {KAknsIIDQgnGrafScrollArrowLeft, EDrawGulIcon, ES60_All, -1,-1}, /* SP_QgnGrafScrollArrowRight */ {KAknsIIDQgnGrafScrollArrowRight, EDrawGulIcon, ES60_All, -1,-1}, diff --git a/src/gui/styles/qs60style_simulated.cpp b/src/gui/styles/qs60style_simulated.cpp index f87cf28..3f09ebc 100644 --- a/src/gui/styles/qs60style_simulated.cpp +++ b/src/gui/styles/qs60style_simulated.cpp @@ -94,12 +94,12 @@ bool saveThemeToBlob(const QString &themeBlob, dataOut << color; } - const int picturesCount = partPictures.count(); - dataOut << picturesCount; - foreach (const QString &key, partPictures.keys()) { - const QPicture picture = partPictures.value(key); - dataOut << key; - dataOut << picture; + dataOut << partPictures.count(); + QHashIterator<QString, QPicture> i(partPictures); + while (i.hasNext()) { + i.next(); + dataOut << i.key(); + dataOut << i.value(); // the QPicture } QDataStream blobOut(&blob); diff --git a/src/gui/styles/qstylesheetstyle.cpp b/src/gui/styles/qstylesheetstyle.cpp index 9002172..1f9fc32 100644 --- a/src/gui/styles/qstylesheetstyle.cpp +++ b/src/gui/styles/qstylesheetstyle.cpp @@ -1125,6 +1125,7 @@ void QRenderRule::fixupBorder(int nativeWidth) void QRenderRule::drawBorderImage(QPainter *p, const QRect& rect) { + setClip(p, rect); static const Qt::TileRule tileMode2TileRule[] = { Qt::StretchTile, Qt::RoundTile, Qt::StretchTile, Qt::RepeatTile, Qt::StretchTile }; @@ -1142,6 +1143,7 @@ void QRenderRule::drawBorderImage(QPainter *p, const QRect& rect) QRect(QPoint(), borderImageData->pixmap.size()), sourceMargins, QTileRules(tileMode2TileRule[borderImageData->horizStretch], tileMode2TileRule[borderImageData->vertStretch])); p->setRenderHint(QPainter::SmoothPixmapTransform, wasSmoothPixmapTransform); + unsetClip(p); } QRect QRenderRule::originRect(const QRect &rect, Origin origin) const diff --git a/src/gui/text/qfont.cpp b/src/gui/text/qfont.cpp index bbd35f1..dd9e69e 100644 --- a/src/gui/text/qfont.cpp +++ b/src/gui/text/qfont.cpp @@ -629,8 +629,9 @@ QFontEngineData::~QFontEngineData() Returns the name of the font within the underlying window system. - Only on X11 when Qt was built without FontConfig support the XLFD (X Logical Font Description) - is returned; otherwise an empty string. + On X11, this function will return an empty string if Qt is built with + FontConfig support; otherwise the XLFD (X Logical Font Description) is + returned. Using the return value of this function is usually \e not \e portable. diff --git a/src/gui/text/qfontdatabase_s60.cpp b/src/gui/text/qfontdatabase_s60.cpp index 3ae6fe9..87a73df 100644 --- a/src/gui/text/qfontdatabase_s60.cpp +++ b/src/gui/text/qfontdatabase_s60.cpp @@ -246,8 +246,8 @@ static void initializeDb() QSymbianFbsHeapLock lock(QSymbianFbsHeapLock::Unlock); const int numTypeFaces = QS60Data::screenDevice()->NumTypefaces(); - const QFontDatabaseS60StoreImplementation *store = dynamic_cast<const QFontDatabaseS60StoreImplementation*>(db->s60Store); - Q_ASSERT(store); + const QFontDatabaseS60StoreImplementation *store = + static_cast<const QFontDatabaseS60StoreImplementation*>(db->s60Store); bool fontAdded = false; for (int i = 0; i < numTypeFaces; i++) { TTypefaceSupport typefaceSupport; @@ -258,8 +258,7 @@ static void initializeDb() continue; if (font->TypeUid() == KCFbsFontUid) { TOpenFontFaceAttrib faceAttrib; - const CFbsFont *cfbsFont = dynamic_cast<const CFbsFont *>(font); - Q_ASSERT(cfbsFont); + const CFbsFont *cfbsFont = static_cast<const CFbsFont *>(font); cfbsFont->GetFaceAttrib(faceAttrib); QtFontStyle::Key styleKey; @@ -390,8 +389,8 @@ QFontEngine *QFontDatabase::findFont(int script, const QFontPrivate *, const QFo QFontDef request = req; request.family = fontFamily; #if defined(QT_NO_FREETYPE) - const QFontDatabaseS60StoreImplementation *store = dynamic_cast<const QFontDatabaseS60StoreImplementation*>(db->s60Store); - Q_ASSERT(store); + const QFontDatabaseS60StoreImplementation *store = + static_cast<const QFontDatabaseS60StoreImplementation*>(db->s60Store); const QFontEngineS60Extensions *extension = store->extension(fontFamily); fe = new QFontEngineS60(request, extension); #else diff --git a/src/gui/text/qfontdatabase_win.cpp b/src/gui/text/qfontdatabase_win.cpp index b30a6c3..c50d363 100644 --- a/src/gui/text/qfontdatabase_win.cpp +++ b/src/gui/text/qfontdatabase_win.cpp @@ -336,8 +336,18 @@ void addFontToDatabase(QString familyName, const QString &scriptName, signature->fsCsb[0], signature->fsCsb[1] }; QList<QFontDatabase::WritingSystem> systems = determineWritingSystemsFromTrueTypeBits(unicodeRange, codePageRange); - for (int i = 0; i < systems.count(); ++i) - family->writingSystems[systems.at(i)] = QtFontFamily::Supported; + + for (int i = 0; i < systems.count(); ++i) { + QFontDatabase::WritingSystem writingSystem = systems.at(i); + + // ### Hack to work around problem with Thai text on Windows 7. Segoe UI contains + // the symbol for Baht, and Windows thus reports that it supports the Thai script. + // Since it's the default UI font on this platform, most widgets will be unable to + // display Thai text by default. As a temporary work around, we special case Segoe UI + // and remove the Thai script from its list of supported writing systems. + if (writingSystem != QFontDatabase::Thai || familyName != QLatin1String("Segoe UI")) + family->writingSystems[writingSystem] = QtFontFamily::Supported; + } } else if (!family->writingSystemCheck) { //qDebug("family='%s' script=%s", family->name.latin1(), script.latin1()); if (scriptName == QLatin1String("Western") diff --git a/src/gui/text/qfontengine_s60.cpp b/src/gui/text/qfontengine_s60.cpp index 9dd4af7..3ea084b 100644 --- a/src/gui/text/qfontengine_s60.cpp +++ b/src/gui/text/qfontengine_s60.cpp @@ -44,7 +44,7 @@ #include "qglobal.h" #include <private/qapplication_p.h> #include "qimage.h" -#include "qt_s60_p.h" +#include <private/qt_s60_p.h> #include <e32base.h> #include <e32std.h> diff --git a/src/gui/text/qstatictext.cpp b/src/gui/text/qstatictext.cpp new file mode 100644 index 0000000..a7138b9 --- /dev/null +++ b/src/gui/text/qstatictext.cpp @@ -0,0 +1,616 @@ +/**************************************************************************** +** +** Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies). +** All rights reserved. +** Contact: Nokia Corporation (qt-info@nokia.com) +** +** This file is part of the test suite of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the Technology Preview License Agreement accompanying +** this package. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain additional +** rights. These rights are described in the Nokia Qt LGPL Exception +** version 1.1, included in the file LGPL_EXCEPTION.txt in this package. +** +** If you have questions regarding the use of this file, please contact +** Nokia at qt-info@nokia.com. +** +** +** +** +** +** +** +** +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#include "qstatictext.h" +#include "qstatictext_p.h" +#include <private/qtextengine_p.h> +#include <private/qfontengine_p.h> + +#include <QtGui/qapplication.h> + +QT_BEGIN_NAMESPACE + +/*! + \class QStaticText + \brief The QStaticText class enables optimized drawing of text when the text and its layout + is updated rarely. + \since 4.7 + + \ingroup multimedia + \ingroup text + \mainclass + + QStaticText provides a way to cache layout data for a block of text so that it can be drawn + more efficiently than by using QPainter::drawText() in which the layout information is + recalculated with every call. + + The class primarily provides an optimization for cases where the text, its font and the + transformations on the painter are static over several paint events. If the text or its layout + is changed for every iteration, QPainter::drawText() is the more efficient alternative, since + the static text's layout would have to be recalculated to take the new state into consideration. + + Translating the painter will not cause the layout of the text to be recalculated, but will cause + a very small performance impact on drawStaticText(). Altering any other parts of the painter's + transformation or the painter's font will cause the layout of the static text to be + recalculated. This should be avoided as often as possible to maximize the performance + benefit of using QStaticText. + + In addition, only affine transformations are supported by drawStaticText(). Calling + drawStaticText() on a projected painter will perform slightly worse than using the regular + drawText() call, so this should be avoided. + + \code + class MyWidget: public QWidget + { + public: + MyWidget(QWidget *parent = 0) : QWidget(parent), m_staticText("This is static text") + + protected: + void paintEvent(QPaintEvent *) + { + QPainter painter(this); + painter.drawStaticText(0, 0, m_staticText); + } + + private: + QStaticText m_staticText; + }; + \endcode + + The QStaticText class can be used to mimic the behavior of QPainter::drawText() to a specific + point with no boundaries, and also when QPainter::drawText() is called with a bounding + rectangle. + + If a bounding rectangle is not required, create a QStaticText object without setting a maximum + size. The text will then occupy a single line. + + If you set a maximum size on the QStaticText object, this will bound the text. The text will + be formatted so that no line exceeds the given width. When the object is painted, it will + be clipped at the given size. The position of the text is decided by the argument + passed to QPainter::drawStaticText() and can change from call to call with a minimal impact + on performance. + + QStaticText will attempt to guess the format of the input text using Qt::mightBeRichText(). + To force QStaticText to display its contents as either plain text or rich text, use the + function QStaticText::setTextFormat() and pass in, respectively, Qt::PlainText and + Qt::RichText. + + \sa QPainter::drawText(), QPainter::drawStaticText(), QTextLayout, QTextDocument +*/ + +/*! + \enum QStaticText::PerformanceHint + + This enum the different performance hints that can be set on the QStaticText. These hints + can be used to indicate that the QStaticText should use additional caches, if possible, + to improve performance at the expense of memory. In particular, setting the performance hint + AggressiveCaching on the QStaticText will improve performance when using the OpenGL graphics + system or when drawing to a QGLWidget. + + \value ModerateCaching Do basic caching for high performance at a low memory cost. + \value AggressiveCaching Use additional caching when available. This may improve performance + at a higher memory cost. +*/ + +/*! + Constructs an empty QStaticText +*/ +QStaticText::QStaticText() + : data(new QStaticTextPrivate) +{ +} + +/*! + Constructs a QStaticText object with the given \a text and bounded by the given \a size. + + If an invalid size is passed for \a size the text will be unbounded. +*/ +QStaticText::QStaticText(const QString &text, const QSizeF &size) + : data(new QStaticTextPrivate) +{ + data->text = text; + data->maximumSize = size; + data->init(); +} + +/*! + Constructs a QStaticText object which is a copy of \a other. +*/ +QStaticText::QStaticText(const QStaticText &other) +{ + data = other.data; +} + +/*! + Destroys the QStaticText. +*/ +QStaticText::~QStaticText() +{ + Q_ASSERT(!data || data->ref >= 1); +} + +/*! + \internal +*/ +void QStaticText::detach() +{ + if (data->ref != 1) + data.detach(); +} + +/*! + Prepares the QStaticText object for being painted with the given \a matrix and the given + \a font to avoid overhead when the actual drawStaticText() call is made. + + When drawStaticText() is called, the layout of the QStaticText will be recalculated if the + painter's font or matrix is different from the one used for the currently cached layout. By + default, QStaticText will use a default constructed QFont and an identity matrix to create + its layout. + + To avoid the overhead of creating the layout the first time you draw the QStaticText with + a painter whose matrix or font are different from the defaults, you can use the prepare() + function and pass in the matrix and font you expect to use when drawing the text. + + \sa QPainter::setFont(), QPainter::setMatrix() +*/ +void QStaticText::prepare(const QTransform &matrix, const QFont &font) +{ + data->matrix = matrix; + data->font = font; + data->init(); +} + + +/*! + Assigns \a other to this QStaticText. +*/ +QStaticText &QStaticText::operator=(const QStaticText &other) +{ + data = other.data; + return *this; +} + +/*! + Compares \a other to this QStaticText. Returns true if the texts, fonts and maximum sizes + are equal. +*/ +bool QStaticText::operator==(const QStaticText &other) const +{ + return (data == other.data + || (data->text == other.data->text + && data->font == other.data->font + && data->maximumSize == other.data->maximumSize)); +} + +/*! + Compares \a other to this QStaticText. Returns true if the texts, fonts or maximum sizes + are different. +*/ +bool QStaticText::operator!=(const QStaticText &other) const +{ + return !(*this == other); +} + +/*! + Sets the text of the QStaticText to \a text. + + \note This function will cause the layout of the text to be recalculated. + + \sa text() +*/ +void QStaticText::setText(const QString &text) +{ + detach(); + data->text = text; + data->init(); +} + +/*! + Sets the text format of the QStaticText to \a textFormat. If \a textFormat is set to + Qt::AutoText (the default), the format of the text will try to be determined using the + function Qt::mightBeRichText(). If the text format is Qt::PlainText, then the text will be + displayed as is, whereas it will be interpreted as HTML if the format is Qt::RichText. HTML tags + that alter the font of the text, its color, or its layout are supported by QStaticText. + + \note This function will cause the layout of the text to be recalculated. + + \sa textFormat(), setText(), text() +*/ +void QStaticText::setTextFormat(Qt::TextFormat textFormat) +{ + detach(); + data->textFormat = textFormat; + data->init(); +} + +/*! + Returns the text format of the QStaticText. + + \sa setTextFormat(), setText(), text() +*/ +Qt::TextFormat QStaticText::textFormat() const +{ + return Qt::TextFormat(data->textFormat); +} + +/*! + Returns the text of the QStaticText. + + \sa setText() +*/ +QString QStaticText::text() const +{ + return data->text; +} + +/*! + Sets the performance hint of the QStaticText. This hint can be used to customize how much + caching is done internally to improve performance. + + The default is QStaticText::ModerateCaching. + + \note This function will cause the layout of the text to be recalculated. + + \sa performanceHint() +*/ +void QStaticText::setPerformanceHint(PerformanceHint performanceHint) +{ + if ((performanceHint == ModerateCaching && !data->useBackendOptimizations) + || (performanceHint == AggressiveCaching && data->useBackendOptimizations)) { + return; + } + detach(); + data->useBackendOptimizations = (performanceHint == AggressiveCaching); + data->init(); +} + +/*! + Returns which performance hint is set for the QStaticText. + + \sa setPerformanceHint() +*/ +QStaticText::PerformanceHint QStaticText::performanceHint() const +{ + return data->useBackendOptimizations ? AggressiveCaching : ModerateCaching; +} + +/*! + Sets the maximum size of the QStaticText to \a size. + + \note This function will cause the layout of the text to be recalculated. + + \sa maximumSize(), size() +*/ +void QStaticText::setMaximumSize(const QSizeF &size) +{ + detach(); + data->maximumSize = size; + data->init(); +} + +/*! + Returns the maximum size of the QStaticText. + + \sa setMaximumSize() +*/ +QSizeF QStaticText::maximumSize() const +{ + return data->maximumSize; +} + +/*! + Returns the size of the bounding rect for this QStaticText. + + \sa maximumSize() +*/ +QSizeF QStaticText::size() const +{ + return data->actualSize; +} + +QStaticTextPrivate::QStaticTextPrivate() + : items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false), + useBackendOptimizations(false), textFormat(Qt::AutoText) +{ + ref = 1; +} + +QStaticTextPrivate::QStaticTextPrivate(const QStaticTextPrivate &other) + : text(other.text), font(other.font), maximumSize(other.maximumSize), matrix(other.matrix), + items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false), + useBackendOptimizations(false), textFormat(other.textFormat) +{ + ref = 1; +} + +QStaticTextPrivate::~QStaticTextPrivate() +{ + delete[] items; + delete[] glyphPool; + delete[] positionPool; +} + +QStaticTextPrivate *QStaticTextPrivate::get(const QStaticText *q) +{ + return q->data.data(); +} + +extern int qt_defaultDpiX(); +extern int qt_defaultDpiY(); + +namespace { + + class DrawTextItemRecorder: public QPaintEngine + { + public: + DrawTextItemRecorder(int expectedItemCount, QStaticTextItem *items, + int expectedGlyphCount, QFixedPoint *positionPool, glyph_t *glyphPool) + : m_items(items), + m_itemCount(0), m_glyphCount(0), + m_expectedItemCount(expectedItemCount), + m_expectedGlyphCount(expectedGlyphCount), + m_glyphPool(glyphPool), + m_positionPool(positionPool) + { + } + + virtual void drawTextItem(const QPointF &position, const QTextItem &textItem) + { + const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem); + + m_itemCount++; + m_glyphCount += ti.glyphs.numGlyphs; + if (m_items == 0) + return; + + Q_ASSERT(m_itemCount <= m_expectedItemCount); + Q_ASSERT(m_glyphCount <= m_expectedGlyphCount); + + QStaticTextItem *currentItem = (m_items + (m_itemCount - 1)); + currentItem->fontEngine = ti.fontEngine; + currentItem->font = ti.font(); + currentItem->chars = ti.chars; + currentItem->numChars = ti.num_chars; + currentItem->numGlyphs = ti.glyphs.numGlyphs; + currentItem->glyphs = m_glyphPool; + currentItem->glyphPositions = m_positionPool; + currentItem->color = state->pen().color(); + + QTransform matrix = state->transform(); + matrix.translate(position.x(), position.y()); + + QVarLengthArray<glyph_t> glyphs; + QVarLengthArray<QFixedPoint> positions; + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + int size = glyphs.size(); + Q_ASSERT(size == ti.glyphs.numGlyphs); + Q_ASSERT(size == positions.size()); + + memmove(currentItem->glyphs, glyphs.constData(), sizeof(glyph_t) * size); + memmove(currentItem->glyphPositions, positions.constData(), sizeof(QFixedPoint) * size); + + m_glyphPool += size; + m_positionPool += size; + } + + + virtual bool begin(QPaintDevice *) { return true; } + virtual bool end() { return true; } + virtual void updateState(const QPaintEngineState &) {} + virtual void drawPixmap(const QRectF &, const QPixmap &, const QRectF &) {} + virtual Type type() const + { + return User; + } + + int itemCount() const + { + return m_itemCount; + } + + int glyphCount() const + { + return m_glyphCount; + } + + private: + QStaticTextItem *m_items; + int m_itemCount; + int m_glyphCount; + int m_expectedItemCount; + int m_expectedGlyphCount; + + glyph_t *m_glyphPool; + QFixedPoint *m_positionPool; + }; + + class DrawTextItemDevice: public QPaintDevice + { + public: + DrawTextItemDevice(int expectedItemCount = -1, QStaticTextItem *items = 0, + int expectedGlyphCount = -1, QFixedPoint *positionPool = 0, + glyph_t *glyphPool = 0) + { + m_paintEngine = new DrawTextItemRecorder(expectedItemCount, items, + expectedGlyphCount, positionPool, glyphPool); + } + + ~DrawTextItemDevice() + { + delete m_paintEngine; + } + + int metric(PaintDeviceMetric m) const + { + int val; + switch (m) { + case PdmWidth: + case PdmHeight: + case PdmWidthMM: + case PdmHeightMM: + val = 0; + break; + case PdmDpiX: + case PdmPhysicalDpiX: + val = qt_defaultDpiX(); + break; + case PdmDpiY: + case PdmPhysicalDpiY: + val = qt_defaultDpiY(); + break; + case PdmNumColors: + val = 16777216; + break; + case PdmDepth: + val = 24; + break; + default: + val = 0; + qWarning("DrawTextItemDevice::metric: Invalid metric command"); + } + return val; + } + + virtual QPaintEngine *paintEngine() const + { + return m_paintEngine; + } + + int itemCount() const + { + return m_paintEngine->itemCount(); + } + + int glyphCount() const + { + return m_paintEngine->glyphCount(); + } + + private: + DrawTextItemRecorder *m_paintEngine; + }; +} + +void QStaticTextPrivate::paintText(const QPointF &pos, QPainter *p) +{ + bool preferRichText = textFormat == Qt::RichText + || (textFormat == Qt::AutoText && Qt::mightBeRichText(text)); + + if (!preferRichText) { + if (maximumSize.isValid()) { + QRectF boundingRect; + p->drawText(QRectF(pos, maximumSize), Qt::TextWordWrap, text, &boundingRect); + + actualSize = boundingRect.size(); + needsClipRect = boundingRect.width() > maximumSize.width() + || boundingRect.height() > maximumSize.height(); + } else { + p->drawText(pos, text); + needsClipRect = false; + + QFontMetrics fm(font); + actualSize = fm.boundingRect(text).size(); + } + } else { + QTextDocument document; + document.setDefaultFont(font); + document.setHtml(text); + + QRectF rect = maximumSize.isValid() ? QRectF(pos, maximumSize) : QRectF(); + document.adjustSize(); + p->save(); + p->translate(pos); + document.drawContents(p, rect); + p->restore(); + actualSize = document.size(); + needsClipRect = maximumSize.isValid() + && (actualSize.width() > maximumSize.width() + || actualSize.height() > maximumSize.height()); + } +} + +void QStaticTextPrivate::init() +{ + delete[] items; + delete[] glyphPool; + delete[] positionPool; + + position = QPointF(0, 0); + + // Draw once to count number of items and glyphs, so that we can use as little memory + // as possible to store the data + DrawTextItemDevice counterDevice; + { + QPainter painter(&counterDevice); + painter.setFont(font); + painter.setTransform(matrix); + + paintText(QPointF(0, 0), &painter); + + } + + itemCount = counterDevice.itemCount(); + items = new QStaticTextItem[itemCount]; + + if (useBackendOptimizations) { + for (int i=0; i<itemCount; ++i) + items[i].useBackendOptimizations = true; + } + + + int glyphCount = counterDevice.glyphCount(); + glyphPool = new glyph_t[glyphCount]; + positionPool = new QFixedPoint[glyphCount]; + + // Draw again to actually record the items and glyphs + DrawTextItemDevice recorderDevice(itemCount, items, glyphCount, positionPool, glyphPool); + { + QPainter painter(&recorderDevice); + painter.setFont(font); + painter.setTransform(matrix); + + paintText(QPointF(0, 0), &painter); + } + +} + +QT_END_NAMESPACE diff --git a/src/gui/text/qstatictext.h b/src/gui/text/qstatictext.h new file mode 100644 index 0000000..00d42e0 --- /dev/null +++ b/src/gui/text/qstatictext.h @@ -0,0 +1,106 @@ +/**************************************************************************** +** +** Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies). +** All rights reserved. +** Contact: Nokia Corporation (qt-info@nokia.com) +** +** This file is part of the test suite of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the Technology Preview License Agreement accompanying +** this package. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain additional +** rights. These rights are described in the Nokia Qt LGPL Exception +** version 1.1, included in the file LGPL_EXCEPTION.txt in this package. +** +** If you have questions regarding the use of this file, please contact +** Nokia at qt-info@nokia.com. +** +** +** +** +** +** +** +** +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#ifndef QSTATICTEXT_H +#define QSTATICTEXT_H + +#include <QtCore/qsize.h> +#include <QtCore/qstring.h> +#include <QtCore/qmetatype.h> + +#include <QtGui/qtransform.h> +#include <QtGui/qfont.h> + + +QT_BEGIN_HEADER + +QT_BEGIN_NAMESPACE + +QT_MODULE(Gui) + +class QStaticTextPrivate; +class Q_GUI_EXPORT QStaticText +{ +public: + enum PerformanceHint { + ModerateCaching, + AggressiveCaching + }; + + QStaticText(); + QStaticText(const QString &text, const QSizeF &maximumSize = QSizeF()); + QStaticText(const QStaticText &other); + ~QStaticText(); + + void setText(const QString &text); + QString text() const; + + void setTextFormat(Qt::TextFormat textFormat); + Qt::TextFormat textFormat() const; + + void setMaximumSize(const QSizeF &maximumSize); + QSizeF maximumSize() const; + + QSizeF size() const; + + void prepare(const QTransform &matrix, const QFont &font); + + void setPerformanceHint(PerformanceHint performanceHint); + PerformanceHint performanceHint() const; + + QStaticText &operator=(const QStaticText &); + bool operator==(const QStaticText &) const; + bool operator!=(const QStaticText &) const; + +private: + void detach(); + + QExplicitlySharedDataPointer<QStaticTextPrivate> data; + friend class QStaticTextPrivate; +}; + +QT_END_NAMESPACE + +Q_DECLARE_METATYPE(QStaticText) + +QT_END_HEADER + +#endif // QSTATICTEXT_H diff --git a/src/gui/text/qstatictext_p.h b/src/gui/text/qstatictext_p.h new file mode 100644 index 0000000..e758244 --- /dev/null +++ b/src/gui/text/qstatictext_p.h @@ -0,0 +1,146 @@ +/**************************************************************************** +** +** Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies). +** All rights reserved. +** Contact: Nokia Corporation (qt-info@nokia.com) +** +** This file is part of the test suite of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the Technology Preview License Agreement accompanying +** this package. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain additional +** rights. These rights are described in the Nokia Qt LGPL Exception +** version 1.1, included in the file LGPL_EXCEPTION.txt in this package. +** +** If you have questions regarding the use of this file, please contact +** Nokia at qt-info@nokia.com. +** +** +** +** +** +** +** +** +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#ifndef QSTATICTEXT_P_H +#define QSTATICTEXT_P_H + +// +// W A R N I N G +// ------------- +// +// This file is not part of the Qt API. It exists for the convenience +// of internal files. This header file may change from version to version +// without notice, or even be removed. +// +// We mean it. +// + +#include <private/qtextureglyphcache_p.h> +#include <QtGui/qcolor.h> + +QT_BEGIN_NAMESPACE + +class QStaticTextUserData +{ +public: + enum Type { + NoUserData, + OpenGLUserData + }; + + QStaticTextUserData(Type t) : type(t) {} + virtual ~QStaticTextUserData() {} + + Type type; +}; + +class Q_GUI_EXPORT QStaticTextItem +{ +public: + QStaticTextItem() : chars(0), numChars(0), fontEngine(0), userData(0), + useBackendOptimizations(false), userDataNeedsUpdate(0) {} + ~QStaticTextItem() { delete userData; } + + void setUserData(QStaticTextUserData *newUserData) + { + if (userData == newUserData) + return; + + delete userData; + userData = newUserData; + } + + QFixedPoint *glyphPositions; // 8 bytes per glyph + glyph_t *glyphs; // 4 bytes per glyph + const QChar *chars; // 2 bytes per glyph + // ================= + // 14 bytes per glyph + + // 12 bytes for pointers + int numGlyphs; // 4 bytes per item + int numChars; // 4 bytes per item + QFontEngine *fontEngine; // 4 bytes per item + QFont font; // 8 bytes per item + QColor color; // 10 bytes per item + QStaticTextUserData *userData; // 8 bytes per item + char useBackendOptimizations : 1; // 1 byte per item + char userDataNeedsUpdate : 1; // + // ================ + // 51 bytes per item +}; + +class QStaticText; +class Q_AUTOTEST_EXPORT QStaticTextPrivate +{ +public: + QStaticTextPrivate(); + QStaticTextPrivate(const QStaticTextPrivate &other); + ~QStaticTextPrivate(); + + void init(); + void paintText(const QPointF &pos, QPainter *p); + + QAtomicInt ref; // 4 bytes per text + + QString text; // 4 bytes per text + QFont font; // 8 bytes per text + QSizeF maximumSize; // 16 bytes per text + QSizeF actualSize; // 16 bytes per text + QPointF position; // 16 bytes per text + + QTransform matrix; // 80 bytes per text + QStaticTextItem *items; // 4 bytes per text + int itemCount; // 4 bytes per text + glyph_t *glyphPool; // 4 bytes per text + QFixedPoint *positionPool; // 4 bytes per text + + unsigned char needsClipRect : 1; // 1 byte per text + unsigned char useBackendOptimizations : 1; + unsigned char textFormat : 2; + // ================ + // 171 bytes per text + + static QStaticTextPrivate *get(const QStaticText *q); +}; + +QT_END_NAMESPACE + +#endif // QSTATICTEXT_P_H diff --git a/src/gui/text/qtextcontrol.cpp b/src/gui/text/qtextcontrol.cpp index aaaa3ca..f345cd1 100644 --- a/src/gui/text/qtextcontrol.cpp +++ b/src/gui/text/qtextcontrol.cpp @@ -441,7 +441,6 @@ void QTextControlPrivate::setContent(Qt::TextFormat format, const QString &text, QObject::connect(doc, SIGNAL(documentLayoutChanged()), q, SLOT(_q_documentLayoutChanged())); // convenience signal forwards - QObject::connect(doc, SIGNAL(contentsChanged()), q, SIGNAL(textChanged())); QObject::connect(doc, SIGNAL(undoAvailable(bool)), q, SIGNAL(undoAvailable(bool))); QObject::connect(doc, SIGNAL(redoAvailable(bool)), q, SIGNAL(redoAvailable(bool))); QObject::connect(doc, SIGNAL(modificationChanged(bool)), q, SIGNAL(modificationChanged(bool))); @@ -452,8 +451,11 @@ void QTextControlPrivate::setContent(Qt::TextFormat format, const QString &text, if (!document) doc->setUndoRedoEnabled(false); + //Saving the index save some time. + static int contentsChangedIndex = QTextDocument::staticMetaObject.indexOfSignal("contentsChanged()"); + static int textChangedIndex = QTextControl::staticMetaObject.indexOfSignal("textChanged()"); // avoid multiple textChanged() signals being emitted - QObject::disconnect(doc, SIGNAL(contentsChanged()), q, SIGNAL(textChanged())); + QMetaObject::disconnect(doc, contentsChangedIndex, q, textChangedIndex); if (!text.isEmpty()) { // clear 'our' cursor for insertion to prevent @@ -488,7 +490,7 @@ void QTextControlPrivate::setContent(Qt::TextFormat format, const QString &text, } cursor.setCharFormat(charFormatForInsertion); - QObject::connect(doc, SIGNAL(contentsChanged()), q, SIGNAL(textChanged())); + QMetaObject::connect(doc, contentsChangedIndex, q, textChangedIndex); emit q->textChanged(); if (!document) doc->setUndoRedoEnabled(previousUndoRedoState); @@ -1762,8 +1764,8 @@ void QTextControlPrivate::contextMenuEvent(const QPoint &screenPos, const QPoint QMenu *menu = q->createStandardContextMenu(docPos, contextWidget); if (!menu) return; - menu->exec(screenPos); - delete menu; + menu->setAttribute(Qt::WA_DeleteOnClose); + menu->popup(screenPos); #endif } diff --git a/src/gui/text/qtextcursor.cpp b/src/gui/text/qtextcursor.cpp index c81d538..c91df3c 100644 --- a/src/gui/text/qtextcursor.cpp +++ b/src/gui/text/qtextcursor.cpp @@ -1145,7 +1145,7 @@ void QTextCursor::setPosition(int pos, MoveMode m) Returns the absolute position of the cursor within the document. The cursor is positioned between characters. - \sa setPosition() movePosition() anchor() + \sa setPosition() movePosition() anchor() positionInBlock() */ int QTextCursor::position() const { @@ -1155,6 +1155,22 @@ int QTextCursor::position() const } /*! + \since 4.7 + Returns the relative position of the cursor within the block. + The cursor is positioned between characters. + + This is equivalent to \c{ position() - block().position()}. + + \sa position() +*/ +int QTextCursor::positionInBlock() const +{ + if (!d || !d->priv) + return 0; + return d->position - d->block().position(); +} + +/*! Returns the anchor position; this is the same as position() unless there is a selection in which case position() marks one end of the selection and anchor() marks the other end. Just like the cursor @@ -2414,9 +2430,17 @@ int QTextCursor::blockNumber() const return d->block().blockNumber(); } + /*! \since 4.2 Returns the position of the cursor within its containing line. + + Note that this is the column number relative to a wrapped line, + not relative to the block (i.e. the paragraph). + + You probably want to call positionInBlock() instead. + + \sa positionInBlock() */ int QTextCursor::columnNumber() const { diff --git a/src/gui/text/qtextcursor.h b/src/gui/text/qtextcursor.h index 38bc39d..3e968a3 100644 --- a/src/gui/text/qtextcursor.h +++ b/src/gui/text/qtextcursor.h @@ -89,6 +89,7 @@ public: void setPosition(int pos, MoveMode mode = MoveAnchor); int position() const; + int positionInBlock() const; int anchor() const; diff --git a/src/gui/text/qtextdocument.cpp b/src/gui/text/qtextdocument.cpp index b8c9b94..9a1b70c 100644 --- a/src/gui/text/qtextdocument.cpp +++ b/src/gui/text/qtextdocument.cpp @@ -435,6 +435,30 @@ void QTextDocument::redo(QTextCursor *cursor) } } +/*! \enum QTextDocument::Stacks + + \value UndoStack The undo stack. + \value RedoStack The redo stack. + \value UndoAndRedoStacks Both the undo and redo stacks. +*/ + +/*! + \since 4.7 + Clears the stacks specified by \a stacksToClear. + + This method clears any commands on the undo stack, the redo stack, + or both (the default). If commands are cleared, the appropriate + signals are emitted, QTextDocument::undoAvailable() or + QTextDocument::redoAvailable(). + + \sa QTextDocument::undoAvailable() QTextDocument::redoAvailable() +*/ +void QTextDocument::clearUndoRedoStacks(Stacks stacksToClear) +{ + Q_D(QTextDocument); + d->clearUndoRedoStacks(stacksToClear, true); +} + /*! \overload @@ -1750,9 +1774,9 @@ void QTextDocument::print(QPrinter *printer) const int pageCopies; if (printer->collateCopies() == true){ docCopies = 1; - pageCopies = printer->numCopies(); + pageCopies = printer->supportsMultipleCopies() ? 1 : printer->copyCount(); } else { - docCopies = printer->numCopies(); + docCopies = printer->supportsMultipleCopies() ? 1 : printer->copyCount(); pageCopies = 1; } diff --git a/src/gui/text/qtextdocument.h b/src/gui/text/qtextdocument.h index b5bcb41..0140772 100644 --- a/src/gui/text/qtextdocument.h +++ b/src/gui/text/qtextdocument.h @@ -256,6 +256,13 @@ public: void undo(QTextCursor *cursor); void redo(QTextCursor *cursor); + enum Stacks { + UndoStack = 0x01, + RedoStack = 0x02, + UndoAndRedoStacks = UndoStack | RedoStack + }; + void clearUndoRedoStacks(Stacks historyToClear = UndoAndRedoStacks); + int maximumBlockCount() const; void setMaximumBlockCount(int maximum); diff --git a/src/gui/text/qtextdocument_p.cpp b/src/gui/text/qtextdocument_p.cpp index 372b9dc..969d5b4 100644 --- a/src/gui/text/qtextdocument_p.cpp +++ b/src/gui/text/qtextdocument_p.cpp @@ -259,8 +259,7 @@ void QTextDocumentPrivate::clear() objects.clear(); title.clear(); - undoState = 0; - truncateUndoStack(); + clearUndoRedoStacks(QTextDocument::UndoAndRedoStacks); text = QString(); unreachableCharacterCount = 0; modifiedState = 0; @@ -292,7 +291,7 @@ QTextDocumentPrivate::~QTextDocumentPrivate() cursors.clear(); undoState = 0; undoEnabled = true; - truncateUndoStack(); + clearUndoRedoStacks(QTextDocument::RedoStack); } void QTextDocumentPrivate::setLayout(QAbstractTextDocumentLayout *layout) @@ -1027,7 +1026,7 @@ void QTextDocumentPrivate::appendUndoItem(const QTextUndoCommand &c) if (!undoEnabled) return; if (undoState < undoStack.size()) - truncateUndoStack(); + clearUndoRedoStacks(QTextDocument::RedoStack); if (!undoStack.isEmpty() && modified) { QTextUndoCommand &last = undoStack[undoState - 1]; @@ -1050,26 +1049,46 @@ void QTextDocumentPrivate::appendUndoItem(const QTextUndoCommand &c) emit document()->undoCommandAdded(); } -void QTextDocumentPrivate::truncateUndoStack() +void QTextDocumentPrivate::clearUndoRedoStacks(QTextDocument::Stacks stacksToClear, + bool emitSignals) { - if (undoState == undoStack.size()) - return; - - for (int i = undoState; i < undoStack.size(); ++i) { - QTextUndoCommand c = undoStack[i]; - if (c.command & QTextUndoCommand::Removed) { - // ######## -// QTextFragment *f = c.fragment_list; -// while (f) { -// QTextFragment *n = f->right; -// delete f; -// f = n; -// } - } else if (c.command & QTextUndoCommand::Custom) { - delete c.custom; + bool undoCommandsAvailable = undoState != 0; + bool redoCommandsAvailable = undoState != undoStack.size(); + if (stacksToClear == QTextDocument::UndoStack && undoCommandsAvailable) { + for (int i = 0; i < undoState; ++i) { + QTextUndoCommand c = undoStack[undoState]; + if (c.command & QTextUndoCommand::Custom) + delete c.custom; } + undoStack.remove(0, undoState); + undoStack.resize(undoStack.size() - undoState); + undoState = 0; + if (emitSignals) + emitUndoAvailable(false); + } else if (stacksToClear == QTextDocument::RedoStack + && redoCommandsAvailable) { + for (int i = undoState; i < undoStack.size(); ++i) { + QTextUndoCommand c = undoStack[i]; + if (c.command & QTextUndoCommand::Custom) + delete c.custom; + } + undoStack.resize(undoState); + if (emitSignals) + emitRedoAvailable(false); + } else if (stacksToClear == QTextDocument::UndoAndRedoStacks + && !undoStack.isEmpty()) { + for (int i = 0; i < undoStack.size(); ++i) { + QTextUndoCommand c = undoStack[i]; + if (c.command & QTextUndoCommand::Custom) + delete c.custom; + } + undoState = 0; + undoStack.resize(0); + if (emitSignals && undoCommandsAvailable) + emitUndoAvailable(false); + if (emitSignals && redoCommandsAvailable) + emitRedoAvailable(false); } - undoStack.resize(undoState); } void QTextDocumentPrivate::emitUndoAvailable(bool available) @@ -1097,7 +1116,7 @@ void QTextDocumentPrivate::enableUndoRedo(bool enable) if (!enable) { undoState = 0; - truncateUndoStack(); + clearUndoRedoStacks(QTextDocument::RedoStack); emitUndoAvailable(false); emitRedoAvailable(false); } diff --git a/src/gui/text/qtextdocument_p.h b/src/gui/text/qtextdocument_p.h index 4ecc2fa..ac5ed3c 100644 --- a/src/gui/text/qtextdocument_p.h +++ b/src/gui/text/qtextdocument_p.h @@ -252,10 +252,11 @@ public: inline QFont defaultFont() const { return formats.defaultFont(); } inline void setDefaultFont(const QFont &f) { formats.setDefaultFont(f); } + void clearUndoRedoStacks(QTextDocument::Stacks stacksToClear, bool emitSignals = false); + private: bool split(int pos); bool unite(uint f); - void truncateUndoStack(); void insert_string(int pos, uint strPos, uint length, int format, QTextUndoCommand::Operation op); int insert_block(int pos, uint strPos, int format, int blockformat, QTextUndoCommand::Operation op, int command); diff --git a/src/gui/text/qtextlayout.cpp b/src/gui/text/qtextlayout.cpp index 26c7c1e..af91603 100644 --- a/src/gui/text/qtextlayout.cpp +++ b/src/gui/text/qtextlayout.cpp @@ -1331,7 +1331,7 @@ void QTextLayout::drawCursor(QPainter *p, const QPointF &pos, int cursorPosition QTextLine l(line, d); const QScriptLine &sl = d->lines[line]; - const qreal x = position.x() + l.cursorToX(cursorPosition); + qreal x = position.x() + l.cursorToX(cursorPosition); int itm = d->findItem(cursorPosition - 1); QFixed base = sl.base(); @@ -1350,6 +1350,10 @@ void QTextLayout::drawCursor(QPainter *p, const QPointF &pos, int cursorPosition && (p->transform().type() > QTransform::TxTranslate); if (toggleAntialiasing) p->setRenderHint(QPainter::Antialiasing); +#if defined(QT_MAC_USE_COCOA) + // Always draw the cursor aligned to pixel boundary. + x = qRound(x); +#endif p->fillRect(QRectF(x, y, qreal(width), (base + descent + 1).toReal()), p->pen().brush()); if (toggleAntialiasing) p->setRenderHint(QPainter::Antialiasing, false); diff --git a/src/gui/text/qzip.cpp b/src/gui/text/qzip.cpp index 2fc1940..d30c996 100644 --- a/src/gui/text/qzip.cpp +++ b/src/gui/text/qzip.cpp @@ -54,10 +54,13 @@ #include <zlib.h> #if defined(Q_OS_WIN) -#undef S_IFREG -#define S_IFREG 0100000 +# undef S_IFREG +# define S_IFREG 0100000 +# ifndef S_IFDIR +# define S_IFDIR 0040000 +# endif # ifndef S_ISDIR -# define S_ISDIR(x) ((x) & 0040000) > 0 +# define S_ISDIR(x) ((x) & S_IFDIR) > 0 # endif # ifndef S_ISREG # define S_ISREG(x) ((x) & 0170000) == S_IFREG diff --git a/src/gui/text/qzipreader_p.h b/src/gui/text/qzipreader_p.h index 1086464..9b73373 100644 --- a/src/gui/text/qzipreader_p.h +++ b/src/gui/text/qzipreader_p.h @@ -49,7 +49,7 @@ // ------------- // // This file is not part of the Qt API. It exists for the convenience -// of the QLibrary class. This header file may change from +// of the QZipReader class. This header file may change from // version to version without notice, or even be removed. // // We mean it. @@ -62,7 +62,7 @@ QT_BEGIN_NAMESPACE class QZipReaderPrivate; -class Q_AUTOTEST_EXPORT QZipReader +class Q_GUI_EXPORT QZipReader { public: QZipReader(const QString &fileName, QIODevice::OpenMode mode = QIODevice::ReadOnly ); @@ -73,7 +73,7 @@ public: bool isReadable() const; bool exists() const; - struct Q_AUTOTEST_EXPORT FileInfo + struct Q_GUI_EXPORT FileInfo { FileInfo(); FileInfo(const FileInfo &other); diff --git a/src/gui/text/qzipwriter_p.h b/src/gui/text/qzipwriter_p.h index 7b97937..9322f4a 100644 --- a/src/gui/text/qzipwriter_p.h +++ b/src/gui/text/qzipwriter_p.h @@ -47,7 +47,7 @@ // ------------- // // This file is not part of the Qt API. It exists for the convenience -// of the QLibrary class. This header file may change from +// of the QZipWriter class. This header file may change from // version to version without notice, or even be removed. // // We mean it. diff --git a/src/gui/text/text.pri b/src/gui/text/text.pri index b7615a4..9ec3142 100644 --- a/src/gui/text/text.pri +++ b/src/gui/text/text.pri @@ -37,7 +37,9 @@ HEADERS += \ text/qtexttable_p.h \ text/qzipreader_p.h \ text/qzipwriter_p.h \ - text/qtextodfwriter_p.h + text/qtextodfwriter_p.h \ + text/qstatictext_p.h \ + text/qstatictext.h SOURCES += \ text/qfont.cpp \ @@ -66,7 +68,8 @@ SOURCES += \ text/qsyntaxhighlighter.cpp \ text/qcssparser.cpp \ text/qzip.cpp \ - text/qtextodfwriter.cpp + text/qtextodfwriter.cpp \ + text/qstatictext.cpp win32 { SOURCES += \ diff --git a/src/gui/util/qdesktopservices_s60.cpp b/src/gui/util/qdesktopservices_s60.cpp index 319c4b0..65b998f 100644 --- a/src/gui/util/qdesktopservices_s60.cpp +++ b/src/gui/util/qdesktopservices_s60.cpp @@ -48,7 +48,6 @@ #include <qurl.h> #include <private/qcore_symbian_p.h> -#include <miutset.h> // KUidMsgTypeSMTP #include <txtrich.h> // CRichText #include <f32file.h> // TDriveUnit etc #include <eikenv.h> // CEikonEnv @@ -57,6 +56,9 @@ #include <rsendas.h> // RSendAs #include <rsendasmessage.h> // RSendAsMessage +// copied from miutset.h, so we don't get a dependency into the app layer +const TUid KUidMsgTypeSMTP = {0x10001028}; // 268439592 + #ifdef Q_WS_S60 # include <pathinfo.h> // PathInfo # ifdef USE_DOCUMENTHANDLER @@ -413,11 +415,11 @@ QString QDesktopServices::storageLocation(StandardLocation type) //return QDir::homePath(); break; break; case DataLocation: - CEikonEnv::Static()->FsSession().PrivatePath(path); + qt_s60GetRFs().PrivatePath(path); path.Insert(0, writableExeDrive().Name()); break; case CacheLocation: - CEikonEnv::Static()->FsSession().PrivatePath(path); + qt_s60GetRFs().PrivatePath(path); path.Insert(0, writableExeDrive().Name()); path.Append(KCacheSubDir); break; diff --git a/src/gui/util/qsystemtrayicon_mac.mm b/src/gui/util/qsystemtrayicon_mac.mm index 0265a83..348657e 100644 --- a/src/gui/util/qsystemtrayicon_mac.mm +++ b/src/gui/util/qsystemtrayicon_mac.mm @@ -93,6 +93,7 @@ extern bool qt_mac_execute_apple_script(const QString &script, AEDesc *ret); //q extern void qtsystray_sendActivated(QSystemTrayIcon *i, int r); //qsystemtrayicon.cpp extern NSString *keySequenceToKeyEqivalent(const QKeySequence &accel); // qmenu_mac.mm extern NSUInteger keySequenceModifierMask(const QKeySequence &accel); // qmenu_mac.mm +extern Qt::MouseButton cocoaButton2QtButton(NSInteger buttonNum); QT_END_NAMESPACE QT_USE_NAMESPACE @@ -110,7 +111,7 @@ QT_USE_NAMESPACE -(QSystemTrayIcon*)icon; -(NSStatusItem*)item; -(QRectF)geometry; -- (void)triggerSelector:(id)sender; +- (void)triggerSelector:(id)sender button:(Qt::MouseButton)mouseButton; - (void)doubleClickSelector:(id)sender; @end @@ -121,7 +122,7 @@ QT_USE_NAMESPACE -(id)initWithParent:(QNSStatusItem*)myParent; -(QSystemTrayIcon*)icon; -(void)menuTrackingDone:(NSNotification*)notification; --(void)mousePressed:(NSEvent *)mouseEvent; +-(void)mousePressed:(NSEvent *)mouseEvent button:(Qt::MouseButton)mouseButton; @end @@ -333,12 +334,10 @@ QT_END_NAMESPACE [self setNeedsDisplay:YES]; } --(void)mousePressed:(NSEvent *)mouseEvent +-(void)mousePressed:(NSEvent *)mouseEvent button:(Qt::MouseButton)mouseButton { - int clickCount = [mouseEvent clickCount]; - down = !down; - if(!down && [self icon]->contextMenu()) - [self icon]->contextMenu()->hide(); + down = YES; + int clickCount = [mouseEvent clickCount]; [self setNeedsDisplay:YES]; #ifndef QT_MAC_USE_COCOA @@ -348,47 +347,52 @@ QT_END_NAMESPACE const short scale = hgt - 4; #endif - if( down && ![self icon]->icon().isNull() ) { + if (![self icon]->icon().isNull() ) { NSImage *nsaltimage = static_cast<NSImage *>(qt_mac_create_nsimage([self icon]->icon().pixmap(QSize(scale, scale), QIcon::Selected))); [self setImage: nsaltimage]; [nsaltimage release]; } - - if (down) - [parent triggerSelector:self]; - else if ((clickCount%2)) + if ((clickCount == 2)) { + [self menuTrackingDone:nil]; [parent doubleClickSelector:self]; - while (down) { - mouseEvent = [[self window] nextEventMatchingMask:NSLeftMouseDownMask | NSLeftMouseUpMask - | NSLeftMouseDraggedMask | NSRightMouseDownMask | NSRightMouseUpMask - | NSRightMouseDraggedMask]; - switch ([mouseEvent type]) { - case NSRightMouseDown: - case NSRightMouseUp: - case NSLeftMouseDown: - case NSLeftMouseUp: - [self menuTrackingDone:nil]; - break; - case NSRightMouseDragged: - case NSLeftMouseDragged: - default: - /* Ignore any other kind of event. */ - break; - } - }; + } else { + [parent triggerSelector:self button:mouseButton]; + } } -(void)mouseDown:(NSEvent *)mouseEvent { - [self mousePressed:mouseEvent]; + [self mousePressed:mouseEvent button:Qt::LeftButton]; +} + +-(void)mouseUp:(NSEvent *)mouseEvent +{ + Q_UNUSED(mouseEvent); + [self menuTrackingDone:nil]; } - (void)rightMouseDown:(NSEvent *)mouseEvent { - [self mousePressed:mouseEvent]; + [self mousePressed:mouseEvent button:Qt::RightButton]; +} + +-(void)rightMouseUp:(NSEvent *)mouseEvent +{ + Q_UNUSED(mouseEvent); + [self menuTrackingDone:nil]; } +- (void)otherMouseDown:(NSEvent *)mouseEvent +{ + [self mousePressed:mouseEvent button:cocoaButton2QtButton([mouseEvent buttonNumber])]; +} + +-(void)otherMouseUp:(NSEvent *)mouseEvent +{ + Q_UNUSED(mouseEvent); + [self menuTrackingDone:nil]; +} -(void)drawRect:(NSRect)rect { [[parent item] drawStatusBarBackgroundInRect:rect withHighlight:down]; @@ -433,45 +437,40 @@ QT_END_NAMESPACE } return QRectF(); } -- (void)triggerSelector:(id)sender { + +- (void)triggerSelector:(id)sender button:(Qt::MouseButton)mouseButton { Q_UNUSED(sender); - if(!icon) + if (!icon) return; - qtsystray_sendActivated(icon, QSystemTrayIcon::Trigger); + + if (mouseButton == Qt::MidButton) + qtsystray_sendActivated(icon, QSystemTrayIcon::MiddleClick); + else + qtsystray_sendActivated(icon, QSystemTrayIcon::Trigger); + if (icon->contextMenu()) { -#if 0 - const QRectF geom = [self geometry]; - if(!geom.isNull()) { - [[NSNotificationCenter defaultCenter] addObserver:imageCell - selector:@selector(menuTrackingDone:) - name:nil - object:self]; - icon->contextMenu()->exec(geom.topLeft().toPoint(), 0); - [imageCell menuTrackingDone:nil]; - } else -#endif - { #ifndef QT_MAC_USE_COCOA - [[[self item] view] removeAllToolTips]; - iconPrivate->updateToolTip_sys(); + [[[self item] view] removeAllToolTips]; + iconPrivate->updateToolTip_sys(); #endif - NSMenu *m = [[QNSMenu alloc] initWithQMenu:icon->contextMenu()]; - [m setAutoenablesItems: NO]; - [[NSNotificationCenter defaultCenter] addObserver:imageCell - selector:@selector(menuTrackingDone:) - name:NSMenuDidEndTrackingNotification - object:m]; - [item popUpStatusItemMenu: m]; - [m release]; - } + NSMenu *m = [[QNSMenu alloc] initWithQMenu:icon->contextMenu()]; + [m setAutoenablesItems: NO]; + [[NSNotificationCenter defaultCenter] addObserver:imageCell + selector:@selector(menuTrackingDone:) + name:NSMenuDidEndTrackingNotification + object:m]; + [item popUpStatusItemMenu: m]; + [m release]; } } + - (void)doubleClickSelector:(id)sender { Q_UNUSED(sender); if(!icon) return; qtsystray_sendActivated(icon, QSystemTrayIcon::DoubleClick); } + @end class QSystemTrayIconQMenu : public QMenu diff --git a/src/gui/util/qsystemtrayicon_p.h b/src/gui/util/qsystemtrayicon_p.h index b881f68..e8bf197 100644 --- a/src/gui/util/qsystemtrayicon_p.h +++ b/src/gui/util/qsystemtrayicon_p.h @@ -164,7 +164,9 @@ protected: bool x11Event(XEvent *event); void mousePressEvent(QMouseEvent *event); void mouseDoubleClickEvent(QMouseEvent *event); +#ifndef QT_NO_WHEELEVENT void wheelEvent(QWheelEvent *event); +#endif bool event(QEvent *e); private: diff --git a/src/gui/util/qsystemtrayicon_x11.cpp b/src/gui/util/qsystemtrayicon_x11.cpp index a645050..82b4325 100644 --- a/src/gui/util/qsystemtrayicon_x11.cpp +++ b/src/gui/util/qsystemtrayicon_x11.cpp @@ -308,10 +308,12 @@ void QSystemTrayIconSys::mouseDoubleClickEvent(QMouseEvent *ev) emit q->activated(QSystemTrayIcon::DoubleClick); } +#ifndef QT_NO_WHEELEVENT void QSystemTrayIconSys::wheelEvent(QWheelEvent *e) { QApplication::sendEvent(q, e); } +#endif bool QSystemTrayIconSys::event(QEvent *e) { diff --git a/src/gui/widgets/qabstractscrollarea.cpp b/src/gui/widgets/qabstractscrollarea.cpp index 87f6c83..1d496d5 100644 --- a/src/gui/widgets/qabstractscrollarea.cpp +++ b/src/gui/widgets/qabstractscrollarea.cpp @@ -1134,13 +1134,10 @@ void QAbstractScrollArea::mouseMoveEvent(QMouseEvent *e) void QAbstractScrollArea::wheelEvent(QWheelEvent *e) { Q_D(QAbstractScrollArea); - QScrollBar *const bars[2] = { d->hbar, d->vbar }; - int idx = (e->orientation() == Qt::Vertical) ? 1 : 0; - int other = (idx + 1) % 2; - if (!bars[idx]->isVisible() && bars[other]->isVisible()) - idx = other; // If the scrollbar of the event orientation is hidden, fallback to the other. - - QApplication::sendEvent(bars[idx], e); + if (static_cast<QWheelEvent*>(e)->orientation() == Qt::Horizontal) + QApplication::sendEvent(d->hbar, e); + else + QApplication::sendEvent(d->vbar, e); } #endif diff --git a/src/gui/widgets/qabstractscrollarea_p.h b/src/gui/widgets/qabstractscrollarea_p.h index 7c72859..9a0d66f 100644 --- a/src/gui/widgets/qabstractscrollarea_p.h +++ b/src/gui/widgets/qabstractscrollarea_p.h @@ -62,7 +62,7 @@ QT_BEGIN_NAMESPACE class QScrollBar; class QAbstractScrollAreaScrollBarContainer; -class Q_AUTOTEST_EXPORT QAbstractScrollAreaPrivate: public QFramePrivate +class Q_GUI_EXPORT QAbstractScrollAreaPrivate: public QFramePrivate { Q_DECLARE_PUBLIC(QAbstractScrollArea) diff --git a/src/gui/widgets/qabstractslider.cpp b/src/gui/widgets/qabstractslider.cpp index 2874647..4bd7b5a 100644 --- a/src/gui/widgets/qabstractslider.cpp +++ b/src/gui/widgets/qabstractslider.cpp @@ -214,8 +214,8 @@ QT_BEGIN_NAMESPACE */ QAbstractSliderPrivate::QAbstractSliderPrivate() - : minimum(0), maximum(99), singleStep(1), pageStep(10), - value(0), position(0), pressValue(-1), offset_accumulated(0), tracking(true), + : minimum(0), maximum(99), pageStep(10), value(0), position(0), pressValue(-1), + singleStep(1), offset_accumulated(0), tracking(true), blocktracking(false), pressed(false), invertedAppearance(false), invertedControls(false), orientation(Qt::Horizontal), repeatAction(QAbstractSlider::SliderNoAction) @@ -688,51 +688,66 @@ void QAbstractSlider::sliderChange(SliderChange) update(); } - -/*! - \reimp -*/ -#ifndef QT_NO_WHEELEVENT -void QAbstractSlider::wheelEvent(QWheelEvent * e) +bool QAbstractSliderPrivate::scrollByDelta(Qt::Orientation orientation, Qt::KeyboardModifiers modifiers, int delta) { - Q_D(QAbstractSlider); - e->ignore(); - + Q_Q(QAbstractSlider); int stepsToScroll = 0; - qreal offset = qreal(e->delta()) / 120; + // in Qt scrolling to the right gives negative values. + if (orientation == Qt::Horizontal) + delta = -delta; + qreal offset = qreal(delta) / 120; - if ((e->modifiers() & Qt::ControlModifier) || (e->modifiers() & Qt::ShiftModifier)) { + if ((modifiers & Qt::ControlModifier) || (modifiers & Qt::ShiftModifier)) { // Scroll one page regardless of delta: - stepsToScroll = qBound(-d->pageStep, int(offset * d->pageStep), d->pageStep); - d->offset_accumulated = 0; + stepsToScroll = qBound(-pageStep, int(offset * pageStep), pageStep); + offset_accumulated = 0; } else { // Calculate how many lines to scroll. Depending on what delta is (and // offset), we might end up with a fraction (e.g. scroll 1.3 lines). We can // only scroll whole lines, so we keep the reminder until next event. - qreal stepsToScrollF = offset * QApplication::wheelScrollLines() * d->effectiveSingleStep(); + qreal stepsToScrollF = +#ifndef QT_NO_WHEELEVENT + QApplication::wheelScrollLines() * +#endif + offset * effectiveSingleStep(); // Check if wheel changed direction since last event: - if (d->offset_accumulated != 0 && (offset / d->offset_accumulated) < 0) - d->offset_accumulated = 0; + if (offset_accumulated != 0 && (offset / offset_accumulated) < 0) + offset_accumulated = 0; - d->offset_accumulated += stepsToScrollF; - stepsToScroll = qBound(-d->pageStep, int(d->offset_accumulated), d->pageStep); - d->offset_accumulated -= int(d->offset_accumulated); + offset_accumulated += stepsToScrollF; + stepsToScroll = qBound(-pageStep, int(offset_accumulated), pageStep); + offset_accumulated -= int(offset_accumulated); if (stepsToScroll == 0) - return; + return false; } - if (d->invertedControls) + if (invertedControls) stepsToScroll = -stepsToScroll; - int prevValue = d->value; - d->position = d->overflowSafeAdd(stepsToScroll); // value will be updated by triggerAction() - triggerAction(SliderMove); + int prevValue = value; + position = overflowSafeAdd(stepsToScroll); // value will be updated by triggerAction() + q->triggerAction(QAbstractSlider::SliderMove); - if (prevValue == d->value) - d->offset_accumulated = 0; - else + if (prevValue == value) { + offset_accumulated = 0; + return false; + } + return true; +} + +/*! + \reimp +*/ +#ifndef QT_NO_WHEELEVENT +void QAbstractSlider::wheelEvent(QWheelEvent * e) +{ + Q_D(QAbstractSlider); + e->ignore(); + int delta = e->delta(); + if (d->scrollByDelta(e->orientation(), e->modifiers(), delta)) e->accept(); } + #endif #ifdef QT_KEYPAD_NAVIGATION /*! diff --git a/src/gui/widgets/qabstractslider_p.h b/src/gui/widgets/qabstractslider_p.h index 6cde468..6e6ff6e 100644 --- a/src/gui/widgets/qabstractslider_p.h +++ b/src/gui/widgets/qabstractslider_p.h @@ -138,6 +138,7 @@ public: } q->triggerAction(repeatAction); } + bool scrollByDelta(Qt::Orientation orientation, Qt::KeyboardModifiers modifiers, int delta); }; QT_END_NAMESPACE diff --git a/src/gui/widgets/qabstractspinbox.h b/src/gui/widgets/qabstractspinbox.h index 059943a..6c062c0 100644 --- a/src/gui/widgets/qabstractspinbox.h +++ b/src/gui/widgets/qabstractspinbox.h @@ -137,7 +137,9 @@ protected: void resizeEvent(QResizeEvent *event); void keyPressEvent(QKeyEvent *event); void keyReleaseEvent(QKeyEvent *event); +#ifndef QT_NO_WHEELEVENT void wheelEvent(QWheelEvent *event); +#endif void focusInEvent(QFocusEvent *event); void focusOutEvent(QFocusEvent *event); void contextMenuEvent(QContextMenuEvent *event); diff --git a/src/gui/widgets/qcombobox.cpp b/src/gui/widgets/qcombobox.cpp index be20a38..f71d250 100644 --- a/src/gui/widgets/qcombobox.cpp +++ b/src/gui/widgets/qcombobox.cpp @@ -607,7 +607,13 @@ void QComboBoxPrivateContainer::changeEvent(QEvent *e) view->setMouseTracking(combo->style()->styleHint(QStyle::SH_ComboBox_ListMouseTracking, &opt, combo) || combo->style()->styleHint(QStyle::SH_ComboBox_Popup, &opt, combo)); setFrameStyle(combo->style()->styleHint(QStyle::SH_ComboBox_PopupFrameStyle, &opt, combo)); +#ifdef QT_SOFTKEYS_ENABLED + } else if (e->type() == QEvent::LanguageChange) { + selectAction->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::SelectSoftKey)); + cancelAction->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::CancelSoftKey)); +#endif } + QWidget::changeEvent(e); } diff --git a/src/gui/widgets/qcombobox.h b/src/gui/widgets/qcombobox.h index f332d31..9b19a66 100644 --- a/src/gui/widgets/qcombobox.h +++ b/src/gui/widgets/qcombobox.h @@ -245,7 +245,9 @@ protected: void mouseReleaseEvent(QMouseEvent *e); void keyPressEvent(QKeyEvent *e); void keyReleaseEvent(QKeyEvent *e); +#ifndef QT_NO_WHEELEVENT void wheelEvent(QWheelEvent *e); +#endif void contextMenuEvent(QContextMenuEvent *e); void inputMethodEvent(QInputMethodEvent *); QVariant inputMethodQuery(Qt::InputMethodQuery) const; diff --git a/src/gui/widgets/qdialogbuttonbox.cpp b/src/gui/widgets/qdialogbuttonbox.cpp index 48d7022..cc74a53 100644 --- a/src/gui/widgets/qdialogbuttonbox.cpp +++ b/src/gui/widgets/qdialogbuttonbox.cpp @@ -103,7 +103,7 @@ QT_BEGIN_NAMESPACE You can mix and match normal buttons and standard buttons. Currently the buttons are laid out in the following way if the button box is horizontal: - \table 100% + \table \row \o \inlineimage buttonbox-gnomelayout-horizontal.png GnomeLayout Horizontal \o Button box laid out in horizontal GnomeLayout \row \o \inlineimage buttonbox-kdelayout-horizontal.png KdeLayout Horizontal @@ -116,25 +116,23 @@ QT_BEGIN_NAMESPACE The buttons are laid out the following way if the button box is vertical: - \table 100% + \table + \row \o GnomeLayout + \o KdeLayout + \o MacLayout + \o WinLayout \row \o \inlineimage buttonbox-gnomelayout-vertical.png GnomeLayout Vertical - \o Button box laid out in vertical GnomeLayout - \row \o \inlineimage buttonbox-kdelayout-vertical.png KdeLayout Vertical - \o Button box laid out in vertical KdeLayout - \row \o \inlineimage buttonbox-maclayout-vertical.png MacLayout Vertical - \o Button box laid out in vertical MacLayout - \row \o \inlineimage buttonbox-winlayout-vertical.png WinLayout Vertical - \o Button box laid out in vertical WinLayout + \o \inlineimage buttonbox-kdelayout-vertical.png KdeLayout Vertical + \o \inlineimage buttonbox-maclayout-vertical.png MacLayout Vertical + \o \inlineimage buttonbox-winlayout-vertical.png WinLayout Vertical \endtable Additionally, button boxes that contain only buttons with ActionRole or - HelpRole can be considered modeless and have an alternate look on the mac: + HelpRole can be considered modeless and have an alternate look on Mac OS X: - \table 100% - \row \o \inlineimage buttonbox-mac-modeless-horizontal.png Screenshot of modeless horizontal MacLayout - \o modeless horizontal MacLayout - \row \o \inlineimage buttonbox-mac-modeless-vertical.png Screenshot of modeless vertical MacLayout - \o modeless vertical MacLayout + \table + \row \o modeless horizontal MacLayout + \o \inlineimage buttonbox-mac-modeless-horizontal.png Screenshot of modeless horizontal MacLayout \endtable When a button is clicked in the button box, the clicked() signal is emitted @@ -1017,6 +1015,8 @@ void QDialogButtonBox::removeButton(QAbstractButton *button) If the button has already been added, it is removed and added again with the new role. + \note The button box takes ownership of the button. + \sa removeButton(), clear() */ void QDialogButtonBox::addButton(QAbstractButton *button, ButtonRole role) diff --git a/src/gui/widgets/qdockarealayout.cpp b/src/gui/widgets/qdockarealayout.cpp index d754800..2b8cf59 100644 --- a/src/gui/widgets/qdockarealayout.cpp +++ b/src/gui/widgets/qdockarealayout.cpp @@ -220,15 +220,17 @@ static quintptr tabId(const QDockAreaLayoutItem &item) } #endif +static const int zero = 0; + QDockAreaLayoutInfo::QDockAreaLayoutInfo() - : sep(0), dockPos(QInternal::LeftDock), o(Qt::Horizontal), mainWindow(0) + : sep(&zero), dockPos(QInternal::LeftDock), o(Qt::Horizontal), mainWindow(0) #ifndef QT_NO_TABBAR , tabbed(false), tabBar(0), tabBarShape(QTabBar::RoundedSouth), tabBarVisible(false) #endif { } -QDockAreaLayoutInfo::QDockAreaLayoutInfo(int _sep, QInternal::DockPosition _dockPos, +QDockAreaLayoutInfo::QDockAreaLayoutInfo(const int *_sep, QInternal::DockPosition _dockPos, Qt::Orientation _o, int tbshape, QMainWindow *window) : sep(_sep), dockPos(_dockPos), o(_o), mainWindow(window) @@ -281,7 +283,7 @@ QSize QDockAreaLayoutInfo::minimumSize() const #endif { if (!first) - a += sep; + a += *sep; a += pick(o, min_size); } b = qMax(b, perp(o, min_size)); @@ -349,7 +351,7 @@ QSize QDockAreaLayoutInfo::maximumSize() const #endif { if (!first) - a += sep; + a += *sep; a += pick(o, max_size); } b = qMin(b, perp(o, max_size)); @@ -415,7 +417,7 @@ QSize QDockAreaLayoutInfo::sizeHint() const { if (previous && !gap && !(previous->flags & QDockAreaLayoutItem::GapItem) && !previous->hasFixedSize(o)) { - a += sep; + a += *sep; } a += gap ? item.size : pick(o, size_hint); } @@ -491,7 +493,7 @@ static int realMinSize(const QDockAreaLayoutInfo &info) min = pick(info.o, item.minimumSize()); if (!first) - result += info.sep; + result += *info.sep; result += min; first = false; @@ -516,7 +518,7 @@ static int realMaxSize(const QDockAreaLayoutInfo &info) max = pick(info.o, item.maximumSize()); if (!first) - result += info.sep; + result += *info.sep; result += max; if (result >= QWIDGETSIZE_MAX) @@ -555,7 +557,7 @@ void QDockAreaLayoutInfo::fitItems() if (!(previous->flags & QDockAreaLayoutItem::GapItem)) { QLayoutStruct &ls = layout_struct_list[j++]; ls.init(); - ls.minimumSize = ls.maximumSize = ls.sizeHint = previous->hasFixedSize(o) ? 0 : sep; + ls.minimumSize = ls.maximumSize = ls.sizeHint = previous->hasFixedSize(o) ? 0 : *sep; ls.empty = false; } } @@ -938,7 +940,7 @@ int QDockAreaLayoutInfo::separatorMove(int index, int delta) if (item.skip()) { ls.empty = true; } else { - const int separatorSpace = item.hasFixedSize(o) ? 0 : sep; + const int separatorSpace = item.hasFixedSize(o) ? 0 : *sep; ls.empty = false; ls.pos = item.pos; ls.size = item.size + separatorSpace; @@ -956,7 +958,7 @@ int QDockAreaLayoutInfo::separatorMove(int index, int delta) if (item.skip()) continue; QLayoutStruct &ls = list[i]; - const int separatorSpace = item.hasFixedSize(o) ? 0 : sep; + const int separatorSpace = item.hasFixedSize(o) ? 0 : *sep; item.size = ls.size - separatorSpace; item.pos = ls.pos; if (item.subinfo != 0) { @@ -1041,11 +1043,11 @@ QLayoutItem *QDockAreaLayoutInfo::plug(const QList<int> &path) int next = this->next(index); if (prev != -1 && !(item_list.at(prev).flags & QDockAreaLayoutItem::GapItem)) { - item.pos += sep; - item.size -= sep; + item.pos += *sep; + item.size -= *sep; } if (next != -1 && !(item_list.at(next).flags & QDockAreaLayoutItem::GapItem)) - item.size -= sep; + item.size -= *sep; QPoint pos; rpick(o, pos) = item.pos; @@ -1083,11 +1085,11 @@ QLayoutItem *QDockAreaLayoutInfo::unplug(const QList<int> &path) #endif { if (prev != -1 && !(item_list.at(prev).flags & QDockAreaLayoutItem::GapItem)) { - item.pos -= sep; - item.size += sep; + item.pos -= *sep; + item.size += *sep; } if (next != -1 && !(item_list.at(next).flags & QDockAreaLayoutItem::GapItem)) - item.size += sep; + item.size += *sep; } return item.widgetItem; @@ -1255,9 +1257,9 @@ bool QDockAreaLayoutInfo::insertGap(const QList<int> &path, QLayoutItem *dockWid QRect r = dockedGeometry(dockWidgetItem->widget()); gap_size = pick(o, r.size()); if (prev != -1 && !(item_list.at(prev).flags & QDockAreaLayoutItem::GapItem)) - sep_size += sep; + sep_size += *sep; if (next != -1 && !(item_list.at(next).flags & QDockAreaLayoutItem::GapItem)) - sep_size += sep; + sep_size += *sep; } if (gap_size + sep_size > space) gap_size = pick(o, gap_item.minimumSize()); @@ -1364,7 +1366,7 @@ QRect QDockAreaLayoutInfo::separatorRect(int index) const QPoint pos = rect.topLeft(); rpick(o, pos) = item.pos + item.size; QSize s = rect.size(); - rpick(o, s) = sep; + rpick(o, s) = *sep; return QRect(pos, s); } @@ -1413,7 +1415,7 @@ QList<int> QDockAreaLayoutInfo::findSeparator(const QPoint &_pos) const continue; QRect sepRect = separatorRect(i); - if (!sepRect.isNull() && sep == 1) + if (!sepRect.isNull() && *sep == 1) sepRect.adjust(-2, -2, 2, 2); //we also make sure we don't find a separator that's not there if (sepRect.contains(_pos) && !item.hasFixedSize(o)) { @@ -1560,7 +1562,7 @@ void QDockAreaLayoutInfo::apply(bool animate) } } #ifndef QT_NO_TABBAR - if (sep == 1) + if (*sep == 1) updateSeparatorWidgets(); #endif //QT_NO_TABBAR } @@ -2010,7 +2012,7 @@ bool QDockAreaLayoutInfo::restoreState(QDataStream &stream, QList<QDockWidget*> updateTabBar(); setCurrentTabId(tabId(item_list.at(index))); } - if (!testing && sep == 1) + if (!testing && *sep == 1) updateSeparatorWidgets(); #endif @@ -2273,13 +2275,13 @@ QDockAreaLayout::QDockAreaLayout(QMainWindow *win) : fallbackToSizeHints(true) const int tabShape = 0; #endif docks[QInternal::LeftDock] - = QDockAreaLayoutInfo(sep, QInternal::LeftDock, Qt::Vertical, tabShape, win); + = QDockAreaLayoutInfo(&sep, QInternal::LeftDock, Qt::Vertical, tabShape, win); docks[QInternal::RightDock] - = QDockAreaLayoutInfo(sep, QInternal::RightDock, Qt::Vertical, tabShape, win); + = QDockAreaLayoutInfo(&sep, QInternal::RightDock, Qt::Vertical, tabShape, win); docks[QInternal::TopDock] - = QDockAreaLayoutInfo(sep, QInternal::TopDock, Qt::Horizontal, tabShape, win); + = QDockAreaLayoutInfo(&sep, QInternal::TopDock, Qt::Horizontal, tabShape, win); docks[QInternal::BottomDock] - = QDockAreaLayoutInfo(sep, QInternal::BottomDock, Qt::Horizontal, tabShape, win); + = QDockAreaLayoutInfo(&sep, QInternal::BottomDock, Qt::Horizontal, tabShape, win); centralWidgetItem = 0; @@ -2635,7 +2637,7 @@ void QDockAreaLayout::getGrid(QVector<QLayoutStruct> *_ver_struct_list, QSize bottom_max = docks[QInternal::BottomDock].maximumSize(); bottom_hint = bottom_hint.boundedTo(bottom_max).expandedTo(bottom_min); - fallbackToSizeHints = !have_central; + fallbackToSizeHints = false; if (_ver_struct_list != 0) { QVector<QLayoutStruct> &ver_struct_list = *_ver_struct_list; @@ -3028,7 +3030,7 @@ void QDockAreaLayout::addDockWidget(QInternal::DockPosition pos, QDockWidget *do #else int tbshape = 0; #endif - QDockAreaLayoutInfo new_info(sep, pos, orientation, tbshape, mainWindow); + QDockAreaLayoutInfo new_info(&sep, pos, orientation, tbshape, mainWindow); new_info.item_list.append(new QDockAreaLayoutInfo(info)); new_info.item_list.append(dockWidgetItem); info = new_info; @@ -3324,6 +3326,12 @@ void QDockAreaLayout::keepSize(QDockWidget *w) item.flags |= QDockAreaLayoutItem::KeepSize; } +void QDockAreaLayout::styleChangedEvent() +{ + sep = mainWindow->style()->pixelMetric(QStyle::PM_DockWidgetSeparatorExtent, 0, mainWindow); + fitLayout(); +} + QT_END_NAMESPACE #endif // QT_NO_DOCKWIDGET diff --git a/src/gui/widgets/qdockarealayout_p.h b/src/gui/widgets/qdockarealayout_p.h index 0bc1aa9..0088f00 100644 --- a/src/gui/widgets/qdockarealayout_p.h +++ b/src/gui/widgets/qdockarealayout_p.h @@ -128,7 +128,7 @@ class Q_AUTOTEST_EXPORT QDockAreaLayoutInfo { public: QDockAreaLayoutInfo(); - QDockAreaLayoutInfo(int _sep, QInternal::DockPosition _dockPos, Qt::Orientation _o, + QDockAreaLayoutInfo(const int *_sep, QInternal::DockPosition _dockPos, Qt::Orientation _o, int tbhape, QMainWindow *window); QSize minimumSize() const; @@ -189,7 +189,7 @@ public: QMainWindowLayout *mainWindowLayout() const; - int sep; + const int *sep; mutable QVector<QWidget*> separatorWidgets; QInternal::DockPosition dockPos; Qt::Orientation o; @@ -300,6 +300,7 @@ public: QSet<QTabBar*> usedTabBars() const; QSet<QWidget*> usedSeparatorWidgets() const; #endif //QT_NO_TABBAR + void styleChangedEvent(); }; QT_END_NAMESPACE diff --git a/src/gui/widgets/qdockwidget.cpp b/src/gui/widgets/qdockwidget.cpp index fdace46..54189de 100644 --- a/src/gui/widgets/qdockwidget.cpp +++ b/src/gui/widgets/qdockwidget.cpp @@ -1010,7 +1010,7 @@ void QDockWidgetPrivate::setWindowState(bool floating, bool unplug, const QRect if (!floating && parent) { QMainWindowLayout *mwlayout = qobject_cast<QMainWindowLayout *>(q->parentWidget()->layout()); - if (!mwlayout || mwlayout->dockWidgetArea(q) == Qt::NoDockWidgetArea) + if (mwlayout && mwlayout->dockWidgetArea(q) == Qt::NoDockWidgetArea) return; // this dockwidget can't be redocked } diff --git a/src/gui/widgets/qlabel.cpp b/src/gui/widgets/qlabel.cpp index c779312..b81f04f 100644 --- a/src/gui/widgets/qlabel.cpp +++ b/src/gui/widgets/qlabel.cpp @@ -951,8 +951,8 @@ void QLabel::contextMenuEvent(QContextMenuEvent *ev) return; } ev->accept(); - menu->exec(ev->globalPos()); - delete menu; + menu->setAttribute(Qt::WA_DeleteOnClose); + menu->popup(ev->globalPos()); #endif } diff --git a/src/gui/widgets/qlinecontrol.cpp b/src/gui/widgets/qlinecontrol.cpp index b0a64ea..db099e8 100644 --- a/src/gui/widgets/qlinecontrol.cpp +++ b/src/gui/widgets/qlinecontrol.cpp @@ -1371,6 +1371,8 @@ bool QLineControl::processEvent(QEvent* ev) processInputMethodEvent(static_cast<QInputMethodEvent*>(ev)); break; #ifndef QT_NO_SHORTCUT case QEvent::ShortcutOverride:{ + if (isReadOnly()) + return false; QKeyEvent* ke = static_cast<QKeyEvent*>(ev); if (ke == QKeySequence::Copy || ke == QKeySequence::Paste diff --git a/src/gui/widgets/qlineedit.cpp b/src/gui/widgets/qlineedit.cpp index 2d2df92..0ba8b9f 100644 --- a/src/gui/widgets/qlineedit.cpp +++ b/src/gui/widgets/qlineedit.cpp @@ -1637,12 +1637,8 @@ void QLineEdit::keyPressEvent(QKeyEvent *event) if (!hasEditFocus() && !(event->modifiers() & Qt::ControlModifier)) { if (!event->text().isEmpty() && event->text().at(0).isPrint() && !isReadOnly()) - { setEditFocus(true); -#ifndef Q_OS_SYMBIAN - clear(); -#endif - } else { + else { event->ignore(); return; } @@ -1698,12 +1694,8 @@ void QLineEdit::inputMethodEvent(QInputMethodEvent *e) // commit text as they focus out without interfering with focus if (QApplication::keypadNavigationEnabled() && hasFocus() && !hasEditFocus() - && !e->preeditString().isEmpty()) { + && !e->preeditString().isEmpty()) setEditFocus(true); -#ifndef Q_OS_SYMBIAN - selectAll(); // so text is replaced rather than appended to -#endif - } #endif d->control->processInputMethodEvent(e); @@ -2046,9 +2038,9 @@ void QLineEdit::dropEvent(QDropEvent* e) */ void QLineEdit::contextMenuEvent(QContextMenuEvent *event) { - QPointer<QMenu> menu = createStandardContextMenu(); - menu->exec(event->globalPos()); - delete menu; + QMenu *menu = createStandardContextMenu(); + menu->setAttribute(Qt::WA_DeleteOnClose); + menu->popup(event->globalPos()); } #if defined(Q_WS_WIN) diff --git a/src/gui/widgets/qmainwindow.cpp b/src/gui/widgets/qmainwindow.cpp index 269cd12..4620597 100644 --- a/src/gui/widgets/qmainwindow.cpp +++ b/src/gui/widgets/qmainwindow.cpp @@ -1393,6 +1393,7 @@ bool QMainWindow::event(QEvent *event) #endif // QT_NO_STATUSTIP case QEvent::StyleChange: + d->layout->layoutState.dockAreaLayout.styleChangedEvent(); if (!d->explicitIconSize) setIconSize(QSize()); break; @@ -1426,6 +1427,11 @@ bool QMainWindow::event(QEvent *event) } break; #endif +#ifdef QT_SOFTKEYS_ENABLED + case QEvent::LanguageChange: + d->menuBarAction->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::MenuSoftKey)); + break; +#endif default: break; } @@ -1554,11 +1560,15 @@ void QMainWindow::contextMenuEvent(QContextMenuEvent *event) #ifndef QT_NO_MENU QMenu *popup = createPopupMenu(); - if (popup && !popup->isEmpty()) { - popup->exec(event->globalPos()); - event->accept(); + if (popup) { + if (!popup->isEmpty()) { + popup->setAttribute(Qt::WA_DeleteOnClose); + popup->popup(event->globalPos()); + event->accept(); + } else { + delete popup; + } } - delete popup; #endif } #endif // QT_NO_CONTEXTMENU diff --git a/src/gui/widgets/qmainwindowlayout.cpp b/src/gui/widgets/qmainwindowlayout.cpp index d1e7285..593e391 100644 --- a/src/gui/widgets/qmainwindowlayout.cpp +++ b/src/gui/widgets/qmainwindowlayout.cpp @@ -1627,6 +1627,13 @@ void QMainWindowLayout::animationFinished(QWidget *widget) tb->d_func()->plug(currentGapRect); #endif + savedState.clear(); + currentGapPos.clear(); + pluggingWidget = 0; + //applying the state will make sure that the currentGap is updated correctly + //and all the geometries (especially the one from the central widget) is correct + layoutState.apply(false); + #ifndef QT_NO_DOCKWIDGET #ifndef QT_NO_TABBAR if (qobject_cast<QDockWidget*>(widget) != 0) { @@ -1637,13 +1644,6 @@ void QMainWindowLayout::animationFinished(QWidget *widget) } #endif #endif - - savedState.clear(); - currentGapPos.clear(); - pluggingWidget = 0; - //applying the state will make sure that the currentGap is updated correctly - //and all the geometries (especially the one from the central widget) is correct - layoutState.apply(false); } if (!widgetAnimator.animating()) { @@ -1772,6 +1772,7 @@ void QMainWindowLayout::setCentralWidget(QWidget *widget) if (savedState.isValid()) { #ifndef QT_NO_DOCKWIDGET savedState.dockAreaLayout.centralWidgetItem = layoutState.dockAreaLayout.centralWidgetItem; + savedState.dockAreaLayout.fallbackToSizeHints = true; #else savedState.centralWidgetItem = layoutState.centralWidgetItem; #endif diff --git a/src/gui/widgets/qmenu.cpp b/src/gui/widgets/qmenu.cpp index 08960da..e2cf25b 100644 --- a/src/gui/widgets/qmenu.cpp +++ b/src/gui/widgets/qmenu.cpp @@ -117,7 +117,7 @@ public: if (parentWidget->parentWidget()) parentWidget = parentWidget->parentWidget(); setParent(parentWidget, Qt::Window | Qt::Tool); - setAttribute(Qt::WA_DeleteOnClose, true); + setAttribute(Qt::WA_DeleteOnClose, true); setAttribute(Qt::WA_X11NetWmWindowTypeMenu, true); setWindowTitle(p->windowTitle()); setEnabled(p->isEnabled()); @@ -1226,7 +1226,7 @@ void QMenu::initStyleOption(QStyleOptionMenuItem *option, const QAction *action) else if (action->isSeparator()) option->menuItemType = QStyleOptionMenuItem::Separator; else if (d->defaultAction == action) - option->menuItemType = QStyleOptionMenuItem::DefaultItem; + option->menuItemType = QStyleOptionMenuItem::DefaultItem; else option->menuItemType = QStyleOptionMenuItem::Normal; if (action->isIconVisibleInMenu()) @@ -1719,7 +1719,14 @@ bool QMenu::isEmpty() const void QMenu::clear() { QList<QAction*> acts = actions(); + for(int i = 0; i < acts.size(); i++) { +#ifdef QT_SOFTKEYS_ENABLED + Q_D(QMenu); + // Lets not touch to our internal softkey actions + if(acts[i] == d->selectAction || acts[i] == d->cancelAction) + continue; +#endif removeAction(acts[i]); if (acts[i]->parent() == this && acts[i]->d_func()->widgets.isEmpty()) delete acts[i]; @@ -2406,6 +2413,13 @@ QMenu::event(QEvent *e) } return true; #endif +#ifdef QT_SOFTKEYS_ENABLED + case QEvent::LanguageChange: { + d->selectAction->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::SelectSoftKey)); + d->cancelAction->setText(QSoftKeyManager::standardSoftKeyText(QSoftKeyManager::CancelSoftKey)); + } + break; +#endif default: break; } @@ -2917,7 +2931,7 @@ void QMenu::actionEvent(QActionEvent *e) #endif if (isVisible()) { d->updateActionRects(); - resize(sizeHint()); + resize(sizeHint()); update(); } } diff --git a/src/gui/widgets/qmenu.h b/src/gui/widgets/qmenu.h index 28bd859..a040afa 100644 --- a/src/gui/widgets/qmenu.h +++ b/src/gui/widgets/qmenu.h @@ -162,7 +162,9 @@ protected: void mouseReleaseEvent(QMouseEvent *); void mousePressEvent(QMouseEvent *); void mouseMoveEvent(QMouseEvent *); +#ifndef QT_NO_WHEELEVENT void wheelEvent(QWheelEvent *); +#endif void enterEvent(QEvent *); void leaveEvent(QEvent *); void hideEvent(QHideEvent *); diff --git a/src/gui/widgets/qmenu_mac.mm b/src/gui/widgets/qmenu_mac.mm index 658a020..99c550f 100644 --- a/src/gui/widgets/qmenu_mac.mm +++ b/src/gui/widgets/qmenu_mac.mm @@ -2030,6 +2030,18 @@ void qt_mac_clear_menubar() */ bool QMenuBar::macUpdateMenuBar() { +#ifdef QT_MAC_USE_COCOA + QMacCocoaAutoReleasePool pool; + if (!qt_cocoaPostMessage(getMenuLoader(), @selector(qtUpdateMenubar))) + return QMenuBarPrivate::macUpdateMenuBarImmediatly(); + return true; +#else + return QMenuBarPrivate::macUpdateMenuBarImmediatly(); +#endif +} + +bool QMenuBarPrivate::macUpdateMenuBarImmediatly() +{ bool ret = false; cancelAllMenuTracking(); QWidget *w = findWindowThatShouldDisplayMenubar(); @@ -2095,8 +2107,9 @@ bool QMenuBar::macUpdateMenuBar() } } - if(!ret) + if (!ret) { qt_mac_clear_menubar(); + } return ret; } diff --git a/src/gui/widgets/qmenubar_p.h b/src/gui/widgets/qmenubar_p.h index f2e5357..819aee4 100644 --- a/src/gui/widgets/qmenubar_p.h +++ b/src/gui/widgets/qmenubar_p.h @@ -196,6 +196,7 @@ public: return 0; } } *mac_menubar; + static bool macUpdateMenuBarImmediatly(); bool macWidgetHasNativeMenubar(QWidget *widget); void macCreateMenuBar(QWidget *); void macDestroyMenuBar(); diff --git a/src/gui/widgets/qplaintextedit.cpp b/src/gui/widgets/qplaintextedit.cpp index 02ffe13..ef9fac3 100644 --- a/src/gui/widgets/qplaintextedit.cpp +++ b/src/gui/widgets/qplaintextedit.cpp @@ -1320,6 +1320,26 @@ QTextCursor QPlainTextEdit::textCursor() const return d->control->textCursor(); } +/*! + Returns the reference of the anchor at position \a pos, or an + empty string if no anchor exists at that point. + + \since 4.7 + */ +QString QPlainTextEdit::anchorAt(const QPoint &pos) const +{ + Q_D(const QPlainTextEdit); + int cursorPos = d->control->hitTest(pos + QPoint(d->horizontalOffset(), + d->verticalOffset()), + Qt::ExactHit); + if (cursorPos < 0) + return QString(); + + QTextDocumentPrivate *pieceTable = document()->docHandle(); + QTextDocumentPrivate::FragmentIterator it = pieceTable->find(cursorPos); + QTextCharFormat fmt = pieceTable->formatCollection()->charFormat(it->format); + return fmt.anchorHref(); +} /*! Undoes the last operation. @@ -2394,7 +2414,7 @@ void QPlainTextEdit::setReadOnly(bool ro) then the focus policy is also automatically set to Qt::ClickFocus. The default value depends on whether the QPlainTextEdit is read-only - or editable, and whether it is a QTextBrowser or not. + or editable. */ void QPlainTextEdit::setTextInteractionFlags(Qt::TextInteractionFlags flags) diff --git a/src/gui/widgets/qplaintextedit.h b/src/gui/widgets/qplaintextedit.h index 15cf0967..106ae6d 100644 --- a/src/gui/widgets/qplaintextedit.h +++ b/src/gui/widgets/qplaintextedit.h @@ -159,6 +159,8 @@ public: QRect cursorRect(const QTextCursor &cursor) const; QRect cursorRect() const; + QString anchorAt(const QPoint &pos) const; + bool overwriteMode() const; void setOverwriteMode(bool overwrite); diff --git a/src/gui/widgets/qscrollbar.cpp b/src/gui/widgets/qscrollbar.cpp index 73ce122..4eff260 100644 --- a/src/gui/widgets/qscrollbar.cpp +++ b/src/gui/widgets/qscrollbar.cpp @@ -521,6 +521,24 @@ bool QScrollBar::event(QEvent *event) if (const QHoverEvent *he = static_cast<const QHoverEvent *>(event)) d_func()->updateHoverControl(he->pos()); break; +#ifndef QT_NO_WHEELEVENT + case QEvent::Wheel: { + // override wheel event without adding virtual function override + QWheelEvent *ev = static_cast<QWheelEvent *>(event); + int delta = ev->delta(); + // scrollbar is a special case - in vertical mode it reaches minimum + // value in the upper position, however QSlider's minimum value is on + // the bottom. So we need to invert a value, but since the scrollbar is + // inverted by default, we need to inverse the delta value for the + // horizontal orientation. + if (ev->orientation() == Qt::Horizontal) + delta = -delta; + Q_D(QScrollBar); + if (d->scrollByDelta(ev->orientation(), ev->modifiers(), delta)) + event->accept(); + return true; + } +#endif default: break; } diff --git a/src/gui/widgets/qtextedit.cpp b/src/gui/widgets/qtextedit.cpp index b6886b4..4541730 100644 --- a/src/gui/widgets/qtextedit.cpp +++ b/src/gui/widgets/qtextedit.cpp @@ -1212,12 +1212,9 @@ void QTextEdit::keyPressEvent(QKeyEvent *e) default: if (QApplication::keypadNavigationEnabled()) { if (!hasEditFocus() && !(e->modifiers() & Qt::ControlModifier)) { - if (e->text()[0].isPrint()) { + if (e->text()[0].isPrint()) setEditFocus(true); -#ifndef Q_OS_SYMBIAN - clear(); -#endif - } else { + else { e->ignore(); return; } @@ -1677,12 +1674,8 @@ void QTextEdit::inputMethodEvent(QInputMethodEvent *e) #ifdef QT_KEYPAD_NAVIGATION if (d->control->textInteractionFlags() & Qt::TextEditable && QApplication::keypadNavigationEnabled() - && !hasEditFocus()) { + && !hasEditFocus()) setEditFocus(true); -#ifndef Q_OS_SYMBIAN - selectAll(); // so text is replaced rather than appended to -#endif - } #endif d->sendControlEvent(e); ensureCursorVisible(); diff --git a/src/gui/widgets/qtoolbar.cpp b/src/gui/widgets/qtoolbar.cpp index 7782448..7ed27ea 100644 --- a/src/gui/widgets/qtoolbar.cpp +++ b/src/gui/widgets/qtoolbar.cpp @@ -441,8 +441,7 @@ void QToolBarPrivate::plug(const QRect &r) When a QToolBar is not a child of a QMainWindow, it looses the ability to populate the extension pop up with widgets added to the toolbar using addWidget(). Please use widget actions created by inheriting QWidgetAction - and implementing QWidgetAction::createWidget() instead. This is a known - issue which will be fixed in a future release. + and implementing QWidgetAction::createWidget() instead. \sa QToolButton, QMenu, QAction, {Application Example} */ diff --git a/src/gui/widgets/qvalidator.h b/src/gui/widgets/qvalidator.h index e996a01..63734ca 100644 --- a/src/gui/widgets/qvalidator.h +++ b/src/gui/widgets/qvalidator.h @@ -137,10 +137,11 @@ class Q_GUI_EXPORT QDoubleValidator : public QValidator Q_PROPERTY(double bottom READ bottom WRITE setBottom) Q_PROPERTY(double top READ top WRITE setTop) Q_PROPERTY(int decimals READ decimals WRITE setDecimals) + Q_ENUMS(Notation) Q_PROPERTY(Notation notation READ notation WRITE setNotation) public: - explicit QDoubleValidator(QObject * parent); + explicit QDoubleValidator(QObject * parent = 0); QDoubleValidator(double bottom, double top, int decimals, QObject * parent); ~QDoubleValidator(); @@ -184,7 +185,7 @@ class Q_GUI_EXPORT QRegExpValidator : public QValidator Q_PROPERTY(QRegExp regExp READ regExp WRITE setRegExp) public: - explicit QRegExpValidator(QObject *parent); + explicit QRegExpValidator(QObject *parent = 0); QRegExpValidator(const QRegExp& rx, QObject *parent); ~QRegExpValidator(); |