summaryrefslogtreecommitdiffstats
diff options
context:
space:
mode:
-rwxr-xr-xconfig.tests/unix/bsymbolic_functions.test3
-rwxr-xr-xconfigure6
-rwxr-xr-xconfigure.exebin1319424 -> 1318912 bytes
-rw-r--r--dist/changes-4.7.088
-rw-r--r--doc/src/classes.qdoc6
-rw-r--r--doc/src/declarative/declarativeui.qdoc66
-rw-r--r--doc/src/declarative/examples.qdoc5
-rw-r--r--doc/src/development/qmake-manual.qdoc1
-rw-r--r--doc/src/diagrams/modelview-move-rows-1.sk271
-rw-r--r--doc/src/diagrams/modelview-move-rows-2.sk271
-rw-r--r--doc/src/diagrams/modelview-move-rows-3.sk137
-rw-r--r--doc/src/diagrams/modelview-move-rows-4.sk137
-rw-r--r--doc/src/files-and-resources/datastreamformat.qdoc3
-rw-r--r--doc/src/files-and-resources/resources.qdoc2
-rw-r--r--doc/src/frameworks-technologies/accessible.qdoc3
-rw-r--r--doc/src/frameworks-technologies/activeqt-container.qdoc7
-rw-r--r--doc/src/frameworks-technologies/activeqt-server.qdoc6
-rw-r--r--doc/src/frameworks-technologies/activeqt.qdoc5
-rw-r--r--doc/src/frameworks-technologies/animation.qdoc1
-rw-r--r--doc/src/frameworks-technologies/containers.qdoc2
-rw-r--r--doc/src/frameworks-technologies/dbus-adaptors.qdoc1
-rw-r--r--doc/src/frameworks-technologies/dbus-intro.qdoc2
-rw-r--r--doc/src/frameworks-technologies/desktop-integration.qdoc6
-rw-r--r--doc/src/frameworks-technologies/dnd.qdoc10
-rw-r--r--doc/src/frameworks-technologies/eventsandfilters.qdoc3
-rw-r--r--doc/src/frameworks-technologies/gestures.qdoc7
-rw-r--r--doc/src/frameworks-technologies/graphicsview.qdoc5
-rw-r--r--doc/src/frameworks-technologies/implicit-sharing.qdoc2
-rw-r--r--doc/src/frameworks-technologies/ipc.qdoc3
-rw-r--r--doc/src/frameworks-technologies/phonon.qdoc4
-rw-r--r--doc/src/frameworks-technologies/threads.qdoc1
-rw-r--r--doc/src/frameworks-technologies/unicode.qdoc2
-rw-r--r--doc/src/getting-started/demos.qdoc7
-rw-r--r--doc/src/getting-started/examples.qdoc73
-rw-r--r--doc/src/index.qdoc60
-rw-r--r--doc/src/modules.qdoc46
-rw-r--r--doc/src/network-programming/bearermanagement.qdoc9
-rw-r--r--doc/src/network-programming/qtnetwork.qdoc1
-rw-r--r--doc/src/network-programming/ssl.qdoc6
-rw-r--r--doc/src/objectmodel/metaobjects.qdoc3
-rw-r--r--doc/src/objectmodel/object.qdoc3
-rw-r--r--doc/src/objectmodel/objecttrees.qdoc3
-rw-r--r--doc/src/objectmodel/properties.qdoc3
-rw-r--r--doc/src/objectmodel/signalsandslots.qdoc3
-rw-r--r--doc/src/overviews.qdoc68
-rw-r--r--doc/src/painting-and-printing/coordsys.qdoc3
-rw-r--r--doc/src/painting-and-printing/paintsystem.qdoc4
-rw-r--r--doc/src/painting-and-printing/printing.qdoc1
-rw-r--r--doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp20
-rwxr-xr-xdoc/src/template/images/api_examples.pngbin1302 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/api_lookup.pngbin1879 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/api_topics.pngbin1216 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_l.pngbin139 -> 100 bytes
-rwxr-xr-xdoc/src/template/images/bg_l_blank.pngbin123 -> 84 bytes
-rwxr-xr-xdoc/src/template/images/bg_ll.pngbin514 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_ll_blank.pngbin320 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_lr.pngbin458 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_r.pngbin136 -> 96 bytes
-rwxr-xr-xdoc/src/template/images/bg_ul.pngbin516 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_ul_blank.pngbin304 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_ur.pngbin437 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/bg_ur_blank.pngbin437 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/box_bg.pngbin129 -> 89 bytes
-rwxr-xr-xdoc/src/template/images/breadcrumb.pngbin195 -> 134 bytes
-rwxr-xr-xdoc/src/template/images/bullet_gt.pngbin185 -> 124 bytes
-rwxr-xr-xdoc/src/template/images/bullet_sq.pngbin117 -> 74 bytes
-rwxr-xr-xdoc/src/template/images/content_bg.pngbin1498 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/form_bg.pngbin390 -> 0 bytes
-rw-r--r--doc/src/template/images/header.pngbin2600 -> 0 bytes
-rw-r--r--doc/src/template/images/page.pngbin0 -> 3102 bytes
-rwxr-xr-xdoc/src/template/images/page_bg.pngbin126 -> 84 bytes
-rwxr-xr-xdoc/src/template/images/print.pngbin575 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/qt_guide.pngbin12685 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/qt_icon.pngbin4775 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/qt_ref_doc.pngbin2600 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/qt_tools.pngbin17508 -> 0 bytes
-rwxr-xr-xdoc/src/template/images/sep.pngbin120 -> 0 bytes
-rw-r--r--doc/src/template/images/spinner.gifbin0 -> 2037 bytes
-rwxr-xr-xdoc/src/template/images/sprites-combined.pngbin18070 -> 62534 bytes
-rwxr-xr-xdoc/src/template/scripts/functions.js162
-rwxr-xr-xdoc/src/template/style/style.css907
-rw-r--r--doc/src/widgets-and-layouts/layout.qdoc1
-rw-r--r--doc/src/widgets-and-layouts/styles.qdoc1
-rw-r--r--doc/src/widgets-and-layouts/widgets.qdoc1
-rw-r--r--doc/src/windows-and-dialogs/dialogs.qdoc1
-rw-r--r--doc/src/windows-and-dialogs/mainwindow.qdoc1
-rw-r--r--mkspecs/common/symbian/symbian.conf2
-rw-r--r--qmake/generators/win32/msvc_objectmodel.h2
-rw-r--r--qmake/generators/win32/msvc_vcxproj.cpp1
-rw-r--r--qmake/qmake.pri8
-rw-r--r--src/3rdparty/webkit/.tag2
-rw-r--r--src/3rdparty/webkit/JavaScriptCore/ChangeLog23
-rw-r--r--src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h6
-rw-r--r--src/3rdparty/webkit/VERSION2
-rw-r--r--src/3rdparty/webkit/WebCore/ChangeLog262
-rw-r--r--src/3rdparty/webkit/WebCore/WebCore.gypi18
-rw-r--r--src/3rdparty/webkit/WebCore/WebCore.pri4
-rw-r--r--src/3rdparty/webkit/WebCore/WebCore.pro6
-rw-r--r--src/3rdparty/webkit/WebCore/css/StyleMedia.cpp (renamed from src/3rdparty/webkit/WebCore/css/Media.cpp)8
-rw-r--r--src/3rdparty/webkit/WebCore/css/StyleMedia.h (renamed from src/3rdparty/webkit/WebCore/css/Media.h)17
-rw-r--r--src/3rdparty/webkit/WebCore/css/StyleMedia.idl (renamed from src/3rdparty/webkit/WebCore/css/Media.idl)3
-rw-r--r--src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp10
-rw-r--r--src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h2
-rw-r--r--src/3rdparty/webkit/WebCore/generated/JSMedia.cpp201
-rw-r--r--src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp201
-rw-r--r--src/3rdparty/webkit/WebCore/generated/JSStyleMedia.h (renamed from src/3rdparty/webkit/WebCore/generated/JSMedia.h)30
-rw-r--r--src/3rdparty/webkit/WebCore/page/AbstractView.idl2
-rw-r--r--src/3rdparty/webkit/WebCore/page/DOMWindow.cpp6
-rw-r--r--src/3rdparty/webkit/WebCore/page/DOMWindow.h8
-rw-r--r--src/3rdparty/webkit/WebCore/page/DOMWindow.idl2
-rw-r--r--src/3rdparty/webkit/WebCore/page/EventHandler.cpp13
-rw-r--r--src/3rdparty/webkit/WebCore/page/FrameView.h2
-rw-r--r--src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp13
-rw-r--r--src/3rdparty/webkit/WebCore/page/SpatialNavigation.h5
-rw-r--r--src/3rdparty/webkit/WebCore/platform/ScrollView.cpp1
-rw-r--r--src/3rdparty/webkit/WebCore/platform/ScrollView.h3
-rw-r--r--src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp16
-rw-r--r--src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp29
-rw-r--r--src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h11
-rw-r--r--src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp13
-rw-r--r--src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h1
-rw-r--r--src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp2
-rw-r--r--src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubsQt.cpp (renamed from src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubs.cpp)0
-rw-r--r--src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp22
-rw-r--r--src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp32
-rw-r--r--src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h2
-rw-r--r--src/3rdparty/webkit/WebKit/qt/ChangeLog58
-rw-r--r--src/3rdparty/webkit/WebKit/qt/docs/qtwebkit.qdoc4
-rw-r--r--src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def2
-rw-r--r--src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def2
-rw-r--r--src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp17
-rw-r--r--src/corelib/io/qurl.cpp6
-rw-r--r--src/corelib/kernel/qabstractitemmodel.cpp56
-rw-r--r--src/corelib/kernel/qcoreapplication.cpp13
-rw-r--r--src/corelib/kernel/qcoreapplication_p.h7
-rw-r--r--src/corelib/kernel/qeventdispatcher_symbian.cpp2
-rw-r--r--src/corelib/kernel/qeventdispatcher_symbian_p.h1
-rw-r--r--src/corelib/tools/qchar.cpp31
-rw-r--r--src/corelib/tools/qchar.h9
-rw-r--r--src/corelib/tools/qdatetime.cpp44
-rw-r--r--src/corelib/tools/qdatetime.h1
-rw-r--r--src/corelib/tools/qlocale.cpp12
-rw-r--r--src/corelib/tools/qlocale_p.h18
-rw-r--r--src/corelib/tools/qlocale_symbian.cpp53
-rw-r--r--src/corelib/tools/qmap.h20
-rw-r--r--src/dbus/qdbusinternalfilters.cpp2
-rw-r--r--src/dbus/qdbusxmlgenerator.cpp2
-rw-r--r--src/declarative/graphicsitems/qdeclarativegridview_p.h2
-rw-r--r--src/declarative/graphicsitems/qdeclarativelistview_p.h2
-rw-r--r--src/declarative/qml/qdeclarativebinding_p.h2
-rw-r--r--src/declarative/qml/qdeclarativecompiledbindings_p.h4
-rw-r--r--src/declarative/qml/qdeclarativecomponent_p.h2
-rw-r--r--src/declarative/qml/qdeclarativecompositetypemanager.cpp39
-rw-r--r--src/declarative/qml/qdeclarativecontext.h2
-rw-r--r--src/declarative/qml/qdeclarativeguard_p.h2
-rw-r--r--src/declarative/qml/qdeclarativeimport.cpp2
-rw-r--r--src/declarative/qml/qdeclarativepropertycache.cpp2
-rw-r--r--src/declarative/qml/qdeclarativescriptstring.h2
-rw-r--r--src/declarative/qml/qdeclarativestringconverters_p.h2
-rw-r--r--src/declarative/qml/qdeclarativeworkerscript_p.h2
-rw-r--r--src/declarative/qml/qdeclarativexmlhttprequest.cpp6
-rw-r--r--src/declarative/util/qdeclarativelistmodelworkeragent_p.h2
-rw-r--r--src/declarative/util/qdeclarativesmoothedanimation_p.h2
-rw-r--r--src/declarative/util/qdeclarativesmoothedfollow_p.h2
-rw-r--r--src/declarative/util/qdeclarativetransitionmanager_p_p.h2
-rw-r--r--src/gui/dialogs/qcolordialog_mac.mm20
-rw-r--r--src/gui/dialogs/qfiledialog_mac.mm32
-rw-r--r--src/gui/dialogs/qfontdialog_mac.mm16
-rw-r--r--src/gui/dialogs/qnspanelproxy_mac.mm24
-rw-r--r--src/gui/dialogs/qpagesetupdialog_mac.mm8
-rw-r--r--src/gui/dialogs/qprintdialog_mac.mm8
-rw-r--r--src/gui/dialogs/qwizard_win.cpp3
-rw-r--r--src/gui/graphicsview/qgraphicsitem.cpp7
-rw-r--r--src/gui/kernel/qapplication.cpp17
-rw-r--r--src/gui/kernel/qapplication_win.cpp2
-rw-r--r--src/gui/kernel/qdnd_qws.cpp4
-rw-r--r--src/gui/kernel/qdnd_x11.cpp6
-rw-r--r--src/gui/kernel/qgesturemanager.cpp33
-rw-r--r--src/gui/kernel/qgesturemanager_p.h2
-rw-r--r--src/gui/kernel/qsound_mac.mm6
-rw-r--r--src/gui/kernel/qwidget.cpp3
-rw-r--r--src/gui/kernel/qwidget_mac.mm30
-rw-r--r--src/gui/kernel/qwidget_win.cpp2
-rw-r--r--src/gui/kernel/qwidget_wince.cpp2
-rw-r--r--src/gui/kernel/qwidget_x11.cpp2
-rw-r--r--src/gui/painting/qpaintengine_x11.cpp2
-rw-r--r--src/gui/painting/qprintengine_pdf.cpp46
-rw-r--r--src/gui/painting/qprintengine_pdf_p.h1
-rw-r--r--src/gui/styles/qcleanlooksstyle.cpp6
-rw-r--r--src/gui/styles/qgtkstyle.cpp45
-rw-r--r--src/gui/util/qcompleter.cpp21
-rw-r--r--src/gui/util/qsystemtrayicon_mac.mm37
-rw-r--r--src/gui/widgets/qcocoatoolbardelegate_mac.mm2
-rw-r--r--src/gui/widgets/qcocoatoolbardelegate_mac_p.h2
-rw-r--r--src/gui/widgets/qmainwindowlayout_mac.mm2
-rw-r--r--src/network/access/qhttpnetworkconnection.cpp11
-rw-r--r--src/network/access/qhttpnetworkconnection_p.h2
-rw-r--r--src/network/access/qhttpnetworkconnectionchannel.cpp7
-rw-r--r--src/network/access/qhttpnetworkrequest.cpp13
-rw-r--r--src/network/access/qhttpnetworkrequest_p.h4
-rw-r--r--src/network/access/qnetworkaccessbackend.cpp5
-rw-r--r--src/network/access/qnetworkaccessbackend_p.h1
-rw-r--r--src/network/access/qnetworkaccesshttpbackend.cpp13
-rw-r--r--src/network/access/qnetworkaccesshttpbackend_p.h1
-rw-r--r--src/network/access/qnetworkaccessmanager.cpp27
-rw-r--r--src/network/access/qnetworkreplyimpl.cpp8
-rw-r--r--src/network/access/qnetworkrequest.cpp52
-rw-r--r--src/network/access/qnetworkrequest.h7
-rw-r--r--src/network/kernel/qhostinfo.cpp29
-rw-r--r--src/network/kernel/qhostinfo_p.h4
-rw-r--r--src/network/socket/qtcpserver.cpp18
-rw-r--r--src/network/socket/qtcpserver.h1
-rw-r--r--tests/auto/gestures/tst_gestures.cpp71
-rw-r--r--tests/auto/qdatetime/tst_qdatetime.cpp26
-rw-r--r--tests/auto/qfile/largefile/tst_largefile.cpp4
-rw-r--r--tests/auto/qnetworkreply/smb-file.txt1
-rw-r--r--tests/auto/qnetworkreply/tst_qnetworkreply.cpp23
-rw-r--r--tests/auto/qprinter/tst_qprinter.cpp28
-rw-r--r--tests/auto/qxmlquery/tst_qxmlquery.cpp18
-rw-r--r--tests/auto/xmlpatternsxqts/tst_suitetest.cpp15
-rw-r--r--tools/configure/configureapp.cpp4
-rw-r--r--tools/designer/src/designer/qdesigner_actions.cpp1
-rw-r--r--tools/qdoc3/htmlgenerator.cpp224
-rw-r--r--tools/qdoc3/htmlgenerator.h1
-rw-r--r--tools/qdoc3/node.cpp2
-rw-r--r--tools/qdoc3/test/assistant.qdocconf43
-rw-r--r--tools/qdoc3/test/designer.qdocconf57
-rw-r--r--tools/qdoc3/test/linguist.qdocconf57
-rw-r--r--tools/qdoc3/test/qdeclarative.qdocconf60
-rw-r--r--tools/qdoc3/test/qmake.qdocconf61
-rw-r--r--tools/qdoc3/test/qt-build-docs.qdocconf60
-rw-r--r--tools/qdoc3/test/qt-build-docs_zh_CN.qdocconf60
-rw-r--r--tools/qdoc3/test/qt-defines.qdocconf37
-rw-r--r--tools/qdoc3/test/qt-html-templates.qdocconf90
-rw-r--r--tools/qdoc3/test/qt.qdocconf52
-rw-r--r--tools/qdoc3/test/qt_zh_CN.qdocconf60
-rw-r--r--tools/qdoc3/test/style/style.css797
237 files changed, 4381 insertions, 1948 deletions
diff --git a/config.tests/unix/bsymbolic_functions.test b/config.tests/unix/bsymbolic_functions.test
index 52fdb32..6c34895 100755
--- a/config.tests/unix/bsymbolic_functions.test
+++ b/config.tests/unix/bsymbolic_functions.test
@@ -4,11 +4,12 @@ BSYMBOLIC_FUNCTIONS_SUPPORT=no
COMPILER=$1
VERBOSE=$2
+
cat >>bsymbolic_functions.c << EOF
int main() { return 0; }
EOF
-"$COMPILER" -o libtest.so -shared -Wl,-Bsymbolic-functions -fPIC bsymbolic_functions.c >/dev/null 2>&1 && BSYMBOLIC_FUNCTIONS_SUPPORT=yes
+$COMPILER -o libtest.so -shared -Wl,-Bsymbolic-functions -fPIC bsymbolic_functions.c >/dev/null 2>&1 && BSYMBOLIC_FUNCTIONS_SUPPORT=yes
rm -f bsymbolic_functions.c libtest.so
# done
diff --git a/configure b/configure
index a0ccf9a..d357fde 100755
--- a/configure
+++ b/configure
@@ -3097,8 +3097,8 @@ fi
# auto-detect support for separate debug info in objcopy
if [ "$CFG_SEPARATE_DEBUG_INFO" != "no" ] && [ "$CFG_SHARED" = "yes" ]; then
- TEST_COMPILER_CFLAGS=`getQMakeConf "$XQMAKESPEC" | sed -n -e 's%QMAKE_CFLAGS[^_].*=%%p' | tr '\n' ' '`
- TEST_COMPILER_CXXFLAGS=`getQMakeConf "$XQMAKESPEC" | sed -n -e 's%QMAKE_CXXFLAGS[^_].*=%%p' | tr '\n' ' '`
+ TEST_COMPILER_CFLAGS=`getQMakeConf "$XQMAKESPEC" | sed -n -e 's%QMAKE_CFLAGS[^_=]*[+*]*=%%p' | tr '\n' ' '`
+ TEST_COMPILER_CXXFLAGS=`getQMakeConf "$XQMAKESPEC" | sed -n -e 's%QMAKE_CXXFLAGS[^_=]*[+*]*=%%p' | tr '\n' ' '`
TEST_OBJCOPY=`getQMakeConf "$XQMAKESPEC" | grep "^QMAKE_OBJCOPY" | sed "s%.* *= *\(.*\)$%\1%" | tail -1`
COMPILER_WITH_FLAGS="$TEST_COMPILER $TEST_COMPILER_CXXFLAGS"
COMPILER_WITH_FLAGS=`echo "$COMPILER_WITH_FLAGS" | sed -e "s%\\$\\$QMAKE_CFLAGS%$TEST_COMPILER_CFLAGS%g"`
@@ -5915,7 +5915,7 @@ if [ "$PLATFORM_X11" = "yes" -o "$PLATFORM_QWS" = "yes" ]; then
fi
CFG_EGL=no
# If QtOpenGL would be built against OpenGL ES, disable it as we can't to that if EGL is missing
- if [ "$CFG_OPENGL" = "es1" || "$CFG_OPENGL" = "es2" ]; then
+ if [ "$CFG_OPENGL" = "es1" -o "$CFG_OPENGL" = "es2" ]; then
CFG_OPENGL=no
fi
fi
diff --git a/configure.exe b/configure.exe
index 35116ff..69e98dd 100755
--- a/configure.exe
+++ b/configure.exe
Binary files differ
diff --git a/dist/changes-4.7.0 b/dist/changes-4.7.0
index 4fd7fdb..6bf7ea5 100644
--- a/dist/changes-4.7.0
+++ b/dist/changes-4.7.0
@@ -27,6 +27,13 @@ General Improvements
- Support for the GL_EXT_geometry_shader4, aka Geometry Shaders, was added
to QGLShaderProgram.
+New features
+------------
+
+ - QNetworkSession, QNetworkConfiguration, QNetworkConfigurationManager
+ * New bearer management classes added.
+
+
Third party components
----------------------
@@ -44,6 +51,11 @@ Third party components
QtCore
------
+ - QXmlStreamReader
+ * [QTBUG-9196] fixed crash when parsing
+ - QTimer
+ * singleShot with 0 timeout will now avoid allocating objects
+
QtGui
-----
@@ -60,6 +72,82 @@ QtGui
* Fixed a bug that led to missing text pixels in QTabBar when using
small font sizes. (QTBUG-7137)
+ - QGraphicsEffect
+ * Fixed rendering bugs when scrolling graphics items with drop
+ shadows.
+
+ - QImage
+ * [QTBUG-9640] Prevented unneccessary copy in
+ QImage::setAlphaChannel().
+ * Added QImage::bitPlaneCount(). (QTBUG-7982)
+
+ - QPainter
+ * [QTBUG-10018] Fixed image drawing inconsistencies when drawing
+ 1x1 source rects with rotating / shear / perspective transforms.
+ * Optimized various blending and rendering operations for ARM
+ processors with a NEON vector unit.
+ * Fixed some performance issues when drawing sub-pixmaps of large
+ pixmaps and falling back to raster in the X11 paint engine.
+
+ - QPainterPath
+ * [QTBUG-3778] Fixed bug in painter path polygon intersection code.
+ * [QTBUG-7396] Optimized painter path intersections for when at
+ least one of the paths is a rectangle by special casing.
+ * [QTBUG-8035] Got rid of bezier intersection code in the boolean
+ operators (intersect, subtract, unite) to prevent numerical
+ stability issues.
+
+ - QRegion
+ * [QTBUG-7699] Fixed crash caused by large x-coordinates.
+
+ - QTransform
+ * [QTBUG-8557] Fixed bug in QTransform::type() potentially occuring
+ after using operator/ or operator* or their overloads.
+
+QtNetwork
+---------
+ - QHostInfo: Added a small 60 second DNS cache
+ - QNetworkAccessManager
+ * Performance improvements for file:// and http://
+ * Crash fixes
+ * Improvements on HTTP pipelining
+ * Fix problem with canReadLine()
+ * Fix problem with HTTP 100 reply
+ * Some new attributes for QNetworkRequest
+ * [QTBUG-8206] add method to send custom requests
+ * [QTBUG-9618] [MR 2372] send secure cookies only over secure connections
+ * [QTBUG-7713] Fix bug related to re-sending request
+ * [QTBUG-7673] Fix issue with some webservers
+ - Sockets
+ * Better support for derived QTcpServer
+ * [QTBUG-7054] Fix error handling with waitFor*() for socket engine
+ * [QTBUG-7316, QTBUG-7317] Also handle unknown errors from socket engine
+ - SSL
+ * [QTBUG-2515] Do not make OpenSSL prompt for a password
+ * [QTBUG-6504, QTBUG-8924, QTBUG-5645] Fix memleak
+
+QtXmlPatterns
+-------------
+
+ - [QTBUG-8920] fixed crash with anonymous types in XsdSchemaChecker
+ - [QTBUG-8394] include/import/redefine schemas only once
+ - QXmlSchema: fix crash with referencing elements
+
+Qt Plugins
+----------
+
+ - Jpeg image IO plugin
+ * Fixed failure to store certain QImage formats as jpeg (QTBUG-7780)
+ * Optimized smoothscaling
+ * Optimized to avoid data copy when reading from memory device (QTBUG-9095)
+
+ - SVG image IO plugin
+ * Added support for svgz format (QTBUG-8227)
+ * Fixed canRead() so that it can be used also for non-sequential
+ devices. (QTBUG-9053)
+ * Added support for clipping and scaling and backgroundcolor
+ * Optimized to avoid data copy when reading from memory device (QTBUG-9095)
+
****************************************************************************
* Database Drivers *
****************************************************************************
diff --git a/doc/src/classes.qdoc b/doc/src/classes.qdoc
index 1552f56..594c1fe 100644
--- a/doc/src/classes.qdoc
+++ b/doc/src/classes.qdoc
@@ -59,7 +59,7 @@
/*!
\page classes.html
- \title All Qt Classes
+ \title All Classes
\ingroup classlists
\brief If you know the name of the class you want, find it here.
@@ -71,7 +71,7 @@
\generatelist classes
- \sa {Qt3 Support Classes}, {All Qt Modules}, {Obsolete Classes}
+ \sa {Qt3 Support Classes}, {All Modules}, {Obsolete Classes}
*/
/*!
@@ -162,7 +162,7 @@
/*!
\page namespaces.html
- \title All Qt Namespaces
+ \title All Namespaces
\ingroup classlists
\brief A Qt namespace contains enum types, functions, and sometimes classes.
diff --git a/doc/src/declarative/declarativeui.qdoc b/doc/src/declarative/declarativeui.qdoc
index d79c4d2..5283ba8 100644
--- a/doc/src/declarative/declarativeui.qdoc
+++ b/doc/src/declarative/declarativeui.qdoc
@@ -40,46 +40,42 @@
****************************************************************************/
/*!
-\title Declarative UI Using QML
+\title Qt Quick
\page declarativeui.html
-\brief The Qt Declarative module provides a declarative framework for building
-highly dynamic, custom user interfaces.
+\brief Qt Quick provides a declarative framework for building highly
+dynamic, custom user interfaces.
-\section1 \l{QML Elements}{Fast QML Elements Reference Page}
+Qt Quick provides a declarative framework for building highly dynamic,
+custom user interfaces from a rich set of \l {QML Elements}{QML elements}.
+Qt Quick helps programmers and designers collaborate to
+build the fluid user interfaces that are becoming common in portable
+consumer devices, such as mobile phones, media players, set-top boxes
+and netbooks.
-\raw HTML
-<br>
-\endraw
+QML is an extension to \l
+{http://www.ecma-international.org/publications/standards/Ecma-262.htm}
+{JavaScript}, that provides a mechanism to declaratively build an
+object tree of \l {QML Elements}{QML elements}. QML improves the
+integration between JavaScript and Qt's existing QObject based type
+system, adds support for automatic \l {Property Binding}{property
+bindings} and provides \l {Network Transparency}{network transparency}
+at the language level.
-\section1 Preamble
+The \l {QML Elements}{QML elements} are a sophisticated set of
+graphical and behavioral building blocks. These different elements
+are combined together in \l {QML Documents}{QML documents} to build
+components ranging in complexity from simple buttons and sliders, to
+complete internet-enabled applications like a \l
+{http://www.flickr.com}{Flickr} photo browser.
-Qt Declarative UI provides a declarative framework for building highly dynamic, custom
-user interfaces. Declarative UI helps programmers and designers collaborate to build
-the animation rich, fluid user interfaces that are becoming common in portable
-consumer devices, such as mobile phones, media players, set-top boxes and netbooks.
+Qt Quick builds on \l {QML for Qt programmers}{Qt's existing
+strengths}. QML can be be used to incrementally extend an existing
+application or to build completely new applications. QML is fully \l
+{Extending QML in C++}{extensible from C++}.
-The Qt Declarative module provides an engine for interpreting the declarative
-QML language, and a rich set of \bold { \l {QML Elements}{QML elements} }
-that can be used from QML.
+\section1 Getting Started
-QML is an extension to \l {http://www.ecma-international.org/publications/standards/Ecma-262.htm}
-{JavaScript}, that provides a mechanism to declaratively build an object tree
-of QML elements. QML improves the integration between JavaScript and Qt's
-existing QObject based type system, adds support for automatic
-\l {Property Binding}{property bindings} and provides \l {Network Transparency}{network transparency} at the language
-level.
-
-The QML elements are a sophisticated set of graphical and behavioral building
-blocks. These different elements are combined together in \l {QML Documents}{QML documents} to build components
-ranging in complexity from simple buttons and sliders, to complete
-internet-enabled applications like a \l {http://www.flickr.com}{Flickr} photo browser.
-
-Qt Declarative builds on \l {QML for Qt programmers}{Qt's existing strengths}.
-QML can be be used to incrementally extend an existing application or to build
-completely new applications. QML is fully \l {Extending QML in C++}{extensible from C++}.
-
-\section1 Getting Started:
\list
\o \l {Introduction to the QML language}
\o \l {QML Tutorial}{Tutorial: 'Hello World'}
@@ -88,7 +84,7 @@ completely new applications. QML is fully \l {Extending QML in C++}{extensible
\o \l {QML for Qt programmers}
\endlist
-\section1 Core QML Features:
+\section1 Core QML Features
\list
\o \l {QML Documents}
\o \l {Property Binding}
@@ -106,7 +102,7 @@ completely new applications. QML is fully \l {Extending QML in C++}{extensible
\o \l {qmlruntime.html}{The Qt Declarative Runtime}
\endlist
-\section1 Using QML with C++:
+\section1 Using QML with C++
\list
\o \l {Tutorial: Writing QML extensions with C++}
\o \l {Extending QML in C++}
@@ -114,7 +110,7 @@ completely new applications. QML is fully \l {Extending QML in C++}{extensible
\o \l {Integrating QML with existing Qt UI code}
\endlist
-\section1 Reference:
+\section1 Reference
\list
\o \l {QML Elements}
\o \l {QML Global Object}
diff --git a/doc/src/declarative/examples.qdoc b/doc/src/declarative/examples.qdoc
index e01459f..481617e 100644
--- a/doc/src/declarative/examples.qdoc
+++ b/doc/src/declarative/examples.qdoc
@@ -40,8 +40,9 @@
****************************************************************************/
/*!
-\page qdeclarativeexamples.html
-\title QML Examples and Demos
+ \page qdeclarativeexamples.html
+ \title QML Examples and Demos
+ \ingroup all-examples
\previouspage Graphics View Examples
\contentspage Qt Examples
diff --git a/doc/src/development/qmake-manual.qdoc b/doc/src/development/qmake-manual.qdoc
index 688122b..c63e96c 100644
--- a/doc/src/development/qmake-manual.qdoc
+++ b/doc/src/development/qmake-manual.qdoc
@@ -347,6 +347,7 @@
\row \o vcapp \o Creates a Visual Studio Project file to build
an application.
\row \o vclib \o Creates a Visual Studio Project file to build a library.
+ \row \o vcsubdirs \o Creates a Visual Studio Solution file to build projects in sub-directories.
\endtable
See the \l{qmake Tutorial} for advice on writing project files for
diff --git a/doc/src/diagrams/modelview-move-rows-1.sk b/doc/src/diagrams/modelview-move-rows-1.sk
new file mode 100644
index 0000000..dc90cfb
--- /dev/null
+++ b/doc/src/diagrams/modelview-move-rows-1.sk
@@ -0,0 +1,271 @@
+##Sketch 1 2
+document()
+layout('A4',0)
+layer('Layer 1',1,1,0,0,(0,0,0))
+fp((1,1,1))
+lw(1)
+ld((5, 5))
+r(30,0,0,-30,220,515)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,665)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,664.044)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,425)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,337.5)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,605)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,515.177)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,575)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,485.177)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,277.5,575)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,335)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,575)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,545)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30.262,220,305.262)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,307.5)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,455.177)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,635)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,545.177)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,695)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30.956,415.038,695)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,455)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,367.5)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,277.5,605)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,365)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,605)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,277.5,635)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,395)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,635)
+le()
+lw(1)
+r(165,0,0,-230,210,705)
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,673.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(424.478,672.184))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(424.44,345.64))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,643.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(424.478,642.184))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,403.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(424.44,315.64))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,613.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(424.478,523.317))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(286.94,613.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,373.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(424.44,613.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,583.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(424.478,493.317))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(286.94,583.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,343.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(424.44,583.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,553.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(424.478,463.317))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(286.94,553.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,313.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(424.44,553.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.44,523.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.133,283.402))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(424.44,285.64))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(424.478,433.317))
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(277.5,635,0)
+bs(252.5,635,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(292.5,380,0)
+bs(292.5,542.5,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(250,380,0)
+bs(290,380,0)
+guidelayer('Guide Lines',1,0,0,1,(0,0,1))
+grid((0,0,2.5,2.5),1,(0,0,1),'Grid')
diff --git a/doc/src/diagrams/modelview-move-rows-2.sk b/doc/src/diagrams/modelview-move-rows-2.sk
new file mode 100644
index 0000000..7ddb95e
--- /dev/null
+++ b/doc/src/diagrams/modelview-move-rows-2.sk
@@ -0,0 +1,271 @@
+##Sketch 1 2
+document()
+layout('A4',0)
+layer('Layer 1',1,1,0,0,(0,0,0))
+fp((1,1,1))
+lw(1)
+ld((5, 5))
+r(30,0,0,-30,220,515)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,665)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,664.044)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,425)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,337.5)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,605)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,605)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,575)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,575)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,275,455)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,335)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,455)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,545)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,545)
+fp((1,1,1))
+lw(1)
+r(29.6927,0,0,-30,220,305.262)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,307.5)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,635)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,635)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,695)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415.038,694.044)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,455)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,415,367.5)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,275,485)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,365)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,485)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,275,515)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,395)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,415,515)
+le()
+lw(1)
+r(165,0,0,-230,210,705)
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,673.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(424.478,672.184))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(424.44,345.64))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,643.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(424.478,642.184))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,403.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(424.44,315.64))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,613.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(424.44,613.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(284.44,493.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,373.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(424.44,493.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,583.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(424.44,583.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(284.44,463.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,343.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(424.44,463.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,553.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(424.44,553.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(284.44,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,313.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(424.44,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.44,523.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(424.44,523.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.133,283.402))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(424.44,285.64))
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(275,515,0)
+bs(252.5,515,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(292.5,380,0)
+bs(292.5,422.5,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(250,380,0)
+bs(290,380,0)
+guidelayer('Guide Lines',1,0,0,1,(0,0,1))
+grid((0,0,2.5,2.5),1,(0,0,1),'Grid')
diff --git a/doc/src/diagrams/modelview-move-rows-3.sk b/doc/src/diagrams/modelview-move-rows-3.sk
new file mode 100644
index 0000000..33a9ad1
--- /dev/null
+++ b/doc/src/diagrams/modelview-move-rows-3.sk
@@ -0,0 +1,137 @@
+##Sketch 1 2
+document()
+layout('A4',0)
+layer('Layer 1',1,1,0,0,(0,0,0))
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,425)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,344.997,400)
+lw(1)
+r(30,0,0,-30,220,335)
+lw(1)
+r(30,0,0,-30,345,339.739)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,305.262)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,345,310)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,455)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,344.997,430)
+lw(1)
+r(30,0,0,-30,220,365)
+lw(1)
+r(30,0,0,-30,345,369.739)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,272.5,455)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,345,460)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,395)
+le()
+lw(1)
+r(165,0,0,-230,210,705)
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,433.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(354.437,408.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,403.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(354.437,378.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(281.94,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(354.44,438.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,373.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,343.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(354.44,347.879))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,313.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(354.44,317.879))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.133,283.402))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(355.049,288.14))
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(272.5,455,0)
+bs(252.5,455,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(287.5,380,0)
+bs(287.5,422.5,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(250,380,0)
+bs(285,380,0)
+guidelayer('Guide Lines',1,0,0,1,(0,0,1))
+grid((0,0,2.5,2.5),1,(0,0,1),'Grid')
diff --git a/doc/src/diagrams/modelview-move-rows-4.sk b/doc/src/diagrams/modelview-move-rows-4.sk
new file mode 100644
index 0000000..0531749
--- /dev/null
+++ b/doc/src/diagrams/modelview-move-rows-4.sk
@@ -0,0 +1,137 @@
+##Sketch 1 2
+document()
+layout('A4',0)
+layer('Layer 1',1,1,0,0,(0,0,0))
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,425)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,345,430)
+lw(1)
+r(30,0,0,-30,220,335.18)
+lw(1)
+r(30,0,0,-30,345,339.739)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30.442,220,305.442)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,345,310)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,220,455)
+fp((1,1,1))
+lw(1)
+r(30,0,0,-30,345,460)
+lw(1)
+r(30,0,0,-30,220,365)
+lw(1)
+r(30,0,0,-30,345,400)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,272.5,335)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,345,370)
+fp((0.753,0.753,1))
+lw(1)
+r(30,0,0,-30,220,395)
+le()
+lw(1)
+r(165,0,0,-230,210,705)
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(229.44,433.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('0',(354.44,438.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(229.44,403.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('1',(354.44,408.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(281.94,313.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(354.44,348.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('2',(229.44,373.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(229.44,343.14))
+fp((0.503,0.503,0.503))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('3',(354.44,378.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(229.44,313.14))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('4',(354.44,317.879))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(229.44,283.582))
+fp((0,0,0))
+le()
+lw(1)
+Fn('Helvetica')
+Fs(20)
+txt('5',(354.44,288.14))
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(272.5,335,0)
+bs(252.5,335,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(287.5,380,0)
+bs(287.5,337.5,0)
+lw(1.5)
+la2(([(-4.0, 3.0), (2.0, 0.0), (-4.0, -3.0), (-4.0, 3.0)], 1))
+b()
+bs(250,380,0)
+bs(285,380,0)
+guidelayer('Guide Lines',1,0,0,1,(0,0,1))
+grid((0,0,2.5,2.5),1,(0,0,1),'Grid')
diff --git a/doc/src/files-and-resources/datastreamformat.qdoc b/doc/src/files-and-resources/datastreamformat.qdoc
index bab2c2c..c4be7bb 100644
--- a/doc/src/files-and-resources/datastreamformat.qdoc
+++ b/doc/src/files-and-resources/datastreamformat.qdoc
@@ -41,7 +41,8 @@
/*!
\page datastreamformat.html
- \title Format of the QDataStream Operators
+ \title Serializing Qt Data Types
+ \ingroup qt-network
\brief Representations of data types that can be serialized by QDataStream.
The \l QDataStream allows you to serialize some of the Qt data types.
diff --git a/doc/src/files-and-resources/resources.qdoc b/doc/src/files-and-resources/resources.qdoc
index 00646ac..83d74a3 100644
--- a/doc/src/files-and-resources/resources.qdoc
+++ b/doc/src/files-and-resources/resources.qdoc
@@ -54,6 +54,8 @@
/*!
\page resources.html
\title The Qt Resource System
+ \ingroup qt-network
+ \brief A platform-independent mechanism for storing binary files in an application.
\keyword resource system
diff --git a/doc/src/frameworks-technologies/accessible.qdoc b/doc/src/frameworks-technologies/accessible.qdoc
index 101d22a..35f1c75 100644
--- a/doc/src/frameworks-technologies/accessible.qdoc
+++ b/doc/src/frameworks-technologies/accessible.qdoc
@@ -47,8 +47,7 @@
/*!
\page accessible.html
\title Accessibility
-
- \ingroup frameworks-technologies
+ \ingroup technology-apis
\tableofcontents
diff --git a/doc/src/frameworks-technologies/activeqt-container.qdoc b/doc/src/frameworks-technologies/activeqt-container.qdoc
index c1c0947..03cfa8f 100644
--- a/doc/src/frameworks-technologies/activeqt-container.qdoc
+++ b/doc/src/frameworks-technologies/activeqt-container.qdoc
@@ -41,10 +41,11 @@
/*!
\page activeqt-container.html
- \title Using ActiveX controls and COM objects in Qt
+ \title Using ActiveX controls and COM in Qt
+ \ingroup qt-activex
- \brief The QAxContainer module is a Windows-only extension for
- accessing ActiveX controls and COM objects.
+ \brief A Windows-only extension for accessing ActiveX controls and
+ COM objects.
The QAxContainer module is part of the \l ActiveQt framework. It
provides a library implementing a QWidget subclass, QAxWidget,
diff --git a/doc/src/frameworks-technologies/activeqt-server.qdoc b/doc/src/frameworks-technologies/activeqt-server.qdoc
index 4afcee1..900953a 100644
--- a/doc/src/frameworks-technologies/activeqt-server.qdoc
+++ b/doc/src/frameworks-technologies/activeqt-server.qdoc
@@ -41,10 +41,10 @@
/*!
\page activeqt-server.html
- \title Building ActiveX servers and controls with Qt
+ \title Building ActiveX servers in Qt
+ \ingroup qt-activex
- \brief The QAxServer module is a Windows-only static library that
- you can use to turn a standard Qt binary into a COM server.
+ \brief A Windows-only static library for turning a Qt binary into a COM server.
The QAxServer module is part of the \l ActiveQt framework. It
consists of three classes:
diff --git a/doc/src/frameworks-technologies/activeqt.qdoc b/doc/src/frameworks-technologies/activeqt.qdoc
index b752122..6f4ec30 100644
--- a/doc/src/frameworks-technologies/activeqt.qdoc
+++ b/doc/src/frameworks-technologies/activeqt.qdoc
@@ -53,11 +53,10 @@
/*!
\page activeqt.html
- \title ActiveQt Framework
+ \title Qt's ActiveX Framework (ActiveQt)
\brief An overview of Qt's ActiveX and COM integration on Windows.
- \ingroup platform-specific
- \ingroup frameworks-technologies
+ \ingroup qt-activex
\keyword ActiveQt
Qt's ActiveX and COM support allows Qt for Windows developers to:
diff --git a/doc/src/frameworks-technologies/animation.qdoc b/doc/src/frameworks-technologies/animation.qdoc
index 5548b57..dc705ba 100644
--- a/doc/src/frameworks-technologies/animation.qdoc
+++ b/doc/src/frameworks-technologies/animation.qdoc
@@ -47,6 +47,7 @@
/*!
\page animation-overview.html
\title The Animation Framework
+ \ingroup qt-gui-concepts
\brief An overview of the Animation Framework
diff --git a/doc/src/frameworks-technologies/containers.qdoc b/doc/src/frameworks-technologies/containers.qdoc
index 505b65c..5b184fa 100644
--- a/doc/src/frameworks-technologies/containers.qdoc
+++ b/doc/src/frameworks-technologies/containers.qdoc
@@ -58,7 +58,7 @@
/*!
\page containers.html
\title Generic Containers
- \ingroup frameworks-technologies
+ \ingroup technology-apis
\ingroup groups
\keyword container class
\keyword container classes
diff --git a/doc/src/frameworks-technologies/dbus-adaptors.qdoc b/doc/src/frameworks-technologies/dbus-adaptors.qdoc
index 5fc7a79..11c5998 100644
--- a/doc/src/frameworks-technologies/dbus-adaptors.qdoc
+++ b/doc/src/frameworks-technologies/dbus-adaptors.qdoc
@@ -42,6 +42,7 @@
/*!
\page usingadaptors.html
\title Using QtDBus Adaptors
+ \ingroup technology-apis
\ingroup best-practices
diff --git a/doc/src/frameworks-technologies/dbus-intro.qdoc b/doc/src/frameworks-technologies/dbus-intro.qdoc
index 1fe2ed2..10726e5 100644
--- a/doc/src/frameworks-technologies/dbus-intro.qdoc
+++ b/doc/src/frameworks-technologies/dbus-intro.qdoc
@@ -45,7 +45,7 @@
\brief An introduction to Inter-Process Communication and Remote Procedure Calling with D-Bus.
\keyword QtDBus
- \ingroup frameworks-technologies
+ \ingroup technology-apis
\section1 Introduction
diff --git a/doc/src/frameworks-technologies/desktop-integration.qdoc b/doc/src/frameworks-technologies/desktop-integration.qdoc
index 7f01ae3..59b2570 100644
--- a/doc/src/frameworks-technologies/desktop-integration.qdoc
+++ b/doc/src/frameworks-technologies/desktop-integration.qdoc
@@ -40,16 +40,12 @@
****************************************************************************/
/*!
- \group desktop
- \title Desktop Integration Classes
-*/
-
-/*!
\page desktop-integration.html
\title Desktop Integration
\brief Integrating with the user's desktop environment.
\ingroup best-practices
+ \ingroup qt-gui-concepts
Qt applications behave well in the user's desktop environment, but certain
integrations require additional, and sometimes platform specific, techniques.
diff --git a/doc/src/frameworks-technologies/dnd.qdoc b/doc/src/frameworks-technologies/dnd.qdoc
index 49468de..0e952ad 100644
--- a/doc/src/frameworks-technologies/dnd.qdoc
+++ b/doc/src/frameworks-technologies/dnd.qdoc
@@ -40,18 +40,12 @@
****************************************************************************/
/*!
- \group draganddrop
- \title Drag And Drop Classes
-
- \brief Classes dealing with drag and drop and mime type encoding and decoding.
-*/
-
-/*!
\page dnd.html
\title Drag and Drop
\brief An overview of the drag and drop system provided by Qt.
- \ingroup frameworks-technologies
+ \ingroup technology-apis
+ \ingroup qt-gui-concepts
Drag and drop provides a simple visual mechanism which users can use
to transfer information between and within applications. (In the
diff --git a/doc/src/frameworks-technologies/eventsandfilters.qdoc b/doc/src/frameworks-technologies/eventsandfilters.qdoc
index 96ee18c..0cd60b8 100644
--- a/doc/src/frameworks-technologies/eventsandfilters.qdoc
+++ b/doc/src/frameworks-technologies/eventsandfilters.qdoc
@@ -54,7 +54,8 @@
/*!
\page eventsandfilters.html
- \title Events and Event Filters
+ \title The Event System
+ \ingroup qt-basic-concepts
\brief A guide to event handling in Qt.
\ingroup frameworks-technologies
diff --git a/doc/src/frameworks-technologies/gestures.qdoc b/doc/src/frameworks-technologies/gestures.qdoc
index 1b395b0..c999fa6 100644
--- a/doc/src/frameworks-technologies/gestures.qdoc
+++ b/doc/src/frameworks-technologies/gestures.qdoc
@@ -42,12 +42,13 @@
/*!
\page gestures-overview.html
\title Gestures Programming
- \ingroup frameworks-technologies
\startpage index.html Qt Reference Documentation
+ \ingroup technology-apis
+ \ingroup qt-gui-concepts
- \brief An overview of the Qt support for Gesture programming.
+ \brief An overview of Qt support for Gesture programming.
- Qt includes a framework for gesture programming that gives has the ability
+ Qt includes a framework for gesture programming that has the ability
to form gestures from a series of events, independently of the input methods
used. A gesture could be a particular movement of a mouse, a touch screen
action, or a series of events from some other source. The nature of the input,
diff --git a/doc/src/frameworks-technologies/graphicsview.qdoc b/doc/src/frameworks-technologies/graphicsview.qdoc
index 6844aed..681568e 100644
--- a/doc/src/frameworks-technologies/graphicsview.qdoc
+++ b/doc/src/frameworks-technologies/graphicsview.qdoc
@@ -46,12 +46,11 @@
/*!
\page graphicsview.html
- \title The Graphics View Framework
+ \title Graphics View Framework
+ \ingroup qt-graphics
\brief An overview of the Graphics View framework for interactive 2D
graphics.
- \ingroup frameworks-technologies
-
\keyword Graphics View
\keyword GraphicsView
\keyword Graphics
diff --git a/doc/src/frameworks-technologies/implicit-sharing.qdoc b/doc/src/frameworks-technologies/implicit-sharing.qdoc
index e4d6f65..f42ec93 100644
--- a/doc/src/frameworks-technologies/implicit-sharing.qdoc
+++ b/doc/src/frameworks-technologies/implicit-sharing.qdoc
@@ -50,7 +50,7 @@
/*!
\page implicit-sharing.html
\title Implicit Sharing
- \ingroup frameworks-technologies
+ \ingroup qt-basic-concepts
\brief Reference counting for fast copying.
diff --git a/doc/src/frameworks-technologies/ipc.qdoc b/doc/src/frameworks-technologies/ipc.qdoc
index 18a9455..5139f04 100644
--- a/doc/src/frameworks-technologies/ipc.qdoc
+++ b/doc/src/frameworks-technologies/ipc.qdoc
@@ -44,7 +44,8 @@
\title Inter-Process Communication in Qt
\brief Inter-Process communication in Qt applications.
- \ingroup frameworks-technologies
+ \ingroup technology-apis
+ \ingout qt-network
Qt provides several ways to implement Inter-Process Communication
(IPC) in Qt applications.
diff --git a/doc/src/frameworks-technologies/phonon.qdoc b/doc/src/frameworks-technologies/phonon.qdoc
index 2d035c7..61d7926 100644
--- a/doc/src/frameworks-technologies/phonon.qdoc
+++ b/doc/src/frameworks-technologies/phonon.qdoc
@@ -41,8 +41,8 @@
/*!
\page phonon-overview.html
- \title Phonon Overview
- \ingroup frameworks-technologies
+ \title Phonon multimedia framework
+ \ingroup technology-apis
\tableofcontents
diff --git a/doc/src/frameworks-technologies/threads.qdoc b/doc/src/frameworks-technologies/threads.qdoc
index fd6bebb..f7dde59 100644
--- a/doc/src/frameworks-technologies/threads.qdoc
+++ b/doc/src/frameworks-technologies/threads.qdoc
@@ -47,6 +47,7 @@
/*!
\page threads.html
\title Thread Support in Qt
+ \ingroup qt-basic-concepts
\brief A detailed discussion of thread handling in Qt.
\ingroup frameworks-technologies
diff --git a/doc/src/frameworks-technologies/unicode.qdoc b/doc/src/frameworks-technologies/unicode.qdoc
index 8fa168a..88393a0 100644
--- a/doc/src/frameworks-technologies/unicode.qdoc
+++ b/doc/src/frameworks-technologies/unicode.qdoc
@@ -58,7 +58,7 @@
\keyword Unicode
- \ingroup frameworks-technologies
+ \ingroup technology-apis
Unicode is a multi-byte character set, portable across all major
computing platforms and with decent coverage over most of the world.
diff --git a/doc/src/getting-started/demos.qdoc b/doc/src/getting-started/demos.qdoc
index 6974634..f8c70fe 100644
--- a/doc/src/getting-started/demos.qdoc
+++ b/doc/src/getting-started/demos.qdoc
@@ -53,15 +53,14 @@
\l{Qt Examples} and are used to highlight certain features of
Qt.
- \table 50%
+ \table
\header
\o {2,1} Getting an Overview
\row
\o \inlineimage qtdemo-small.png
- \o
- If you run the \l{Examples and Demos Launcher}, you'll see many of Qt's
+ \o If you run the \l{Examples and Demos Launcher}, you'll see many of Qt's
widgets in action.
-
+
The \l{Qt Widget Gallery} also provides overviews of selected Qt
widgets in each of the styles used on various supported platforms.
\endtable
diff --git a/doc/src/getting-started/examples.qdoc b/doc/src/getting-started/examples.qdoc
index f511cd6..2e7f47e 100644
--- a/doc/src/getting-started/examples.qdoc
+++ b/doc/src/getting-started/examples.qdoc
@@ -50,6 +50,39 @@
*/
/*!
+ \group all-examples
+ \title Qt Examples
+
+ Qt includes a set of examples that cover nearly every aspect of Qt
+ development. They aren't meant to be impressive when you run them,
+ but in each case the source code has been carefully written to
+ illustrate one or more best Qt programming practices.
+
+ You can run the examples from the \l{Examples and Demos Launcher}
+ application (except see \l{QML Examples and Demos} {QML Examples}
+ for special instructions for running thos examples).
+
+ The examples are listed below by functional area. Each example
+ listed in a particular functional area is meant to illustrate how
+ best to use Qt to do some particular task in that functional area,
+ but the examples will often use features from other functional
+ areas as well for completeness.
+
+ If you are new to Qt, you should probably start by going through
+ the \l{Tutorials}, and then begin with the
+ \l{mainwindows/application} {Application} example.
+
+ In addition to these examples and the \l{Tutorials}{tutorials}, Qt
+ includes a \l{Qt Demonstrations}{selection of demos} that
+ deliberately show off Qt's features. You might want to look at
+ these as well.
+
+ \section1 Examples by functional area
+
+ \generatelist{related}
+*/
+
+/*!
\page examples.html
\title Qt Examples
\brief The example programs provided with Qt.
@@ -461,6 +494,8 @@
/*!
\page examples-widgets.html
\title Widgets Examples
+ \ingroup all-examples
+ \brief Lots of examples of how to use different kinds of widgets.
\contentspage Qt Examples
\nextpage Dialog Examples
@@ -509,7 +544,9 @@
/*!
\page examples-dialogs.html
+ \ingroup all-examples
\title Dialog Examples
+ \brief Using Qt's standard dialogs and building and using custom dialogs.
\previouspage Widgets Examples
\contentspage Qt Examples
@@ -539,7 +576,9 @@
/*!
\page examples-mainwindow.html
+ \ingroup all-examples
\title Main Window Examples
+ \building applications around a main window.
\previouspage Dialog Examples
\contentspage Qt Examples
@@ -567,7 +606,9 @@
/*!
\page examples-layouts.html
+ \ingroup all-examples
\title Layout Examples
+ Using Qt's layout-based approach to widget management.
\previouspage Main Window Examples
\contentspage Qt Examples
@@ -594,7 +635,9 @@
/*!
\page examples-itemviews.html
+ \ingroup all-examples
\title Item Views Examples
+ \brief Using the model/view design pattern to separate presentation from data.
\previouspage Layout Examples
\contentspage Qt Examples
@@ -632,7 +675,9 @@
/*!
\page examples-graphicsview.html
+ \ingroup all-examples
\title Graphics View Examples
+ \brief Using Qt to manage and interact with a large (potentially) number of graphics items.
\previouspage Item Views Examples
\contentspage Qt Examples
@@ -678,6 +723,7 @@
/*!
\page examples-painting.html
+ \ingroup all-examples
\title Painting Examples
\previouspage QML Examples and Demos
@@ -710,6 +756,7 @@
/*!
\page examples-richtext.html
+ \ingroup all-examples
\title Rich Text Examples
\previouspage Painting Examples
@@ -733,6 +780,7 @@
/*!
\page examples-desktop.html
+ \ingroup all-examples
\title Desktop Examples
\previouspage Rich Text Examples
@@ -756,6 +804,7 @@
/*!
\page examples-draganddrop.html
+ \ingroup all-examples
\title Drag and Drop Examples
\previouspage Desktop Examples
@@ -784,6 +833,7 @@
/*!
\page examples-threadandconcurrent.html
+ \ingroup all-examples
\title Threading and Concurrent Programming Examples
\previouspage Drag and Drop Examples
@@ -824,6 +874,7 @@
/*!
\page examples.tools.html
+ \ingroup all-examples
\title Tools Examples
\previouspage Threading and Concurrent Programming Examples
@@ -862,6 +913,7 @@
/*!
\page examples-network.html
+ \ingroup all-examples
\title Network Examples
\previouspage Tools Examples
@@ -900,6 +952,7 @@
/*!
\page examples-ipc.html
+ \ingroup all-examples
\title Inter-Process Communication Examples
\previouspage Network Examples
@@ -917,6 +970,7 @@
/*!
\page examples-opengl.html
+ \ingroup all-examples
\title OpenGL Examples
\previouspage Inter-Process Communication Examples
@@ -951,6 +1005,7 @@
/*!
\page examples-openvg.html
+ \ingroup all-examples
\title OpenVG Examples
\previouspage OpenGL Examples
@@ -972,6 +1027,7 @@
/*!
\page examples-multimedia.html
+ \ingroup all-examples
\title Multimedia Examples
\previouspage OpenGL Examples
@@ -1021,6 +1077,7 @@
/*!
\page examples-sql.html
+ \ingroup all-examples
\title SQL Examples
\previouspage Multimedia Examples
@@ -1050,6 +1107,7 @@
/*!
\page examples-xml.html
+ \ingroup all-examples
\title XML Examples
\previouspage SQL Examples
@@ -1086,6 +1144,7 @@
/*!
\page examples-designer.html
+ \ingroup all-examples
\title Qt Designer Examples
\previouspage XML Examples
@@ -1111,6 +1170,7 @@
/*!
\page examples-uitools.html
+ \ingroup all-examples
\title UiTools Examples
\previouspage Qt Designer Examples
@@ -1127,6 +1187,7 @@
/*!
\page examples-linguist.html
+ \ingroup all-examples
\title Qt Linguist Examples
\previouspage UiTools Examples
@@ -1147,6 +1208,7 @@
/*!
\page examples-script.html
+ \ingroup all-examples
\title Qt Script Examples
\previouspage Qt Linguist Examples
@@ -1176,6 +1238,7 @@
/*!
\page examples-webkit.html
+ \ingroup all-examples
\title WebKit Examples
\previouspage Qt Script Examples
@@ -1216,7 +1279,8 @@
*/
/*!
- \page examples-helpsystem.html
+ \page examples-helpsystem.html
+ \ingroup all-examples
\title Help System Examples
\previouspage WebKit Examples
@@ -1240,6 +1304,7 @@
/*!
\page examples-statemachine.html
+ \ingroup all-examples
\title State Machine Examples
\previouspage Help System Examples
@@ -1266,6 +1331,7 @@
/*!
\page examples-animation.html
+ \ingroup all-examples
\title Animation Framework Examples
\previouspage State Machine Examples
@@ -1288,6 +1354,7 @@
/*!
\page examples-multitouch.html
+ \ingroup all-examples
\title Multi-Touch Examples
\previouspage Animation Framework Examples
@@ -1307,6 +1374,7 @@
/*!
\page examples-gestures.html
+ \ingroup all-examples
\title Gestures Examples
\previouspage Multi-Touch Examples
@@ -1323,6 +1391,7 @@
/*!
\page examples-dbus.html
+ \ingroup all-examples
\title D-Bus Examples
\previouspage Gestures Examples
@@ -1342,6 +1411,7 @@
/*!
\page examples-embeddedlinux.html
+ \ingroup all-examples
\title Qt for Embedded Linux Examples
\previouspage D-Bus Examples
@@ -1364,6 +1434,7 @@
/*!
\page examples-activeqt.html
+ \ingroup all-examples
\title ActiveQt Examples
\previouspage Qt for Embedded Linux Examples
diff --git a/doc/src/index.qdoc b/doc/src/index.qdoc
index 2e6f9bd..b759435 100644
--- a/doc/src/index.qdoc
+++ b/doc/src/index.qdoc
@@ -44,16 +44,15 @@
\keyword Qt Reference Documentation
\raw HTML
- <div class="indexbox" >
+ <div class="indexbox guide" >
<div class="heading">
Qt Developer Guide</div>
<div class="indexboxcont indexboxbar">
- <div class="section indexIcon">
- <img src="images/qt_guide.png" alt="" /></div>
+ <div class="section indexIcon"><span></span></div>
<div class="section">
<p>Qt is a cross-platform application and UI framework. Using Qt, you can write web-enabled applications once and deploy them across desktop, mobile and embedded operating systems without rewriting the source code.</p>
</div>
- <div class="section sectionlist lastcol">
+ <div class="section sectionlist">
<ul>
<li><a href="">Getting started</a></li>
<li><a href="installation.html">Installation &amp; first steps</a></li>
@@ -65,50 +64,50 @@
</div>
</div>
</div>
- <div class="indexbox">
+ <div class="indexbox api">
<div class="heading">
Qt API Overviews</div>
- <div class="indexboxcont indexboxbar tricol">
- <div class="sectionlist">
+ <div class="indexboxcont indexboxbar ">
+ <div class="sectionlist tricol">
<ul>
- <li><a href="modules.html">All modules</a></li>
- <li><a href="classes.html">All classes</a></li>
- <li><a href="namespaces.html">All namespaces</a></li>
- <li><a href="functions.html">All functions</a></li>
- <li><a href="platform-specific.html">Platform support &amp; specifics</a></li>
+ <li><a href="classes.html">Class index</a></li>
+ <li><a href="functions.html">Function index</a></li>
+ <li><a href="modules.html">Modules</a></li>
+ <li><a href="namespaces.html">Namespaces</a></li>
+ <li><a href="qtglobal.html">Global stuff</a></li>
+ <li><a href="qdeclarativeelements.html">QML elements</a></li>
</ul>
</div>
- <div class="sectionlist">
+ <div class="sectionlist tricol">
<ul>
- <li><a href="object.html">QObject model</a></li>
- <li><a href="application-windows.html">Window architecture</a></li>
- <li><a href="widgets-and-layouts.html">Styles &amp; layout</a></li>
- <li><a href="eventsandfilters.html">Event handling</a></li>
- <li><a href="paintsystem.html">Paint system</a></li>
+ <li><a href="qt-basic-concepts.html">Basic Qt Architecture</a></li>
+ <li><a href="declarativeui.html">Device UI's &amp; Qt Quick</a></li>
+ <li><a href="qt-gui-concepts.html">Desktop UI components</a></li>
+ <li><a href="platform-specific.html">Platform-specific info</a></li>
+ <li><a href="qt-graphics.html">Graphics, Painting &amp Printing</a></li>
+ <li><a href="qt-network.html">Input/Output &amp networking</a></li>
</ul>
</div>
- <div class="lastcol">
+ <div class="sectionlist">
<ul>
- <li><a href="graphicsview.html">Canvas UI with Graphics View</a></li>
- <li><a href="declarativeui.html">UI design &amp; Qt Quick</a></li>
- <li><a href="io.html">Input/output</a></li>
- <li><a href="webintegration.html">Integrating Web Content</a></li>
- <li><a href="developing-with-qt.html">X-platform, debug &amp; deploy</a></li>
+ <li><a href="model-view-programming.html">Model/View programming</a></li>
+ <li><a href="technology-apis.html">Qt API's for other technologies</a></li>
+ <li><a href="best-practices.html">Qt How-to's &amp best practices</a></li>
+ <li><a href="developing-with-qt.html">Cross-platform development</a></li>
</ul>
</div>
</div>
</div>
- <div class="indexbox">
+ <div class="indexbox tools">
<div class="heading">
Qt Tools</div>
<div class="indexboxcont">
- <div class="section indexIcon">
- <img src="images/qt_tools.png" alt="" /></div>
+ <div class="section indexIcon"><span></span></div>
<div class="section">
<p>Qt offers a selection of development tools for different tasks. Use Qt Creator for
project and code management as well as building powerfull UIs.</p>
</div>
- <div class="section sectionlist lastcol">
+ <div class="section sectionlist">
<ul>
<li><a href="http://doc.qt.nokia.com/qtcreator-1.3/index.html">Qt Creator</a></li>
<li><a href="designer-manual.html">Qt Designer</a></li>
@@ -118,9 +117,8 @@
<li><a href="qvfb.html">Virtual Framebuffer</a></li>
</ul>
</div>
- </div>
- </div>
-
+ </div>
+ </div>
\endraw
*/
diff --git a/doc/src/modules.qdoc b/doc/src/modules.qdoc
index 1ab1c00..2c0744b 100644
--- a/doc/src/modules.qdoc
+++ b/doc/src/modules.qdoc
@@ -41,7 +41,7 @@
/*!
\group modules
- \title All Qt Modules
+ \title All Modules
\startpage index.html Qt Reference Documentation
\nextpage QtCore
@@ -96,8 +96,8 @@
/*!
\module QtCore
\title QtCore Module
- \contentspage All Qt Modules
- \previouspage All Qt Modules
+ \contentspage All Modules
+ \previouspage All Modules
\nextpage QtGui
\ingroup modules
@@ -115,7 +115,7 @@
/*!
\module QtGui
\title QtGui Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtCore
\nextpage QtNetwork
\ingroup modules
@@ -132,7 +132,7 @@
\module QtMultimedia
\page qtmultimedia-module.html
\title QtMultimedia Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtCore
\nextpage QtNetwork
\ingroup modules
@@ -156,7 +156,7 @@
/*!
\module QtNetwork
\title QtNetwork Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtMultimedia
\nextpage QtOpenGL
\ingroup modules
@@ -178,7 +178,7 @@
/*!
\module QtOpenGL
\title QtOpenGL Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtNetwork
\nextpage QtOpenVG
\ingroup modules
@@ -231,7 +231,7 @@
\module QtOpenVG
\title QtOpenVG Module
\since 4.6
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtOpenGL
\nextpage QtScript
\ingroup modules
@@ -286,7 +286,7 @@
\module QtScript
\title QtScript Module
\since 4.3
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtOpenVG
\nextpage QtScriptTools
\ingroup modules
@@ -346,7 +346,7 @@
\module QtScriptTools
\title QtScriptTools Module
\since 4.5
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtScript
\nextpage QtSql
\ingroup modules
@@ -370,7 +370,7 @@
/*!
\module QtSql
\title QtSql Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtScript
\nextpage QtSvg
\ingroup modules
@@ -393,7 +393,7 @@
\module QtSvg
\title QtSvg Module
\since 4.1
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtSql
\nextpage QtWebKit
\ingroup modules
@@ -444,7 +444,7 @@
/*!
\module QtXml
\title QtXml Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtSvg
\nextpage QtXmlPatterns
\ingroup modules
@@ -471,7 +471,7 @@
\module QtXmlPatterns
\title QtXmlPatterns Module
\since 4.4
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtXml
\nextpage Phonon Module
\ingroup modules
@@ -551,7 +551,7 @@
\page phonon-module.html
\module Phonon
\title Phonon Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtXmlPatterns
\nextpage Qt3Support
\ingroup modules
@@ -621,7 +621,7 @@
/*!
\module Qt3Support
\title Qt3Support Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage Phonon Module
\nextpage QtDesigner
\ingroup modules
@@ -654,7 +654,7 @@
/*!
\module QtDesigner
\title QtDesigner Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage Qt3Support
\nextpage QtUiTools
\ingroup modules
@@ -681,7 +681,7 @@
\module QtUiTools
\title QtUiTools Module
\since 4.1
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtDesigner
\nextpage QtHelp
\ingroup modules
@@ -717,7 +717,7 @@
/*!
\module QtHelp
\title QtHelp Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtUiTools
\nextpage QtTest
\ingroup modules
@@ -776,7 +776,7 @@
/*!
\module QtTest
\title QtTest Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtHelp
\nextpage QAxContainer
\ingroup modules
@@ -806,7 +806,7 @@
/*!
\module QAxContainer
\title QAxContainer Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QtTest
\nextpage QAxServer
\ingroup modules
@@ -858,7 +858,7 @@
/*!
\module QAxServer
\title QAxServer Module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QAxContainer
\nextpage QtDBus module
\ingroup modules
@@ -910,7 +910,7 @@
/*!
\module QtDBus
\title QtDBus module
- \contentspage All Qt Modules
+ \contentspage All Modules
\previouspage QAxServer
\ingroup modules
diff --git a/doc/src/network-programming/bearermanagement.qdoc b/doc/src/network-programming/bearermanagement.qdoc
index 10d697a..b10481e 100644
--- a/doc/src/network-programming/bearermanagement.qdoc
+++ b/doc/src/network-programming/bearermanagement.qdoc
@@ -40,12 +40,11 @@
****************************************************************************/
/*!
-\page bearer-management.html
+ \page bearer-management.html
-\title Bearer Management
-\brief An API to control the system's connectivity state.
-
-\ingroup network
+ \title Bearer Management
+ \ingroup qt-network
+ \brief An API to control the system's connectivity state.
Bearer Management controls the connectivity state of the system so that
the user can start or stop interfaces or roam transparently between
diff --git a/doc/src/network-programming/qtnetwork.qdoc b/doc/src/network-programming/qtnetwork.qdoc
index 36f48cf..9134809 100644
--- a/doc/src/network-programming/qtnetwork.qdoc
+++ b/doc/src/network-programming/qtnetwork.qdoc
@@ -50,6 +50,7 @@
/*!
\page network-programming.html
\title Network Programming
+ \ingroup qt-network
\brief An Introduction to Network Programming with Qt
The QtNetwork module offers classes that allow you to write TCP/IP clients
diff --git a/doc/src/network-programming/ssl.qdoc b/doc/src/network-programming/ssl.qdoc
index 2feb7b6..7f365a9 100644
--- a/doc/src/network-programming/ssl.qdoc
+++ b/doc/src/network-programming/ssl.qdoc
@@ -40,11 +40,11 @@
****************************************************************************/
/*!
- \group ssl
+ \page ssl.html
\title Secure Sockets Layer (SSL) Classes
- \ingroup groups
-
\brief Classes for secure communication over network sockets.
+ \ingroup qt-network
+
\keyword SSL
The classes below provide support for secure network communication using
diff --git a/doc/src/objectmodel/metaobjects.qdoc b/doc/src/objectmodel/metaobjects.qdoc
index c1b0ea6..e891183 100644
--- a/doc/src/objectmodel/metaobjects.qdoc
+++ b/doc/src/objectmodel/metaobjects.qdoc
@@ -41,7 +41,8 @@
/*!
\page metaobjects.html
- \title Meta-Object System
+ \title The Meta-Object System
+ \ingroup qt-basic-concepts
\brief An overview of Qt's meta-object system and introspection capabilities.
\keyword meta-object
diff --git a/doc/src/objectmodel/object.qdoc b/doc/src/objectmodel/object.qdoc
index 2f06004..e0ba6ed 100644
--- a/doc/src/objectmodel/object.qdoc
+++ b/doc/src/objectmodel/object.qdoc
@@ -41,7 +41,8 @@
/*!
\page object.html
- \title Qt Object Model
+ \title Object Model
+ \ingroup qt-basic-concepts
\brief A description of the powerful features made possible by Qt's dynamic object model.
\ingroup frameworks-technologies
diff --git a/doc/src/objectmodel/objecttrees.qdoc b/doc/src/objectmodel/objecttrees.qdoc
index 11824ae..97d646a 100644
--- a/doc/src/objectmodel/objecttrees.qdoc
+++ b/doc/src/objectmodel/objecttrees.qdoc
@@ -41,7 +41,8 @@
/*!
\page objecttrees.html
- \title Object Trees and Object Ownership
+ \title Object Trees & Ownership
+ \ingroup qt-basic-concepts
\brief Information about the parent-child pattern used to describe
object ownership in Qt.
diff --git a/doc/src/objectmodel/properties.qdoc b/doc/src/objectmodel/properties.qdoc
index a807caf..bc9554c 100644
--- a/doc/src/objectmodel/properties.qdoc
+++ b/doc/src/objectmodel/properties.qdoc
@@ -41,7 +41,8 @@
/*!
\page properties.html
- \title Qt's Property System
+ \title The Property System
+ \ingroup qt-basic-concepts
\brief An overview of Qt's property system.
Qt provides a sophisticated property system similar to the ones
diff --git a/doc/src/objectmodel/signalsandslots.qdoc b/doc/src/objectmodel/signalsandslots.qdoc
index 0f3f618..f33badf 100644
--- a/doc/src/objectmodel/signalsandslots.qdoc
+++ b/doc/src/objectmodel/signalsandslots.qdoc
@@ -41,7 +41,8 @@
/*!
\page signalsandslots.html
- \title Signals and Slots
+ \title Signals & Slots
+ \ingroup qt-basic-concepts
\brief An overview of Qt's signals and slots inter-object
communication mechanism.
diff --git a/doc/src/overviews.qdoc b/doc/src/overviews.qdoc
index 7302e30..0b82388 100644
--- a/doc/src/overviews.qdoc
+++ b/doc/src/overviews.qdoc
@@ -48,19 +48,75 @@
*/
/*!
- \group frameworks-technologies
- \title Frameworks and Technologies
+ \group qt-basic-concepts
+ \title Basic Qt Architecture
- \brief Documentation about the frameworks and technologies in Qt
+ \brief The basic architecture of the Qt cross-platform application and UI framework.
- These documents dive into the frameworks of classes that Qt provides,
- and provide background information about the technical solutions used
- in Qt's architecture.
+ Qt is a cross-platform application and UI framework for writing
+ web-enabled applications for desktop, mobile, and embedded
+ operating systems. These pages explain basic architectural
+ concepts of Qt:
+
+ \generatelist {related}
+ */
+
+/*!
+ \group qt-gui-concepts
+ \title Qt Desktop UI Components
+
+ \brief The Qt components for constructing native look & feel desktop UI's.
+
+ These pages are about Qt's traditional set of GUI components for
+ building both native look ^ feel and custom UI's for the desktop
+ environment. Use \l {declarativeui.html} {Qt Quick} for building
+ UI's for mobile devices.
+
+ \generatelist {related}
+ */
+
+/*!
+ \group qt-graphics
+ \title Qt Graphics and Painting
+
+ \brief The Qt components for doing graphics.
+
+ \generatelist {related}
+ */
+
+/*!
+ \group qt-network
+ \title Network programming with Qt
+
+ \brief The these pages are about Qt's support for network programming.
+
+ \generatelist {related}
+ */
+
+/*!
+ \group technology-apis
+ \title Qt API's for other technologies
+
+ These pages document Qt's API's for some widely-used standards and
+ technologies.
\generatelist{related}
*/
/*!
+ \group qt-activex
+ \title Qt For ActiveX
+ \brief Qt API's for using ActiveX controls, servers, and COM.
+ \ingroup technology-apis
+ \ingroup platform-specific
+
+ These pages document Qt's API's for developing with ActiveX
+ controls, servers, and COM.
+
+ \generatelist{related}
+*/
+
+/*!
\group best-practices
\title How-To's and Best Practices
diff --git a/doc/src/painting-and-printing/coordsys.qdoc b/doc/src/painting-and-printing/coordsys.qdoc
index 5807f57..b360d0b 100644
--- a/doc/src/painting-and-printing/coordsys.qdoc
+++ b/doc/src/painting-and-printing/coordsys.qdoc
@@ -41,7 +41,8 @@
/*!
\page coordsys.html
- \title The Coordinate System
+ \title Coordinate System
+ \ingroup qt-graphics
\brief Information about the coordinate system used by the paint
system.
diff --git a/doc/src/painting-and-printing/paintsystem.qdoc b/doc/src/painting-and-printing/paintsystem.qdoc
index 802751f..44c84a2 100644
--- a/doc/src/painting-and-printing/paintsystem.qdoc
+++ b/doc/src/painting-and-printing/paintsystem.qdoc
@@ -60,7 +60,9 @@
/*!
\page paintsystem.html
- \title The Paint System
+ \title Paint System
+ \brief A system for painting on the screen or on print devices using the same API
+ \ingroup qt-graphics
\ingroup frameworks-technologies
Qt's paint system enables painting on screen and print devices
diff --git a/doc/src/painting-and-printing/printing.qdoc b/doc/src/painting-and-printing/printing.qdoc
index 3d6ade2..6dad097 100644
--- a/doc/src/painting-and-printing/printing.qdoc
+++ b/doc/src/painting-and-printing/printing.qdoc
@@ -49,6 +49,7 @@
/*!
\page printing.html
\title Printing with Qt
+ \ingroup qt-graphics
\previouspage Styling
\contentspage The Paint System
diff --git a/doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp b/doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp
index 22ea240..e3ad483 100644
--- a/doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp
+++ b/doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp
@@ -67,3 +67,23 @@ beginInsertColumns(parent, 6, 8);
//! [5]
beginRemoveColumns(parent, 4, 6);
//! [5]
+
+
+//! [6]
+beginMoveRows(sourceParent, 2, 4, destinationParent, 2);
+//! [6]
+
+
+//! [7]
+beginMoveRows(sourceParent, 2, 4, destinationParent, 6);
+//! [7]
+
+
+//! [8]
+beginMoveRows(parent, 2, 2, parent, 0);
+//! [8]
+
+
+//! [9]
+beginMoveRows(parent, 2, 2, parent, 4);
+//! [9]
diff --git a/doc/src/template/images/api_examples.png b/doc/src/template/images/api_examples.png
deleted file mode 100755
index 1fcbc96..0000000
--- a/doc/src/template/images/api_examples.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/api_lookup.png b/doc/src/template/images/api_lookup.png
deleted file mode 100755
index 1cffd5e..0000000
--- a/doc/src/template/images/api_lookup.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/api_topics.png b/doc/src/template/images/api_topics.png
deleted file mode 100755
index a76a6c3..0000000
--- a/doc/src/template/images/api_topics.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_l.png b/doc/src/template/images/bg_l.png
index 95470c7..90b1da1 100755
--- a/doc/src/template/images/bg_l.png
+++ b/doc/src/template/images/bg_l.png
Binary files differ
diff --git a/doc/src/template/images/bg_l_blank.png b/doc/src/template/images/bg_l_blank.png
index e0eca3f..5a9673d 100755
--- a/doc/src/template/images/bg_l_blank.png
+++ b/doc/src/template/images/bg_l_blank.png
Binary files differ
diff --git a/doc/src/template/images/bg_ll.png b/doc/src/template/images/bg_ll.png
deleted file mode 100755
index 99796e7..0000000
--- a/doc/src/template/images/bg_ll.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_ll_blank.png b/doc/src/template/images/bg_ll_blank.png
deleted file mode 100755
index 95a1c45..0000000
--- a/doc/src/template/images/bg_ll_blank.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_lr.png b/doc/src/template/images/bg_lr.png
deleted file mode 100755
index fef1d17..0000000
--- a/doc/src/template/images/bg_lr.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_r.png b/doc/src/template/images/bg_r.png
index 42a35a5..f0fb121 100755
--- a/doc/src/template/images/bg_r.png
+++ b/doc/src/template/images/bg_r.png
Binary files differ
diff --git a/doc/src/template/images/bg_ul.png b/doc/src/template/images/bg_ul.png
deleted file mode 100755
index 303181f..0000000
--- a/doc/src/template/images/bg_ul.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_ul_blank.png b/doc/src/template/images/bg_ul_blank.png
deleted file mode 100755
index 7051261..0000000
--- a/doc/src/template/images/bg_ul_blank.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_ur.png b/doc/src/template/images/bg_ur.png
deleted file mode 100755
index bfa51a4..0000000
--- a/doc/src/template/images/bg_ur.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/bg_ur_blank.png b/doc/src/template/images/bg_ur_blank.png
deleted file mode 100755
index 5779961..0000000
--- a/doc/src/template/images/bg_ur_blank.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/box_bg.png b/doc/src/template/images/box_bg.png
index 232655a..3322f92 100755
--- a/doc/src/template/images/box_bg.png
+++ b/doc/src/template/images/box_bg.png
Binary files differ
diff --git a/doc/src/template/images/breadcrumb.png b/doc/src/template/images/breadcrumb.png
index f0571ce..0ded551 100755
--- a/doc/src/template/images/breadcrumb.png
+++ b/doc/src/template/images/breadcrumb.png
Binary files differ
diff --git a/doc/src/template/images/bullet_gt.png b/doc/src/template/images/bullet_gt.png
index 8875925..7561b4e 100755
--- a/doc/src/template/images/bullet_gt.png
+++ b/doc/src/template/images/bullet_gt.png
Binary files differ
diff --git a/doc/src/template/images/bullet_sq.png b/doc/src/template/images/bullet_sq.png
index db85ee3..a84845e 100755
--- a/doc/src/template/images/bullet_sq.png
+++ b/doc/src/template/images/bullet_sq.png
Binary files differ
diff --git a/doc/src/template/images/content_bg.png b/doc/src/template/images/content_bg.png
deleted file mode 100755
index 416397d..0000000
--- a/doc/src/template/images/content_bg.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/form_bg.png b/doc/src/template/images/form_bg.png
deleted file mode 100755
index bf2ee54..0000000
--- a/doc/src/template/images/form_bg.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/header.png b/doc/src/template/images/header.png
deleted file mode 100644
index 141488b..0000000
--- a/doc/src/template/images/header.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/page.png b/doc/src/template/images/page.png
new file mode 100644
index 0000000..1db151b
--- /dev/null
+++ b/doc/src/template/images/page.png
Binary files differ
diff --git a/doc/src/template/images/page_bg.png b/doc/src/template/images/page_bg.png
index fb7d051..9b3bd99 100755
--- a/doc/src/template/images/page_bg.png
+++ b/doc/src/template/images/page_bg.png
Binary files differ
diff --git a/doc/src/template/images/print.png b/doc/src/template/images/print.png
deleted file mode 100755
index 4581da1..0000000
--- a/doc/src/template/images/print.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/qt_guide.png b/doc/src/template/images/qt_guide.png
deleted file mode 100755
index 9f53a05..0000000
--- a/doc/src/template/images/qt_guide.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/qt_icon.png b/doc/src/template/images/qt_icon.png
deleted file mode 100755
index fbaee35..0000000
--- a/doc/src/template/images/qt_icon.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/qt_ref_doc.png b/doc/src/template/images/qt_ref_doc.png
deleted file mode 100755
index 141488b..0000000
--- a/doc/src/template/images/qt_ref_doc.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/qt_tools.png b/doc/src/template/images/qt_tools.png
deleted file mode 100755
index cc24179..0000000
--- a/doc/src/template/images/qt_tools.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/sep.png b/doc/src/template/images/sep.png
deleted file mode 100755
index c895646..0000000
--- a/doc/src/template/images/sep.png
+++ /dev/null
Binary files differ
diff --git a/doc/src/template/images/spinner.gif b/doc/src/template/images/spinner.gif
new file mode 100644
index 0000000..1ed786f
--- /dev/null
+++ b/doc/src/template/images/spinner.gif
Binary files differ
diff --git a/doc/src/template/images/sprites-combined.png b/doc/src/template/images/sprites-combined.png
index 4186022..3a48b21 100755
--- a/doc/src/template/images/sprites-combined.png
+++ b/doc/src/template/images/sprites-combined.png
Binary files differ
diff --git a/doc/src/template/scripts/functions.js b/doc/src/template/scripts/functions.js
index fa454e3..7d93486 100755
--- a/doc/src/template/scripts/functions.js
+++ b/doc/src/template/scripts/functions.js
@@ -1,10 +1,8 @@
-
/* START non link areas where cursor should change to pointing hand */
$('.t_button').mouseover(function() {
$('.t_button').css('cursor','pointer');
/*document.getElementById(this.id).style.cursor='pointer';*/
});
-
/* END non link areas */
$('#smallA').click(function() {
$('.content .heading,.content h1, .content h2, .content h3, .content p, .content li, .content table').css('font-size','smaller');
@@ -35,27 +33,139 @@ $('#bigA').click(function() {
$(this).addClass('active')
});
-function doSearch(str){
-
-if (str.length>3)
- {
- alert('Search is not yet activated.');
- // document.getElementById("refWrapper").innerHTML="";
- return;
- }
- else
- return;
-
-// var url="indexSearch.php";
-// url=url+"?q="+str;
- // url=url+"&sid="+Math.random();
- // var url="http://localhost:8983/solr/select?";
- // url=url+"&q="+str;
- // url=url+"&fq=&start=0&rows=10&fl=&qt=&wt=&explainOther=&hl.fl=";
-
- // $.get(url, function(data){
- // alert(data);
- // document.getElementById("refWrapper").innerHTML=data;
- //});
-
-} \ No newline at end of file
+
+var lookupCount = 0;
+var articleCount = 0;
+var exampleCount = 0;
+var qturl = ""; // change from "http://doc.qt.nokia.com/4.6/" to 0 so we can have relative links
+
+function processNokiaData(response){
+$('.sidebar .search form input').addClass('loading');
+ // debug $('.content').prepend('<li>handling search results</li>'); // debuging
+ var propertyTags = response.getElementsByTagName('page');
+
+ for (var i=0; i< propertyTags.length; i++) {
+ var linkStart = "<li class=\"liveResult\"><a href='"+qturl+"";
+ var linkEnd = "</a></li>";
+
+ if(propertyTags[i].getElementsByTagName('pageType')[0].firstChild.nodeValue == 'APIPage'){
+ lookupCount++;
+ //$('.live001').css('display','block');
+
+
+ for (var j=0; j< propertyTags[i].getElementsByTagName('pageWords').length; j++){
+ full_li_element = linkStart + propertyTags[i].getElementsByTagName('pageUrl')[j].firstChild.nodeValue;
+ full_li_element = full_li_element + "'>" + propertyTags[i].getElementsByTagName('pageTitle')[0].firstChild.nodeValue + linkEnd;
+
+ $('#ul001').append(full_li_element);
+ $('#ul001 .defaultLink').css('display','none');
+
+ }
+ }
+
+ if(propertyTags[i].getElementsByTagName('pageType')[0].firstChild.nodeValue == 'Article'){
+ articleCount++;
+ //$('.live002').css('display','block');
+
+
+ for (var j=0; j< propertyTags[i].getElementsByTagName('pageWords').length; j++){
+ full_li_element = linkStart + propertyTags[i].getElementsByTagName('pageUrl')[j].firstChild.nodeValue;
+ full_li_element =full_li_element + "'>" + propertyTags[i].getElementsByTagName('pageTitle')[0].firstChild.nodeValue + linkEnd ;
+
+ $('#ul002').append(full_li_element);
+ $('#ul002 .defaultLink').css('display','none');
+
+ }
+ }
+ if(propertyTags[i].getElementsByTagName('pageType')[0].firstChild.nodeValue == 'Example'){
+ exampleCount++;
+ //$('.live003').css('display','block');
+
+
+ for (var j=0; j< propertyTags[i].getElementsByTagName('pageWords').length; j++){
+ full_li_element = linkStart + propertyTags[i].getElementsByTagName('pageUrl')[j].firstChild.nodeValue;
+ full_li_element =full_li_element + "'>" + propertyTags[i].getElementsByTagName('pageTitle')[0].firstChild.nodeValue + linkEnd ;
+
+ $('#ul003').append(full_li_element);
+ $('#ul003 .defaultLink').css('display','none');
+
+ }
+ }
+ }
+
+ if(lookupCount == 0){$('#ul001').prepend('<li class=\"liveResult noMatch\">Found no result</li>');$('#ul001 li').css('display','block');$('.sidebar .search form input').removeClass('loading');
+}
+ if(articleCount == 0){$('#ul002').prepend('<li class=\"liveResult noMatch\">Found no result</li>');$('#ul002 li').css('display','block');}
+ if(exampleCount == 0){$('#ul003').prepend('<li class=\"liveResult noMatch\">Found no result</li>');$('#ul003 li').css('display','block');}
+ // reset count variables;
+ lookupCount=0;
+ articleCount = 0;
+ exampleCount = 0;
+
+}
+
+//build regular expression object to find empty string or any number of blank
+var blankRE=/^\s*$/;
+function CheckEmptyAndLoadList()
+{
+ $('.liveResult').remove();
+ var value = document.getElementById('pageType').value;
+ if((blankRE.test(value)) || (value.length < 3))
+ {
+ //empty inputbox
+ // load default li elements into the ul if empty
+ // loadAllList(); // replaced
+ $('.defaultLink').css('display','block');
+ // $('.liveResult').css('display','none');
+ }else{
+ $('.defaultLink').css('display','none');
+ }
+}
+/*
+$(window).resize(function(){
+if($(window).width()<400)
+ $('body').addClass('offline');
+else
+ $('body').removeClass('offline');
+ });
+ */
+// Loads on doc ready
+ $(document).ready(function () {
+ var pageTitle = $('title').html();
+ $('#feedform').append('<input id="page" name="pageVal" value="'+pageTitle+'" style="display:none;">');
+ var currentString = $('#pageType').val() ;
+ if(currentString.length < 1){
+ $('.defaultLink').css('display','block');
+ CheckEmptyAndLoadList();
+ }
+
+ $('#pageType').keyup(function () {
+ var searchString = $('#pageType').val() ;
+ if ((searchString == null) || (searchString.length < 3)) {
+ $('.liveResult').remove(); // replaces removeResults();
+ CheckEmptyAndLoadList();
+ $('.report').remove();
+ // debug$('.content').prepend('<li>too short or blank</li>'); // debug
+ return;
+ }
+ if (this.timer) clearTimeout(this.timer);
+ this.timer = setTimeout(function () {
+ // debug$('.content').prepend('<li>new search started </li>');// debug
+ // debug$('.content').prepend('<p class=\"report\">Search string ' +searchString +'</p>'); // debug
+
+ $.ajax({
+ contentType: "application/x-www-form-urlencoded",
+ url: 'http://' + location.host + '/nokiasearch/GetDataServlet',
+ data: 'searchString='+searchString,
+ dataType:'xml',
+ type: 'post',
+ success: function (response, textStatus) {
+
+ $('.liveResult').remove(); // replaces removeResults();
+ processNokiaData(response);
+
+ }
+ });
+ }, 500);
+ });
+ });
diff --git a/doc/src/template/style/style.css b/doc/src/template/style/style.css
index d5920b9..5ad90e3 100755
--- a/doc/src/template/style/style.css
+++ b/doc/src/template/style/style.css
@@ -58,6 +58,23 @@
{
vertical-align: baseline;
}
+ tt, .qmlreadonly span, .qmldefault span
+ {
+ word-spacing:5px;
+ }
+ .heading
+ {
+ font: normal 600 16px/1.0 Arial;
+ padding-bottom: 15px;
+ }
+ .subtitle
+ {
+ font-size: 13px;
+ }
+ .small-subtitle
+ {
+ font-size: 13px;
+ }
legend
{
color: #000000;
@@ -73,7 +90,6 @@
{
font-size: 100%;
}
- /* Page style */
html
{
background-color: #e5e5e5;
@@ -92,6 +108,11 @@
{
font-style: italic;
}
+ a
+ {
+ color: #00732f;
+ text-decoration: none;
+ }
.header, .footer, .wrapper
{
min-width: 600px;
@@ -106,23 +127,19 @@
{
padding-left: 216px;
height: 15px;
- background: url(../images/bg_ul.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 0;
overflow: hidden;
}
.offline .wrapper .hd
{
- background: url(../images/bg_ul_blank.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -15px;
}
.wrapper .hd span
{
height: 15px;
display: block;
- background: url(../images/bg_ur.png) no-repeat 100% 0;
overflow: hidden;
- }
- .offline .wrapper .hd span
- {
- /* background: url(../images/bg_ur_blank.png) no-repeat 100% 0; */
+ background: url(../images/page.png) no-repeat 100% -30px;
}
.wrapper .bd
{
@@ -137,18 +154,18 @@
{
padding-left: 216px;
height: 15px;
- background: url(../images/bg_ll.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -75px;
overflow: hidden;
}
.offline .wrapper .ft
{
- background: url(../images/bg_ll_blank.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -90px;
}
.wrapper .ft span
{
height: 15px;
display: block;
- background: url(../images/bg_lr.png) no-repeat 100% 0;
+ background: url(../images/page.png) no-repeat 100% -60px;
overflow: hidden;
}
.header, .footer
@@ -182,186 +199,9 @@
width: 302px;
height: 22px;
text-indent: -999em;
- background: url(../images/qt_ref_doc.png) no-repeat 0 0;
- }
- /* header elements */
- #nav-topright
- {
- height: 70px;
- }
-
- #nav-topright ul
- {
- list-style-type: none;
- float: right;
- width: 370px;
- margin-top: 11px;
- }
-
- #nav-topright li
- {
- display: inline-block;
- margin-right: 20px;
- float: left;
- }
-
- #nav-topright li.nav-topright-last
- {
- margin-right: 0;
- }
-
- #nav-topright li a
- {
- background: transparent url(../images/sprites-combined.png) no-repeat;
- height: 18px;
- display: block;
- overflow: hidden;
- text-indent: -9999px;
- }
-
- #nav-topright li.nav-topright-home a
- {
- width: 65px;
- background-position: -2px -91px;
- }
-
- #nav-topright li.nav-topright-home a:hover
- {
- background-position: -2px -117px;
- }
-
-
- #nav-topright li.nav-topright-dev a
- {
- width: 30px;
- background-position: -76px -91px;
- }
-
- #nav-topright li.nav-topright-dev a:hover
- {
- background-position: -76px -117px;
- }
-
-
- #nav-topright li.nav-topright-labs a
- {
- width: 40px;
- background-position: -114px -91px;
- }
-
- #nav-topright li.nav-topright-labs a:hover
- {
- background-position: -114px -117px;
- }
-
- #nav-topright li.nav-topright-doc a
- {
- width: 32px;
- background-position: -162px -91px;
- }
-
- #nav-topright li.nav-topright-doc a:hover, #nav-topright li.nav-topright-doc-active a
- {
- background-position: -162px -117px;
- }
-
- #nav-topright li.nav-topright-blog a
- {
- width: 40px;
- background-position: -203px -91px;
- }
-
- #nav-topright li.nav-topright-blog a:hover, #nav-topright li.nav-topright-blog-active a
- {
- background-position: -203px -117px;
- }
-
- #nav-topright li.nav-topright-shop a
- {
- width: 40px;
- background-position: -252px -91px;
- }
-
- #nav-topright li.nav-topright-shop a:hover, #nav-topright li.nav-topright-shop-active a
- {
- background-position: -252px -117px;
+ background: url(../images/sprites-combined.png) no-repeat -78px -235px;
}
- #nav-logo
- {
- background: transparent url( "../images/sprites-combined.png" ) no-repeat 0 -225px;
- left: -3px;
- position: absolute;
- width: 75px;
- height: 75px;
- top: 13px;
- }
- #nav-logo a
- {
- width: 75px;
- height: 75px;
- display: block;
- text-indent: -9999px;
- overflow: hidden;
- }
- /* Clearing */
- .header:after, .footer:after, .breadcrumb:after, .wrap .content:after, .group:after
- {
- content: ".";
- display: block;
- height: 0;
- clear: both;
- visibility: hidden;
- }
- /* ^ Clearing */
-
-
-
- .shortCut-topleft-inactive
- {
- padding-left: 3px;
- background: transparent url( "../images/sprites-combined.png" ) no-repeat 0px -58px;
- height: 20px;
- width: 93px;
- }
- .shortCut-topleft-inactive span
- {
- font-variant: normal;
- }
- #shortCut
- {
- padding-top: 10px;
- font-weight: bolder;
- color: #b0adab;
- }
- #shortCut ul
- {
- list-style-type: none;
- float: left;
- width: 347px;
- margin-left: 100px;
- }
- #shortCut li
- {
- display: inline-block;
- margin-right: 25px;
- float: left;
- white-space: nowrap;
- }
- #shortCut li a
- {
- color: #b0adab;
- text-decoration: none;
- }
- #shortCut li a:hover
- {
- color: #44a51c;
- text-decoration: none;
- }
-
- /* end of header elements */
-
- /* menu element */
.sidebar
{
float: left;
@@ -369,32 +209,32 @@
width: 200px;
font-size: 11px;
}
- .sidebar a
- {
- color: #00732f;
- text-decoration: none;
- }
- .offline .sidebar, .offline .feedback
+
+ .offline .sidebar, .offline .feedback, .offline .t_button
{
display: none;
}
+
.sidebar .searchlabel
{
padding: 0 0 2px 17px;
font: normal bold 11px/1.2 Verdana;
}
+
.sidebar .search
{
padding: 0 15px 0 16px;
}
+
.sidebar .search form
{
- width: 167px;
- height: 21px;
- padding: 2px 0 0 5px;
- background: url(../images/form_bg.png) no-repeat 0 0;
+ background: url(../images/sprites-combined.png) no-repeat -6px -348px;
+ height:21px;
+ padding:2px 0 0 5px;
+ width:167px;
}
- .sidebar .search form fieldset input#searchstring
+
+ .sidebar .search form input#pageType
{
width: 158px;
height: 19px;
@@ -403,35 +243,68 @@
outline: none;
font: 13px/1.2 Verdana;
}
+
.sidebar .box
{
padding: 17px 15px 5px 16px;
}
+
.sidebar .box .first
{
background-image: none;
}
+
.sidebar .box h2
{
font: normal 18px/1.2 Arial;
- padding: 15px 0 0 40px;
+ padding: 0;
min-height: 32px;
}
+ .sidebar .box h2 span
+ {
+ overflow: hidden;
+ display: inline-block;
+ }
.sidebar .box#lookup h2
{
- background: url(../images/api_lookup.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #lookup.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -6px -311px;
+ width: 27px;
+ height: 35px;
+ margin-right: 13px;
}
.sidebar .box#topics h2
{
- background: url(../images/api_topics.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #topics.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -94px -311px;
+ width: 27px;
+ height: 32px;
+ margin-right: 13px;
}
.sidebar .box#examples h2
{
- background: url(../images/api_examples.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #examples.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -48px -311px;
+ width: 30px;
+ height: 31px;
+ margin-right: 9px;
}
+
.sidebar .box .list
{
display: block;
+ max-height:200px;
+ overflow-y:auto;
+ overflow-x:none;
}
.sidebar .box .live
{
@@ -443,33 +316,34 @@
{
text-decoration: underline;
}
+ .sidebar .box ul
+ {
+ padding:10px;
+ }
.sidebar .box ul li
{
padding-left: 12px;
background: url(../images/bullet_gt.png) no-repeat 0 5px;
- margin-bottom: 15px;
+ margin-bottom: 5px;
}
.sidebar .bottombar
{
background: url(../images/box_bg.png) repeat-x 0 bottom;
}
- /* content elements */
.wrap
{
- overflow: hidden;
+ margin: 0 5px 0 208px;
+ overflow: visible;
}
.offline .wrap
{
margin: 0 5px 0 5px;
}
- /* tool bar */
.wrap .toolbar
{
background-color: #fafafa;
border-bottom: 1px solid #d1d1d1;
- height: 20px;
- margin-left: 3px;
- margin-right: 5px;
+ height: 20px;
position: relative;
}
.wrap .toolbar .toolblock
@@ -487,7 +361,7 @@
{
padding: 0 0 10px 21px;
right: 5px;
- vertical-align: top;
+ vertical-align: middle;
overflow: hidden;
}
.wrap .toolbar .toolbuttons .active
@@ -507,32 +381,56 @@
font-weight: bold;
color: #B0ADAB;
}
- #smallA
+
+ .toolbuttons #print
+ {
+ border-left: 1px solid #c5c4c4;
+ margin-top: 0;
+ padding-left: 7px;
+ text-indent: 0;
+ }
+ .toolbuttons #print a
+ {
+ width: 16px;
+ height: 16px;
+ }
+
+ .toolbuttons #print a span
+ {
+ width: 16px;
+ height: 16px;
+ text-indent: -999em;
+ display: block;
+ overflow: hidden;
+ background: url(../images/sprites-combined.png) no-repeat -137px -311px;
+ }
+
+ .toolbuttons #smallA
{
font-size: 10pt;
}
- #medA
+ .toolbuttons #medA
{
font-size: 12pt;
}
- #bigA
+ .toolbuttons #bigA
{
font-size: 14pt;
+ margin-right: 7px;
}
+
#smallA:hover, #medA:hover, #bigA:hover
{
color: #00732F;
}
- #print
+
+ .offline .wrap .breadcrumb
{
- font-size: 14pt;
- line-height: 20pt;
}
- #printIcon
+
+ .wrap .breadcrumb ul
{
- margin-left: 5px;
}
- /* bread crumbs */
.wrap .breadcrumb ul li
{
float: left;
@@ -545,6 +443,10 @@
{
font-weight: normal;
}
+ .wrap .breadcrumb ul li a
+ {
+ color: #363534;
+ }
.wrap .breadcrumb ul li.first
{
background-image: none;
@@ -554,29 +456,29 @@
.wrap .content
{
padding: 30px;
- position: relative;
}
- /* text elements */
- .heading
+
+ .wrap .content li
{
- font: normal 600 16px/1.0 Arial;
- padding-bottom: 15px;
+ padding-left: 12px;
+ background: url(../images/bullet_sq.png) no-repeat 0 5px;
+ font: normal 400 10pt/1 Verdana;
+ /* color: #44a51c;*/
+ margin-bottom: 10px;
}
-
- .subtitle
+ .content li:hover
{
- font-size: 13px;
+ /* text-decoration: underline;*/
}
- .small-subtitle
+ .offline .wrap .content
{
- font-size: 13px;
+ padding-top: 15px;
}
-
+
.wrap .content h1
{
font: 600 18px/1.2 Arial;
- padding-bottom: 15px;
}
.wrap .content h2
{
@@ -588,25 +490,18 @@
}
.wrap .content p
{
- line-height:20px;
- padding:10px 5px 10px 5px;
+ line-height: 20px;
+ padding: 5px;
}
+ .wrap .content table p
+ {
+ line-height: 20px;
+ padding: 0px;
+ }
.wrap .content ul
{
padding-left: 25px;
- }
- .wrap .content li
- {
- padding-left: 12px;
- background: url(../images/bullet_sq.png) no-repeat 0 5px;
- font: normal 400 10pt/1 Verdana;
- margin-bottom: 10px;
- line-height: 14px;
- }
- a
- {
- color: #00732F;
- text-decoration: none;
+ padding-top: 10px;
}
a:hover
{
@@ -618,22 +513,26 @@
color: #4c0033;
text-decoration: none;
}
- .offline .wrap .content
+ .content a:visited:hover
{
- padding-top: 15px;
- }
- .footer
+ color: #4c0033;
+ text-decoration: underline;
+ } .footer
{
min-height: 100px;
color: #797775;
font: normal 9px/1 Verdana;
text-align: center;
padding-top: 40px;
+ background-color: #E6E7E8;
+ margin: 0;
}
.feedback
{
- float: right;
- padding-right: 10px;
+ float: none;
+ position: absolute;
+ right: 15px;
+ bottom: 10px;
font: normal 8px/1 Verdana;
color: #B0ADAB;
}
@@ -644,37 +543,244 @@
color: #00732F;
text-decoration: underline;
}
+ .header:after, .footer:after, .breadcrumb:after, .wrap .content:after, .group:after
+ {
+ content: ".";
+ display: block;
+ height: 0;
+ clear: both;
+ visibility: hidden;
+ }
+ #nav-topright
+ {
+ height: 70px;
+ }
+
+ #nav-topright ul
+ {
+ list-style-type: none;
+ float: right;
+ width: 370px;
+ margin-top: 11px;
+ }
+
+ #nav-topright li
+ {
+ display: inline-block;
+ margin-right: 20px;
+ float: left;
+ }
+
+ #nav-topright li.nav-topright-last
+ {
+ margin-right: 0;
+ }
+
+ #nav-topright li a
+ {
+ background: transparent url(../images/sprites-combined.png) no-repeat;
+ height: 18px;
+ display: block;
+ overflow: hidden;
+ text-indent: -9999px;
+ }
+
+ #nav-topright li.nav-topright-home a
+ {
+ width: 65px;
+ background-position: -2px -91px;
+ }
+
+ #nav-topright li.nav-topright-home a:hover
+ {
+ background-position: -2px -117px;
+ }
+
+
+ #nav-topright li.nav-topright-dev a
+ {
+ width: 30px;
+ background-position: -76px -91px;
+ }
+
+ #nav-topright li.nav-topright-dev a:hover
+ {
+ background-position: -76px -117px;
+ }
+
+
+ #nav-topright li.nav-topright-labs a
+ {
+ width: 40px;
+ background-position: -114px -91px;
+ }
+
+ #nav-topright li.nav-topright-labs a:hover
+ {
+ background-position: -114px -117px;
+ }
+
+ #nav-topright li.nav-topright-doc a
+ {
+ width: 32px;
+ background-position: -162px -91px;
+ }
+
+ #nav-topright li.nav-topright-doc a:hover, #nav-topright li.nav-topright-doc-active a
+ {
+ background-position: -162px -117px;
+ }
+
+ #nav-topright li.nav-topright-blog a
+ {
+ width: 40px;
+ background-position: -203px -91px;
+ }
+
+ #nav-topright li.nav-topright-blog a:hover, #nav-topright li.nav-topright-blog-active a
+ {
+ background-position: -203px -117px;
+ }
+
+ #nav-topright li.nav-topright-shop a
+ {
+ width: 40px;
+ background-position: -252px -91px;
+ }
+
+ #nav-topright li.nav-topright-shop a:hover, #nav-topright li.nav-topright-shop-active a
+ {
+ background-position: -252px -117px;
+ }
+
+ #nav-logo
+ {
+ background: transparent url(../images/sprites-combined.png ) no-repeat 0 -225px;
+ left: -3px;
+ position: absolute;
+ width: 75px;
+ height: 75px;
+ top: 13px;
+ }
+ #nav-logo a
+ {
+ width: 75px;
+ height: 75px;
+ display: block;
+ text-indent: -9999px;
+ overflow: hidden;
+ }
+
+
+ .shortCut-topleft-inactive
+ {
+ padding-left: 3px;
+ background: transparent url( ../images/sprites-combined.png) no-repeat 0px -58px;
+ height: 20px;
+ width: 47px;
+ }
+ .shortCut-topleft-inactive span
+ {
+ font-variant: normal;
+ }
+ .shortCut-topleft-inactive span a:hover, .shortCut-topleft-active a:hover
+ {
+ text-decoration:none;
+ }
+ #shortCut
+ {
+ padding-top: 10px;
+ font-weight: bolder;
+ color: #b0adab;
+ }
+ #shortCut ul
+ {
+ list-style-type: none;
+ float: left;
+ width: 347px;
+ margin-left: 100px;
+ }
+ #shortCut li
+ {
+ display: inline-block;
+ margin-right: 25px;
+ float: left;
+ white-space: nowrap;
+ }
+ #shortCut li a
+ {
+ color: #b0adab;
+ }
+ #shortCut li a:hover
+ {
+ color: #44a51c;
+ }
+
hr
{
- background-color: #e0e0e0;
+ background-color: #E6E6E6;
+ border: 1px solid #E6E6E6;
height: 1px;
width: 100%;
text-align: left;
margin: 15px 0px 15px 0px;
}
-
+
.content .alignedsummary
{
margin: 15px;
}
- /* tables */
+ pre
+ {
+ border: 1px solid #DDDDDD;
+ margin: 0 20px 10px 10px;
+ padding: 20px 15px 20px 20px;
+ overflow-x: auto;
+ }
table, pre
{
-moz-border-radius: 7px 7px 7px 7px;
background-color: #F6F6F6;
border: 1px solid #E6E6E6;
border-collapse: separate;
- font-size: 11px;
- min-width: 395px;
+ font-size: 11px;
+ /*min-width: 395px;*/
margin-bottom: 25px;
+ display: inline-block;
+ }
+ thead
+ {
+ margin-top: 5px;
+ font:600 12px/1.2 Arial;
+ }
+ th
+ {
+ padding: 5px 15px 5px 15px;
+ background-color: #E1E1E1;
+ /* border-bottom: 1px solid #E6E6E6;*/
+ border-left: 1px solid #E6E6E6;
+ /* border-right: 1px solid #E6E6E6;*/
+ }
+ td
+ {
+ padding: 3px 15px 3px 20px;
+ /* border-left: 1px solid #E6E6E6;
+ border-right: 1px solid #E6E6E6;*/
}
- thead{margin-top: 5px;}
- th{ padding: 3px 15px 3px 15px;}
- td{padding: 3px 15px 3px 20px;}
+ tr.odd td:hover, tr.even td:hover
+ {
+ /* border-right: 1px solid #C3C3C3;
+ border-left: 1px solid #C3C3C3;*/
+ }
+
+ td.rightAlign
+ {
+ padding: 3px 15px 3px 10px;
+ }
table tr.odd
{
border-left: 1px solid #E6E6E6;
- background-color: #F6F6F6;
+ background-color: #F6F6F6;
color: #66666E;
}
table tr.even
@@ -683,14 +789,11 @@
background-color: #ffffff;
color: #66666E;
}
- table tr.odd:hover
- {
- background-color: #E6E6E6;
- }
- table tr.even:hover
+ table tr.odd td:hover, table tr.even td:hover
{
background-color: #E6E6E6;
}
+
span.comment
{
color: #8B0000;
@@ -700,15 +803,7 @@
{
color: #254117;
}
- pre
- {
- -moz-border-radius:7px 7px 7px 7px;
- background-color:#F6F6F6;
- border:1px solid #DDDDDD;
- margin:0 20px 10px 10px;
- padding:20px 15px 20px 20px;
- overflow-x:auto;
- }
+
.qmltype
{
text-align: center;
@@ -736,11 +831,11 @@
#feedbackBox
{
- display:none;
- -moz-border-radius:7px 7px 7px 7px;
- border:1px solid #DDDDDD;
- position:fixed;
- top:100px;
+ display: none;
+ -moz-border-radius: 7px 7px 7px 7px;
+ border: 1px solid #DDDDDD;
+ position: fixed;
+ top: 100px;
left: 33%;
height: 190px;
width: 400px;
@@ -750,27 +845,27 @@
}
#feedcloseX a
{
- display:inline;
+ display: inline;
padding: 5px 5px 0 0;
- margin-bottom:3px;
+ margin-bottom: 3px;
color: #363534;
- font-weight:600;
+ font-weight: 600;
float: right;
text-decoration: none;
}
+
#feedbox
- /* here */
{
- display:inline;
+ display: inline;
width: 370px;
height: 120px;
- margin:0px 25px 10px 15px;
+ margin: 0px 25px 10px 15px;
}
#feedsubmit
{
- display:inline;
- float:right;
- margin:4px 32px 0 0;
+ display: inline;
+ float: right;
+ margin: 4px 32px 0 0;
}
#blurpage
{
@@ -786,36 +881,72 @@
}
.toc
{
- float: right;
- -moz-border-radius:7px 7px 7px 7px;
- background-color:#F6F6F6;
- border:1px solid #DDDDDD;
- margin:0 20px 10px 10px;
- padding:20px 15px 20px 20px;
+ float: right;
+ -moz-border-radius: 7px 7px 7px 7px;
+ background-color: #F6F6F6;
+ border: 1px solid #DDDDDD;
+ margin: 0 20px 10px 10px;
+ padding: 20px 15px 20px 20px;
height: auto;
width: 200px;
}
- .toc h3
+ .toc h3, .generic a
{
- font:600 12px/1.2 Arial;
+ font: 600 12px/1.2 Arial;
}
+
+ .generic{
+ max-width:75%;
+ }
+ .generic td{
+ padding:0;
+ }
+
+ .generic .odd .alphaChar{
+ background-color: #F6F6F6;
+ }
+
+ .generic .even .alphaChar{
+ background-color: #FFFFFF;
+ }
+
+ .alignedsummary{}
+ .propsummary{}
+ .memItemLeft{}
+ .memItemRight{}
+ .bottomAlign{}
+ .highlightedCode
+ {
+ margin:10px;
+ }
+ .LegaleseLeft{}
+ .valuelist{}
+ .annotated{}
+ .obsolete{}
+ .compat{}
+ .flags{}
+ .qmlsummary{}
+ .qmlitem{}
+ .qmlproto{}
+ .qmlname{}
+ .qmlreadonly{}
+ .qmldefault{}
+ .qmldoc{}
+ .qt-style{}
+ .redFont{}
+ code{}
.wrap .content .toc ul
{
- /* float: left;*/
padding-left: 0px;
-
}
.wrap .content .toc .level2
{
- /* float: left;*/
- padding-left: 15px;
-
+ margin-left: 15px;
}
-
.content .toc li
{
@@ -823,133 +954,191 @@
background: url(../images/bullet_dn.png) no-repeat 0 5px;
}
- .relpage
+ .relpage
{
-moz-border-radius: 7px 7px 7px 7px;
border: 1px solid #DDDDDD;
padding: 25px 25px;
- clear:both;
+ clear: both;
}
.relpage ul
{
float: none;
padding: 15px;
}
- .content .relpage li
+ .content .relpage li
{
font: normal 11px/1.2 Verdana;
}
- /* edit */
h3.fn, span.fn
{
background-color: #F6F6F6;
border-width: 1px;
border-style: solid;
border-color: #E6E6E6;
- font-weight: bold;
- /* padding: 6px 0px 6px 10px;*/
- /* margin: 42px 0px 0px 0px;*/
+ font-weight: bold;
+ word-spacing:3px;
}
- /* edit */
- .indexbox
- {
- width: 100%;
- }
- .content .indexboxcont li
- {
- font: normal 600 13px/1 Verdana;
- }
+ .functionIndex {
+ font-size:12pt;
+ word-spacing:10px;
+ margin-bottom:10px;
+ background-color: #F6F6F6;
+ border-width: 1px;
+ border-style: solid;
+ border-color: #E6E6E6;
+ }
+
+ .centerAlign
+ {
+ text-align:center;
+ }
+
+ .rightAlign
+ {
+ text-align:right;
+ }
- /* .indexbox a
- {
- color: #00732f;
- text-decoration: none;
- }*/
- .indexbox a:hover, .indexbox a:visited:hover
- {
- color: #4c0033;
- text-decoration: underline;
- }
- .indexbox a:visited
+
+ .leftAlign
+ {
+ text-align:left;
+ }
+
+ .topAlign{
+ vertical-align:top
+ }
+
+ .functionIndex a{
+ display:inline-block;
+ }
+
+ /* start index box */
+ .indexbox
{
- color: #00732f;
- text-decoration: none;
+ width: 100%;
+ display:inline-block;
}
.indexboxcont
{
display: block;
+ /* overflow: hidden;*/
}
.indexboxbar
{
- background: transparent url( "../images/horBar.png" ) repeat-x left bottom;
+ background: transparent url(../images/horBar.png ) repeat-x left bottom;
margin-bottom: 25px;
+ /* background-image: none;
+ border-bottom: 1px solid #e2e2e2;*/
}
.indexboxcont .section
{
- display: inline-block;
+ display: inline-block;
width: 49%;
*width:42%;
_width:42%;
padding:0 2% 0 1%;
vertical-align:top;
+
}
.indexboxcont .indexIcon
- {
+ {
width: 11%;
*width:18%;
_width:18%;
overflow:hidden;
+
}
+
+.indexboxcont .section {
+ float: left;
+}
+
.indexboxcont .section p
- {
+ {
padding-top: 20px;
padding-bottom: 20px;
}
-
.indexboxcont .sectionlist
{
display: inline-block;
- width: 33%;
- margin-right: -2px;
- vertical-align: top;
+ width: 32.5%;
padding: 0;
}
- .tricol
- {
-
- }
.indexboxcont .sectionlist ul
{
- padding-left: 15px;
margin-bottom: 20px;
}
-/*
+
.indexboxcont .sectionlist ul li
{
line-height: 12px;
}
-*/
- .lastcol
+
+ .content .indexboxcont li
{
- display: inline-block;
- vertical-align: top;
- padding: 0;
- max-width: 25%;
+ font: normal 600 13px/1 Verdana;
}
- .tricol .lastcol
+ .indexbox a:hover, .indexbox a:visited:hover
{
- margin-left:-6px;
+ color: #4c0033;
+ text-decoration: underline;
}
- /*.toc ul*/
+ .indexbox a:visited
+ {
+ color: #00732f;
+ text-decoration: none;
+ }
+
+ .indexbox .indexIcon {
+ width: 11%;
+ }
- /* end page elements */
+
+ .indexbox .indexIcon span
+ {
+ display: block;
+ }
+
+ .indexbox.guide .indexIcon span
+ {
+ width: 96px;
+ height: 137px;
+ background: url(../images/sprites-combined.png) no-repeat -5px -376px;
+ padding: 0;
+ }
+
+ .indexbox.tools .indexIcon span
+ {
+ width: 115px;
+ height: 137px;
+ background: url(../images/sprites-combined.png) no-repeat -111px -376px;
+ padding: 0;
+ }
+ .indexboxcont:after
+ {
+ content: ".";
+ display: block;
+ height: 0;
+ clear: both;
+ visibility: hidden;
+ }
+
+.sidebar .search form input.loading
+{
+ background:url("../images/spinner.gif") no-repeat scroll right center transparent;
+}
+
+ /* end of screen media */
+
+
}
/* end of screen media */
@@ -957,7 +1146,7 @@
@media print
{
- .header, .footer, .toolbar, .feedback, .wrapper .hd, .wrapper .bd .sidebar, .wrapper .ft
+ input, textarea, .header, .footer, .toolbar, .feedback, .wrapper .hd, .wrapper .bd .sidebar, .wrapper .ft
{
display: none;
background: none;
diff --git a/doc/src/widgets-and-layouts/layout.qdoc b/doc/src/widgets-and-layouts/layout.qdoc
index 0cfde22..2ca202f 100644
--- a/doc/src/widgets-and-layouts/layout.qdoc
+++ b/doc/src/widgets-and-layouts/layout.qdoc
@@ -47,6 +47,7 @@
/*!
\page layout.html
\title Layout Management
+ \ingroup qt-gui-concepts
\brief A tour of the standard layout managers and an introduction to custom
layouts.
diff --git a/doc/src/widgets-and-layouts/styles.qdoc b/doc/src/widgets-and-layouts/styles.qdoc
index 9a28715..b4bec8c 100644
--- a/doc/src/widgets-and-layouts/styles.qdoc
+++ b/doc/src/widgets-and-layouts/styles.qdoc
@@ -48,6 +48,7 @@
/*!
\page style-reference.html
\title Implementing Styles and Style Aware Widgets
+ \ingroup qt-gui-concepts
\brief An overview of styles and the styling of widgets.
\ingroup frameworks-technologies
diff --git a/doc/src/widgets-and-layouts/widgets.qdoc b/doc/src/widgets-and-layouts/widgets.qdoc
index 7bd27b6..ac0bf77 100644
--- a/doc/src/widgets-and-layouts/widgets.qdoc
+++ b/doc/src/widgets-and-layouts/widgets.qdoc
@@ -42,6 +42,7 @@
/*!
\page widgets-and-layouts.html
\title Widgets and Layouts
+ \ingroup qt-gui-concepts
\ingroup frameworks-technologies
diff --git a/doc/src/windows-and-dialogs/dialogs.qdoc b/doc/src/windows-and-dialogs/dialogs.qdoc
index acee0c5..0b0a842 100644
--- a/doc/src/windows-and-dialogs/dialogs.qdoc
+++ b/doc/src/windows-and-dialogs/dialogs.qdoc
@@ -52,6 +52,7 @@
/*!
\page dialogs.html
\title Dialog Windows
+ \ingroup qt-gui-concepts
\brief An overview over dialog windows.
\previouspage The Application Main Window
diff --git a/doc/src/windows-and-dialogs/mainwindow.qdoc b/doc/src/windows-and-dialogs/mainwindow.qdoc
index 6adfa75..b282dab 100644
--- a/doc/src/windows-and-dialogs/mainwindow.qdoc
+++ b/doc/src/windows-and-dialogs/mainwindow.qdoc
@@ -47,6 +47,7 @@
/*!
\page application-windows.html
\title Application Windows and Dialogs
+ \ingroup qt-gui-concepts
\ingroup frameworks-technologies
\nextpage The Application Main Window
diff --git a/mkspecs/common/symbian/symbian.conf b/mkspecs/common/symbian/symbian.conf
index 0bd0bf2..89034ca 100644
--- a/mkspecs/common/symbian/symbian.conf
+++ b/mkspecs/common/symbian/symbian.conf
@@ -66,7 +66,7 @@ QMAKE_LINK_OBJECT_MAX =
QMAKE_LINK_OBJECT_SCRIPT=
QMAKE_LIBS = -llibc -llibm -leuser -llibdl
-QMAKE_LIBS_CORE = $$QMAKE_LIBS -lefsrv -lhal
+QMAKE_LIBS_CORE = $$QMAKE_LIBS -lefsrv -lhal -lbafl
QMAKE_LIBS_GUI = $$QMAKE_LIBS_CORE -lfbscli -lbitgdi -lgdi -lws32 -lapgrfx -lcone -leikcore -lmediaclientaudio -leikcoctl -leiksrv -lapparc -lcentralrepository
QMAKE_LIBS_NETWORK =
QMAKE_LIBS_EGL = -llibEGL
diff --git a/qmake/generators/win32/msvc_objectmodel.h b/qmake/generators/win32/msvc_objectmodel.h
index 3f60a13..97f8570 100644
--- a/qmake/generators/win32/msvc_objectmodel.h
+++ b/qmake/generators/win32/msvc_objectmodel.h
@@ -59,7 +59,7 @@ enum DotNET {
NET2003 = 0x71,
NET2005 = 0x80,
NET2008 = 0x90,
- NET2010 = 0x91
+ NET2010 = 0xa0
};
/*
diff --git a/qmake/generators/win32/msvc_vcxproj.cpp b/qmake/generators/win32/msvc_vcxproj.cpp
index da93fe3..05c1511 100644
--- a/qmake/generators/win32/msvc_vcxproj.cpp
+++ b/qmake/generators/win32/msvc_vcxproj.cpp
@@ -89,7 +89,6 @@ bool VcxprojGenerator::writeMakefile(QTextStream &t)
return true;
}
return project->isActiveConfig("build_pass");
- return true;
}
diff --git a/qmake/qmake.pri b/qmake/qmake.pri
index 0163839..6e0f8a2 100644
--- a/qmake/qmake.pri
+++ b/qmake/qmake.pri
@@ -13,7 +13,8 @@ SOURCES += project.cpp property.cpp main.cpp generators/makefile.cpp \
generators/xmloutput.cpp generators/win32/borland_bmake.cpp \
generators/win32/msvc_nmake.cpp generators/projectgenerator.cpp \
generators/win32/msvc_vcproj.cpp \
- generators/win32/msvc_objectmodel.cpp \
+ generators/win32/msvc_vcxproj.cpp \
+ generators/win32/msvc_objectmodel.cpp generators/win32/msbuild_objectmodel.cpp \
generators/symbian/symbiancommon.cpp \
generators/symbian/symmake.cpp \
generators/symbian/symmake_abld.cpp \
@@ -24,11 +25,12 @@ SOURCES += project.cpp property.cpp main.cpp generators/makefile.cpp \
HEADERS += project.h property.h generators/makefile.h \
generators/unix/unixmake.h meta.h option.h cachekeys.h \
- generators/win32/winmakefile.h generators/projectgenerator.h \
+ generators/win32/winmakefile.h generators/win32/mingw_make.h generators/projectgenerator.h \
generators/makefiledeps.h generators/metamakefile.h generators/mac/pbuilder_pbx.h \
generators/xmloutput.h generators/win32/borland_bmake.h generators/win32/msvc_nmake.h \
generators/win32/msvc_vcproj.h \
- generators/win32/mingw_make.h generators/win32/msvc_objectmodel.h \
+ generators/win32/msvc_vcxproj.h \
+ generators/win32/msvc_objectmodel.h generators/win32/msbuild_objectmodel.h \
generators/symbian/symbiancommon.h \
generators/symbian/symmake.h \
generators/symbian/symmake_abld.h \
diff --git a/src/3rdparty/webkit/.tag b/src/3rdparty/webkit/.tag
index 75fc5e7..d8b4b32 100644
--- a/src/3rdparty/webkit/.tag
+++ b/src/3rdparty/webkit/.tag
@@ -1 +1 @@
-b4aa5e1ddc41edab895132aba3cc66d9d7129444
+57d10d5c05e59bbf7de8189ff47dd18d1be996dc
diff --git a/src/3rdparty/webkit/JavaScriptCore/ChangeLog b/src/3rdparty/webkit/JavaScriptCore/ChangeLog
index 1439ae0..97176ef 100644
--- a/src/3rdparty/webkit/JavaScriptCore/ChangeLog
+++ b/src/3rdparty/webkit/JavaScriptCore/ChangeLog
@@ -1,3 +1,26 @@
+2010-05-10 Laszlo Gombos <laszlo.1.gombos@nokia.com>
+
+ Reviewed by Darin Adler.
+
+ [Qt] Disable JIT support for mingw-w64
+ https://bugs.webkit.org/show_bug.cgi?id=38747
+
+ Disale JIT for mingw-w64 as it is reportedly
+ unstable.
+
+ Thanks for Vanboxem Rruben for the investigation.
+
+ * wtf/Platform.h:
+
+2010-05-06 Laszlo Gombos <laszlo.1.gombos@nokia.com>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] Enable YARR_JIT for X86 Mac for QtWebKit
+ https://bugs.webkit.org/show_bug.cgi?id=38668
+
+ * wtf/Platform.h:
+
2010-05-02 Laszlo Gombos <laszlo.1.gombos@nokia.com>
Reviewed by Eric Seidel.
diff --git a/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h b/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h
index c582905..8d98765 100644
--- a/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h
+++ b/src/3rdparty/webkit/JavaScriptCore/wtf/Platform.h
@@ -927,8 +927,6 @@ on MinGW. See https://bugs.webkit.org/show_bug.cgi?id=29268 */
#elif CPU(X86) && OS(WINDOWS) && COMPILER(MINGW) && GCC_VERSION >= 40100
#define ENABLE_JIT 1
#define WTF_USE_JIT_STUB_ARGUMENT_VA_LIST 1
-#elif CPU(X86_64) && OS(WINDOWS) && COMPILER(MINGW64) && GCC_VERSION >= 40100
- #define ENABLE_JIT 1
#elif CPU(X86) && OS(WINDOWS) && COMPILER(MSVC)
#define ENABLE_JIT 1
#define WTF_USE_JIT_STUB_ARGUMENT_REGISTER 1
@@ -1011,7 +1009,9 @@ on MinGW. See https://bugs.webkit.org/show_bug.cgi?id=29268 */
|| (CPU(X86_64) && OS(LINUX) && GCC_VERSION >= 40100) \
|| (CPU(ARM_TRADITIONAL) && OS(LINUX)) \
|| (CPU(ARM_TRADITIONAL) && OS(SYMBIAN) && COMPILER(RVCT)) \
- || (CPU(MIPS) && OS(LINUX))
+ || (CPU(MIPS) && OS(LINUX)) \
+ || (CPU(X86) && OS(DARWIN)) \
+ || (CPU(X86_64) && OS(DARWIN))
#define ENABLE_YARR 1
#define ENABLE_YARR_JIT 1
#endif
diff --git a/src/3rdparty/webkit/VERSION b/src/3rdparty/webkit/VERSION
index 98debf6..c8c2aa3 100644
--- a/src/3rdparty/webkit/VERSION
+++ b/src/3rdparty/webkit/VERSION
@@ -4,4 +4,4 @@ This is a snapshot of the Qt port of WebKit from
and has the sha1 checksum
- 07b60cf799680fcfb7785ee88e14f8030a5dbfa2
+ dc5821c3df2ef60456d85263160852f5335cf946
diff --git a/src/3rdparty/webkit/WebCore/ChangeLog b/src/3rdparty/webkit/WebCore/ChangeLog
index 6617b66..76b4eff 100644
--- a/src/3rdparty/webkit/WebCore/ChangeLog
+++ b/src/3rdparty/webkit/WebCore/ChangeLog
@@ -1,3 +1,265 @@
+2010-04-29 James Robinson <jamesr@chromium.org>
+
+ Reviewed by Simon Fraser.
+
+ Calls FrameView::scrollPositionChanged whenever a ScrollView is scrolled
+ https://bugs.webkit.org/show_bug.cgi?id=38286
+
+ When a ScrollView's scroll position is changed, we have to call
+ FrameView::scrollPositionChanged to generate repaint invalidation for
+ fixed position elements. This ends up getting called indirectly when
+ the ScrollView has a platformWidget through the port layer
+ (see WebHTMLView.mm's _frameOrBoundsChanged method for how the mac
+ port does it) but not when there is no platformWidget.
+
+ This is tested by the fast/repaint/fixed-* tests when run in pixel
+ mode.
+
+ Test: fast/repaint/fixed-move-after-keyboard-scroll.html
+
+ * page/FrameView.h:
+ * platform/ScrollView.cpp:
+ (WebCore::ScrollView::valueChanged):
+ * platform/ScrollView.h:
+ (WebCore::ScrollView::scrollPositionChanged):
+
+2010-04-23 Kenneth Rohde Christiansen <kenneth@webkit.org>
+
+ Unreviewed build fix.
+
+ Change Media to StyleMedia
+
+ * DerivedSources.make:
+
+2010-04-22 Kenneth Rohde Christiansen <kenneth@webkit.org>
+
+ Reviewed by Laszlo Gombos.
+
+ Rename window.media to window.styleMedia
+ https://bugs.webkit.org/show_bug.cgi?id=36187
+
+ Rename the interface Media to StyleMedia as required by the
+ new CSSOM View spec.
+
+ * Android.derived.jscbindings.mk:
+ * Android.derived.v8bindings.mk:
+ * GNUmakefile.am:
+ * WebCore.gypi:
+ * WebCore.pri:
+ * WebCore.pro:
+ * WebCore.vcproj/WebCore.vcproj:
+ * WebCore.xcodeproj/project.pbxproj:
+ * css/Media.cpp: Removed.
+ * css/Media.h: Removed.
+ * css/Media.idl: Removed.
+ * css/StyleMedia.cpp: Added.
+ (WebCore::StyleMedia::StyleMedia):
+ (WebCore::StyleMedia::type):
+ (WebCore::StyleMedia::matchMedium):
+ * css/StyleMedia.h: Added.
+ (WebCore::StyleMedia::create):
+ (WebCore::StyleMedia::disconnectFrame):
+ * css/StyleMedia.idl: Added.
+ * page/DOMWindow.cpp:
+ (WebCore::DOMWindow::styleMedia):
+ * page/DOMWindow.h:
+ (WebCore::DOMWindow::optionalMedia):
+ * page/DOMWindow.idl:
+
+2010-04-22 Kenneth Rohde Christiansen <kenneth@webkit.org>
+
+ Reviewed by Simon Fraser.
+
+ Rename window.media to window.styleMedia
+ https://bugs.webkit.org/show_bug.cgi?id=36187
+
+ It has been defined that the AbstractView media extension
+ defined in the CSSOM View spec should be renamed to styleMedia.
+ This patch does that and updates the current layout tests
+ making use of it.
+
+ * page/AbstractView.idl:
+ * page/DOMWindow.cpp:
+ (WebCore::DOMWindow::styleMedia):
+ * page/DOMWindow.h:
+ * page/DOMWindow.idl:
+
+2010-05-11 Benjamin Poulain <benjamin.poulain@nokia.com>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] fast/text/find-hidden-text.html
+ https://bugs.webkit.org/show_bug.cgi?id=32922
+
+ Use the real page step for populating the QStyleOption otherwhise
+ the size can be negative, which can break the QStyle used.
+
+ * platform/qt/ScrollbarThemeQt.cpp:
+ (WebCore::styleOptionSlider):
+
+2010-05-03 Antonio Gomes <tonikitoo@webkit.org>
+
+ Reviewed by Kenneth Christiansen.
+
+ Spatial Navigation: create a getter for the "fudgeFactor"
+ https://bugs.webkit.org/show_bug.cgi?id=38488
+
+ A couple of places in the Spatial Navigation code make use of a "fudge factor"
+ to improve precision by working around outline focus metrics and such. Patch adds
+ a helper method for unify getter operations of this value, instead of having it
+ declared locally in the various methods it is used.
+
+ No behaviour change.
+
+ * page/SpatialNavigation.cpp:
+ (WebCore::scrollIntoView):
+ (WebCore::deflateIfOverlapped):
+ * page/SpatialNavigation.h:
+ (WebCore::fudgeFactor):
+
+2010-05-10 Markus Goetz <Markus.Goetz@nokia.com>
+
+ Reviewed by Simon Hausmann.
+
+ Qt after 4.6.3 has its integrated DNS cache. Therefore some
+ code is not necessary anymore.
+
+ https://bugs.webkit.org/show_bug.cgi?id=38834
+
+ * platform/network/qt/DnsPrefetchHelper.h:
+ (WebCore::DnsPrefetchHelper::lookup):
+ (WebCore::DnsPrefetchHelper::lookedUp):
+
+2010-05-06 Laszlo Gombos <laszlo.1.gombos@nokia.com>
+
+ Unreviewed, build fix WinCE for QtWebKit.
+
+ [Qt] Compilation with Plugins disabled is broken
+ https://bugs.webkit.org/show_bug.cgi?id=31407
+
+ Rename platform/qt/TemporaryLinkStubs.cpp to avoid name collition on
+ Windows.
+
+ Thanks for Ismail "cartman" Donmez for help.
+
+ No new tests, as there is no new functionality.
+
+ * WebCore.gypi:
+ * WebCore.pro:
+ * platform/qt/TemporaryLinkStubs.cpp: Removed.
+ * platform/qt/TemporaryLinkStubsQt.cpp: Copied from WebCore/platform/qt/TemporaryLinkStubs.cpp.
+
+2010-04-23 Qi Zhang <qi.2.zhang@nokia.com>
+
+ Reviewed by Laszlo Gombos.
+
+ [Qt] LayoutTests/fast/canvas/pointInPath.html passed, actually it failed
+ https://bugs.webkit.org/show_bug.cgi?id=37276
+
+ QPainterPath::contains doesn't count the point on the bound.
+
+ * platform/graphics/qt/PathQt.cpp:
+ (WebCore::isPointOnPathBorder):
+ (WebCore::Path::contains):
+
+2010-05-07 Tor Arne Vestbø <tor.arne.vestbo@nokia.com>
+
+ Reviewed by Simon Hausmann.
+
+ [Qt] Fix rendering of -webkit-user-select: none
+
+ -webkit-user-select: none is implemented by filling
+ the area with an invalid default-constructed Color.
+ In most ports passing an invalid color down to the
+ graphics backend seems to produce transparent fills.
+
+ In Qt the behavior of painting with an invalid QColor
+ is undefined, and in practice it results in painting
+ black opaque areas.
+
+ One way to fix this would be to use Qt::transparent
+ when converting an undefined Color to a QColor, but
+ Qt does not have short circuits for fully transparent
+ painting, and we actually end up in slow code paths
+ due to the transparency. So, we're better of doing the
+ short circuit in WebKit.
+
+ https://bugs.webkit.org/show_bug.cgi?id=38523
+
+ * platform/graphics/qt/GraphicsContextQt.cpp:
+
+2010-04-05 Robert Hogan <robert@webkit.org>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] Fix infinite redirection loop in QNetworkReplyHandler
+
+ Put a maximum on consecutive redirections so we don't have to
+ worry about whether it's the same url or not.
+
+ Tolerate up to 10 consecutive redirections, anything beyond
+ that is considered a potentially infinite recursion in the
+ redirection requests. This is the same behaviour as Firefox.
+
+ https://bugs.webkit.org/show_bug.cgi?id=37097
+
+ * platform/network/qt/QNetworkReplyHandler.cpp:
+ (WebCore::QNetworkReplyHandler::QNetworkReplyHandler):
+ (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+ * platform/network/qt/QNetworkReplyHandler.h:
+
+2010-04-05 Robert Hogan <robert@webkit.org>
+
+ Reviewed by Kenneth Rohde-Christiansen.
+
+ [Qt] Fix infinite redirection loop in QNetworkReplyHandler
+
+ Qt enters an infinite loop if a redirect response redirects to itself.
+
+ Fixes http/tests/xmlhttprequest/connection-error-sync.html
+
+ https://bugs.webkit.org/show_bug.cgi?id=37097
+
+ * platform/network/qt/QNetworkReplyHandler.cpp:
+ (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+
+2010-05-07 Ben Murdoch <benm@google.com>
+
+ Reviewed by Darin Adler.
+
+ Potential crash in EventHandler::handleTouchEvent
+ https://bugs.webkit.org/show_bug.cgi?id=38646
+
+ Fix a ref counting bug that can cause a crash if the m_originatingouchPointTargets
+ hashmap holds the last ref to an EventTarget when the user lifts their finger.
+
+ This is very hard to reproduce in a consistent way and clearly a
+ simple logic error in the code, therefore no new tests.
+
+ * page/EventHandler.cpp:
+ (WebCore::EventHandler::handleTouchEvent): Don't let the RefPtr we get back from
+ the hasmap go out of scope so soon as it could delete the wrapped ptr if the
+ hashmap held the last ref (and we use the raw ptr that the RefPtr
+ wraps later in the WebCore::Touch constructor).
+
+2010-05-04 Ben Murdoch <benm@google.com>
+
+ Reviewed by Simon Hausmann.
+
+ Crash in handleTouchEvent: using dangling node ptrs in hashmap
+ https://bugs.webkit.org/show_bug.cgi?id=38514
+
+ When navigating away from a page, if you have your finger still
+ pressed and then lift it on the new page we see a crash if the
+ node got deleted as we still have a dangling pointer in the
+ m_originatingTouchPointTargets hashmap and try to use it as the
+ receiver to dispatch a touchend event.
+
+ Test: fast/events/touch/touch-stale-node-crash.html
+
+ * page/EventHandler.cpp:
+ (WebCore::EventHandler::clear): Clear the hashmap of touch targets.
+
2010-05-04 Luiz Agostini <luiz.agostini@openbossa.org>
Reviewed by Simon Hausmann.
diff --git a/src/3rdparty/webkit/WebCore/WebCore.gypi b/src/3rdparty/webkit/WebCore/WebCore.gypi
index caa79f2..1e92f1f 100644
--- a/src/3rdparty/webkit/WebCore/WebCore.gypi
+++ b/src/3rdparty/webkit/WebCore/WebCore.gypi
@@ -18,10 +18,10 @@
'css/CSSVariablesDeclaration.idl',
'css/CSSVariablesRule.idl',
'css/Counter.idl',
- 'css/Media.idl',
'css/MediaList.idl',
- 'css/RGBColor.idl',
'css/Rect.idl',
+ 'css/RGBColor.idl',
+ 'css/StyleMedia.idl',
'css/StyleSheet.idl',
'css/StyleSheetList.idl',
'css/WebKitCSSKeyframeRule.idl',
@@ -1003,33 +1003,33 @@
'css/FontValue.h',
'css/MediaFeatureNames.cpp',
'css/MediaFeatureNames.h',
- 'css/Media.cpp',
- 'css/Media.h',
'css/MediaList.cpp',
'css/MediaList.h',
'css/MediaQuery.cpp',
- 'css/MediaQuery.h',
'css/MediaQueryEvaluator.cpp',
'css/MediaQueryEvaluator.h',
'css/MediaQueryExp.cpp',
'css/MediaQueryExp.h',
+ 'css/MediaQuery.h',
'css/Pair.h',
'css/Rect.h',
'css/RGBColor.cpp',
'css/RGBColor.h',
- 'css/SVGCSSComputedStyleDeclaration.cpp',
- 'css/SVGCSSParser.cpp',
- 'css/SVGCSSStyleSelector.cpp',
'css/ShadowValue.cpp',
'css/ShadowValue.h',
'css/StyleBase.cpp',
'css/StyleBase.h',
'css/StyleList.cpp',
'css/StyleList.h',
+ 'css/StyleMedia.cpp',
+ 'css/StyleMedia.h',
'css/StyleSheet.cpp',
'css/StyleSheet.h',
'css/StyleSheetList.cpp',
'css/StyleSheetList.h',
+ 'css/SVGCSSComputedStyleDeclaration.cpp',
+ 'css/SVGCSSParser.cpp',
+ 'css/SVGCSSStyleSelector.cpp',
'css/WebKitCSSKeyframeRule.cpp',
'css/WebKitCSSKeyframeRule.h',
'css/WebKitCSSKeyframesRule.cpp',
@@ -2640,7 +2640,7 @@
'platform/qt/SharedBufferQt.cpp',
'platform/qt/SharedTimerQt.cpp',
'platform/qt/SoundQt.cpp',
- 'platform/qt/TemporaryLinkStubs.cpp',
+ 'platform/qt/TemporaryLinkStubsQt.cpp',
'platform/qt/WheelEventQt.cpp',
'platform/qt/WidgetQt.cpp',
'platform/sql/SQLValue.cpp',
diff --git a/src/3rdparty/webkit/WebCore/WebCore.pri b/src/3rdparty/webkit/WebCore/WebCore.pri
index ad514a2..5f5987f 100644
--- a/src/3rdparty/webkit/WebCore/WebCore.pri
+++ b/src/3rdparty/webkit/WebCore/WebCore.pri
@@ -227,10 +227,10 @@ IDL_BINDINGS += \
css/CSSValueList.idl \
css/CSSVariablesDeclaration.idl \
css/CSSVariablesRule.idl \
- css/Media.idl \
css/MediaList.idl \
- css/RGBColor.idl \
css/Rect.idl \
+ css/RGBColor.idl \
+ css/StyleMedia.idl \
css/StyleSheet.idl \
css/StyleSheetList.idl \
css/WebKitCSSKeyframeRule.idl \
diff --git a/src/3rdparty/webkit/WebCore/WebCore.pro b/src/3rdparty/webkit/WebCore/WebCore.pro
index beeb529..254d17b 100644
--- a/src/3rdparty/webkit/WebCore/WebCore.pro
+++ b/src/3rdparty/webkit/WebCore/WebCore.pro
@@ -431,7 +431,6 @@ SOURCES += \
css/FontFamilyValue.cpp \
css/FontValue.cpp \
css/MediaFeatureNames.cpp \
- css/Media.cpp \
css/MediaList.cpp \
css/MediaQuery.cpp \
css/MediaQueryEvaluator.cpp \
@@ -440,6 +439,7 @@ SOURCES += \
css/ShadowValue.cpp \
css/StyleBase.cpp \
css/StyleList.cpp \
+ css/StyleMedia.cpp \
css/StyleSheet.cpp \
css/StyleSheetList.cpp \
css/WebKitCSSKeyframeRule.cpp \
@@ -1145,7 +1145,6 @@ HEADERS += \
css/FontFamilyValue.h \
css/FontValue.h \
css/MediaFeatureNames.h \
- css/Media.h \
css/MediaList.h \
css/MediaQueryEvaluator.h \
css/MediaQueryExp.h \
@@ -1154,6 +1153,7 @@ HEADERS += \
css/ShadowValue.h \
css/StyleBase.h \
css/StyleList.h \
+ css/StyleMedia.h \
css/StyleSheet.h \
css/StyleSheetList.h \
css/WebKitCSSKeyframeRule.h \
@@ -2081,7 +2081,7 @@ SOURCES += \
platform/qt/SoundQt.cpp \
platform/qt/LoggingQt.cpp \
platform/text/qt/StringQt.cpp \
- platform/qt/TemporaryLinkStubs.cpp \
+ platform/qt/TemporaryLinkStubsQt.cpp \
platform/text/qt/TextBoundariesQt.cpp \
platform/text/qt/TextBreakIteratorQt.cpp \
platform/text/qt/TextCodecQt.cpp \
diff --git a/src/3rdparty/webkit/WebCore/css/Media.cpp b/src/3rdparty/webkit/WebCore/css/StyleMedia.cpp
index e238602..6cb662f 100644
--- a/src/3rdparty/webkit/WebCore/css/Media.cpp
+++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.cpp
@@ -24,8 +24,8 @@
*/
#include "config.h"
+#include "StyleMedia.h"
-#include "Media.h"
#include "CSSStyleSelector.h"
#include "Frame.h"
#include "FrameView.h"
@@ -34,12 +34,12 @@
namespace WebCore {
-Media::Media(Frame* frame)
+StyleMedia::StyleMedia(Frame* frame)
: m_frame(frame)
{
}
-String Media::type() const
+String StyleMedia::type() const
{
FrameView* view = m_frame ? m_frame->view() : 0;
if (view)
@@ -48,7 +48,7 @@ String Media::type() const
return String();
}
-bool Media::matchMedium(const String& query) const
+bool StyleMedia::matchMedium(const String& query) const
{
if (!m_frame)
return false;
diff --git a/src/3rdparty/webkit/WebCore/css/Media.h b/src/3rdparty/webkit/WebCore/css/StyleMedia.h
index ee6961b..761e6a3 100644
--- a/src/3rdparty/webkit/WebCore/css/Media.h
+++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.h
@@ -1,5 +1,6 @@
/*
* Copyright (C) 2009 Apple Inc. All rights reserved.
+ * Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies)
*
* Redistribution and use in source and binary forms, with or without
* modification, are permitted provided that the following conditions
@@ -23,18 +24,18 @@
* OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
*/
-#ifndef Media_h
-#define Media_h
+#ifndef StyleMedia_h
+#define StyleMedia_h
#include "DOMWindow.h"
namespace WebCore {
-class Media : public RefCounted<Media> {
+class StyleMedia : public RefCounted<StyleMedia> {
public:
- static PassRefPtr<Media> create(Frame* frame)
+ static PassRefPtr<StyleMedia> create(Frame* frame)
{
- return adoptRef(new Media(frame));
+ return adoptRef(new StyleMedia(frame));
}
void disconnectFrame() { m_frame = 0; }
@@ -42,13 +43,13 @@ public:
String type() const;
bool matchMedium(const String&) const;
-
+
private:
- Media(Frame*);
+ StyleMedia(Frame*);
Frame* m_frame;
};
} // namespace
-#endif // Media_h
+#endif // StyleMedia_h
diff --git a/src/3rdparty/webkit/WebCore/css/Media.idl b/src/3rdparty/webkit/WebCore/css/StyleMedia.idl
index 1bf5900..7be35cc 100644
--- a/src/3rdparty/webkit/WebCore/css/Media.idl
+++ b/src/3rdparty/webkit/WebCore/css/StyleMedia.idl
@@ -1,5 +1,6 @@
/*
* Copyright (C) 2009 Apple Inc. All rights reserved.
+ * Copyright (C) 2010 Nokia Corporation and/or its subsidiary(-ies)
*
* Redistribution and use in source and binary forms, with or without
* modification, are permitted provided that the following conditions
@@ -24,7 +25,7 @@
*/
module view {
- interface Media {
+ interface StyleMedia {
readonly attribute DOMString type;
boolean matchMedium(in DOMString mediaquery);
};
diff --git a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp
index 04238bc..11dfd2e 100644
--- a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp
+++ b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.cpp
@@ -152,7 +152,6 @@
#include "JSHTMLVideoElement.h"
#include "JSImageData.h"
#include "JSKeyboardEvent.h"
-#include "JSMedia.h"
#include "JSMediaError.h"
#include "JSMediaList.h"
#include "JSMessageChannel.h"
@@ -299,6 +298,7 @@
#include "JSSharedWorker.h"
#include "JSStorage.h"
#include "JSStorageEvent.h"
+#include "JSStyleMedia.h"
#include "JSStyleSheet.h"
#include "JSStyleSheetList.h"
#include "JSText.h"
@@ -334,11 +334,11 @@
#include "JSXPathResult.h"
#include "JSXSLTProcessor.h"
#include "KURL.h"
-#include "Media.h"
#include "Navigator.h"
#include "RegisteredEventListener.h"
#include "Screen.h"
#include "Storage.h"
+#include "StyleMedia.h"
#include "WebKitPoint.h"
#include <runtime/Error.h>
#include <runtime/JSNumberCell.h>
@@ -395,7 +395,7 @@ static const HashTableValue JSDOMWindowTableValues[409] =
{ "parent", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowParent), (intptr_t)setJSDOMWindowParent },
{ "top", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowTop), (intptr_t)setJSDOMWindowTop },
{ "document", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowDocument), (intptr_t)0 },
- { "media", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowMedia), (intptr_t)0 },
+ { "styleMedia", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowStyleMedia), (intptr_t)0 },
{ "devicePixelRatio", DontDelete, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowDevicePixelRatio), (intptr_t)setJSDOMWindowDevicePixelRatio },
{ "applicationCache", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowApplicationCache), (intptr_t)0 },
{ "sessionStorage", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsDOMWindowSessionStorage), (intptr_t)0 },
@@ -1304,14 +1304,14 @@ JSValue jsDOMWindowDocument(ExecState* exec, JSValue slotBase, const Identifier&
return result;
}
-JSValue jsDOMWindowMedia(ExecState* exec, JSValue slotBase, const Identifier&)
+JSValue jsDOMWindowStyleMedia(ExecState* exec, JSValue slotBase, const Identifier&)
{
JSDOMWindow* castedThis = static_cast<JSDOMWindow*>(asObject(slotBase));
if (!castedThis->allowsAccessFrom(exec))
return jsUndefined();
UNUSED_PARAM(exec);
DOMWindow* imp = static_cast<DOMWindow*>(castedThis->impl());
- JSValue result = toJS(exec, castedThis->globalObject(), WTF::getPtr(imp->media()));
+ JSValue result = toJS(exec, castedThis->globalObject(), WTF::getPtr(imp->styleMedia()));
return result;
}
diff --git a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h
index a6f3253..7e50556 100644
--- a/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h
+++ b/src/3rdparty/webkit/WebCore/generated/JSDOMWindow.h
@@ -231,7 +231,7 @@ void setJSDOMWindowParent(JSC::ExecState*, JSC::JSObject*, JSC::JSValue);
JSC::JSValue jsDOMWindowTop(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
void setJSDOMWindowTop(JSC::ExecState*, JSC::JSObject*, JSC::JSValue);
JSC::JSValue jsDOMWindowDocument(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
-JSC::JSValue jsDOMWindowMedia(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
+JSC::JSValue jsDOMWindowStyleMedia(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
JSC::JSValue jsDOMWindowDevicePixelRatio(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
void setJSDOMWindowDevicePixelRatio(JSC::ExecState*, JSC::JSObject*, JSC::JSValue);
JSC::JSValue jsDOMWindowApplicationCache(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
diff --git a/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp b/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp
deleted file mode 100644
index 1579c2b..0000000
--- a/src/3rdparty/webkit/WebCore/generated/JSMedia.cpp
+++ /dev/null
@@ -1,201 +0,0 @@
-/*
- This file is part of the WebKit open source project.
- This file has been generated by generate-bindings.pl. DO NOT MODIFY!
-
- This library is free software; you can redistribute it and/or
- modify it under the terms of the GNU Library General Public
- License as published by the Free Software Foundation; either
- version 2 of the License, or (at your option) any later version.
-
- This library is distributed in the hope that it will be useful,
- but WITHOUT ANY WARRANTY; without even the implied warranty of
- MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- Library General Public License for more details.
-
- You should have received a copy of the GNU Library General Public License
- along with this library; see the file COPYING.LIB. If not, write to
- the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor,
- Boston, MA 02110-1301, USA.
-*/
-
-#include "config.h"
-#include "JSMedia.h"
-
-#include "KURL.h"
-#include "Media.h"
-#include <runtime/Error.h>
-#include <runtime/JSString.h>
-#include <wtf/GetPtr.h>
-
-using namespace JSC;
-
-namespace WebCore {
-
-ASSERT_CLASS_FITS_IN_CELL(JSMedia);
-
-/* Hash table */
-
-static const HashTableValue JSMediaTableValues[3] =
-{
- { "type", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsMediaType), (intptr_t)0 },
- { "constructor", DontEnum|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsMediaConstructor), (intptr_t)0 },
- { 0, 0, 0, 0 }
-};
-
-static JSC_CONST_HASHTABLE HashTable JSMediaTable =
-#if ENABLE(PERFECT_HASH_SIZE)
- { 3, JSMediaTableValues, 0 };
-#else
- { 4, 3, JSMediaTableValues, 0 };
-#endif
-
-/* Hash table for constructor */
-
-static const HashTableValue JSMediaConstructorTableValues[1] =
-{
- { 0, 0, 0, 0 }
-};
-
-static JSC_CONST_HASHTABLE HashTable JSMediaConstructorTable =
-#if ENABLE(PERFECT_HASH_SIZE)
- { 0, JSMediaConstructorTableValues, 0 };
-#else
- { 1, 0, JSMediaConstructorTableValues, 0 };
-#endif
-
-class JSMediaConstructor : public DOMConstructorObject {
-public:
- JSMediaConstructor(ExecState* exec, JSDOMGlobalObject* globalObject)
- : DOMConstructorObject(JSMediaConstructor::createStructure(globalObject->objectPrototype()), globalObject)
- {
- putDirect(exec->propertyNames().prototype, JSMediaPrototype::self(exec, globalObject), None);
- }
- virtual bool getOwnPropertySlot(ExecState*, const Identifier&, PropertySlot&);
- virtual bool getOwnPropertyDescriptor(ExecState*, const Identifier&, PropertyDescriptor&);
- virtual const ClassInfo* classInfo() const { return &s_info; }
- static const ClassInfo s_info;
-
- static PassRefPtr<Structure> createStructure(JSValue proto)
- {
- return Structure::create(proto, TypeInfo(ObjectType, StructureFlags), AnonymousSlotCount);
- }
-
-protected:
- static const unsigned StructureFlags = OverridesGetOwnPropertySlot | ImplementsHasInstance | DOMConstructorObject::StructureFlags;
-};
-
-const ClassInfo JSMediaConstructor::s_info = { "MediaConstructor", 0, &JSMediaConstructorTable, 0 };
-
-bool JSMediaConstructor::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
-{
- return getStaticValueSlot<JSMediaConstructor, DOMObject>(exec, &JSMediaConstructorTable, this, propertyName, slot);
-}
-
-bool JSMediaConstructor::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
-{
- return getStaticValueDescriptor<JSMediaConstructor, DOMObject>(exec, &JSMediaConstructorTable, this, propertyName, descriptor);
-}
-
-/* Hash table for prototype */
-
-static const HashTableValue JSMediaPrototypeTableValues[2] =
-{
- { "matchMedium", DontDelete|Function, (intptr_t)static_cast<NativeFunction>(jsMediaPrototypeFunctionMatchMedium), (intptr_t)1 },
- { 0, 0, 0, 0 }
-};
-
-static JSC_CONST_HASHTABLE HashTable JSMediaPrototypeTable =
-#if ENABLE(PERFECT_HASH_SIZE)
- { 0, JSMediaPrototypeTableValues, 0 };
-#else
- { 2, 1, JSMediaPrototypeTableValues, 0 };
-#endif
-
-const ClassInfo JSMediaPrototype::s_info = { "MediaPrototype", 0, &JSMediaPrototypeTable, 0 };
-
-JSObject* JSMediaPrototype::self(ExecState* exec, JSGlobalObject* globalObject)
-{
- return getDOMPrototype<JSMedia>(exec, globalObject);
-}
-
-bool JSMediaPrototype::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
-{
- return getStaticFunctionSlot<JSObject>(exec, &JSMediaPrototypeTable, this, propertyName, slot);
-}
-
-bool JSMediaPrototype::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
-{
- return getStaticFunctionDescriptor<JSObject>(exec, &JSMediaPrototypeTable, this, propertyName, descriptor);
-}
-
-const ClassInfo JSMedia::s_info = { "Media", 0, &JSMediaTable, 0 };
-
-JSMedia::JSMedia(NonNullPassRefPtr<Structure> structure, JSDOMGlobalObject* globalObject, PassRefPtr<Media> impl)
- : DOMObjectWithGlobalPointer(structure, globalObject)
- , m_impl(impl)
-{
-}
-
-JSMedia::~JSMedia()
-{
- forgetDOMObject(this, impl());
-}
-
-JSObject* JSMedia::createPrototype(ExecState* exec, JSGlobalObject* globalObject)
-{
- return new (exec) JSMediaPrototype(JSMediaPrototype::createStructure(globalObject->objectPrototype()));
-}
-
-bool JSMedia::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
-{
- return getStaticValueSlot<JSMedia, Base>(exec, &JSMediaTable, this, propertyName, slot);
-}
-
-bool JSMedia::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
-{
- return getStaticValueDescriptor<JSMedia, Base>(exec, &JSMediaTable, this, propertyName, descriptor);
-}
-
-JSValue jsMediaType(ExecState* exec, JSValue slotBase, const Identifier&)
-{
- JSMedia* castedThis = static_cast<JSMedia*>(asObject(slotBase));
- UNUSED_PARAM(exec);
- Media* imp = static_cast<Media*>(castedThis->impl());
- JSValue result = jsString(exec, imp->type());
- return result;
-}
-
-JSValue jsMediaConstructor(ExecState* exec, JSValue slotBase, const Identifier&)
-{
- JSMedia* domObject = static_cast<JSMedia*>(asObject(slotBase));
- return JSMedia::getConstructor(exec, domObject->globalObject());
-}
-JSValue JSMedia::getConstructor(ExecState* exec, JSGlobalObject* globalObject)
-{
- return getDOMConstructor<JSMediaConstructor>(exec, static_cast<JSDOMGlobalObject*>(globalObject));
-}
-
-JSValue JSC_HOST_CALL jsMediaPrototypeFunctionMatchMedium(ExecState* exec, JSObject*, JSValue thisValue, const ArgList& args)
-{
- UNUSED_PARAM(args);
- if (!thisValue.inherits(&JSMedia::s_info))
- return throwError(exec, TypeError);
- JSMedia* castedThisObj = static_cast<JSMedia*>(asObject(thisValue));
- Media* imp = static_cast<Media*>(castedThisObj->impl());
- const UString& mediaquery = args.at(0).toString(exec);
-
-
- JSC::JSValue result = jsBoolean(imp->matchMedium(mediaquery));
- return result;
-}
-
-JSC::JSValue toJS(JSC::ExecState* exec, JSDOMGlobalObject* globalObject, Media* object)
-{
- return getDOMObjectWrapper<JSMedia>(exec, globalObject, object);
-}
-Media* toMedia(JSC::JSValue value)
-{
- return value.inherits(&JSMedia::s_info) ? static_cast<JSMedia*>(asObject(value))->impl() : 0;
-}
-
-}
diff --git a/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp
new file mode 100644
index 0000000..b06bf09
--- /dev/null
+++ b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.cpp
@@ -0,0 +1,201 @@
+/*
+ This file is part of the WebKit open source project.
+ This file has been generated by generate-bindings.pl. DO NOT MODIFY!
+
+ This library is free software; you can redistribute it and/or
+ modify it under the terms of the GNU Library General Public
+ License as published by the Free Software Foundation; either
+ version 2 of the License, or (at your option) any later version.
+
+ This library is distributed in the hope that it will be useful,
+ but WITHOUT ANY WARRANTY; without even the implied warranty of
+ MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ Library General Public License for more details.
+
+ You should have received a copy of the GNU Library General Public License
+ along with this library; see the file COPYING.LIB. If not, write to
+ the Free Software Foundation, Inc., 51 Franklin Street, Fifth Floor,
+ Boston, MA 02110-1301, USA.
+*/
+
+#include "config.h"
+#include "JSStyleMedia.h"
+
+#include "KURL.h"
+#include "StyleMedia.h"
+#include <runtime/Error.h>
+#include <runtime/JSString.h>
+#include <wtf/GetPtr.h>
+
+using namespace JSC;
+
+namespace WebCore {
+
+ASSERT_CLASS_FITS_IN_CELL(JSStyleMedia);
+
+/* Hash table */
+
+static const HashTableValue JSStyleMediaTableValues[3] =
+{
+ { "type", DontDelete|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsStyleMediaType), (intptr_t)0 },
+ { "constructor", DontEnum|ReadOnly, (intptr_t)static_cast<PropertySlot::GetValueFunc>(jsStyleMediaConstructor), (intptr_t)0 },
+ { 0, 0, 0, 0 }
+};
+
+static JSC_CONST_HASHTABLE HashTable JSStyleMediaTable =
+#if ENABLE(PERFECT_HASH_SIZE)
+ { 3, JSStyleMediaTableValues, 0 };
+#else
+ { 4, 3, JSStyleMediaTableValues, 0 };
+#endif
+
+/* Hash table for constructor */
+
+static const HashTableValue JSStyleMediaConstructorTableValues[1] =
+{
+ { 0, 0, 0, 0 }
+};
+
+static JSC_CONST_HASHTABLE HashTable JSStyleMediaConstructorTable =
+#if ENABLE(PERFECT_HASH_SIZE)
+ { 0, JSStyleMediaConstructorTableValues, 0 };
+#else
+ { 1, 0, JSStyleMediaConstructorTableValues, 0 };
+#endif
+
+class JSStyleMediaConstructor : public DOMConstructorObject {
+public:
+ JSStyleMediaConstructor(ExecState* exec, JSDOMGlobalObject* globalObject)
+ : DOMConstructorObject(JSStyleMediaConstructor::createStructure(globalObject->objectPrototype()), globalObject)
+ {
+ putDirect(exec->propertyNames().prototype, JSStyleMediaPrototype::self(exec, globalObject), None);
+ }
+ virtual bool getOwnPropertySlot(ExecState*, const Identifier&, PropertySlot&);
+ virtual bool getOwnPropertyDescriptor(ExecState*, const Identifier&, PropertyDescriptor&);
+ virtual const ClassInfo* classInfo() const { return &s_info; }
+ static const ClassInfo s_info;
+
+ static PassRefPtr<Structure> createStructure(JSValue proto)
+ {
+ return Structure::create(proto, TypeInfo(ObjectType, StructureFlags), AnonymousSlotCount);
+ }
+
+protected:
+ static const unsigned StructureFlags = OverridesGetOwnPropertySlot | ImplementsHasInstance | DOMConstructorObject::StructureFlags;
+};
+
+const ClassInfo JSStyleMediaConstructor::s_info = { "StyleMediaConstructor", 0, &JSStyleMediaConstructorTable, 0 };
+
+bool JSStyleMediaConstructor::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
+{
+ return getStaticValueSlot<JSStyleMediaConstructor, DOMObject>(exec, &JSStyleMediaConstructorTable, this, propertyName, slot);
+}
+
+bool JSStyleMediaConstructor::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
+{
+ return getStaticValueDescriptor<JSStyleMediaConstructor, DOMObject>(exec, &JSStyleMediaConstructorTable, this, propertyName, descriptor);
+}
+
+/* Hash table for prototype */
+
+static const HashTableValue JSStyleMediaPrototypeTableValues[2] =
+{
+ { "matchMedium", DontDelete|Function, (intptr_t)static_cast<NativeFunction>(jsStyleMediaPrototypeFunctionMatchMedium), (intptr_t)1 },
+ { 0, 0, 0, 0 }
+};
+
+static JSC_CONST_HASHTABLE HashTable JSStyleMediaPrototypeTable =
+#if ENABLE(PERFECT_HASH_SIZE)
+ { 0, JSStyleMediaPrototypeTableValues, 0 };
+#else
+ { 2, 1, JSStyleMediaPrototypeTableValues, 0 };
+#endif
+
+const ClassInfo JSStyleMediaPrototype::s_info = { "StyleMediaPrototype", 0, &JSStyleMediaPrototypeTable, 0 };
+
+JSObject* JSStyleMediaPrototype::self(ExecState* exec, JSGlobalObject* globalObject)
+{
+ return getDOMPrototype<JSStyleMedia>(exec, globalObject);
+}
+
+bool JSStyleMediaPrototype::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
+{
+ return getStaticFunctionSlot<JSObject>(exec, &JSStyleMediaPrototypeTable, this, propertyName, slot);
+}
+
+bool JSStyleMediaPrototype::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
+{
+ return getStaticFunctionDescriptor<JSObject>(exec, &JSStyleMediaPrototypeTable, this, propertyName, descriptor);
+}
+
+const ClassInfo JSStyleMedia::s_info = { "StyleMedia", 0, &JSStyleMediaTable, 0 };
+
+JSStyleMedia::JSStyleMedia(NonNullPassRefPtr<Structure> structure, JSDOMGlobalObject* globalObject, PassRefPtr<StyleMedia> impl)
+ : DOMObjectWithGlobalPointer(structure, globalObject)
+ , m_impl(impl)
+{
+}
+
+JSStyleMedia::~JSStyleMedia()
+{
+ forgetDOMObject(this, impl());
+}
+
+JSObject* JSStyleMedia::createPrototype(ExecState* exec, JSGlobalObject* globalObject)
+{
+ return new (exec) JSStyleMediaPrototype(JSStyleMediaPrototype::createStructure(globalObject->objectPrototype()));
+}
+
+bool JSStyleMedia::getOwnPropertySlot(ExecState* exec, const Identifier& propertyName, PropertySlot& slot)
+{
+ return getStaticValueSlot<JSStyleMedia, Base>(exec, &JSStyleMediaTable, this, propertyName, slot);
+}
+
+bool JSStyleMedia::getOwnPropertyDescriptor(ExecState* exec, const Identifier& propertyName, PropertyDescriptor& descriptor)
+{
+ return getStaticValueDescriptor<JSStyleMedia, Base>(exec, &JSStyleMediaTable, this, propertyName, descriptor);
+}
+
+JSValue jsStyleMediaType(ExecState* exec, JSValue slotBase, const Identifier&)
+{
+ JSStyleMedia* castedThis = static_cast<JSStyleMedia*>(asObject(slotBase));
+ UNUSED_PARAM(exec);
+ StyleMedia* imp = static_cast<StyleMedia*>(castedThis->impl());
+ JSValue result = jsString(exec, imp->type());
+ return result;
+}
+
+JSValue jsStyleMediaConstructor(ExecState* exec, JSValue slotBase, const Identifier&)
+{
+ JSStyleMedia* domObject = static_cast<JSStyleMedia*>(asObject(slotBase));
+ return JSStyleMedia::getConstructor(exec, domObject->globalObject());
+}
+JSValue JSStyleMedia::getConstructor(ExecState* exec, JSGlobalObject* globalObject)
+{
+ return getDOMConstructor<JSStyleMediaConstructor>(exec, static_cast<JSDOMGlobalObject*>(globalObject));
+}
+
+JSValue JSC_HOST_CALL jsStyleMediaPrototypeFunctionMatchMedium(ExecState* exec, JSObject*, JSValue thisValue, const ArgList& args)
+{
+ UNUSED_PARAM(args);
+ if (!thisValue.inherits(&JSStyleMedia::s_info))
+ return throwError(exec, TypeError);
+ JSStyleMedia* castedThisObj = static_cast<JSStyleMedia*>(asObject(thisValue));
+ StyleMedia* imp = static_cast<StyleMedia*>(castedThisObj->impl());
+ const UString& mediaquery = args.at(0).toString(exec);
+
+
+ JSC::JSValue result = jsBoolean(imp->matchMedium(mediaquery));
+ return result;
+}
+
+JSC::JSValue toJS(JSC::ExecState* exec, JSDOMGlobalObject* globalObject, StyleMedia* object)
+{
+ return getDOMObjectWrapper<JSStyleMedia>(exec, globalObject, object);
+}
+StyleMedia* toStyleMedia(JSC::JSValue value)
+{
+ return value.inherits(&JSStyleMedia::s_info) ? static_cast<JSStyleMedia*>(asObject(value))->impl() : 0;
+}
+
+}
diff --git a/src/3rdparty/webkit/WebCore/generated/JSMedia.h b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.h
index 28515c9..12601d5 100644
--- a/src/3rdparty/webkit/WebCore/generated/JSMedia.h
+++ b/src/3rdparty/webkit/WebCore/generated/JSStyleMedia.h
@@ -18,8 +18,8 @@
Boston, MA 02110-1301, USA.
*/
-#ifndef JSMedia_h
-#define JSMedia_h
+#ifndef JSStyleMedia_h
+#define JSStyleMedia_h
#include "JSDOMBinding.h"
#include <runtime/JSGlobalObject.h>
@@ -27,13 +27,13 @@
namespace WebCore {
-class Media;
+class StyleMedia;
-class JSMedia : public DOMObjectWithGlobalPointer {
+class JSStyleMedia : public DOMObjectWithGlobalPointer {
typedef DOMObjectWithGlobalPointer Base;
public:
- JSMedia(NonNullPassRefPtr<JSC::Structure>, JSDOMGlobalObject*, PassRefPtr<Media>);
- virtual ~JSMedia();
+ JSStyleMedia(NonNullPassRefPtr<JSC::Structure>, JSDOMGlobalObject*, PassRefPtr<StyleMedia>);
+ virtual ~JSStyleMedia();
static JSC::JSObject* createPrototype(JSC::ExecState*, JSC::JSGlobalObject*);
virtual bool getOwnPropertySlot(JSC::ExecState*, const JSC::Identifier& propertyName, JSC::PropertySlot&);
virtual bool getOwnPropertyDescriptor(JSC::ExecState*, const JSC::Identifier& propertyName, JSC::PropertyDescriptor&);
@@ -46,18 +46,18 @@ public:
}
static JSC::JSValue getConstructor(JSC::ExecState*, JSC::JSGlobalObject*);
- Media* impl() const { return m_impl.get(); }
+ StyleMedia* impl() const { return m_impl.get(); }
private:
- RefPtr<Media> m_impl;
+ RefPtr<StyleMedia> m_impl;
protected:
static const unsigned StructureFlags = JSC::OverridesGetOwnPropertySlot | Base::StructureFlags;
};
-JSC::JSValue toJS(JSC::ExecState*, JSDOMGlobalObject*, Media*);
-Media* toMedia(JSC::JSValue);
+JSC::JSValue toJS(JSC::ExecState*, JSDOMGlobalObject*, StyleMedia*);
+StyleMedia* toStyleMedia(JSC::JSValue);
-class JSMediaPrototype : public JSC::JSObject {
+class JSStyleMediaPrototype : public JSC::JSObject {
typedef JSC::JSObject Base;
public:
static JSC::JSObject* self(JSC::ExecState*, JSC::JSGlobalObject*);
@@ -69,18 +69,18 @@ public:
{
return JSC::Structure::create(prototype, JSC::TypeInfo(JSC::ObjectType, StructureFlags), AnonymousSlotCount);
}
- JSMediaPrototype(NonNullPassRefPtr<JSC::Structure> structure) : JSC::JSObject(structure) { }
+ JSStyleMediaPrototype(NonNullPassRefPtr<JSC::Structure> structure) : JSC::JSObject(structure) { }
protected:
static const unsigned StructureFlags = JSC::OverridesGetOwnPropertySlot | Base::StructureFlags;
};
// Functions
-JSC::JSValue JSC_HOST_CALL jsMediaPrototypeFunctionMatchMedium(JSC::ExecState*, JSC::JSObject*, JSC::JSValue, const JSC::ArgList&);
+JSC::JSValue JSC_HOST_CALL jsStyleMediaPrototypeFunctionMatchMedium(JSC::ExecState*, JSC::JSObject*, JSC::JSValue, const JSC::ArgList&);
// Attributes
-JSC::JSValue jsMediaType(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
-JSC::JSValue jsMediaConstructor(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
+JSC::JSValue jsStyleMediaType(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
+JSC::JSValue jsStyleMediaConstructor(JSC::ExecState*, JSC::JSValue, const JSC::Identifier&);
} // namespace WebCore
diff --git a/src/3rdparty/webkit/WebCore/page/AbstractView.idl b/src/3rdparty/webkit/WebCore/page/AbstractView.idl
index 290bf48..e4ece0f 100644
--- a/src/3rdparty/webkit/WebCore/page/AbstractView.idl
+++ b/src/3rdparty/webkit/WebCore/page/AbstractView.idl
@@ -32,7 +32,7 @@ module views {
OmitConstructor
] AbstractView {
readonly attribute Document document;
- readonly attribute Media media;
+ readonly attribute Media styleMedia;
};
}
diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp b/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp
index dd90200..8dcff5c 100644
--- a/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp
+++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.cpp
@@ -57,7 +57,7 @@
#include "InspectorController.h"
#include "InspectorTimelineAgent.h"
#include "Location.h"
-#include "Media.h"
+#include "StyleMedia.h"
#include "MessageEvent.h"
#include "Navigator.h"
#include "NotificationCenter.h"
@@ -1112,10 +1112,10 @@ Document* DOMWindow::document() const
return m_frame->document();
}
-PassRefPtr<Media> DOMWindow::media() const
+PassRefPtr<StyleMedia> DOMWindow::styleMedia() const
{
if (!m_media)
- m_media = Media::create(m_frame);
+ m_media = StyleMedia::create(m_frame);
return m_media.get();
}
diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.h b/src/3rdparty/webkit/WebCore/page/DOMWindow.h
index a70713b..cf9bc88 100644
--- a/src/3rdparty/webkit/WebCore/page/DOMWindow.h
+++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.h
@@ -56,7 +56,7 @@ namespace WebCore {
class IndexedDatabaseRequest;
class InspectorTimelineAgent;
class Location;
- class Media;
+ class StyleMedia;
class Navigator;
class Node;
class NotificationCenter;
@@ -187,7 +187,7 @@ namespace WebCore {
// DOM Level 2 AbstractView Interface
Document* document() const;
// CSSOM View Module
- PassRefPtr<Media> media() const;
+ PassRefPtr<StyleMedia> styleMedia() const;
// DOM Level 2 Style Interface
PassRefPtr<CSSStyleDeclaration> getComputedStyle(Element*, const String& pseudoElt) const;
@@ -353,7 +353,7 @@ namespace WebCore {
Console* optionalConsole() const { return m_console.get(); }
Navigator* optionalNavigator() const { return m_navigator.get(); }
Location* optionalLocation() const { return m_location.get(); }
- Media* optionalMedia() const { return m_media.get(); }
+ StyleMedia* optionalMedia() const { return m_media.get(); }
#if ENABLE(DOM_STORAGE)
Storage* optionalSessionStorage() const { return m_sessionStorage.get(); }
Storage* optionalLocalStorage() const { return m_localStorage.get(); }
@@ -390,7 +390,7 @@ namespace WebCore {
mutable RefPtr<Console> m_console;
mutable RefPtr<Navigator> m_navigator;
mutable RefPtr<Location> m_location;
- mutable RefPtr<Media> m_media;
+ mutable RefPtr<StyleMedia> m_media;
#if ENABLE(DOM_STORAGE)
mutable RefPtr<Storage> m_sessionStorage;
mutable RefPtr<Storage> m_localStorage;
diff --git a/src/3rdparty/webkit/WebCore/page/DOMWindow.idl b/src/3rdparty/webkit/WebCore/page/DOMWindow.idl
index 31e4d4f..33e49e8 100644
--- a/src/3rdparty/webkit/WebCore/page/DOMWindow.idl
+++ b/src/3rdparty/webkit/WebCore/page/DOMWindow.idl
@@ -141,7 +141,7 @@ module window {
readonly attribute Document document;
// CSSOM View Module
- readonly attribute Media media;
+ readonly attribute StyleMedia styleMedia;
// DOM Level 2 Style Interface
CSSStyleDeclaration getComputedStyle(in Element element,
diff --git a/src/3rdparty/webkit/WebCore/page/EventHandler.cpp b/src/3rdparty/webkit/WebCore/page/EventHandler.cpp
index 0a0e8c6..46dd7ae 100644
--- a/src/3rdparty/webkit/WebCore/page/EventHandler.cpp
+++ b/src/3rdparty/webkit/WebCore/page/EventHandler.cpp
@@ -230,6 +230,9 @@ void EventHandler::clear()
m_capturingMouseEventsNode = 0;
m_latchedWheelEventNode = 0;
m_previousWheelScrolledNode = 0;
+#if ENABLE(TOUCH_EVENTS)
+ m_originatingTouchPointTargets.clear();
+#endif
}
void EventHandler::selectClosestWordFromMouseEvent(const MouseEventWithHitTestResults& result)
@@ -2714,21 +2717,21 @@ bool EventHandler::handleTouchEvent(const PlatformTouchEvent& event)
// Increment the platform touch id by 1 to avoid storing a key of 0 in the hashmap.
unsigned touchPointTargetKey = point.id() + 1;
- EventTarget* touchTarget = 0;
+ RefPtr<EventTarget> touchTarget;
if (point.state() == PlatformTouchPoint::TouchPressed) {
m_originatingTouchPointTargets.set(touchPointTargetKey, target);
touchTarget = target;
} else if (point.state() == PlatformTouchPoint::TouchReleased || point.state() == PlatformTouchPoint::TouchCancelled) {
// The target should be the original target for this touch, so get it from the hashmap. As it's a release or cancel
// we also remove it from the map.
- touchTarget = m_originatingTouchPointTargets.take(touchPointTargetKey).get();
+ touchTarget = m_originatingTouchPointTargets.take(touchPointTargetKey);
} else
- touchTarget = m_originatingTouchPointTargets.get(touchPointTargetKey).get();
+ touchTarget = m_originatingTouchPointTargets.get(touchPointTargetKey);
- if (!touchTarget)
+ if (!touchTarget.get())
continue;
- RefPtr<Touch> touch = Touch::create(doc->frame(), touchTarget, point.id(),
+ RefPtr<Touch> touch = Touch::create(doc->frame(), touchTarget.get(), point.id(),
point.screenPos().x(), point.screenPos().y(),
adjustedPageX, adjustedPageY);
diff --git a/src/3rdparty/webkit/WebCore/page/FrameView.h b/src/3rdparty/webkit/WebCore/page/FrameView.h
index 7371d13..7119975 100644
--- a/src/3rdparty/webkit/WebCore/page/FrameView.h
+++ b/src/3rdparty/webkit/WebCore/page/FrameView.h
@@ -139,7 +139,7 @@ public:
virtual void scrollRectIntoViewRecursively(const IntRect&);
virtual void setScrollPosition(const IntPoint&);
- void scrollPositionChanged();
+ virtual void scrollPositionChanged();
String mediaType() const;
void setMediaType(const String&);
diff --git a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp
index 890eacd..d7eaf25 100644
--- a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp
+++ b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.cpp
@@ -477,9 +477,8 @@ void scrollIntoView(Element* element)
// it is preferable to inflate |element|'s bounding rect a bit before
// scrolling it for accurate reason.
// Element's scrollIntoView method does not provide this flexibility.
- static const int fudgeFactor = 2;
IntRect bounds = element->getRect();
- bounds.inflate(fudgeFactor);
+ bounds.inflate(fudgeFactor());
element->renderer()->enclosingLayer()->scrollRectToVisible(bounds);
}
@@ -497,14 +496,14 @@ static void deflateIfOverlapped(IntRect& a, IntRect& b)
if (!a.intersects(b) || a.contains(b) || b.contains(a))
return;
- static const int fudgeFactor = -2;
+ int deflateFactor = -fudgeFactor();
// Avoid negative width or height values.
- if ((a.width() + 2 * fudgeFactor > 0) && (a.height() + 2 * fudgeFactor > 0))
- a.inflate(fudgeFactor);
+ if ((a.width() + 2 * deflateFactor > 0) && (a.height() + 2 * deflateFactor > 0))
+ a.inflate(deflateFactor);
- if ((b.width() + 2 * fudgeFactor > 0) && (b.height() + 2 * fudgeFactor > 0))
- b.inflate(fudgeFactor);
+ if ((b.width() + 2 * deflateFactor > 0) && (b.height() + 2 * deflateFactor > 0))
+ b.inflate(deflateFactor);
}
static bool checkNegativeCoordsForNode(Node* node, const IntRect& curRect)
diff --git a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h
index 90ff1cf..309b095 100644
--- a/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h
+++ b/src/3rdparty/webkit/WebCore/page/SpatialNavigation.h
@@ -40,6 +40,11 @@ inline long long maxDistance()
return numeric_limits<long long>::max();
}
+inline unsigned int fudgeFactor()
+{
+ return 2;
+}
+
// Spatially speaking, two given elements in a web page can be:
// 1) Fully aligned: There is a full intersection between the rects, either
// vertically or horizontally.
diff --git a/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp b/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp
index 5c70eff..e50ab55 100644
--- a/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/ScrollView.cpp
@@ -292,6 +292,7 @@ void ScrollView::valueChanged(Scrollbar* scrollbar)
if (scrollbarsSuppressed())
return;
+ scrollPositionChanged();
scrollContents(scrollDelta);
}
diff --git a/src/3rdparty/webkit/WebCore/platform/ScrollView.h b/src/3rdparty/webkit/WebCore/platform/ScrollView.h
index 9134ddf..118a310 100644
--- a/src/3rdparty/webkit/WebCore/platform/ScrollView.h
+++ b/src/3rdparty/webkit/WebCore/platform/ScrollView.h
@@ -302,6 +302,9 @@ private:
// Called to update the scrollbars to accurately reflect the state of the view.
void updateScrollbars(const IntSize& desiredOffset);
+ // Called when the scroll position within this view changes. FrameView overrides this to generate repaint invalidations.
+ virtual void scrollPositionChanged() {}
+
void platformInit();
void platformDestroy();
void platformAddChild(Widget*);
diff --git a/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp b/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp
index edac268..0100b72 100644
--- a/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/graphics/qt/GraphicsContextQt.cpp
@@ -641,12 +641,12 @@ void GraphicsContext::fillRect(const FloatRect& rect)
}
}
-void GraphicsContext::fillRect(const FloatRect& rect, const Color& c, ColorSpace colorSpace)
+void GraphicsContext::fillRect(const FloatRect& rect, const Color& color, ColorSpace colorSpace)
{
- if (paintingDisabled())
+ if (paintingDisabled() || !color.isValid())
return;
- m_data->solidColor.setColor(c);
+ m_data->solidColor.setColor(color);
QPainter* p = m_data->p();
if (m_common->state.shadowColor.isValid())
drawBorderlessRectShadow(this, p, rect);
@@ -655,7 +655,7 @@ void GraphicsContext::fillRect(const FloatRect& rect, const Color& c, ColorSpace
void GraphicsContext::fillRoundedRect(const IntRect& rect, const IntSize& topLeft, const IntSize& topRight, const IntSize& bottomLeft, const IntSize& bottomRight, const Color& color, ColorSpace colorSpace)
{
- if (paintingDisabled() || !color.alpha())
+ if (paintingDisabled() || !color.isValid() || !color.alpha())
return;
Path path = Path::createRoundedRectangle(rect, topLeft, topRight, bottomLeft, bottomRight);
@@ -717,7 +717,7 @@ void GraphicsContext::drawFocusRing(const Vector<Path>& paths, int width, int of
*/
void GraphicsContext::drawFocusRing(const Vector<IntRect>& rects, int /* width */, int /* offset */, const Color& color)
{
- if (paintingDisabled())
+ if (paintingDisabled() || !color.isValid())
return;
unsigned rectCount = rects.size();
@@ -1141,8 +1141,9 @@ void GraphicsContext::setURLForRect(const KURL&, const IntRect&)
void GraphicsContext::setPlatformStrokeColor(const Color& color, ColorSpace colorSpace)
{
- if (paintingDisabled())
+ if (paintingDisabled() || !color.isValid())
return;
+
QPainter* p = m_data->p();
QPen newPen(p->pen());
m_data->solidColor.setColor(color);
@@ -1172,8 +1173,9 @@ void GraphicsContext::setPlatformStrokeThickness(float thickness)
void GraphicsContext::setPlatformFillColor(const Color& color, ColorSpace colorSpace)
{
- if (paintingDisabled())
+ if (paintingDisabled() || !color.isValid())
return;
+
m_data->solidColor.setColor(color);
m_data->p()->setBrush(m_data->solidColor);
}
diff --git a/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp b/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp
index ee4af7f..4b0c21f 100644
--- a/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/graphics/qt/PathQt.cpp
@@ -69,12 +69,41 @@ Path& Path::operator=(const Path& other)
return *this;
}
+// Check whether a point is on the border
+bool isPointOnPathBorder(const QPolygonF& border, const QPointF& p)
+{
+ QPointF p1 = border.at(0);
+ QPointF p2;
+
+ for (int i = 1; i < border.size(); ++i) {
+ p2 = border.at(i);
+ // (x1<=x<=x2||x1=>x>=x2) && (y1<=y<=y2||y1=>y>=y2) && (y2-y1)(x-x1) == (y-y1)(x2-x1)
+ // In which, (y2-y1)(x-x1) == (y-y1)(x2-x1) is from (y2-y1)/(x2-x1) == (y-y1)/(x-x1)
+ // it want to check the slope between p1 and p2 is same with slope between p and p1,
+ // if so then the three points lie on the same line.
+ // In which, (x1<=x<=x2||x1=>x>=x2) && (y1<=y<=y2||y1=>y>=y2) want to make sure p is
+ // between p1 and p2, not outside.
+ if (((p.x() <= p1.x() && p.x() >= p2.x()) || (p.x() >= p1.x() && p.x() <= p2.x()))
+ && ((p.y() <= p1.y() && p.y() >= p2.y()) || (p.y() >= p1.y() && p.y() <= p2.y()))
+ && (p2.y() - p1.y()) * (p.x() - p1.x()) == (p.y() - p1.y()) * (p2.x() - p1.x())) {
+ return true;
+ }
+ p1 = p2;
+ }
+ return false;
+}
+
bool Path::contains(const FloatPoint& point, WindRule rule) const
{
Qt::FillRule savedRule = m_path.fillRule();
const_cast<QPainterPath*>(&m_path)->setFillRule(rule == RULE_EVENODD ? Qt::OddEvenFill : Qt::WindingFill);
bool contains = m_path.contains(point);
+
+ if (!contains) {
+ // check whether the point is on the border
+ contains = isPointOnPathBorder(m_path.toFillPolygon(), point);
+ }
const_cast<QPainterPath*>(&m_path)->setFillRule(savedRule);
return contains;
diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h b/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h
index 0d98fcb..e355025 100644
--- a/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h
+++ b/src/3rdparty/webkit/WebCore/platform/network/qt/DnsPrefetchHelper.h
@@ -42,6 +42,13 @@ namespace WebCore {
if (currentLookups >= 10)
return; // do not launch more than 10 lookups at the same time
+#if QT_VERSION >= QT_VERSION_CHECK(4, 6, 3)
+ currentLookups++;
+ QHostInfo::lookupHost(hostname, this, SLOT(lookedUp(QHostInfo)));
+#else
+ // This code is only needed for Qt versions that do not have
+ // the small Qt DNS cache yet.
+
QTime* entryTime = lookupCache.object(hostname);
if (entryTime && entryTime->elapsed() > 300*1000) {
// delete knowledge about lookup if it is already 300 seconds old
@@ -54,6 +61,7 @@ namespace WebCore {
currentLookups++;
QHostInfo::lookupHost(hostname, this, SLOT(lookedUp(QHostInfo)));
}
+#endif
}
void lookedUp(const QHostInfo&)
@@ -61,11 +69,14 @@ namespace WebCore {
// we do not cache the result, we throw it away.
// we currently rely on the OS to cache the results. If it does not do that
// then at least the ISP nameserver did it.
+ // Since Qt 4.6.3, Qt also has a small DNS cache.
currentLookups--;
}
protected:
+#if QT_VERSION < QT_VERSION_CHECK(4, 6, 3)
QCache<QString, QTime> lookupCache; // 100 entries
+#endif
int currentLookups;
};
diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp
index 403718f..abeb895 100644
--- a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.cpp
@@ -49,6 +49,7 @@
#define SIGNAL_CONN Qt::QueuedConnection
#endif
+static const int gMaxRecursionLimit = 10;
namespace WebCore {
@@ -139,6 +140,7 @@ QNetworkReplyHandler::QNetworkReplyHandler(ResourceHandle* handle, LoadMode load
, m_shouldFinish(false)
, m_shouldSendResponse(false)
, m_shouldForwardData(false)
+ , m_redirectionTries(gMaxRecursionLimit)
{
const ResourceRequest &r = m_resourceHandle->request();
@@ -336,9 +338,18 @@ void QNetworkReplyHandler::sendResponseIfNeeded()
QUrl redirection = m_reply->attribute(QNetworkRequest::RedirectionTargetAttribute).toUrl();
if (redirection.isValid()) {
+ QUrl newUrl = m_reply->url().resolved(redirection);
+
+ m_redirectionTries--;
+ if (m_redirectionTries == 0) { // 10 or more redirections to the same url is considered infinite recursion
+ ResourceError error(newUrl.host(), 400 /*bad request*/,
+ newUrl.toString(),
+ QCoreApplication::translate("QWebPage", "Redirection limit reached"));
+ client->didFail(m_resourceHandle, error);
+ return;
+ }
m_redirected = true;
- QUrl newUrl = m_reply->url().resolved(redirection);
ResourceRequest newRequest = m_resourceHandle->request();
newRequest.setURL(newUrl);
diff --git a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h
index eb5ae3c..1abad4e 100644
--- a/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h
+++ b/src/3rdparty/webkit/WebCore/platform/network/qt/QNetworkReplyHandler.h
@@ -82,6 +82,7 @@ private:
bool m_shouldFinish;
bool m_shouldSendResponse;
bool m_shouldForwardData;
+ int m_redirectionTries;
};
// Self destructing QIODevice for FormData
diff --git a/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp b/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp
index 04a2b1b..eb2d934 100644
--- a/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/qt/ScrollbarThemeQt.cpp
@@ -114,7 +114,7 @@ static QStyleOptionSlider* styleOptionSlider(Scrollbar* scrollbar, QWidget* widg
opt.state |= QStyle::State_Horizontal;
opt.sliderValue = scrollbar->value();
opt.sliderPosition = opt.sliderValue;
- opt.pageStep = scrollbar->visibleSize();
+ opt.pageStep = scrollbar->pageStep();
opt.singleStep = scrollbar->lineStep();
opt.minimum = 0;
opt.maximum = qMax(0, scrollbar->maximum());
diff --git a/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubs.cpp b/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubsQt.cpp
index 814f961..814f961 100644
--- a/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubs.cpp
+++ b/src/3rdparty/webkit/WebCore/platform/qt/TemporaryLinkStubsQt.cpp
diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp b/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp
index 0c13e43..75a23d9 100644
--- a/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp
+++ b/src/3rdparty/webkit/WebKit/qt/Api/qgraphicswebview.cpp
@@ -82,7 +82,6 @@ public:
, page(0)
, resizesToContents(false)
#if USE(ACCELERATED_COMPOSITING)
- , rootGraphicsLayer(0)
, shouldSync(false)
#endif
{
@@ -158,7 +157,7 @@ public:
enum { RootGraphicsLayerZValue, OverlayZValue };
#if USE(ACCELERATED_COMPOSITING)
- QGraphicsItem* rootGraphicsLayer;
+ QWeakPointer<QGraphicsObject> rootGraphicsLayer;
// we need to sync the layers if we get a special call from the WebCore
// compositor telling us to do so. We'll get that call from ChromeClientQt
bool shouldSync;
@@ -171,12 +170,11 @@ public:
QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate()
{
#if USE(ACCELERATED_COMPOSITING)
- if (rootGraphicsLayer) {
- // we don't need to delete the root graphics layer
- // The lifecycle is managed in GraphicsLayerQt.cpp
- rootGraphicsLayer->setParentItem(0);
- q->scene()->removeItem(rootGraphicsLayer);
- }
+ if (!rootGraphicsLayer)
+ return;
+ // we don't need to delete the root graphics layer. The lifecycle is managed in GraphicsLayerQt.cpp.
+ rootGraphicsLayer.data()->setParentItem(0);
+ q->scene()->removeItem(rootGraphicsLayer.data());
#endif
}
@@ -204,12 +202,12 @@ void QGraphicsWebViewPrivate::createOrDeleteOverlay()
void QGraphicsWebViewPrivate::setRootGraphicsLayer(QGraphicsItem* layer)
{
if (rootGraphicsLayer) {
- rootGraphicsLayer->setParentItem(0);
- q->scene()->removeItem(rootGraphicsLayer);
+ rootGraphicsLayer.data()->setParentItem(0);
+ q->scene()->removeItem(rootGraphicsLayer.data());
QWebFramePrivate::core(q->page()->mainFrame())->view()->syncCompositingStateRecursive();
}
- rootGraphicsLayer = layer;
+ rootGraphicsLayer = layer ? layer->toGraphicsObject() : 0;
if (layer) {
layer->setFlag(QGraphicsItem::ItemClipsChildrenToShape, true);
@@ -231,7 +229,7 @@ void QGraphicsWebViewPrivate::updateCompositingScrollPosition()
{
if (rootGraphicsLayer && q->page() && q->page()->mainFrame()) {
const QPoint scrollPosition = q->page()->mainFrame()->scrollPosition();
- rootGraphicsLayer->setPos(-scrollPosition);
+ rootGraphicsLayer.data()->setPos(-scrollPosition);
}
}
#endif
diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp
index b8b50b7..e9ebce5 100644
--- a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp
+++ b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage.cpp
@@ -119,15 +119,6 @@
using namespace WebCore;
-void QWEBKIT_EXPORT qt_wrt_setViewMode(QWebPage* page, const QString& mode)
-{
- QWebPagePrivate::priv(page)->viewMode = mode;
- WebCore::Frame* frame = QWebFramePrivate::core(page->mainFrame());
- WebCore::FrameView* view = frame->view();
- frame->document()->updateStyleSelector();
- view->forceLayout();
-}
-
void QWEBKIT_EXPORT qt_drt_overwritePluginDirectories()
{
PluginDatabase* db = PluginDatabase::installedPlugins(/* populate */ false);
@@ -1361,6 +1352,26 @@ void QWebPagePrivate::inputMethodEvent(QInputMethodEvent *ev)
ev->accept();
}
+void QWebPagePrivate::dynamicPropertyChangeEvent(QDynamicPropertyChangeEvent* event)
+{
+ if (event->propertyName() == "_q_viewMode") {
+ QString mode = q->property("_q_viewMode").toString();
+ if (mode != viewMode) {
+ viewMode = mode;
+ WebCore::Frame* frame = QWebFramePrivate::core(q->mainFrame());
+ WebCore::FrameView* view = frame->view();
+ frame->document()->updateStyleSelector();
+ view->forceLayout();
+ }
+ } else if (event->propertyName() == "_q_HTMLTokenizerChunkSize") {
+ int chunkSize = q->property("_q_HTMLTokenizerChunkSize").toInt();
+ q->handle()->page->setCustomHTMLTokenizerChunkSize(chunkSize);
+ } else if (event->propertyName() == "_q_HTMLTokenizerTimeDelay") {
+ double timeDelay = q->property("_q_HTMLTokenizerTimeDelay").toDouble();
+ q->handle()->page->setCustomHTMLTokenizerTimeDelay(timeDelay);
+ }
+}
+
void QWebPagePrivate::shortcutOverrideEvent(QKeyEvent* event)
{
WebCore::Frame* frame = page->focusController()->focusedOrMainFrame();
@@ -2708,6 +2719,9 @@ bool QWebPage::event(QEvent *ev)
d->touchEvent(static_cast<QTouchEvent*>(ev));
break;
#endif
+ case QEvent::DynamicPropertyChange:
+ d->dynamicPropertyChangeEvent(static_cast<QDynamicPropertyChangeEvent*>(ev));
+ break;
default:
return QObject::event(ev);
}
diff --git a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h
index 0712d0c..5350cd9 100644
--- a/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h
+++ b/src/3rdparty/webkit/WebKit/qt/Api/qwebpage_p.h
@@ -112,6 +112,8 @@ public:
void inputMethodEvent(QInputMethodEvent*);
+ void dynamicPropertyChangeEvent(QDynamicPropertyChangeEvent*);
+
void shortcutOverrideEvent(QKeyEvent*);
void leaveEvent(QEvent*);
void handleClipboard(QEvent*, Qt::MouseButton);
diff --git a/src/3rdparty/webkit/WebKit/qt/ChangeLog b/src/3rdparty/webkit/WebKit/qt/ChangeLog
index 555b14d..6ddaa2b 100644
--- a/src/3rdparty/webkit/WebKit/qt/ChangeLog
+++ b/src/3rdparty/webkit/WebKit/qt/ChangeLog
@@ -1,3 +1,61 @@
+2010-05-09 Noam Rosenthal <noam.rosenthal@nokia.com>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] Crash in QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate when animation were used
+ https://bugs.webkit.org/show_bug.cgi?id=38574
+
+ The fix uses a QWeakPointer for rootGraphicsLayer, protecting from a crash in case the layer is deleted before the QGraphicsWebView.
+
+ * Api/qgraphicswebview.cpp:
+ (QGraphicsWebViewPrivate::QGraphicsWebViewPrivate):
+ (QGraphicsWebViewPrivate::~QGraphicsWebViewPrivate):
+ (QGraphicsWebViewPrivate::setRootGraphicsLayer):
+ (QGraphicsWebViewPrivate::updateCompositingScrollPosition):
+
+2010-05-03 Laszlo Gombos <laszlo.1.gombos@nokia.com>
+
+ Reviewed by Simon Hausmann.
+
+ [Qt] Expose HTMLTokenizer yielding parameters
+ https://bugs.webkit.org/show_bug.cgi?id=37023
+
+ Enables to set TimeDelay and ChunkSize for
+ HTMLTokenizer.
+
+ * Api/qwebpage.cpp:
+ (QWebPagePrivate::dynamicPropertyChangeEvent):
+
+2010-05-04 Laszlo Gombos <laszlo.1.gombos@nokia.com>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] QWebPage viewMode property
+ https://bugs.webkit.org/show_bug.cgi?id=38119
+
+ Rename the property from wrt_viewMode to _q_viewMode.
+
+ * Api/qwebpage.cpp:
+ (QWebPagePrivate::dynamicPropertyChangeEvent):
+ * tests/qwebpage/tst_qwebpage.cpp:
+ (tst_QWebPage::viewModes):
+
+2010-04-28 Luiz Agostini <luiz.agostini@openbossa.org>
+
+ Reviewed by Kenneth Rohde Christiansen.
+
+ [Qt] QWebPage viewMode property
+ https://bugs.webkit.org/show_bug.cgi?id=38119
+
+ Replacing method qt_wrt_setViewMode by wrt_viewMode property.
+
+ * Api/qwebpage.cpp:
+ (QWebPagePrivate::dynamicPropertyChangeEvent):
+ (QWebPage::event):
+ * Api/qwebpage_p.h:
+ * tests/qwebpage/tst_qwebpage.cpp:
+ (tst_QWebPage::wrt_viewModes):
+
2010-04-09 Tasuku Suzuki <tasuku.suzuki@nokia.com>
Reviewed by Simon Hausmann.
diff --git a/src/3rdparty/webkit/WebKit/qt/docs/qtwebkit.qdoc b/src/3rdparty/webkit/WebKit/qt/docs/qtwebkit.qdoc
index 9e653e4..96eb16e 100644
--- a/src/3rdparty/webkit/WebKit/qt/docs/qtwebkit.qdoc
+++ b/src/3rdparty/webkit/WebKit/qt/docs/qtwebkit.qdoc
@@ -5,7 +5,9 @@
\previouspage QtSvg
\nextpage QtXml
\ingroup modules
- \brief The QtWebKit module provides a web browser engine as well as
+ \ingroup technology-apis
+
+ \brief The QtWebKit module provides a web browser engine and
classes to render and interact with web content.
To include the definitions of the module's classes, use the
diff --git a/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def b/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def
index a450f9e..910ba8f 100644
--- a/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def
+++ b/src/3rdparty/webkit/WebKit/qt/symbian/bwins/QtWebKitu.def
@@ -642,7 +642,7 @@ EXPORTS
?qt_drt_webinspector_executeScript@@YAXPAVQWebPage@@JABVQString@@@Z @ 641 NONAME ; void qt_drt_webinspector_executeScript(class QWebPage *, long, class QString const &)
?qt_drt_webinspector_show@@YAXPAVQWebPage@@@Z @ 642 NONAME ; void qt_drt_webinspector_show(class QWebPage *)
?qt_drt_workerThreadCount@@YAHXZ @ 643 NONAME ; int qt_drt_workerThreadCount(void)
- ?qt_wrt_setViewMode@@YAXPAVQWebPage@@ABVQString@@@Z @ 644 NONAME ; void qt_wrt_setViewMode(class QWebPage *, class QString const &)
+ ?qt_wrt_setViewMode@@YAXPAVQWebPage@@ABVQString@@@Z @ 644 NONAME ABSENT ; void qt_wrt_setViewMode(class QWebPage *, class QString const &)
?qtwebkit_webframe_scrollRecursively@@YAXPAVQWebFrame@@HHABVQPoint@@@Z @ 645 NONAME ; void qtwebkit_webframe_scrollRecursively(class QWebFrame *, int, int, class QPoint const &)
?resizesToContents@QGraphicsWebView@@QBE_NXZ @ 646 NONAME ; bool QGraphicsWebView::resizesToContents(void) const
?scrollToAnchor@QWebFrame@@QAEXABVQString@@@Z @ 647 NONAME ; void QWebFrame::scrollToAnchor(class QString const &)
diff --git a/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def b/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def
index 145fe0b..ca462d0 100644
--- a/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def
+++ b/src/3rdparty/webkit/WebKit/qt/symbian/eabi/QtWebKitu.def
@@ -716,7 +716,7 @@ EXPORTS
_ZN13QWebInspector10closeEventEP11QCloseEvent @ 715 NONAME
_ZN16QGraphicsWebView26setTiledBackingStoreFrozenEb @ 716 NONAME
_ZNK16QGraphicsWebView25isTiledBackingStoreFrozenEv @ 717 NONAME
- _Z18qt_wrt_setViewModeP8QWebPageRK7QString @ 718 NONAME
+ _Z18qt_wrt_setViewModeP8QWebPageRK7QString @ 718 NONAME ABSENT
_Z19qt_drt_setMediaTypeP9QWebFrameRK7QString @ 719 NONAME
_Z26qt_drt_enableCaretBrowsingP8QWebPageb @ 720 NONAME
_ZNK12QWebSettings12inspectorUrlEv @ 721 NONAME
diff --git a/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp b/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp
index f7eddd5..834a394 100644
--- a/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp
+++ b/src/3rdparty/webkit/WebKit/qt/tests/qwebpage/tst_qwebpage.cpp
@@ -110,6 +110,8 @@ private slots:
void userAgentApplicationName();
void userAgentLocaleChange();
+ void viewModes();
+
void crashTests_LazyInitializationOfMainFrame();
void screenshot_data();
@@ -357,6 +359,21 @@ void tst_QWebPage::userStyleSheet()
QCOMPARE(networkManager->requestedUrls.at(0), QUrl("http://does.not/exist.png"));
}
+void tst_QWebPage::viewModes()
+{
+ m_view->setHtml("<body></body>");
+ m_page->setProperty("_q_viewMode", "minimized");
+
+ QVariant empty = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode)\")");
+ QVERIFY(empty.type() == QVariant::Bool && empty.toBool());
+
+ QVariant minimized = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode: minimized)\")");
+ QVERIFY(minimized.type() == QVariant::Bool && minimized.toBool());
+
+ QVariant maximized = m_page->mainFrame()->evaluateJavaScript("window.styleMedia.matchMedium(\"(-webkit-view-mode: maximized)\")");
+ QVERIFY(maximized.type() == QVariant::Bool && !maximized.toBool());
+}
+
void tst_QWebPage::modified()
{
m_page->mainFrame()->setUrl(QUrl("data:text/html,<body>blub"));
diff --git a/src/corelib/io/qurl.cpp b/src/corelib/io/qurl.cpp
index 4e580dd..d4b8b5f 100644
--- a/src/corelib/io/qurl.cpp
+++ b/src/corelib/io/qurl.cpp
@@ -5557,6 +5557,12 @@ QUrl QUrl::resolved(const QUrl &relative) const
removeDotsFromPath(&t.d->encodedPath);
t.d->path.clear();
+#if defined(QURL_DEBUG)
+ qDebug("QUrl(\"%s\").resolved(\"%s\") = \"%s\"",
+ toEncoded().constData(),
+ relative.toEncoded().constData(),
+ t.toEncoded().constData());
+#endif
return t;
}
diff --git a/src/corelib/kernel/qabstractitemmodel.cpp b/src/corelib/kernel/qabstractitemmodel.cpp
index b0503be..3660a3c 100644
--- a/src/corelib/kernel/qabstractitemmodel.cpp
+++ b/src/corelib/kernel/qabstractitemmodel.cpp
@@ -2530,6 +2530,62 @@ bool QAbstractItemModelPrivate::allowMove(const QModelIndex &srcParent, int star
condition is true, in which case you should abort your move
operation.
+ \table 80%
+ \row
+ \o \inlineimage modelview-move-rows-1.png Moving rows to another parent
+ \o Specify the first and last row numbers for the span of rows in
+ the source parent you want to move in the model. Also specify
+ the row in the destination parent to move the span to.
+
+ For example, as shown in the diagram, we move three rows from
+ row 2 to 4 in the source, so \a sourceFirst is 2 and \a sourceLast is 4.
+ We move those items to above row 2 in the destination, so \a destinationRow is 2.
+
+ \snippet doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp 6
+
+ This moves the three rows rows 2, 3, and 4 in the source to become 2, 3 and 4 in
+ the destination. Other affected siblings are displaced accordingly.
+ \row
+ \o \inlineimage modelview-move-rows-2.png Moving rows to append to another parent
+ \o To append rows to another parent, move them to after the last row.
+
+ For example, as shown in the diagram, we move three rows to a
+ collection of 6 existing rows (ending in row 5), so \a destinationStart is 6:
+
+ \snippet doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp 7
+
+ This moves the target rows to the end of the target parent as 6, 7 and 8.
+ \row
+ \o \inlineimage modelview-move-rows-3.png Moving rows in the same parent up
+ \o To move rows within the same parent, specify the row to move them to.
+
+ For example, as shown in the diagram, we move one item from row 2 to row 0,
+ so \a sourceFirst and \a sourceLast are 2 and \a destinationChild is 0.
+
+ \snippet doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp 8
+
+ Note that other rows may be displaced accordingly. Note also that when moving
+ items within the same parent you should not attempt invalid or no-op moves. In
+ the above example, item 2 is at row 2 before the move, so it can not be moved
+ to row 2 (where it is already) or row 3 (no-op as row 3 means above row 3, where
+ it is already)
+
+ \row
+ \o \inlineimage modelview-move-rows-4.png Moving rows in the same parent down
+ \o To move rows within the same parent, specify the row to move them to.
+
+ For example, as shown in the diagram, we move one item from row 2 to row 4,
+ so \a sourceFirst and \a sourceLast are 2 and \a destinationChild is 4.
+
+ \snippet doc/src/snippets/code/src_corelib_kernel_qabstractitemmodel.cpp 9
+
+ Note that other rows may be displaced accordingly.
+ \endtable
+
+ \note This function emits the rowsAboutToBeInserted() signal which
+ connected views (or proxies) must handle before the data is inserted.
+ Otherwise, the views may end up in an invalid state.
+
\sa endMoveRows()
\since 4.6
diff --git a/src/corelib/kernel/qcoreapplication.cpp b/src/corelib/kernel/qcoreapplication.cpp
index 609e6b3..4e6e6b9 100644
--- a/src/corelib/kernel/qcoreapplication.cpp
+++ b/src/corelib/kernel/qcoreapplication.cpp
@@ -63,6 +63,7 @@
#include <qvarlengtharray.h>
#include <private/qfactoryloader_p.h>
#include <private/qfunctions_p.h>
+#include <private/qlocale_p.h>
#ifdef Q_OS_SYMBIAN
# include <exception>
@@ -521,6 +522,9 @@ QCoreApplication::QCoreApplication(int &argc, char **argv)
QFactoryLoader::refreshAll();
#endif
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+ d_func()->symbianInit();
+#endif
}
// ### move to QCoreApplicationPrivate constructor?
@@ -597,6 +601,15 @@ void QCoreApplication::init()
qt_startup_hook();
}
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+void QCoreApplicationPrivate::symbianInit()
+{
+ if (!environmentChangeNotifier)
+ environmentChangeNotifier.reset(new QEnvironmentChangeNotifier);
+}
+#endif
+
+
/*!
Destroys the QCoreApplication object.
*/
diff --git a/src/corelib/kernel/qcoreapplication_p.h b/src/corelib/kernel/qcoreapplication_p.h
index 77188d3..e066137 100644
--- a/src/corelib/kernel/qcoreapplication_p.h
+++ b/src/corelib/kernel/qcoreapplication_p.h
@@ -65,6 +65,9 @@ QT_BEGIN_NAMESPACE
typedef QList<QTranslator*> QTranslatorList;
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+class QEnvironmentChangeNotifier;
+#endif
class QAbstractEventDispatcher;
class Q_CORE_EXPORT QCoreApplicationPrivate : public QObjectPrivate
@@ -113,6 +116,10 @@ public:
bool aboutToQuitEmitted;
QString cachedApplicationDirPath;
QString cachedApplicationFilePath;
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+ QScopedPointer<QEnvironmentChangeNotifier> environmentChangeNotifier;
+ void symbianInit();
+#endif
static bool isTranslatorInstalled(QTranslator *translator);
diff --git a/src/corelib/kernel/qeventdispatcher_symbian.cpp b/src/corelib/kernel/qeventdispatcher_symbian.cpp
index a6d486e..687a6d9 100644
--- a/src/corelib/kernel/qeventdispatcher_symbian.cpp
+++ b/src/corelib/kernel/qeventdispatcher_symbian.cpp
@@ -1105,3 +1105,5 @@ void CQtActiveScheduler::Error(TInt aError) const
}
QT_END_NAMESPACE
+
+#include "moc_qeventdispatcher_symbian_p.cpp"
diff --git a/src/corelib/kernel/qeventdispatcher_symbian_p.h b/src/corelib/kernel/qeventdispatcher_symbian_p.h
index 05758ca..bc42753 100644
--- a/src/corelib/kernel/qeventdispatcher_symbian_p.h
+++ b/src/corelib/kernel/qeventdispatcher_symbian_p.h
@@ -221,6 +221,7 @@ public: // from CActiveScheduler
class Q_CORE_EXPORT QEventDispatcherSymbian : public QAbstractEventDispatcher
{
+ Q_OBJECT
Q_DECLARE_PRIVATE(QAbstractEventDispatcher)
public:
diff --git a/src/corelib/tools/qchar.cpp b/src/corelib/tools/qchar.cpp
index 67ea00d..2f09b0e 100644
--- a/src/corelib/tools/qchar.cpp
+++ b/src/corelib/tools/qchar.cpp
@@ -653,14 +653,41 @@ bool QChar::isSymbol() const
\fn bool QChar::isHighSurrogate() const
Returns true if the QChar is the high part of a utf16 surrogate
- (ie. if its code point is between 0xd800 and 0xdbff).
+ (ie. if its code point is between 0xd800 and 0xdbff, inclusive).
*/
/*!
\fn bool QChar::isLowSurrogate() const
Returns true if the QChar is the low part of a utf16 surrogate
- (ie. if its code point is between 0xdc00 and 0xdfff).
+ (ie. if its code point is between 0xdc00 and 0xdfff, inclusive).
+*/
+
+/*!
+ \fn static bool QChar::isHighSurrogate(uint ucs4)
+ \since 4.7
+
+ Returns true if the UCS-4-encoded character specified by \a ucs4
+ is the high part of a utf16 surrogate
+ (ie. if its code point is between 0xd800 and 0xdbff, inclusive).
+*/
+
+/*!
+ \fn static bool QChar::isLowSurrogate(uint ucs4)
+ \since 4.7
+
+ Returns true if the UCS-4-encoded character specified by \a ucs4
+ is the high part of a utf16 surrogate
+ (ie. if its code point is between 0xdc00 and 0xdfff, inclusive).
+*/
+
+/*!
+ \fn static bool QChar::requiresSurrogates(uint ucs4)
+ \since 4.7
+
+ Returns true if the UCS-4-encoded character specified by \a ucs4
+ can be splited to the high and low parts of a utf16 surrogate
+ (ie. if its code point is greater than or equals to 0x10000).
*/
/*!
diff --git a/src/corelib/tools/qchar.h b/src/corelib/tools/qchar.h
index 1432c7f..205f911 100644
--- a/src/corelib/tools/qchar.h
+++ b/src/corelib/tools/qchar.h
@@ -285,6 +285,15 @@ public:
inline void setCell(uchar cell);
inline void setRow(uchar row);
+ static inline bool isHighSurrogate(uint ucs4) {
+ return ((ucs4 & 0xfffffc00) == 0xd800);
+ }
+ static inline bool isLowSurrogate(uint ucs4) {
+ return ((ucs4 & 0xfffffc00) == 0xdc00);
+ }
+ static inline bool requiresSurrogates(uint ucs4) {
+ return (ucs4 >= 0x10000);
+ }
static inline uint surrogateToUcs4(ushort high, ushort low) {
return (uint(high)<<10) + low - 0x35fdc00;
}
diff --git a/src/corelib/tools/qdatetime.cpp b/src/corelib/tools/qdatetime.cpp
index 9afcd80..9f5d8c6 100644
--- a/src/corelib/tools/qdatetime.cpp
+++ b/src/corelib/tools/qdatetime.cpp
@@ -1705,7 +1705,7 @@ int QTime::secsTo(const QTime &t) const
Note that the time will wrap if it passes midnight. See addSecs()
for an example.
- \sa addSecs(), msecsTo()
+ \sa addSecs(), msecsTo(), QDateTime::addMSecs()
*/
QTime QTime::addMSecs(int ms) const
@@ -1734,7 +1734,7 @@ QTime QTime::addMSecs(int ms) const
seconds in a day, the result is always between -86400000 and
86400000 ms.
- \sa secsTo(), addMSecs()
+ \sa secsTo(), addMSecs(), QDateTime::msecsTo()
*/
int QTime::msecsTo(const QTime &t) const
@@ -2042,10 +2042,11 @@ int QTime::elapsed() const
later.
You can increment (or decrement) a datetime by a given number of
- seconds using addSecs(), or days using addDays(). Similarly you can
- use addMonths() and addYears(). The daysTo() function returns the
- number of days between two datetimes, and secsTo() returns the
- number of seconds between two datetimes.
+ milliseconds using addMSecs(), seconds using addSecs(), or days
+ using addDays(). Similarly you can use addMonths() and addYears().
+ The daysTo() function returns the number of days between two datetimes,
+ secsTo() returns the number of seconds between two datetimes, and
+ msecsTo() returns the number of milliseconds between two datetimes.
QDateTime can store datetimes as \l{Qt::LocalTime}{local time} or
as \l{Qt::UTC}{UTC}. QDateTime::currentDateTime() returns a
@@ -2719,7 +2720,7 @@ QDateTime QDateTime::addSecs(int s) const
later than the datetime of this object (or earlier if \a msecs is
negative).
- \sa addSecs(), secsTo(), addDays(), addMonths(), addYears()
+ \sa addSecs(), msecsTo(), addDays(), addMonths(), addYears()
*/
QDateTime QDateTime::addMSecs(qint64 msecs) const
{
@@ -2731,7 +2732,7 @@ QDateTime QDateTime::addMSecs(qint64 msecs) const
datetime. If the \a other datetime is earlier than this datetime,
the value returned is negative.
- \sa addDays(), secsTo()
+ \sa addDays(), secsTo(), msecsTo()
*/
int QDateTime::daysTo(const QDateTime &other) const
@@ -2766,6 +2767,33 @@ int QDateTime::secsTo(const QDateTime &other) const
}
/*!
+ Returns the number of milliseconds from this datetime to the \a other
+ datetime. If the \a other datetime is earlier than this datetime,
+ the value returned is negative.
+
+ Before performing the comparison, the two datetimes are converted
+ to Qt::UTC to ensure that the result is correct if one of the two
+ datetimes has daylight saving time (DST) and the other doesn't.
+
+ \sa addMSecs(), daysTo(), QTime::msecsTo()
+*/
+
+qint64 QDateTime::msecsTo(const QDateTime &other) const
+{
+ QDate selfDate;
+ QDate otherDate;
+ QTime selfTime;
+ QTime otherTime;
+
+ d->getUTC(selfDate, selfTime);
+ other.d->getUTC(otherDate, otherTime);
+
+ return (static_cast<qint64>(selfDate.daysTo(otherDate)) * static_cast<qint64>(MSECS_PER_DAY))
+ + static_cast<qint64>(selfTime.msecsTo(otherTime));
+}
+
+
+/*!
\fn QDateTime QDateTime::toTimeSpec(Qt::TimeSpec specification) const
Returns a copy of this datetime configured to use the given time
diff --git a/src/corelib/tools/qdatetime.h b/src/corelib/tools/qdatetime.h
index f445f1c..2466aeb 100644
--- a/src/corelib/tools/qdatetime.h
+++ b/src/corelib/tools/qdatetime.h
@@ -251,6 +251,7 @@ public:
inline QDateTime toUTC() const { return toTimeSpec(Qt::UTC); }
int daysTo(const QDateTime &) const;
int secsTo(const QDateTime &) const;
+ qint64 msecsTo(const QDateTime &) const;
bool operator==(const QDateTime &other) const;
inline bool operator!=(const QDateTime &other) const { return !(*this == other); }
diff --git a/src/corelib/tools/qlocale.cpp b/src/corelib/tools/qlocale.cpp
index c3f6783..20c2e27 100644
--- a/src/corelib/tools/qlocale.cpp
+++ b/src/corelib/tools/qlocale.cpp
@@ -129,6 +129,11 @@ inline bool isascii(int c)
}
#endif
+#if defined(Q_OS_SYMBIAN)
+void qt_symbianUpdateSystemPrivate();
+void qt_symbianInitSystemLocale();
+#endif
+
/******************************************************************************
** Helpers for accessing Qt locale database
*/
@@ -1407,6 +1412,9 @@ static const QSystemLocale *systemLocale()
{
if (_systemLocale)
return _systemLocale;
+#if defined(Q_OS_SYMBIAN)
+ qt_symbianInitSystemLocale();
+#endif
return QSystemLocale_globalSystemLocale();
}
@@ -1417,6 +1425,10 @@ void QLocalePrivate::updateSystemPrivate()
system_lp = globalLocalePrivate();
*system_lp = *sys_locale->fallbackLocale().d();
+#if defined(Q_OS_SYMBIAN)
+ qt_symbianUpdateSystemPrivate();
+#endif
+
QVariant res = sys_locale->query(QSystemLocale::LanguageId, QVariant());
if (!res.isNull())
system_lp->m_language_id = res.toInt();
diff --git a/src/corelib/tools/qlocale_p.h b/src/corelib/tools/qlocale_p.h
index ecf79e9..6205745 100644
--- a/src/corelib/tools/qlocale_p.h
+++ b/src/corelib/tools/qlocale_p.h
@@ -58,6 +58,10 @@
#include "qlocale.h"
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+class CEnvironmentChangeNotifier;
+#endif
+
QT_BEGIN_NAMESPACE
struct Q_CORE_EXPORT QLocalePrivate
@@ -201,6 +205,20 @@ inline char QLocalePrivate::digitToCLocale(const QChar &in) const
return 0;
}
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+class QEnvironmentChangeNotifier
+{
+public:
+ QEnvironmentChangeNotifier();
+ ~QEnvironmentChangeNotifier();
+
+ static TInt localeChanged(TAny *data);
+
+private:
+ CEnvironmentChangeNotifier *iChangeNotifier;
+};
+#endif
+
QT_END_NAMESPACE
#endif // QLOCALE_P_H
diff --git a/src/corelib/tools/qlocale_symbian.cpp b/src/corelib/tools/qlocale_symbian.cpp
index 01f56cc..6e36dcd 100644
--- a/src/corelib/tools/qlocale_symbian.cpp
+++ b/src/corelib/tools/qlocale_symbian.cpp
@@ -46,8 +46,14 @@
#include <QThread>
#include <e32std.h>
+#include <e32const.h>
+#include <e32base.h>
+#include <e32property.h>
+#include <bacntf.h>
#include "private/qcore_symbian_p.h"
-
+#include "private/qcoreapplication_p.h"
+#include "private/qlocale_p.h"
+#include <qdebug.h>
QT_BEGIN_NAMESPACE
@@ -771,13 +777,18 @@ static QLocale::MeasurementSystem symbianMeasurementSystem()
return QLocale::MetricSystem;
}
-QLocale QSystemLocale::fallbackLocale() const
+void qt_symbianUpdateSystemPrivate()
{
// load system data before query calls
+ _s60Locale.LoadSystemSettings();
+}
+
+void qt_symbianInitSystemLocale()
+{
static QBasicAtomicInt initDone = Q_BASIC_ATOMIC_INITIALIZER(0);
+ if (initDone == 2)
+ return;
if (initDone.testAndSetRelaxed(0, 1)) {
- _s60Locale.LoadSystemSettings();
-
// Initialize platform version dependent function pointers
ptrTimeFormatL = reinterpret_cast<FormatFunc>
(qt_resolveS60PluginFunc(S60Plugin_TimeFormatL));
@@ -801,7 +812,10 @@ QLocale QSystemLocale::fallbackLocale() const
}
while(initDone != 2)
QThread::yieldCurrentThread();
+}
+QLocale QSystemLocale::fallbackLocale() const
+{
TLanguage lang = User::Language();
QString locale = QLatin1String(qt_symbianLocaleName(lang));
return QLocale(locale);
@@ -884,4 +898,35 @@ QVariant QSystemLocale::query(QueryType type, QVariant in = QVariant()) const
return QVariant();
}
+#if !defined(QT_NO_SYSTEMLOCALE)
+QEnvironmentChangeNotifier::QEnvironmentChangeNotifier()
+{
+ // Create the change notifier and install the callback function
+ const TCallBack callback(&QEnvironmentChangeNotifier::localeChanged, this);
+ QT_TRAP_THROWING(iChangeNotifier = CEnvironmentChangeNotifier::NewL(CActive::EPriorityStandard, callback));
+ iChangeNotifier->Start();
+}
+
+TInt QEnvironmentChangeNotifier::localeChanged(TAny *data)
+{
+ QEnvironmentChangeNotifier *that = reinterpret_cast<QEnvironmentChangeNotifier *>(data);
+
+ TInt flag = that->iChangeNotifier->Change();
+ if (flag & EChangesLocale) {
+ static bool first = true;
+ if (!first) { // skip the first notification on app startup
+ QT_TRYCATCH_LEAVING(QLocalePrivate::updateSystemPrivate());
+ QT_TRYCATCH_LEAVING(QCoreApplication::postEvent(qApp, new QEvent(QEvent::LocaleChange)));
+ }
+ first = false;
+ }
+ return KErrNone;
+}
+
+QEnvironmentChangeNotifier::~QEnvironmentChangeNotifier()
+{
+ delete iChangeNotifier;
+}
+#endif
+
QT_END_NAMESPACE
diff --git a/src/corelib/tools/qmap.h b/src/corelib/tools/qmap.h
index df0ae46..5696ba6 100644
--- a/src/corelib/tools/qmap.h
+++ b/src/corelib/tools/qmap.h
@@ -125,6 +125,10 @@ template <class Key, class T>
struct QMapNode {
Key key;
T value;
+
+private:
+ // never access these members through this structure.
+ // see below
QMapData::Node *backward;
QMapData::Node *forward[1];
};
@@ -134,6 +138,22 @@ struct QMapPayloadNode
{
Key key;
T value;
+
+private:
+ // QMap::e is a pointer to QMapData::Node, which matches the member
+ // below. However, the memory allocation node in QMapData::node_create
+ // allocates sizeof(QMapPayloNode) and incorrectly calculates the offset
+ // of 'backward' below. If the alignment of QMapPayloadNode is larger
+ // than the alignment of a pointer, the 'backward' member is aligned to
+ // the end of this structure, not to 'value' above, and will occupy the
+ // tail-padding area.
+ //
+ // e.g., on a 32-bit archictecture with Key = int and
+ // sizeof(T) = alignof(T) = 8
+ // 0 4 8 12 16 20 24 byte
+ // | key | PAD | value |backward| PAD | correct layout
+ // | key | PAD | value | |backward| how it's actually used
+ // |<----- value of QMap::payload() = 20 ----->|
QMapData::Node *backward;
};
diff --git a/src/dbus/qdbusinternalfilters.cpp b/src/dbus/qdbusinternalfilters.cpp
index 8fc219a..78abf94 100644
--- a/src/dbus/qdbusinternalfilters.cpp
+++ b/src/dbus/qdbusinternalfilters.cpp
@@ -87,7 +87,7 @@ static const char propertiesInterfaceXml[] =
" <method name=\"GetAll\">\n"
" <arg name=\"interface_name\" type=\"s\" direction=\"in\"/>\n"
" <arg name=\"values\" type=\"a{sv}\" direction=\"out\"/>\n"
- " <annotation name=\"com.trolltech.QtDBus.QtTypeName.Out0\" value=\"QVariantMap\"/>"
+ " <annotation name=\"com.trolltech.QtDBus.QtTypeName.Out0\" value=\"QVariantMap\"/>\n"
" </method>\n"
" </interface>\n";
diff --git a/src/dbus/qdbusxmlgenerator.cpp b/src/dbus/qdbusxmlgenerator.cpp
index 9c25d82..463ac73 100644
--- a/src/dbus/qdbusxmlgenerator.cpp
+++ b/src/dbus/qdbusxmlgenerator.cpp
@@ -160,7 +160,7 @@ static QString generateInterfaceXml(const QMetaObject *mo, int flags, int method
// do we need to describe this argument?
if (QDBusMetaType::signatureToType(typeName) == QVariant::Invalid)
xml += QString::fromLatin1(" <annotation name=\"com.trolltech.QtDBus.QtTypeName.Out0\" value=\"%1\"/>\n")
- .arg(typeNameToXml(mm.typeName()));
+ .arg(typeNameToXml(QVariant::typeToName(QVariant::Type(typeId))));
} else
continue;
}
diff --git a/src/declarative/graphicsitems/qdeclarativegridview_p.h b/src/declarative/graphicsitems/qdeclarativegridview_p.h
index c06879e..f5d061d 100644
--- a/src/declarative/graphicsitems/qdeclarativegridview_p.h
+++ b/src/declarative/graphicsitems/qdeclarativegridview_p.h
@@ -142,7 +142,7 @@ public:
void setSnapMode(SnapMode mode);
enum PositionMode { Beginning, Center, End, Visible, Contain };
- Q_ENUMS(PositionMode);
+ Q_ENUMS(PositionMode)
Q_INVOKABLE void positionViewAtIndex(int index, int mode);
Q_INVOKABLE int indexAt(int x, int y) const;
diff --git a/src/declarative/graphicsitems/qdeclarativelistview_p.h b/src/declarative/graphicsitems/qdeclarativelistview_p.h
index 9c0b7dd..051455c 100644
--- a/src/declarative/graphicsitems/qdeclarativelistview_p.h
+++ b/src/declarative/graphicsitems/qdeclarativelistview_p.h
@@ -200,7 +200,7 @@ public:
static QDeclarativeListViewAttached *qmlAttachedProperties(QObject *);
enum PositionMode { Beginning, Center, End, Visible, Contain };
- Q_ENUMS(PositionMode);
+ Q_ENUMS(PositionMode)
Q_INVOKABLE void positionViewAtIndex(int index, int mode);
Q_INVOKABLE int indexAt(int x, int y) const;
diff --git a/src/declarative/qml/qdeclarativebinding_p.h b/src/declarative/qml/qdeclarativebinding_p.h
index 2d3acf5..598f09f 100644
--- a/src/declarative/qml/qdeclarativebinding_p.h
+++ b/src/declarative/qml/qdeclarativebinding_p.h
@@ -164,6 +164,6 @@ private:
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(QDeclarativeBinding*);
+Q_DECLARE_METATYPE(QDeclarativeBinding*)
#endif // QDECLARATIVEBINDING_P_H
diff --git a/src/declarative/qml/qdeclarativecompiledbindings_p.h b/src/declarative/qml/qdeclarativecompiledbindings_p.h
index 29a1092..a9772cc 100644
--- a/src/declarative/qml/qdeclarativecompiledbindings_p.h
+++ b/src/declarative/qml/qdeclarativecompiledbindings_p.h
@@ -104,8 +104,8 @@ protected:
int qt_metacall(QMetaObject::Call, int, void **);
private:
- Q_DISABLE_COPY(QDeclarativeCompiledBindings);
- Q_DECLARE_PRIVATE(QDeclarativeCompiledBindings);
+ Q_DISABLE_COPY(QDeclarativeCompiledBindings)
+ Q_DECLARE_PRIVATE(QDeclarativeCompiledBindings)
};
QT_END_NAMESPACE
diff --git a/src/declarative/qml/qdeclarativecomponent_p.h b/src/declarative/qml/qdeclarativecomponent_p.h
index 19aac84..2a7d633 100644
--- a/src/declarative/qml/qdeclarativecomponent_p.h
+++ b/src/declarative/qml/qdeclarativecomponent_p.h
@@ -150,7 +150,7 @@ Q_SIGNALS:
void destruction();
private:
- friend class QDeclarativeContextData;;
+ friend class QDeclarativeContextData;
friend class QDeclarativeComponentPrivate;
};
diff --git a/src/declarative/qml/qdeclarativecompositetypemanager.cpp b/src/declarative/qml/qdeclarativecompositetypemanager.cpp
index 0ea198d..b43b4d0 100644
--- a/src/declarative/qml/qdeclarativecompositetypemanager.cpp
+++ b/src/declarative/qml/qdeclarativecompositetypemanager.cpp
@@ -338,7 +338,7 @@ void QDeclarativeCompositeTypeManager::resourceReplyFinished()
// WARNING, there is a copy of this function in qdeclarativeengine.cpp
static QString toLocalFileOrQrc(const QUrl& url)
{
- if (url.scheme() == QLatin1String("qrc")) {
+ if (url.scheme().compare(QLatin1String("qrc"), Qt::CaseInsensitive) == 0) {
if (url.authority().isEmpty())
return QLatin1Char(':') + url.path();
return QString();
@@ -360,7 +360,10 @@ void QDeclarativeCompositeTypeManager::loadResource(QDeclarativeCompositeTypeRes
} else {
resource->status = QDeclarativeCompositeTypeResource::Error;
}
+ } else if (url.scheme().isEmpty()) {
+ // We can't open this, so just declare as an error
+ resource->status = QDeclarativeCompositeTypeResource::Error;
} else {
QNetworkReply *reply =
@@ -382,27 +385,29 @@ void QDeclarativeCompositeTypeManager::loadSource(QDeclarativeCompositeTypeData
if (file.open(QFile::ReadOnly)) {
QByteArray data = file.readAll();
setData(unit, data, url);
- } else {
- QString errorDescription;
- // ### - Fill in error
- errorDescription = QLatin1String("File error for URL ") + url.toString();
- unit->status = QDeclarativeCompositeTypeData::Error;
- // ### FIXME
- QDeclarativeError error;
- error.setDescription(errorDescription);
- unit->errorType = QDeclarativeCompositeTypeData::AccessError;
- unit->errors << error;
- doComplete(unit);
+ return; // success
}
-
- } else {
+ } else if (!url.scheme().isEmpty()) {
QNetworkReply *reply =
engine->networkAccessManager()->get(QNetworkRequest(url));
QObject::connect(reply, SIGNAL(finished()),
this, SLOT(replyFinished()));
QObject::connect(reply, SIGNAL(downloadProgress(qint64,qint64)),
this, SLOT(requestProgress(qint64,qint64)));
+ return; // waiting
}
+
+ // error happened
+ QString errorDescription;
+ // ### - Fill in error
+ errorDescription = QLatin1String("File error for URL ") + url.toString();
+ unit->status = QDeclarativeCompositeTypeData::Error;
+ // ### FIXME
+ QDeclarativeError error;
+ error.setDescription(errorDescription);
+ unit->errorType = QDeclarativeCompositeTypeData::AccessError;
+ unit->errors << error;
+ doComplete(unit);
}
void QDeclarativeCompositeTypeManager::requestProgress(qint64 received, qint64 total)
@@ -716,8 +721,10 @@ void QDeclarativeCompositeTypeManager::compile(QDeclarativeCompositeTypeData *un
}
}
- QUrl importUrl = unit->imports.baseUrl().resolved(QUrl(QLatin1String("qmldir")));
- if (toLocalFileOrQrc(importUrl).isEmpty())
+ QUrl importUrl;
+ if (!unit->imports.baseUrl().scheme().isEmpty())
+ importUrl = unit->imports.baseUrl().resolved(QUrl(QLatin1String("qmldir")));
+ if (!importUrl.scheme().isEmpty() && toLocalFileOrQrc(importUrl).isEmpty())
resourceList.prepend(importUrl);
for (int ii = 0; ii < resourceList.count(); ++ii) {
diff --git a/src/declarative/qml/qdeclarativecontext.h b/src/declarative/qml/qdeclarativecontext.h
index 548869c..d87123a 100644
--- a/src/declarative/qml/qdeclarativecontext.h
+++ b/src/declarative/qml/qdeclarativecontext.h
@@ -107,7 +107,7 @@ private:
};
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(QList<QObject*>);
+Q_DECLARE_METATYPE(QList<QObject*>)
QT_END_HEADER
diff --git a/src/declarative/qml/qdeclarativeguard_p.h b/src/declarative/qml/qdeclarativeguard_p.h
index be60ce4..02fed0b 100644
--- a/src/declarative/qml/qdeclarativeguard_p.h
+++ b/src/declarative/qml/qdeclarativeguard_p.h
@@ -97,7 +97,7 @@ private:
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(QDeclarativeGuard<QObject>);
+Q_DECLARE_METATYPE(QDeclarativeGuard<QObject>)
#include "private/qdeclarativedata_p.h"
diff --git a/src/declarative/qml/qdeclarativeimport.cpp b/src/declarative/qml/qdeclarativeimport.cpp
index 65d42a1..576e048 100644
--- a/src/declarative/qml/qdeclarativeimport.cpp
+++ b/src/declarative/qml/qdeclarativeimport.cpp
@@ -57,7 +57,7 @@ DEFINE_BOOL_CONFIG_OPTION(qmlCheckTypes, QML_CHECK_TYPES)
static QString toLocalFileOrQrc(const QUrl& url)
{
- if (url.scheme() == QLatin1String("qrc")) {
+ if (url.scheme().compare(QLatin1String("qrc"), Qt::CaseInsensitive) == 0) {
if (url.authority().isEmpty())
return QLatin1Char(':') + url.path();
return QString();
diff --git a/src/declarative/qml/qdeclarativepropertycache.cpp b/src/declarative/qml/qdeclarativepropertycache.cpp
index f04a706..839d79f 100644
--- a/src/declarative/qml/qdeclarativepropertycache.cpp
+++ b/src/declarative/qml/qdeclarativepropertycache.cpp
@@ -45,7 +45,7 @@
#include "private/qdeclarativebinding_p.h"
#include <QtCore/qdebug.h>
-Q_DECLARE_METATYPE(QScriptValue);
+Q_DECLARE_METATYPE(QScriptValue)
QT_BEGIN_NAMESPACE
diff --git a/src/declarative/qml/qdeclarativescriptstring.h b/src/declarative/qml/qdeclarativescriptstring.h
index 43bef44..fc92a9b 100644
--- a/src/declarative/qml/qdeclarativescriptstring.h
+++ b/src/declarative/qml/qdeclarativescriptstring.h
@@ -79,7 +79,7 @@ private:
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(QDeclarativeScriptString);
+Q_DECLARE_METATYPE(QDeclarativeScriptString)
QT_END_HEADER
diff --git a/src/declarative/qml/qdeclarativestringconverters_p.h b/src/declarative/qml/qdeclarativestringconverters_p.h
index 7afdfd3..97f72fc 100644
--- a/src/declarative/qml/qdeclarativestringconverters_p.h
+++ b/src/declarative/qml/qdeclarativestringconverters_p.h
@@ -80,7 +80,7 @@ namespace QDeclarativeStringConverters
QSizeF Q_DECLARATIVE_EXPORT sizeFFromString(const QString &, bool *ok = 0);
QRectF Q_DECLARATIVE_EXPORT rectFFromString(const QString &, bool *ok = 0);
QVector3D Q_DECLARATIVE_EXPORT vector3DFromString(const QString &, bool *ok = 0);
-};
+}
QT_END_NAMESPACE
diff --git a/src/declarative/qml/qdeclarativeworkerscript_p.h b/src/declarative/qml/qdeclarativeworkerscript_p.h
index 80ef5f3..dc73811 100644
--- a/src/declarative/qml/qdeclarativeworkerscript_p.h
+++ b/src/declarative/qml/qdeclarativeworkerscript_p.h
@@ -122,7 +122,7 @@ private:
QT_END_NAMESPACE
-QML_DECLARE_TYPE(QDeclarativeWorkerScript);
+QML_DECLARE_TYPE(QDeclarativeWorkerScript)
QT_END_HEADER
diff --git a/src/declarative/qml/qdeclarativexmlhttprequest.cpp b/src/declarative/qml/qdeclarativexmlhttprequest.cpp
index 94205fe..80510f8 100644
--- a/src/declarative/qml/qdeclarativexmlhttprequest.cpp
+++ b/src/declarative/qml/qdeclarativexmlhttprequest.cpp
@@ -321,9 +321,9 @@ public:
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(Node);
-Q_DECLARE_METATYPE(NodeList);
-Q_DECLARE_METATYPE(NamedNodeMap);
+Q_DECLARE_METATYPE(Node)
+Q_DECLARE_METATYPE(NodeList)
+Q_DECLARE_METATYPE(NamedNodeMap)
QT_BEGIN_NAMESPACE
diff --git a/src/declarative/util/qdeclarativelistmodelworkeragent_p.h b/src/declarative/util/qdeclarativelistmodelworkeragent_p.h
index 53d30c2..1622144 100644
--- a/src/declarative/util/qdeclarativelistmodelworkeragent_p.h
+++ b/src/declarative/util/qdeclarativelistmodelworkeragent_p.h
@@ -146,7 +146,7 @@ private:
QT_END_NAMESPACE
-Q_DECLARE_METATYPE(QDeclarativeListModelWorkerAgent::VariantRef);
+Q_DECLARE_METATYPE(QDeclarativeListModelWorkerAgent::VariantRef)
QT_END_HEADER
diff --git a/src/declarative/util/qdeclarativesmoothedanimation_p.h b/src/declarative/util/qdeclarativesmoothedanimation_p.h
index 17aafa4..f45d19f 100644
--- a/src/declarative/util/qdeclarativesmoothedanimation_p.h
+++ b/src/declarative/util/qdeclarativesmoothedanimation_p.h
@@ -96,7 +96,7 @@ Q_SIGNALS:
QT_END_NAMESPACE
-QML_DECLARE_TYPE(QDeclarativeSmoothedAnimation);
+QML_DECLARE_TYPE(QDeclarativeSmoothedAnimation)
QT_END_HEADER
diff --git a/src/declarative/util/qdeclarativesmoothedfollow_p.h b/src/declarative/util/qdeclarativesmoothedfollow_p.h
index d860052..6319192 100644
--- a/src/declarative/util/qdeclarativesmoothedfollow_p.h
+++ b/src/declarative/util/qdeclarativesmoothedfollow_p.h
@@ -106,7 +106,7 @@ Q_SIGNALS:
QT_END_NAMESPACE
-QML_DECLARE_TYPE(QDeclarativeSmoothedFollow);
+QML_DECLARE_TYPE(QDeclarativeSmoothedFollow)
QT_END_HEADER
diff --git a/src/declarative/util/qdeclarativetransitionmanager_p_p.h b/src/declarative/util/qdeclarativetransitionmanager_p_p.h
index 4131391..2e23898 100644
--- a/src/declarative/util/qdeclarativetransitionmanager_p_p.h
+++ b/src/declarative/util/qdeclarativetransitionmanager_p_p.h
@@ -70,7 +70,7 @@ public:
void cancel();
private:
- Q_DISABLE_COPY(QDeclarativeTransitionManager);
+ Q_DISABLE_COPY(QDeclarativeTransitionManager)
QDeclarativeTransitionManagerPrivate *d;
void complete();
diff --git a/src/gui/dialogs/qcolordialog_mac.mm b/src/gui/dialogs/qcolordialog_mac.mm
index 8af0d2b..82cfa24 100644
--- a/src/gui/dialogs/qcolordialog_mac.mm
+++ b/src/gui/dialogs/qcolordialog_mac.mm
@@ -65,9 +65,9 @@ typedef float CGFloat; // Should only not be defined on 32-bit platforms
QT_USE_NAMESPACE
-@class QCocoaColorPanelDelegate;
+@class QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate);
-@interface QCocoaColorPanelDelegate : NSObject<NSWindowDelegate> {
+@interface QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) : NSObject<NSWindowDelegate> {
NSColorPanel *mColorPanel;
NSView *mStolenContentView;
NSButton *mOkButton;
@@ -99,7 +99,7 @@ QT_USE_NAMESPACE
- (void)setResultSet:(BOOL)result;
@end
-@implementation QCocoaColorPanelDelegate
+@implementation QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate)
- (id)initWithColorPanel:(NSColorPanel *)panel
stolenContentView:(NSView *)stolenContentView
okButton:(NSButton *)okButton
@@ -432,26 +432,26 @@ void QColorDialogPrivate::openCocoaColorPanel(const QColor &initial,
[colorPanel setDefaultButtonCell:[okButton cell]];
}
- delegate = [[QCocoaColorPanelDelegate alloc] initWithColorPanel:colorPanel
+ delegate = [[QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) alloc] initWithColorPanel:colorPanel
stolenContentView:stolenContentView
okButton:okButton
cancelButton:cancelButton
priv:this];
- [colorPanel setDelegate:static_cast<QCocoaColorPanelDelegate *>(delegate)];
+ [colorPanel setDelegate:static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate)];
}
[delegate setResultSet:false];
setCocoaPanelColor(initial);
- [static_cast<QCocoaColorPanelDelegate *>(delegate) showColorPanel];
+ [static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate) showColorPanel];
}
void QColorDialogPrivate::closeCocoaColorPanel()
{
- [static_cast<QCocoaColorPanelDelegate *>(delegate) onCancelClicked];
+ [static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate) onCancelClicked];
}
void QColorDialogPrivate::releaseCocoaColorPanelDelegate()
{
- [static_cast<QCocoaColorPanelDelegate *>(delegate) release];
+ [static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate) release];
}
void QColorDialogPrivate::mac_nativeDialogModalHelp()
@@ -471,13 +471,13 @@ void QColorDialogPrivate::mac_nativeDialogModalHelp()
void QColorDialogPrivate::_q_macRunNativeAppModalPanel()
{
- [static_cast<QCocoaColorPanelDelegate *>(delegate) exec];
+ [static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate) exec];
}
void QColorDialogPrivate::setCocoaPanelColor(const QColor &color)
{
QMacCocoaAutoReleasePool pool;
- QCocoaColorPanelDelegate *theDelegate = static_cast<QCocoaColorPanelDelegate *>(delegate);
+ QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *theDelegate = static_cast<QT_MANGLE_NAMESPACE(QCocoaColorPanelDelegate) *>(delegate);
NSColor *nsColor;
const QColor::Spec spec = color.spec();
if (spec == QColor::Cmyk) {
diff --git a/src/gui/dialogs/qfiledialog_mac.mm b/src/gui/dialogs/qfiledialog_mac.mm
index 28acf24..b07b1ea 100644
--- a/src/gui/dialogs/qfiledialog_mac.mm
+++ b/src/gui/dialogs/qfiledialog_mac.mm
@@ -82,9 +82,9 @@ QT_FORWARD_DECLARE_CLASS(QAction)
QT_FORWARD_DECLARE_CLASS(QFileInfo)
QT_USE_NAMESPACE
-@class QNSOpenSavePanelDelegate;
+@class QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate);
-@interface QNSOpenSavePanelDelegate : NSObject {
+@interface QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) : NSObject {
@public
NSOpenPanel *mOpenPanel;
NSSavePanel *mSavePanel;
@@ -123,7 +123,7 @@ QT_USE_NAMESPACE
@end
-@implementation QNSOpenSavePanelDelegate
+@implementation QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate)
- (id)initWithAcceptMode:(QT_PREPEND_NAMESPACE(QFileDialog::AcceptMode))acceptMode
title:(const QString &)title
@@ -554,7 +554,7 @@ void QFileDialogPrivate::setDirectory_sys(const QString &directory)
}
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
[delegate->mSavePanel setDirectory:qt_mac_QStringToNSString(directory)];
#endif
}
@@ -565,7 +565,7 @@ QString QFileDialogPrivate::directory_sys() const
return mCurrentLocation;
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
return qt_mac_NSStringToQString([delegate->mSavePanel directory]);
#endif
}
@@ -622,7 +622,7 @@ QStringList QFileDialogPrivate::selectedFiles_sys() const
}
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
return [delegate selectedFiles];
#endif
}
@@ -633,7 +633,7 @@ void QFileDialogPrivate::setNameFilters_sys(const QStringList &filters)
Q_UNUSED(filters);
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
bool hideDetails = q_func()->testOption(QFileDialog::HideNameFilterDetails);
[delegate setNameFilters:filters hideDetails:hideDetails];
#endif
@@ -645,7 +645,7 @@ void QFileDialogPrivate::setFilter_sys()
#else
Q_Q(QFileDialog);
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
*(delegate->mQDirFilter) = model->filter();
delegate->mFileMode = fileMode;
[delegate->mSavePanel setTitle:qt_mac_QStringToNSString(q->windowTitle())];
@@ -668,7 +668,7 @@ void QFileDialogPrivate::selectNameFilter_sys(const QString &filter)
NavCustomControl(mDialog, kNavCtlSelectCustomType, &navSpec);
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
[delegate->mPopUpButton selectItemAtIndex:index];
[delegate filterChanged:nil];
#endif
@@ -681,7 +681,7 @@ QString QFileDialogPrivate::selectedNameFilter_sys() const
int index = filterInfo.currentSelection;
#else
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
int index = [delegate->mPopUpButton indexOfSelectedItem];
#endif
return index != -1 ? nameFilters.at(index) : QString();
@@ -696,7 +696,7 @@ void QFileDialogPrivate::deleteNativeDialog_sys()
mDialogStarted = false;
#else
QMacCocoaAutoReleasePool pool;
- [reinterpret_cast<QNSOpenSavePanelDelegate *>(mDelegate) release];
+ [reinterpret_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate) release];
mDelegate = 0;
#endif
nativeDialogInUse = false;
@@ -1034,7 +1034,7 @@ void QFileDialogPrivate::createNSOpenSavePanelDelegate()
bool selectDir = q->selectedFiles().isEmpty();
QString selection(selectDir ? q->directory().absolutePath() : q->selectedFiles().value(0));
- QNSOpenSavePanelDelegate *delegate = [[QNSOpenSavePanelDelegate alloc]
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = [[QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) alloc]
initWithAcceptMode:acceptMode
title:q->windowTitle()
nameFilters:q->nameFilters()
@@ -1055,7 +1055,7 @@ bool QFileDialogPrivate::showCocoaFilePanel()
Q_Q(QFileDialog);
QMacCocoaAutoReleasePool pool;
createNSOpenSavePanelDelegate();
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
if (qt_mac_is_macsheet(q))
[delegate showWindowModalSheet:q->parentWidget()];
else
@@ -1071,7 +1071,7 @@ bool QFileDialogPrivate::hideCocoaFilePanel()
return false;
} else {
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
[delegate closePanel];
// Even when we hide it, we are still using a
// native dialog, so return true:
@@ -1104,7 +1104,7 @@ void QFileDialogPrivate::_q_macRunNativeAppModalPanel()
#else
Q_Q(QFileDialog);
QMacCocoaAutoReleasePool pool;
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
[delegate runApplicationModalPanel];
dialogResultCode_sys() == QDialog::Accepted ? q->accept() : q->reject();
#endif
@@ -1119,7 +1119,7 @@ QDialog::DialogCode QFileDialogPrivate::dialogResultCode_sys()
else
return QDialog::Accepted;
#else
- QNSOpenSavePanelDelegate *delegate = static_cast<QNSOpenSavePanelDelegate *>(mDelegate);
+ QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *delegate = static_cast<QT_MANGLE_NAMESPACE(QNSOpenSavePanelDelegate) *>(mDelegate);
return [delegate dialogResultCode];
#endif
}
diff --git a/src/gui/dialogs/qfontdialog_mac.mm b/src/gui/dialogs/qfontdialog_mac.mm
index 919790b..bb8ef3f 100644
--- a/src/gui/dialogs/qfontdialog_mac.mm
+++ b/src/gui/dialogs/qfontdialog_mac.mm
@@ -82,7 +82,7 @@ const CGFloat DialogSideMargin = 9.0;
const int StyleMask = NSTitledWindowMask | NSClosableWindowMask | NSResizableWindowMask;
-@class QCocoaFontPanelDelegate;
+@class QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate);
#if MAC_OS_X_VERSION_MAX_ALLOWED <= MAC_OS_X_VERSION_10_5
@@ -93,7 +93,7 @@ const int StyleMask = NSTitledWindowMask | NSClosableWindowMask | NSResizableWin
#endif
-@interface QCocoaFontPanelDelegate : NSObject <NSWindowDelegate> {
+@interface QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) : NSObject <NSWindowDelegate> {
NSFontPanel *mFontPanel;
NSView *mStolenContentView;
NSButton *mOkButton;
@@ -156,7 +156,7 @@ static QFont qfontForCocoaFont(NSFont *cocoaFont, const QFont &resolveFont)
return newFont;
}
-@implementation QCocoaFontPanelDelegate
+@implementation QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate)
- (id)initWithFontPanel:(NSFontPanel *)panel
stolenContentView:(NSView *)stolenContentView
okButton:(NSButton *)okButton
@@ -478,7 +478,7 @@ QT_BEGIN_NAMESPACE
void QFontDialogPrivate::closeCocoaFontPanel()
{
QMacCocoaAutoReleasePool pool;
- QCocoaFontPanelDelegate *theDelegate = static_cast<QCocoaFontPanelDelegate *>(delegate);
+ QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *theDelegate = static_cast<QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *>(delegate);
NSWindow *ourPanel = [theDelegate actualPanel];
[ourPanel close];
[theDelegate cleanUpAfterMyself];
@@ -519,7 +519,7 @@ void QFontDialogPrivate::setFont(void *delegate, const QFont &font)
}
[mgr setSelectedFont:nsFont isMultiple:NO];
- [static_cast<QCocoaFontPanelDelegate *>(delegate) setQtFont:font];
+ [static_cast<QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *>(delegate) setQtFont:font];
}
void QFontDialogPrivate::createNSFontPanelDelegate()
@@ -584,7 +584,7 @@ void QFontDialogPrivate::createNSFontPanelDelegate()
}
// create the delegate and set it
- QCocoaFontPanelDelegate *del = [[QCocoaFontPanelDelegate alloc] initWithFontPanel:sharedFontPanel
+ QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *del = [[QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) alloc] initWithFontPanel:sharedFontPanel
stolenContentView:stolenContentView
okButton:okButton
cancelButton:cancelButton
@@ -637,7 +637,7 @@ void QFontDialogPrivate::mac_nativeDialogModalHelp()
void QFontDialogPrivate::_q_macRunNativeAppModalPanel()
{
createNSFontPanelDelegate();
- QCocoaFontPanelDelegate *del = static_cast<QCocoaFontPanelDelegate *>(delegate);
+ QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *del = static_cast<QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *>(delegate);
[del runApplicationModalPanel];
}
@@ -649,7 +649,7 @@ bool QFontDialogPrivate::showCocoaFontPanel()
Q_Q(QFontDialog);
QMacCocoaAutoReleasePool pool;
createNSFontPanelDelegate();
- QCocoaFontPanelDelegate *del = static_cast<QCocoaFontPanelDelegate *>(delegate);
+ QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *del = static_cast<QT_MANGLE_NAMESPACE(QCocoaFontPanelDelegate) *>(delegate);
if (qt_mac_is_macsheet(q))
[del showWindowModalSheet:q->parentWidget()];
else
diff --git a/src/gui/dialogs/qnspanelproxy_mac.mm b/src/gui/dialogs/qnspanelproxy_mac.mm
index 3229a4d..0bd5c63 100644
--- a/src/gui/dialogs/qnspanelproxy_mac.mm
+++ b/src/gui/dialogs/qnspanelproxy_mac.mm
@@ -52,9 +52,9 @@ QT_END_NAMESPACE
QT_USE_NAMESPACE
-@class QNSPanelProxy;
+@class QT_MANGLE_NAMESPACE(QNSPanelProxy);
-@interface QNSPanelProxy : NSWindow {
+@interface QT_MANGLE_NAMESPACE(QNSPanelProxy) : NSWindow {
}
- (id)initWithContentRect:(NSRect)contentRect styleMask:(NSUInteger)windowStyle
backing:(NSBackingStoreType)bufferingType defer:(BOOL)deferCreation;
@@ -66,7 +66,7 @@ QT_USE_NAMESPACE
backing:(NSBackingStoreType)bufferingType defer:(BOOL)deferCreation screen:(NSScreen *)screen;
@end
-@implementation QNSPanelProxy
+@implementation QT_MANGLE_NAMESPACE(QNSPanelProxy)
- (id)initWithContentRect:(NSRect)contentRect styleMask:(NSUInteger)windowStyle
backing:(NSBackingStoreType)bufferingType defer:(BOOL)deferCreation
{
@@ -108,15 +108,15 @@ QT_USE_NAMESPACE
}
@end
-@class QNSWindowProxy;
+@class QT_MANGLE_NAMESPACE(QNSWindowProxy);
-@interface QNSWindowProxy : NSWindow {
+@interface QT_MANGLE_NAMESPACE(QNSWindowProxy) : NSWindow {
}
- (void)setTitle:(NSString *)title;
- (void)qt_fakeSetTitle:(NSString *)title;
@end
-@implementation QNSWindowProxy
+@implementation QT_MANGLE_NAMESPACE(QNSWindowProxy)
- (void)setTitle:(NSString *)title
{
QCFString cftitle(currentWindow->windowTitle());
@@ -190,10 +190,10 @@ void macStartInterceptNSPanelCtor()
{
macStartIntercept(@selector(initWithContentRect:styleMask:backing:defer:),
@selector(qt_fakeInitWithContentRect:styleMask:backing:defer:),
- [NSPanel class], [QNSPanelProxy class]);
+ [NSPanel class], [QT_MANGLE_NAMESPACE(QNSPanelProxy) class]);
macStartIntercept(@selector(initWithContentRect:styleMask:backing:defer:screen:),
@selector(qt_fakeInitWithContentRect:styleMask:backing:defer:screen:),
- [NSPanel class], [QNSPanelProxy class]);
+ [NSPanel class], [QT_MANGLE_NAMESPACE(QNSPanelProxy) class]);
}
/*
@@ -203,10 +203,10 @@ void macStopInterceptNSPanelCtor()
{
macStopIntercept(@selector(initWithContentRect:styleMask:backing:defer:screen:),
@selector(qt_fakeInitWithContentRect:styleMask:backing:defer:screen:),
- [NSPanel class], [QNSPanelProxy class]);
+ [NSPanel class], [QT_MANGLE_NAMESPACE(QNSPanelProxy) class]);
macStopIntercept(@selector(initWithContentRect:styleMask:backing:defer:),
@selector(qt_fakeInitWithContentRect:styleMask:backing:defer:),
- [NSPanel class], [QNSPanelProxy class]);
+ [NSPanel class], [QT_MANGLE_NAMESPACE(QNSPanelProxy) class]);
}
/*
@@ -217,7 +217,7 @@ void macStartInterceptWindowTitle(QWidget *window)
{
currentWindow = window;
macStartIntercept(@selector(setTitle:), @selector(qt_fakeSetTitle:),
- [NSWindow class], [QNSWindowProxy class]);
+ [NSWindow class], [QT_MANGLE_NAMESPACE(QNSWindowProxy) class]);
}
/*
@@ -227,7 +227,7 @@ void macStopInterceptWindowTitle()
{
currentWindow = 0;
macStopIntercept(@selector(setTitle:), @selector(qt_fakeSetTitle:),
- [NSWindow class], [QNSWindowProxy class]);
+ [NSWindow class], [QT_MANGLE_NAMESPACE(QNSWindowProxy) class]);
}
/*
diff --git a/src/gui/dialogs/qpagesetupdialog_mac.mm b/src/gui/dialogs/qpagesetupdialog_mac.mm
index cfcde0f..0302be4 100644
--- a/src/gui/dialogs/qpagesetupdialog_mac.mm
+++ b/src/gui/dialogs/qpagesetupdialog_mac.mm
@@ -50,9 +50,9 @@
QT_USE_NAMESPACE
-@class QCocoaPageLayoutDelegate;
+@class QT_MANGLE_NAMESPACE(QCocoaPageLayoutDelegate);
-@interface QCocoaPageLayoutDelegate : NSObject {
+@interface QT_MANGLE_NAMESPACE(QCocoaPageLayoutDelegate) : NSObject {
QMacPrintEnginePrivate *pe;
}
- (id)initWithMacPrintEngine:(QMacPrintEnginePrivate *)printEngine;
@@ -60,7 +60,7 @@ QT_USE_NAMESPACE
returnCode:(int)returnCode contextInfo:(void *)contextInfo;
@end
-@implementation QCocoaPageLayoutDelegate
+@implementation QT_MANGLE_NAMESPACE(QCocoaPageLayoutDelegate)
- (id)initWithMacPrintEngine:(QMacPrintEnginePrivate *)printEngine;
{
self = [super init];
@@ -213,7 +213,7 @@ void QPageSetupDialogPrivate::openCocoaPageLayout(Qt::WindowModality modality)
pageLayout = [NSPageLayout pageLayout];
// Keep a copy to this since we plan on using it for a bit.
[pageLayout retain];
- QCocoaPageLayoutDelegate *delegate = [[QCocoaPageLayoutDelegate alloc] initWithMacPrintEngine:ep];
+ QT_MANGLE_NAMESPACE(QCocoaPageLayoutDelegate) *delegate = [[QT_MANGLE_NAMESPACE(QCocoaPageLayoutDelegate) alloc] initWithMacPrintEngine:ep];
if (modality == Qt::ApplicationModal) {
int rval = [pageLayout runModalWithPrintInfo:ep->printInfo];
diff --git a/src/gui/dialogs/qprintdialog_mac.mm b/src/gui/dialogs/qprintdialog_mac.mm
index 6a8d6a4..84a72db 100644
--- a/src/gui/dialogs/qprintdialog_mac.mm
+++ b/src/gui/dialogs/qprintdialog_mac.mm
@@ -124,15 +124,15 @@ QT_USE_NAMESPACE
#ifdef QT_MAC_USE_COCOA
-@class QCocoaPrintPanelDelegate;
+@class QT_MANGLE_NAMESPACE(QCocoaPrintPanelDelegate);
-@interface QCocoaPrintPanelDelegate : NSObject {
+@interface QT_MANGLE_NAMESPACE(QCocoaPrintPanelDelegate) : NSObject {
}
- (void)printPanelDidEnd:(NSPrintPanel *)printPanel
returnCode:(int)returnCode contextInfo:(void *)contextInfo;
@end
-@implementation QCocoaPrintPanelDelegate
+@implementation QT_MANGLE_NAMESPACE(QCocoaPrintPanelDelegate)
- (void)printPanelDidEnd:(NSPrintPanel *)printPanel
returnCode:(int)returnCode contextInfo:(void *)contextInfo
{
@@ -313,7 +313,7 @@ void QPrintDialogPrivate::openCocoaPrintPanel(Qt::WindowModality modality)
macStartInterceptWindowTitle(q);
printPanel = [NSPrintPanel printPanel];
- QCocoaPrintPanelDelegate *delegate = [[QCocoaPrintPanelDelegate alloc] init];
+ QT_MANGLE_NAMESPACE(QCocoaPrintPanelDelegate) *delegate = [[QT_MANGLE_NAMESPACE(QCocoaPrintPanelDelegate) alloc] init];
[printPanel setOptions:macOptions];
if (modality == Qt::ApplicationModal) {
diff --git a/src/gui/dialogs/qwizard_win.cpp b/src/gui/dialogs/qwizard_win.cpp
index 1390b21..e406cba 100644
--- a/src/gui/dialogs/qwizard_win.cpp
+++ b/src/gui/dialogs/qwizard_win.cpp
@@ -237,7 +237,8 @@ void QVistaBackButton::paintEvent(QPaintEvent *)
*/
QVistaHelper::QVistaHelper(QWizard *wizard)
- : pressed(false)
+ : QObject(wizard)
+ , pressed(false)
, wizard(wizard)
, backButton_(0)
{
diff --git a/src/gui/graphicsview/qgraphicsitem.cpp b/src/gui/graphicsview/qgraphicsitem.cpp
index b491ab9..5e0d46f 100644
--- a/src/gui/graphicsview/qgraphicsitem.cpp
+++ b/src/gui/graphicsview/qgraphicsitem.cpp
@@ -1427,6 +1427,13 @@ QGraphicsItem::~QGraphicsItem()
d_ptr->inDestructor = 1;
d_ptr->removeExtraItemCache();
+ if (d_ptr->isObject && !d_ptr->gestureContext.isEmpty()) {
+ QGraphicsObject *o = static_cast<QGraphicsObject *>(this);
+ QGestureManager *manager = QGestureManager::instance();
+ foreach (Qt::GestureType type, d_ptr->gestureContext.keys())
+ manager->cleanupCachedGestures(o, type);
+ }
+
clearFocus();
// Update focus scope item ptr.
diff --git a/src/gui/kernel/qapplication.cpp b/src/gui/kernel/qapplication.cpp
index ec635d4..7b62de1 100644
--- a/src/gui/kernel/qapplication.cpp
+++ b/src/gui/kernel/qapplication.cpp
@@ -788,6 +788,10 @@ void QApplicationPrivate::construct(
qt_gui_eval_init(application_type);
#endif
+#if defined(Q_OS_SYMBIAN) && !defined(QT_NO_SYSTEMLOCALE)
+ symbianInit();
+#endif
+
#ifndef QT_NO_LIBRARY
if(load_testability) {
QLibrary testLib(QLatin1String("qttestability"));
@@ -2364,6 +2368,19 @@ bool QApplication::event(QEvent *e)
if (!(w->windowType() == Qt::Desktop))
postEvent(w, new QEvent(QEvent::LanguageChange));
}
+#ifndef Q_OS_WIN
+ } else if (e->type() == QEvent::LocaleChange) {
+ // on Windows the event propagation is taken care by the
+ // WM_SETTINGCHANGE event handler.
+ QWidgetList list = topLevelWidgets();
+ for (int i = 0; i < list.size(); ++i) {
+ QWidget *w = list.at(i);
+ if (!(w->windowType() == Qt::Desktop)) {
+ if (!w->testAttribute(Qt::WA_SetLocale))
+ w->d_func()->setLocale_helper(QLocale(), true);
+ }
+ }
+#endif
} else if (e->type() == QEvent::Timer) {
QTimerEvent *te = static_cast<QTimerEvent*>(e);
Q_ASSERT(te != 0);
diff --git a/src/gui/kernel/qapplication_win.cpp b/src/gui/kernel/qapplication_win.cpp
index fb2837e..50b9759 100644
--- a/src/gui/kernel/qapplication_win.cpp
+++ b/src/gui/kernel/qapplication_win.cpp
@@ -1936,6 +1936,8 @@ extern "C" LRESULT QT_WIN_CALLBACK QtWndProc(HWND hwnd, UINT message, WPARAM wPa
QLocalePrivate::updateSystemPrivate();
if (!widget->testAttribute(Qt::WA_SetLocale))
widget->dptr()->setLocale_helper(QLocale(), true);
+ QEvent e(QEvent::LocaleChange);
+ QApplication::sendEvent(qApp, &e);
}
}
else if (msg.wParam == SPI_SETICONTITLELOGFONT) {
diff --git a/src/gui/kernel/qdnd_qws.cpp b/src/gui/kernel/qdnd_qws.cpp
index e47de00..7e5afc7 100644
--- a/src/gui/kernel/qdnd_qws.cpp
+++ b/src/gui/kernel/qdnd_qws.cpp
@@ -192,6 +192,10 @@ bool QDragManager::eventFilter(QObject *o, QEvent *e)
return false;
switch(e->type()) {
+ case QEvent::ShortcutOverride:
+ // prevent accelerators from firing while dragging
+ e->accept();
+ return true;
case QEvent::KeyPress:
case QEvent::KeyRelease:
diff --git a/src/gui/kernel/qdnd_x11.cpp b/src/gui/kernel/qdnd_x11.cpp
index 0a05d8e..2b12317 100644
--- a/src/gui/kernel/qdnd_x11.cpp
+++ b/src/gui/kernel/qdnd_x11.cpp
@@ -1299,6 +1299,12 @@ bool QDragManager::eventFilter(QObject * o, QEvent * e)
return true;
}
+ if (e->type() == QEvent::ShortcutOverride) {
+ // prevent accelerators from firing while dragging
+ e->accept();
+ return true;
+ }
+
if (e->type() == QEvent::KeyPress || e->type() == QEvent::KeyRelease) {
QKeyEvent *ke = ((QKeyEvent*)e);
if (ke->key() == Qt::Key_Escape && e->type() == QEvent::KeyPress) {
diff --git a/src/gui/kernel/qgesturemanager.cpp b/src/gui/kernel/qgesturemanager.cpp
index aa6720e..9495f40 100644
--- a/src/gui/kernel/qgesturemanager.cpp
+++ b/src/gui/kernel/qgesturemanager.cpp
@@ -132,20 +132,21 @@ void QGestureManager::unregisterGestureRecognizer(Qt::GestureType type)
QGestureRecognizer *recognizer = m_gestureToRecognizer.value(g);
if (list.contains(recognizer)) {
m_deletedRecognizers.insert(g, recognizer);
- m_gestureToRecognizer.remove(g);
}
}
- foreach (QGestureRecognizer *recognizer, list) {
- QList<QGesture *> obsoleteGestures;
- QMap<ObjectGesture, QList<QGesture *> >::Iterator iter = m_objectGestures.begin();
- while (iter != m_objectGestures.end()) {
- ObjectGesture objectGesture = iter.key();
- if (objectGesture.gesture == type)
- obsoleteGestures << iter.value();
- ++iter;
+ QMap<ObjectGesture, QList<QGesture *> >::const_iterator iter = m_objectGestures.begin();
+ while (iter != m_objectGestures.end()) {
+ ObjectGesture objectGesture = iter.key();
+ if (objectGesture.gesture == type) {
+ foreach (QGesture *g, iter.value()) {
+ if (QGestureRecognizer *recognizer = m_gestureToRecognizer.value(g)) {
+ m_gestureToRecognizer.remove(g);
+ m_obsoleteGestures[recognizer].insert(g);
+ }
+ }
}
- m_obsoleteGestures.insert(recognizer, obsoleteGestures);
+ ++iter;
}
}
@@ -155,7 +156,14 @@ void QGestureManager::cleanupCachedGestures(QObject *target, Qt::GestureType typ
while (iter != m_objectGestures.end()) {
ObjectGesture objectGesture = iter.key();
if (objectGesture.gesture == type && target == objectGesture.object.data()) {
- qDeleteAll(iter.value());
+ QSet<QGesture *> gestures = iter.value().toSet();
+ for (QHash<QGestureRecognizer *, QSet<QGesture *> >::iterator
+ it = m_obsoleteGestures.begin(), e = m_obsoleteGestures.end(); it != e; ++it) {
+ it.value() -= gestures;
+ }
+ foreach (QGesture *g, gestures)
+ m_deletedRecognizers.remove(g);
+ qDeleteAll(gestures);
iter = m_objectGestures.erase(iter);
} else {
++iter;
@@ -177,6 +185,9 @@ QGesture *QGestureManager::getState(QObject *object, QGestureRecognizer *recogni
#ifndef QT_NO_GRAPHICSVIEW
} else {
Q_ASSERT(qobject_cast<QGraphicsObject *>(object));
+ QGraphicsObject *graphicsObject = static_cast<QGraphicsObject *>(object);
+ if (graphicsObject->QGraphicsItem::d_func()->inDestructor)
+ return 0;
#endif
}
diff --git a/src/gui/kernel/qgesturemanager_p.h b/src/gui/kernel/qgesturemanager_p.h
index a0ff83f..c105c9b 100644
--- a/src/gui/kernel/qgesturemanager_p.h
+++ b/src/gui/kernel/qgesturemanager_p.h
@@ -127,7 +127,7 @@ private:
int m_lastCustomGestureId;
- QHash<QGestureRecognizer *, QList<QGesture *> > m_obsoleteGestures;
+ QHash<QGestureRecognizer *, QSet<QGesture *> > m_obsoleteGestures;
QHash<QGesture *, QGestureRecognizer *> m_deletedRecognizers;
void cleanupGesturesForRemovedRecognizer(QGesture *gesture);
diff --git a/src/gui/kernel/qsound_mac.mm b/src/gui/kernel/qsound_mac.mm
index 71fd663..2aff44d 100644
--- a/src/gui/kernel/qsound_mac.mm
+++ b/src/gui/kernel/qsound_mac.mm
@@ -88,14 +88,14 @@ QT_END_NAMESPACE
QT_USE_NAMESPACE
-@interface QMacSoundDelegate : NSObject<NSSoundDelegate> {
+@interface QT_MANGLE_NAMESPACE(QMacSoundDelegate) : NSObject<NSSoundDelegate> {
QSound *qSound; // may be null.
QAuServerMac* server;
}
-(id)initWithQSound:(QSound*)sound:(QAuServerMac*)server;
@end
-@implementation QMacSoundDelegate
+@implementation QT_MANGLE_NAMESPACE(QMacSoundDelegate)
-(id)initWithQSound:(QSound*)s:(QAuServerMac*)serv {
self = [super init];
if(self) {
@@ -172,7 +172,7 @@ NSSound *QAuServerMac::createNSSound(const QString &fileName, QSound *qSound)
{
NSString *nsFileName = const_cast<NSString *>(reinterpret_cast<const NSString *>(QCFString::toCFStringRef(fileName)));
NSSound * const nsSound = [[NSSound alloc] initWithContentsOfFile: nsFileName byReference:YES];
- QMacSoundDelegate * const delegate = [[QMacSoundDelegate alloc] initWithQSound:qSound:this];
+ QT_MANGLE_NAMESPACE(QMacSoundDelegate) * const delegate = [[QT_MANGLE_NAMESPACE(QMacSoundDelegate) alloc] initWithQSound:qSound:this];
[nsSound setDelegate:delegate];
[nsFileName release];
return nsSound;
diff --git a/src/gui/kernel/qwidget.cpp b/src/gui/kernel/qwidget.cpp
index 0c22368..4a9fa94 100644
--- a/src/gui/kernel/qwidget.cpp
+++ b/src/gui/kernel/qwidget.cpp
@@ -1388,6 +1388,9 @@ QWidget::~QWidget()
qWarning("QWidget: %s (%s) deleted while being painted", className(), name());
#endif
+ foreach (Qt::GestureType type, d->gestureContext.keys())
+ ungrabGesture(type);
+
// force acceptDrops false before winId is destroyed.
d->registerDropSite(false);
diff --git a/src/gui/kernel/qwidget_mac.mm b/src/gui/kernel/qwidget_mac.mm
index e29b755..f12c956 100644
--- a/src/gui/kernel/qwidget_mac.mm
+++ b/src/gui/kernel/qwidget_mac.mm
@@ -3824,9 +3824,35 @@ void QWidgetPrivate::raise_sys()
#if QT_MAC_USE_COCOA
QMacCocoaAutoReleasePool pool;
if (isRealWindow()) {
- // Calling orderFront shows the window on Cocoa too.
+ // With the introduction of spaces it is not as simple as just raising the window.
+ // First we need to check if we are in the right space. If we are, then we just continue
+ // as usual. The problem comes when we are not in the active space. There are two main cases:
+ // 1. Our parent was moved to a new space. In this case we want the window to be raised
+ // in the same space as its parent.
+ // 2. We don't have a parent. For this case we will just raise the window and let Cocoa
+ // switch to the corresponding space.
+ // NOTICE: There are a lot of corner cases here. We are keeping this simple for now, if
+ // required we will introduce special handling for some of them.
if (!q->testAttribute(Qt::WA_DontShowOnScreen) && q->isVisible()) {
- [qt_mac_window_for(q) orderFront:qt_mac_window_for(q)];
+ OSWindowRef window = qt_mac_window_for(q);
+ // isOnActiveSpace is available only from 10.6 onwards, so we need to check if it is
+ // available before calling it.
+ if([window respondsToSelector:@selector(isOnActiveSpace)]) {
+ if(![window performSelector:@selector(isOnActiveSpace)]) {
+ QWidget *parentWidget = q->parentWidget();
+ if(parentWidget) {
+ OSWindowRef parentWindow = qt_mac_window_for(parentWidget);
+ if(parentWindow && [parentWindow isOnActiveSpace]) {
+ // The window was created in a different space. Therefore if we want
+ // to show it in the current space we need to recreate it in the new
+ // space.
+ recreateMacWindow();
+ window = qt_mac_window_for(q);
+ }
+ }
+ }
+ }
+ [window orderFront:window];
}
if (qt_mac_raise_process) { //we get to be the active process now
ProcessSerialNumber psn;
diff --git a/src/gui/kernel/qwidget_win.cpp b/src/gui/kernel/qwidget_win.cpp
index c2a24fe..5482da3 100644
--- a/src/gui/kernel/qwidget_win.cpp
+++ b/src/gui/kernel/qwidget_win.cpp
@@ -517,8 +517,10 @@ void QWidgetPrivate::create_sys(WId window, bool initializeWindow, bool destroyO
DestroyWindow(destroyw);
}
+#ifndef QT_NO_TABLETEVENT
if (q != qt_tablet_widget && QWidgetPrivate::mapper)
qt_tablet_init();
+#endif // QT_NO_TABLETEVENT
if (q->testAttribute(Qt::WA_DropSiteRegistered))
registerDropSite(true);
diff --git a/src/gui/kernel/qwidget_wince.cpp b/src/gui/kernel/qwidget_wince.cpp
index 9c2c8c7..fc1e52c 100644
--- a/src/gui/kernel/qwidget_wince.cpp
+++ b/src/gui/kernel/qwidget_wince.cpp
@@ -360,8 +360,10 @@ void QWidgetPrivate::create_sys(WId window, bool initializeWindow, bool destroyO
DestroyWindow(destroyw);
}
+#ifndef QT_NO_TABLETEVENT
if (q != qt_tablet_widget && QWidgetPrivate::mapper)
qt_tablet_init_wce();
+#endif // QT_NO_TABLETEVENT
if (q->testAttribute(Qt::WA_DropSiteRegistered))
registerDropSite(true);
diff --git a/src/gui/kernel/qwidget_x11.cpp b/src/gui/kernel/qwidget_x11.cpp
index 37ac6bf..43f510c 100644
--- a/src/gui/kernel/qwidget_x11.cpp
+++ b/src/gui/kernel/qwidget_x11.cpp
@@ -3000,7 +3000,7 @@ Picture QX11Data::getSolidFill(int screen, const QColor &c)
return X11->solid_fills[i].picture;
}
// none found, replace one
- int i = rand() % 16;
+ int i = qrand() % 16;
if (X11->solid_fills[i].screen != screen && X11->solid_fills[i].picture) {
XRenderFreePicture (X11->display, X11->solid_fills[i].picture);
diff --git a/src/gui/painting/qpaintengine_x11.cpp b/src/gui/painting/qpaintengine_x11.cpp
index da48fcb..aef8b80 100644
--- a/src/gui/painting/qpaintengine_x11.cpp
+++ b/src/gui/painting/qpaintengine_x11.cpp
@@ -315,7 +315,7 @@ static Picture getPatternFill(int screen, const QBrush &b)
return X11->pattern_fills[i].picture;
}
// none found, replace one
- int i = rand() % 16;
+ int i = qrand() % 16;
if (X11->pattern_fills[i].screen != screen && X11->pattern_fills[i].picture) {
XRenderFreePicture (X11->display, X11->pattern_fills[i].picture);
diff --git a/src/gui/painting/qprintengine_pdf.cpp b/src/gui/painting/qprintengine_pdf.cpp
index b8bf15e..2955e39 100644
--- a/src/gui/painting/qprintengine_pdf.cpp
+++ b/src/gui/painting/qprintengine_pdf.cpp
@@ -931,29 +931,16 @@ void QPdfEnginePrivate::writeHeader()
void QPdfEnginePrivate::writeInfo()
{
info = addXrefEntry(-1);
-
- // The 'text string' type in PDF is encoded either as PDFDocEncoding, or
- // Unicode UTF-16 with a Unicode byte order mark as the first character
- // (0xfeff), with the high-order byte first.
- QByteArray array("<<\n/Title (\xfe\xff");
- const ushort *utf16Title = title.utf16();
- for (int i=0; i < title.size(); ++i) {
- array.append((*(utf16Title + i)) >> 8);
- array.append((*(utf16Title + i)) & 0xff);
- }
- array.append(")\n/Creator (\xfe\xff");
- const ushort *utf16Creator = creator.utf16();
- for (int i=0; i < creator.size(); ++i) {
- array.append((*(utf16Creator + i)) >> 8);
- array.append((*(utf16Creator + i)) & 0xff);
- }
- array.append(")\n/Producer (Qt " QT_VERSION_STR " (C) 2010 Nokia Corporation and/or its subsidiary(-ies))\n");
- write(array);
-
+ xprintf("<<\n/Title ");
+ printString(title);
+ xprintf("\n/Creator ");
+ printString(creator);
+ xprintf("\n/Producer ");
+ printString(QString::fromLatin1("Qt " QT_VERSION_STR " (C) 2010 Nokia Corporation and/or its subsidiary(-ies)"));
QDateTime now = QDateTime::currentDateTime().toUTC();
QTime t = now.time();
QDate d = now.date();
- xprintf("/CreationDate (D:%d%02d%02d%02d%02d%02d)\n",
+ xprintf("\n/CreationDate (D:%d%02d%02d%02d%02d%02d)\n",
d.year(),
d.month(),
d.day(),
@@ -1230,6 +1217,25 @@ int QPdfEnginePrivate::addXrefEntry(int object, bool printostr)
return object;
}
+void QPdfEnginePrivate::printString(const QString &string) {
+ // The 'text string' type in PDF is encoded either as PDFDocEncoding, or
+ // Unicode UTF-16 with a Unicode byte order mark as the first character
+ // (0xfeff), with the high-order byte first.
+ QByteArray array("(\xfe\xff");
+ const ushort *utf16 = string.utf16();
+
+ for (int i=0; i < string.size(); ++i) {
+ char part[2] = {char((*(utf16 + i)) >> 8), char((*(utf16 + i)) & 0xff)};
+ for(int j=0; j < 2; ++j) {
+ if (part[j] == '(' || part[j] == ')' || part[j] == '\\')
+ array.append('\\');
+ array.append(part[j]);
+ }
+ }
+ array.append(")");
+ write(array);
+}
+
QT_END_NAMESPACE
#endif // QT_NO_PRINTER
diff --git a/src/gui/painting/qprintengine_pdf_p.h b/src/gui/painting/qprintengine_pdf_p.h
index cb6c59d..e0ca56f 100644
--- a/src/gui/painting/qprintengine_pdf_p.h
+++ b/src/gui/painting/qprintengine_pdf_p.h
@@ -170,6 +170,7 @@ private:
void writePage();
int addXrefEntry(int object, bool printostr = true);
+ void printString(const QString &string);
void xprintf(const char* fmt, ...);
inline void write(const QByteArray &data) {
stream->writeRawData(data.constData(), data.size());
diff --git a/src/gui/styles/qcleanlooksstyle.cpp b/src/gui/styles/qcleanlooksstyle.cpp
index 0f39b23..d9f7df0 100644
--- a/src/gui/styles/qcleanlooksstyle.cpp
+++ b/src/gui/styles/qcleanlooksstyle.cpp
@@ -1397,7 +1397,6 @@ void QCleanlooksStyle::drawControl(ControlElement element, const QStyleOption *o
dark.lighter(135), 60);
QColor highlight = option->palette.highlight().color();
- QColor highlightText = option->palette.highlightedText().color();
switch(element) {
case CE_RadioButton: //fall through
@@ -2723,7 +2722,6 @@ void QCleanlooksStyle::drawComplexControl(ComplexControl control, const QStyleOp
{
// Fill title bar gradient
QColor titlebarColor = QColor(active ? highlight: palette.background().color());
- QColor titleBarGradientStop(active ? highlight.darker(150): palette.background().color().darker(120));
QLinearGradient gradient(option->rect.center().x(), option->rect.top(),
option->rect.center().x(), option->rect.bottom());
@@ -2986,7 +2984,6 @@ void QCleanlooksStyle::drawComplexControl(ComplexControl control, const QStyleOp
painter->fillRect(option->rect, option->palette.background());
- QRect rect = scrollBar->rect;
QRect scrollBarSubLine = proxy()->subControlRect(control, scrollBar, SC_ScrollBarSubLine, widget);
QRect scrollBarAddLine = proxy()->subControlRect(control, scrollBar, SC_ScrollBarAddLine, widget);
QRect scrollBarSlider = proxy()->subControlRect(control, scrollBar, SC_ScrollBarSlider, widget);
@@ -3714,6 +3711,9 @@ int QCleanlooksStyle::pixelMetric(PixelMetric metric, const QStyleOption *option
{
int ret = -1;
switch (metric) {
+ case PM_ToolTipLabelFrameWidth:
+ ret = 2;
+ break;
case PM_ButtonDefaultIndicator:
ret = 0;
break;
diff --git a/src/gui/styles/qgtkstyle.cpp b/src/gui/styles/qgtkstyle.cpp
index 9c61023..6c8d561 100644
--- a/src/gui/styles/qgtkstyle.cpp
+++ b/src/gui/styles/qgtkstyle.cpp
@@ -1163,7 +1163,6 @@ void QGtkStyle::drawPrimitive(PrimitiveElement element,
if (const QStyleOptionTabBarBase *tbb
= qstyleoption_cast<const QStyleOptionTabBarBase *>(option)) {
QRect tabRect = tbb->rect;
- QRegion region(tabRect);
painter->save();
painter->setPen(QPen(option->palette.dark().color().dark(110), 0));
switch (tbb->shape) {
@@ -1245,8 +1244,6 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
else
alphaCornerColor = mergedColors(option->palette.background().color(), darkOutline);
- QPalette palette = option->palette;
-
switch (control) {
case CC_TitleBar:
@@ -1333,11 +1330,8 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
bool isEnabled = (comboBox->state & State_Enabled);
bool focus = isEnabled && (comboBox->state & State_HasFocus);
- QColor buttonShadow = option->palette.dark().color();
GtkStateType state = gtkPainter.gtkState(option);
int appears_as_list = !proxy()->styleHint(QStyle::SH_ComboBox_Popup, comboBox, widget);
- QPixmap cache;
- QString pixmapName;
QStyleOptionComboBox comboBoxCopy = *comboBox;
comboBoxCopy.rect = option->rect;
@@ -1345,8 +1339,6 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
QRect rect = option->rect;
QRect arrowButtonRect = proxy()->subControlRect(CC_ComboBox, &comboBoxCopy,
SC_ComboBoxArrow, widget);
- QRect editRect = proxy()->subControlRect(CC_ComboBox, &comboBoxCopy,
- SC_ComboBoxEditField, widget);
GtkShadowType shadow = (option->state & State_Sunken || option->state & State_On ) ?
GTK_SHADOW_IN : GTK_SHADOW_OUT;
@@ -1414,9 +1406,6 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
else if (option->state & State_MouseOver && comboBox->activeSubControls & SC_ComboBoxArrow)
buttonState = GTK_STATE_PRELIGHT;
- QRect buttonrect = QRect(gtkToggleButton->allocation.x, gtkToggleButton->allocation.y,
- gtkToggleButton->allocation.width, gtkToggleButton->allocation.height);
-
Q_ASSERT(gtkToggleButton);
gtkCachedPainter.paintBox( gtkToggleButton, "button", arrowButtonRect, buttonState,
shadow, gtkToggleButton->style, buttonPath.toString() +
@@ -1436,8 +1425,6 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
if (focus)
GTK_WIDGET_UNSET_FLAGS(gtkToggleButton, GTK_HAS_FOCUS);
- QHashableLatin1Literal buttonPath = comboBox->editable ? QHashableLatin1Literal("GtkComboBoxEntry.GtkToggleButton")
- : QHashableLatin1Literal("GtkComboBox.GtkToggleButton");
// Draw the separator between label and arrows
QHashableLatin1Literal vSeparatorPath = comboBox->editable
@@ -1643,6 +1630,7 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
style = scrollbarWidget->style;
gboolean trough_under_steppers = true;
gboolean trough_side_details = false;
+ gboolean activate_slider = false;
gboolean stepper_size = 14;
gint trough_border = 1;
if (!d->gtk_check_version(2, 10, 0)) {
@@ -1650,6 +1638,7 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
"trough-border", &trough_border,
"trough-side-details", &trough_side_details,
"trough-under-steppers", &trough_under_steppers,
+ "activate-slider", &activate_slider,
"stepper-size", &stepper_size, NULL);
}
if (trough_under_steppers) {
@@ -1695,6 +1684,9 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
if (!(option->state & State_Enabled))
state = GTK_STATE_INSENSITIVE;
+ else if (activate_slider &&
+ option->state & State_Sunken && (scrollBar->activeSubControls & SC_ScrollBarSlider))
+ state = GTK_STATE_ACTIVE;
else if (option->state & State_MouseOver && (scrollBar->activeSubControls & SC_ScrollBarSlider))
state = GTK_STATE_PRELIGHT;
@@ -1932,14 +1924,11 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
QRect groove = proxy()->subControlRect(CC_Slider, option, SC_SliderGroove, widget);
QRect handle = proxy()->subControlRect(CC_Slider, option, SC_SliderHandle, widget);
- QRect ticks = proxy()->subControlRect(CC_Slider, option, SC_SliderTickmarks, widget);
bool horizontal = slider->orientation == Qt::Horizontal;
bool ticksAbove = slider->tickPosition & QSlider::TicksAbove;
bool ticksBelow = slider->tickPosition & QSlider::TicksBelow;
- QColor activeHighlight = option->palette.color(QPalette::Normal, QPalette::Highlight);
- QPixmap cache;
QBrush oldBrush = painter->brush();
QPen oldPen = painter->pen();
@@ -1948,6 +1937,8 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
QColor highlightAlpha(Qt::white);
highlightAlpha.setAlpha(80);
+ QGtkStylePrivate::gtk_widget_set_direction(hScaleWidget, slider->upsideDown ?
+ GTK_TEXT_DIR_RTL : GTK_TEXT_DIR_LTR);
GtkWidget *scaleWidget = horizontal ? hScaleWidget : vScaleWidget;
style = scaleWidget->style;
@@ -1981,11 +1972,21 @@ void QGtkStyle::drawComplexControl(ComplexControl control, const QStyleOptionCom
QRect lowerGroove = grooveRect;
if (horizontal) {
- upperGroove.setLeft(handle.center().x());
- lowerGroove.setRight(handle.center().x());
+ if (slider->upsideDown) {
+ lowerGroove.setLeft(handle.center().x());
+ upperGroove.setRight(handle.center().x());
+ } else {
+ upperGroove.setLeft(handle.center().x());
+ lowerGroove.setRight(handle.center().x());
+ }
} else {
- upperGroove.setBottom(handle.center().y());
- lowerGroove.setTop(handle.center().y());
+ if (!slider->upsideDown) {
+ lowerGroove.setBottom(handle.center().y());
+ upperGroove.setTop(handle.center().y());
+ } else {
+ upperGroove.setBottom(handle.center().y());
+ lowerGroove.setTop(handle.center().y());
+ }
}
gtkPainter.paintBox( scaleWidget, "trough-upper", upperGroove, state,
@@ -2543,7 +2544,6 @@ void QGtkStyle::drawControl(ControlElement element,
d->gtkWidget("GtkMenu.GtkMenuItem");
style = gtkPainter.getStyle(gtkMenuItem);
- QColor borderColor = option->palette.background().color().darker(160);
QColor shadow = option->palette.dark().color();
if (menuItem->menuItemType == QStyleOptionMenuItem::Separator) {
@@ -2768,8 +2768,6 @@ void QGtkStyle::drawControl(ControlElement element,
// Arrow
if (menuItem->menuItemType == QStyleOptionMenuItem::SubMenu) {// draw sub menu arrow
- QPoint buttonShift(pixelMetric(PM_ButtonShiftHorizontal, option, widget),
- proxy()->pixelMetric(PM_ButtonShiftVertical, option, widget));
QFontMetrics fm(menuitem->font);
int arrow_size = fm.ascent() + fm.descent() - 2 * gtkMenuItem->style->ythickness;
@@ -3116,7 +3114,6 @@ QRect QGtkStyle::subControlRect(ComplexControl control, const QStyleOptionComple
case CC_ComboBox:
if (const QStyleOptionComboBox *box = qstyleoption_cast<const QStyleOptionComboBox *>(option)) {
// We employ the gtk widget to position arrows and separators for us
- QString comboBoxPath = box->editable ? QLS("GtkComboBoxEntry") : QLS("GtkComboBox");
GtkWidget *gtkCombo = box->editable ? d->gtkWidget("GtkComboBoxEntry")
: d->gtkWidget("GtkComboBox");
d->gtk_widget_set_direction(gtkCombo, (option->direction == Qt::RightToLeft) ? GTK_TEXT_DIR_RTL : GTK_TEXT_DIR_LTR);
diff --git a/src/gui/util/qcompleter.cpp b/src/gui/util/qcompleter.cpp
index 8e7ec80..05fe744 100644
--- a/src/gui/util/qcompleter.cpp
+++ b/src/gui/util/qcompleter.cpp
@@ -873,7 +873,7 @@ void QCompleterPrivate::showPopup(const QRect& rect)
const QRect screen = QApplication::desktop()->availableGeometry(widget);
Qt::LayoutDirection dir = widget->layoutDirection();
QPoint pos;
- int rw, rh, w;
+ int rh, w;
int h = (popup->sizeHintForRow(0) * qMin(maxVisibleItems, popup->model()->rowCount()) + 3) + 3;
QScrollBar *hsb = popup->horizontalScrollBar();
if (hsb && hsb->isVisible())
@@ -881,21 +881,30 @@ void QCompleterPrivate::showPopup(const QRect& rect)
if (rect.isValid()) {
rh = rect.height();
- w = rw = rect.width();
+ w = rect.width();
pos = widget->mapToGlobal(dir == Qt::RightToLeft ? rect.bottomRight() : rect.bottomLeft());
} else {
rh = widget->height();
- rw = widget->width();
pos = widget->mapToGlobal(QPoint(0, widget->height() - 2));
w = widget->width();
}
- if ((pos.x() + rw) > (screen.x() + screen.width()))
+ if (w > screen.width())
+ w = screen.width();
+ if ((pos.x() + w) > (screen.x() + screen.width()))
pos.setX(screen.x() + screen.width() - w);
if (pos.x() < screen.x())
pos.setX(screen.x());
- if (((pos.y() + rh) > (screen.y() + screen.height())) && ((pos.y() - h - rh) >= 0))
- pos.setY(pos.y() - qMax(h, popup->minimumHeight()) - rh + 2);
+
+ int top = pos.y() - rh - screen.top() + 2;
+ int bottom = screen.bottom() - pos.y();
+ h = qMax(h, popup->minimumHeight());
+ if (h > bottom) {
+ h = qMin(qMax(top, bottom), h);
+
+ if (top > bottom)
+ pos.setY(pos.y() - h - rh + 2);
+ }
popup->setGeometry(pos.x(), pos.y(), w, h);
diff --git a/src/gui/util/qsystemtrayicon_mac.mm b/src/gui/util/qsystemtrayicon_mac.mm
index d943c8c..8aaaa0f 100644
--- a/src/gui/util/qsystemtrayicon_mac.mm
+++ b/src/gui/util/qsystemtrayicon_mac.mm
@@ -75,8 +75,6 @@
#define QT_MAC_SYSTEMTRAY_USE_GROWL
-@class QNSMenu;
-
#include <private/qt_cocoa_helpers_mac_p.h>
#include <private/qsystemtrayicon_p.h>
#include <qtemporaryfile.h>
@@ -98,13 +96,14 @@ QT_END_NAMESPACE
QT_USE_NAMESPACE
-@class QNSImageView;
+@class QT_MANGLE_NAMESPACE(QNSMenu);
+@class QT_MANGLE_NAMESPACE(QNSImageView);
-@interface QNSStatusItem : NSObject {
+@interface QT_MANGLE_NAMESPACE(QNSStatusItem) : NSObject {
NSStatusItem *item;
QSystemTrayIcon *icon;
QSystemTrayIconPrivate *iconPrivate;
- QNSImageView *imageCell;
+ QT_MANGLE_NAMESPACE(QNSImageView) *imageCell;
}
-(id)initWithIcon:(QSystemTrayIcon*)icon iconPrivate:(QSystemTrayIconPrivate *)iprivate;
-(void)dealloc;
@@ -115,11 +114,11 @@ QT_USE_NAMESPACE
- (void)doubleClickSelector:(id)sender;
@end
-@interface QNSImageView : NSImageView {
+@interface QT_MANGLE_NAMESPACE(QNSImageView) : NSImageView {
BOOL down;
- QNSStatusItem *parent;
+ QT_MANGLE_NAMESPACE(QNSStatusItem) *parent;
}
--(id)initWithParent:(QNSStatusItem*)myParent;
+-(id)initWithParent:(QT_MANGLE_NAMESPACE(QNSStatusItem)*)myParent;
-(QSystemTrayIcon*)icon;
-(void)menuTrackingDone:(NSNotification*)notification;
-(void)mousePressed:(NSEvent *)mouseEvent button:(Qt::MouseButton)mouseButton;
@@ -134,7 +133,7 @@ QT_USE_NAMESPACE
#endif
-@interface QNSMenu : NSMenu <NSMenuDelegate> {
+@interface QT_MANGLE_NAMESPACE(QNSMenu) : NSMenu <NSMenuDelegate> {
QMenu *qmenu;
}
-(QMenu*)menu;
@@ -148,14 +147,14 @@ class QSystemTrayIconSys
public:
QSystemTrayIconSys(QSystemTrayIcon *icon, QSystemTrayIconPrivate *d) {
QMacCocoaAutoReleasePool pool;
- item = [[QNSStatusItem alloc] initWithIcon:icon iconPrivate:d];
+ item = [[QT_MANGLE_NAMESPACE(QNSStatusItem) alloc] initWithIcon:icon iconPrivate:d];
}
~QSystemTrayIconSys() {
QMacCocoaAutoReleasePool pool;
[[[item item] view] setHidden: YES];
[item release];
}
- QNSStatusItem *item;
+ QT_MANGLE_NAMESPACE(QNSStatusItem) *item;
};
void QSystemTrayIconPrivate::install_sys()
@@ -299,8 +298,8 @@ QT_END_NAMESPACE
@implementation NSStatusItem (Qt)
@end
-@implementation QNSImageView
--(id)initWithParent:(QNSStatusItem*)myParent {
+@implementation QT_MANGLE_NAMESPACE(QNSImageView)
+-(id)initWithParent:(QT_MANGLE_NAMESPACE(QNSStatusItem)*)myParent {
self = [super init];
parent = myParent;
down = NO;
@@ -400,7 +399,7 @@ QT_END_NAMESPACE
}
@end
-@implementation QNSStatusItem
+@implementation QT_MANGLE_NAMESPACE(QNSStatusItem)
-(id)initWithIcon:(QSystemTrayIcon*)i iconPrivate:(QSystemTrayIconPrivate *)iPrivate
{
@@ -409,7 +408,7 @@ QT_END_NAMESPACE
icon = i;
iconPrivate = iPrivate;
item = [[[NSStatusBar systemStatusBar] statusItemWithLength:NSSquareStatusItemLength] retain];
- imageCell = [[QNSImageView alloc] initWithParent:self];
+ imageCell = [[QT_MANGLE_NAMESPACE(QNSImageView) alloc] initWithParent:self];
[item setView: imageCell];
}
return self;
@@ -453,7 +452,7 @@ QT_END_NAMESPACE
[[[self item] view] removeAllToolTips];
iconPrivate->updateToolTip_sys();
#endif
- NSMenu *m = [[QNSMenu alloc] initWithQMenu:icon->contextMenu()];
+ NSMenu *m = [[QT_MANGLE_NAMESPACE(QNSMenu) alloc] initWithQMenu:icon->contextMenu()];
[m setAutoenablesItems: NO];
[[NSNotificationCenter defaultCenter] addObserver:imageCell
selector:@selector(menuTrackingDone:)
@@ -481,7 +480,7 @@ private:
QSystemTrayIconQMenu();
};
-@implementation QNSMenu
+@implementation QT_MANGLE_NAMESPACE(QNSMenu)
-(id)initWithQMenu:(QMenu*)qm {
self = [super init];
if(self) {
@@ -494,7 +493,7 @@ private:
return qmenu;
}
-(void)menuNeedsUpdate:(NSMenu*)nsmenu {
- QNSMenu *menu = static_cast<QNSMenu *>(nsmenu);
+ QT_MANGLE_NAMESPACE(QNSMenu) *menu = static_cast<QT_MANGLE_NAMESPACE(QNSMenu) *>(nsmenu);
emit static_cast<QSystemTrayIconQMenu*>(menu->qmenu)->doAboutToShow();
for(int i = [menu numberOfItems]-1; i >= 0; --i)
[menu removeItemAtIndex:i];
@@ -539,7 +538,7 @@ private:
[nsimage release];
}
if(action->menu()) {
- QNSMenu *sub = [[QNSMenu alloc] initWithQMenu:action->menu()];
+ QT_MANGLE_NAMESPACE(QNSMenu) *sub = [[QT_MANGLE_NAMESPACE(QNSMenu) alloc] initWithQMenu:action->menu()];
[item setSubmenu:sub];
} else {
[item setAction:@selector(selectedAction:)];
diff --git a/src/gui/widgets/qcocoatoolbardelegate_mac.mm b/src/gui/widgets/qcocoatoolbardelegate_mac.mm
index b2a0e0c..e68ee7c 100644
--- a/src/gui/widgets/qcocoatoolbardelegate_mac.mm
+++ b/src/gui/widgets/qcocoatoolbardelegate_mac.mm
@@ -58,7 +58,7 @@ QT_FORWARD_DECLARE_CLASS(QMainWindowLayout);
QT_FORWARD_DECLARE_CLASS(QToolBar);
QT_FORWARD_DECLARE_CLASS(QCFString);
-@implementation QCocoaToolBarDelegate
+@implementation QT_MANGLE_NAMESPACE(QCocoaToolBarDelegate)
- (id)initWithMainWindowLayout:(QMainWindowLayout *)layout
{
diff --git a/src/gui/widgets/qcocoatoolbardelegate_mac_p.h b/src/gui/widgets/qcocoatoolbardelegate_mac_p.h
index 8e3d06f..b4af54f 100644
--- a/src/gui/widgets/qcocoatoolbardelegate_mac_p.h
+++ b/src/gui/widgets/qcocoatoolbardelegate_mac_p.h
@@ -61,7 +61,7 @@ QT_END_NAMESPACE
@class NSToolbarItem;
-@interface QCocoaToolBarDelegate : NSObject {
+@interface QT_MANGLE_NAMESPACE(QCocoaToolBarDelegate) : NSObject {
QT_PREPEND_NAMESPACE(QMainWindowLayout) *mainWindowLayout;
NSToolbarItem *toolbarItem;
}
diff --git a/src/gui/widgets/qmainwindowlayout_mac.mm b/src/gui/widgets/qmainwindowlayout_mac.mm
index 9527057..b8cef93 100644
--- a/src/gui/widgets/qmainwindowlayout_mac.mm
+++ b/src/gui/widgets/qmainwindowlayout_mac.mm
@@ -410,7 +410,7 @@ void QMainWindowLayout::insertIntoMacToolbar(QToolBar *before, QToolBar *toolbar
macToolbar = [[NSToolbar alloc] initWithIdentifier:(NSString *)kQMainWindowMacToolbarID];
[macToolbar setDisplayMode:NSToolbarDisplayModeIconOnly];
[macToolbar setSizeMode:NSToolbarSizeModeRegular];
- [macToolbar setDelegate:[[QCocoaToolBarDelegate alloc] initWithMainWindowLayout:this]];
+ [macToolbar setDelegate:[[QT_MANGLE_NAMESPACE(QCocoaToolBarDelegate) alloc] initWithMainWindowLayout:this]];
[window setToolbar:macToolbar];
[macToolbar release];
}
diff --git a/src/network/access/qhttpnetworkconnection.cpp b/src/network/access/qhttpnetworkconnection.cpp
index 559124f..31c64f0 100644
--- a/src/network/access/qhttpnetworkconnection.cpp
+++ b/src/network/access/qhttpnetworkconnection.cpp
@@ -343,9 +343,16 @@ bool QHttpNetworkConnectionPrivate::handleAuthenticateChallenge(QAbstractSocket
copyCredentials(i, auth, isProxy);
QMetaObject::invokeMethod(q, "_q_restartAuthPendingRequests", Qt::QueuedConnection);
}
+ } else if (priv->phase == QAuthenticatorPrivate::Start) {
+ // If the url's authenticator has a 'user' set we will end up here (phase is only set to 'Done' by
+ // parseHttpResponse above if 'user' is empty). So if credentials were supplied with the request,
+ // such as in the case of an XMLHttpRequest, this is our only opportunity to cache them.
+ emit q->cacheCredentials(reply->request(), auth, q);
}
- // changing values in QAuthenticator will reset the 'phase'
- if (priv->phase == QAuthenticatorPrivate::Done) {
+ // - Changing values in QAuthenticator will reset the 'phase'.
+ // - If withCredentials has been set to false (e.g. by QtWebKit for a cross-origin XMLHttpRequest) then
+ // we need to bail out if authentication is required.
+ if (priv->phase == QAuthenticatorPrivate::Done || !reply->request().withCredentials()) {
// authentication is cancelled, send the current contents to the user.
emit channels[i].reply->headerChanged();
emit channels[i].reply->readyRead();
diff --git a/src/network/access/qhttpnetworkconnection_p.h b/src/network/access/qhttpnetworkconnection_p.h
index b5bd300..51666d6 100644
--- a/src/network/access/qhttpnetworkconnection_p.h
+++ b/src/network/access/qhttpnetworkconnection_p.h
@@ -133,6 +133,8 @@ Q_SIGNALS:
#endif
void authenticationRequired(const QHttpNetworkRequest &request, QAuthenticator *authenticator,
const QHttpNetworkConnection *connection = 0);
+ void cacheCredentials(const QHttpNetworkRequest &request, QAuthenticator *authenticator,
+ const QHttpNetworkConnection *connection = 0);
void error(QNetworkReply::NetworkError errorCode, const QString &detail = QString());
private:
diff --git a/src/network/access/qhttpnetworkconnectionchannel.cpp b/src/network/access/qhttpnetworkconnectionchannel.cpp
index 3b7bc9e..d24eb1f 100644
--- a/src/network/access/qhttpnetworkconnectionchannel.cpp
+++ b/src/network/access/qhttpnetworkconnectionchannel.cpp
@@ -173,7 +173,7 @@ bool QHttpNetworkConnectionChannel::sendRequest()
pendingEncrypt = false;
// if the url contains authentication parameters, use the new ones
// both channels will use the new authentication parameters
- if (!request.url().userInfo().isEmpty()) {
+ if (!request.url().userInfo().isEmpty() && request.withCredentials()) {
QUrl url = request.url();
QAuthenticator &auth = authenticator;
if (url.userName() != auth.user()
@@ -187,7 +187,10 @@ bool QHttpNetworkConnectionChannel::sendRequest()
url.setUserInfo(QString());
request.setUrl(url);
}
- connection->d_func()->createAuthorization(socket, request);
+ // Will only be false if QtWebKit is performing a cross-origin XMLHttpRequest
+ // and withCredentials has not been set to true.
+ if (request.withCredentials())
+ connection->d_func()->createAuthorization(socket, request);
#ifndef QT_NO_NETWORKPROXY
QByteArray header = QHttpNetworkRequestPrivate::header(request,
(connection->d_func()->networkProxy.type() != QNetworkProxy::NoProxy));
diff --git a/src/network/access/qhttpnetworkrequest.cpp b/src/network/access/qhttpnetworkrequest.cpp
index 9eb2399..639025e 100644
--- a/src/network/access/qhttpnetworkrequest.cpp
+++ b/src/network/access/qhttpnetworkrequest.cpp
@@ -49,7 +49,7 @@ QT_BEGIN_NAMESPACE
QHttpNetworkRequestPrivate::QHttpNetworkRequestPrivate(QHttpNetworkRequest::Operation op,
QHttpNetworkRequest::Priority pri, const QUrl &newUrl)
: QHttpNetworkHeaderPrivate(newUrl), operation(op), priority(pri), uploadByteDevice(0),
- autoDecompress(false), pipeliningAllowed(false)
+ autoDecompress(false), pipeliningAllowed(false), withCredentials(true)
{
}
@@ -62,6 +62,7 @@ QHttpNetworkRequestPrivate::QHttpNetworkRequestPrivate(const QHttpNetworkRequest
autoDecompress = other.autoDecompress;
pipeliningAllowed = other.pipeliningAllowed;
customVerb = other.customVerb;
+ withCredentials = other.withCredentials;
}
QHttpNetworkRequestPrivate::~QHttpNetworkRequestPrivate()
@@ -274,6 +275,16 @@ void QHttpNetworkRequest::setPipeliningAllowed(bool b)
d->pipeliningAllowed = b;
}
+bool QHttpNetworkRequest::withCredentials() const
+{
+ return d->withCredentials;
+}
+
+void QHttpNetworkRequest::setWithCredentials(bool b)
+{
+ d->withCredentials = b;
+}
+
void QHttpNetworkRequest::setUploadByteDevice(QNonContiguousByteDevice *bd)
{
d->uploadByteDevice = bd;
diff --git a/src/network/access/qhttpnetworkrequest_p.h b/src/network/access/qhttpnetworkrequest_p.h
index 1b35a84..15cab73 100644
--- a/src/network/access/qhttpnetworkrequest_p.h
+++ b/src/network/access/qhttpnetworkrequest_p.h
@@ -113,6 +113,9 @@ public:
bool isPipeliningAllowed() const;
void setPipeliningAllowed(bool b);
+ bool withCredentials() const;
+ void setWithCredentials(bool b);
+
void setUploadByteDevice(QNonContiguousByteDevice *bd);
QNonContiguousByteDevice* uploadByteDevice() const;
@@ -142,6 +145,7 @@ public:
mutable QNonContiguousByteDevice* uploadByteDevice;
bool autoDecompress;
bool pipeliningAllowed;
+ bool withCredentials;
};
diff --git a/src/network/access/qnetworkaccessbackend.cpp b/src/network/access/qnetworkaccessbackend.cpp
index f188bd5..2a02c99 100644
--- a/src/network/access/qnetworkaccessbackend.cpp
+++ b/src/network/access/qnetworkaccessbackend.cpp
@@ -327,6 +327,11 @@ void QNetworkAccessBackend::authenticationRequired(QAuthenticator *authenticator
manager->authenticationRequired(this, authenticator);
}
+void QNetworkAccessBackend::cacheCredentials(QAuthenticator *authenticator)
+{
+ manager->addCredentials(this->reply->url, authenticator);
+}
+
void QNetworkAccessBackend::metaDataChanged()
{
reply->metaDataChanged();
diff --git a/src/network/access/qnetworkaccessbackend_p.h b/src/network/access/qnetworkaccessbackend_p.h
index 4ce37a6..4fe6de6 100644
--- a/src/network/access/qnetworkaccessbackend_p.h
+++ b/src/network/access/qnetworkaccessbackend_p.h
@@ -188,6 +188,7 @@ protected slots:
void proxyAuthenticationRequired(const QNetworkProxy &proxy, QAuthenticator *auth);
#endif
void authenticationRequired(QAuthenticator *auth);
+ void cacheCredentials(QAuthenticator *auth);
void metaDataChanged();
void redirectionRequested(const QUrl &destination);
void sslErrors(const QList<QSslError> &errors);
diff --git a/src/network/access/qnetworkaccesshttpbackend.cpp b/src/network/access/qnetworkaccesshttpbackend.cpp
index 3154ed6..a6c5c02 100644
--- a/src/network/access/qnetworkaccesshttpbackend.cpp
+++ b/src/network/access/qnetworkaccesshttpbackend.cpp
@@ -346,6 +346,8 @@ void QNetworkAccessHttpBackend::setupConnection()
#endif
connect(http, SIGNAL(authenticationRequired(QHttpNetworkRequest,QAuthenticator*)),
SLOT(httpAuthenticationRequired(QHttpNetworkRequest,QAuthenticator*)));
+ connect(http, SIGNAL(cacheCredentials(QHttpNetworkRequest,QAuthenticator*)),
+ SLOT(httpCacheCredentials(QHttpNetworkRequest,QAuthenticator*)));
connect(http, SIGNAL(error(QNetworkReply::NetworkError,QString)),
SLOT(httpError(QNetworkReply::NetworkError,QString)));
#ifndef QT_NO_OPENSSL
@@ -578,6 +580,11 @@ void QNetworkAccessHttpBackend::postRequest()
if (request().attribute(QNetworkRequest::HttpPipeliningAllowedAttribute).toBool() == true)
httpRequest.setPipeliningAllowed(true);
+ if (static_cast<QNetworkRequest::LoadControl>
+ (request().attribute(QNetworkRequest::AuthenticationReuseAttribute,
+ QNetworkRequest::Automatic).toInt()) == QNetworkRequest::Manual)
+ httpRequest.setWithCredentials(false);
+
httpReply = http->sendRequest(httpRequest);
httpReply->setParent(this);
#ifndef QT_NO_OPENSSL
@@ -861,6 +868,12 @@ void QNetworkAccessHttpBackend::httpAuthenticationRequired(const QHttpNetworkReq
authenticationRequired(auth);
}
+void QNetworkAccessHttpBackend::httpCacheCredentials(const QHttpNetworkRequest &,
+ QAuthenticator *auth)
+{
+ cacheCredentials(auth);
+}
+
void QNetworkAccessHttpBackend::httpError(QNetworkReply::NetworkError errorCode,
const QString &errorString)
{
diff --git a/src/network/access/qnetworkaccesshttpbackend_p.h b/src/network/access/qnetworkaccesshttpbackend_p.h
index e5cc0ab..254907f 100644
--- a/src/network/access/qnetworkaccesshttpbackend_p.h
+++ b/src/network/access/qnetworkaccesshttpbackend_p.h
@@ -107,6 +107,7 @@ private slots:
void replyFinished();
void replyHeaderChanged();
void httpAuthenticationRequired(const QHttpNetworkRequest &request, QAuthenticator *auth);
+ void httpCacheCredentials(const QHttpNetworkRequest &request, QAuthenticator *auth);
void httpError(QNetworkReply::NetworkError error, const QString &errorString);
bool sendCacheContents(const QNetworkCacheMetaData &metaData);
void finished(); // override
diff --git a/src/network/access/qnetworkaccessmanager.cpp b/src/network/access/qnetworkaccessmanager.cpp
index feb9d99..1c7661d 100644
--- a/src/network/access/qnetworkaccessmanager.cpp
+++ b/src/network/access/qnetworkaccessmanager.cpp
@@ -948,10 +948,15 @@ QNetworkReply *QNetworkAccessManager::createRequest(QNetworkAccessManager::Opera
// but the data that is outgoing is random-access
request.setHeader(QNetworkRequest::ContentLengthHeader, outgoingData->size());
}
- if (d->cookieJar) {
- QList<QNetworkCookie> cookies = d->cookieJar->cookiesForUrl(request.url());
- if (!cookies.isEmpty())
- request.setHeader(QNetworkRequest::CookieHeader, qVariantFromValue(cookies));
+
+ if (static_cast<QNetworkRequest::LoadControl>
+ (request.attribute(QNetworkRequest::CookieLoadControlAttribute,
+ QNetworkRequest::Automatic).toInt()) == QNetworkRequest::Automatic) {
+ if (d->cookieJar) {
+ QList<QNetworkCookie> cookies = d->cookieJar->cookiesForUrl(request.url());
+ if (!cookies.isEmpty())
+ request.setHeader(QNetworkRequest::CookieHeader, qVariantFromValue(cookies));
+ }
}
// first step: create the reply
@@ -967,11 +972,15 @@ QNetworkReply *QNetworkAccessManager::createRequest(QNetworkAccessManager::Opera
priv->manager = this;
// second step: fetch cached credentials
- QNetworkAuthenticationCredential *cred = d->fetchCachedCredentials(url);
- if (cred) {
- url.setUserName(cred->user);
- url.setPassword(cred->password);
- priv->urlForLastAuthentication = url;
+ if (static_cast<QNetworkRequest::LoadControl>
+ (request.attribute(QNetworkRequest::AuthenticationReuseAttribute,
+ QNetworkRequest::Automatic).toInt()) == QNetworkRequest::Automatic) {
+ QNetworkAuthenticationCredential *cred = d->fetchCachedCredentials(url);
+ if (cred) {
+ url.setUserName(cred->user);
+ url.setPassword(cred->password);
+ priv->urlForLastAuthentication = url;
+ }
}
// third step: find a backend
diff --git a/src/network/access/qnetworkreplyimpl.cpp b/src/network/access/qnetworkreplyimpl.cpp
index 128d18f..31ee2a4 100644
--- a/src/network/access/qnetworkreplyimpl.cpp
+++ b/src/network/access/qnetworkreplyimpl.cpp
@@ -673,8 +673,12 @@ void QNetworkReplyImplPrivate::error(QNetworkReplyImpl::NetworkError code, const
void QNetworkReplyImplPrivate::metaDataChanged()
{
Q_Q(QNetworkReplyImpl);
- // do we have cookies?
- if (cookedHeaders.contains(QNetworkRequest::SetCookieHeader) && !manager.isNull()) {
+ // 1. do we have cookies?
+ // 2. are we allowed to set them?
+ if (cookedHeaders.contains(QNetworkRequest::SetCookieHeader) && !manager.isNull()
+ && (static_cast<QNetworkRequest::LoadControl>
+ (request.attribute(QNetworkRequest::CookieSaveControlAttribute,
+ QNetworkRequest::Automatic).toInt()) == QNetworkRequest::Automatic)) {
QList<QNetworkCookie> cookies =
qvariant_cast<QList<QNetworkCookie> >(cookedHeaders.value(QNetworkRequest::SetCookieHeader));
QNetworkCookieJar *jar = manager->cookieJar();
diff --git a/src/network/access/qnetworkrequest.cpp b/src/network/access/qnetworkrequest.cpp
index 61c116d..911eadc 100644
--- a/src/network/access/qnetworkrequest.cpp
+++ b/src/network/access/qnetworkrequest.cpp
@@ -190,6 +190,46 @@ QT_BEGIN_NAMESPACE
of other verbs than GET, POST, PUT and DELETE). This verb is set
when calling QNetworkAccessManager::sendCustomRequest().
+ \value CookieLoadControlAttribute
+ Requests only, type: QVariant::Int (default: QNetworkRequest::Automatic)
+ Indicates whether to send 'Cookie' headers in the request.
+
+ This attribute is set to false by QtWebKit when creating a cross-origin
+ XMLHttpRequest where withCredentials has not been set explicitly to true by the
+ Javascript that created the request.
+
+ See http://www.w3.org/TR/XMLHttpRequest2/#credentials-flag for more information.
+
+ \since 4.7
+
+ \value CookieSaveControlAttribute
+ Requests only, type: QVariant::Int (default: QNetworkRequest::Automatic)
+ Indicates whether to save 'Cookie' headers received from the server in reply
+ to the request.
+
+ This attribute is set to false by QtWebKit when creating a cross-origin
+ XMLHttpRequest where withCredentials has not been set explicitly to true by the
+ Javascript that created the request.
+
+ See http://www.w3.org/TR/XMLHttpRequest2/#credentials-flag for more information.
+
+ \since 4.7
+
+ \value AuthenticationReuseControlAttribute
+ Requests only, type: QVariant::Int (default: QNetworkRequest::Automatic)
+ Indicates whether to use cached authorization credentials in the request,
+ if available. If this is set to QNetworkRequest::Manual and the authentication
+ mechanism is 'Basic' or 'Digest', Qt will not send an an 'Authorization' HTTP
+ header with any cached credentials it may have for the request's URL.
+
+ This attribute is set to QNetworkRequest::Manual by QtWebKit when creating a cross-origin
+ XMLHttpRequest where withCredentials has not been set explicitly to true by the
+ Javascript that created the request.
+
+ See http://www.w3.org/TR/XMLHttpRequest2/#credentials-flag for more information.
+
+ \since 4.7
+
\value User
Special type. Additional information can be passed in
QVariants with types ranging from User to UserMax. The default
@@ -222,6 +262,18 @@ QT_BEGIN_NAMESPACE
if the item was not cached (i.e., off-line mode)
*/
+/*!
+ \enum QNetworkRequest::LoadControl
+ \since 4.7
+
+ Indicates if an aspect of the request's loading mechanism has been
+ manually overridden, e.g. by QtWebKit.
+
+ \value Automatic default value: indicates default behaviour.
+
+ \value Manual indicates behaviour has been manually overridden.
+*/
+
class QNetworkRequestPrivate: public QSharedData, public QNetworkHeadersPrivate
{
public:
diff --git a/src/network/access/qnetworkrequest.h b/src/network/access/qnetworkrequest.h
index a0ef1a6..d2945c4 100644
--- a/src/network/access/qnetworkrequest.h
+++ b/src/network/access/qnetworkrequest.h
@@ -79,6 +79,9 @@ public:
HttpPipeliningAllowedAttribute,
HttpPipeliningWasUsedAttribute,
CustomVerbAttribute,
+ CookieLoadControlAttribute,
+ AuthenticationReuseAttribute,
+ CookieSaveControlAttribute,
User = 1000,
UserMax = 32767
@@ -89,6 +92,10 @@ public:
PreferCache,
AlwaysCache
};
+ enum LoadControl {
+ Automatic = 0,
+ Manual
+ };
enum Priority {
HighPriority = 1,
diff --git a/src/network/kernel/qhostinfo.cpp b/src/network/kernel/qhostinfo.cpp
index f287630..28a6c84 100644
--- a/src/network/kernel/qhostinfo.cpp
+++ b/src/network/kernel/qhostinfo.cpp
@@ -471,6 +471,18 @@ void QHostInfoRunnable::run()
hostInfo.setLookupId(id);
resultEmitter.emitResultsReady(hostInfo);
+ // now also iterate through the postponed ones
+ QMutableListIterator<QHostInfoRunnable*> iterator(manager->postponedLookups);
+ while (iterator.hasNext()) {
+ QHostInfoRunnable* postponed = iterator.next();
+ if (toBeLookedUp == postponed->toBeLookedUp) {
+ // we can now emit
+ iterator.remove();
+ hostInfo.setLookupId(postponed->id);
+ postponed->resultEmitter.emitResultsReady(hostInfo);
+ }
+ }
+
manager->lookupFinished(this);
// thread goes back to QThreadPool
@@ -596,6 +608,23 @@ void QHostInfoLookupManager::abortLookup(int id)
return;
QMutexLocker locker(&this->mutex);
+
+ // is postponed? delete and return
+ for (int i = 0; i < postponedLookups.length(); i++) {
+ if (postponedLookups.at(i)->id == id) {
+ delete postponedLookups.takeAt(i);
+ return;
+ }
+ }
+
+ // is scheduled? delete and return
+ for (int i = 0; i < scheduledLookups.length(); i++) {
+ if (scheduledLookups.at(i)->id == id) {
+ delete scheduledLookups.takeAt(i);
+ return;
+ }
+ }
+
if (!abortedLookups.contains(id))
abortedLookups.append(id);
}
diff --git a/src/network/kernel/qhostinfo_p.h b/src/network/kernel/qhostinfo_p.h
index e11766b..85d14c2 100644
--- a/src/network/kernel/qhostinfo_p.h
+++ b/src/network/kernel/qhostinfo_p.h
@@ -84,7 +84,7 @@ public Q_SLOTS:
}
Q_SIGNALS:
- void resultsReady(const QHostInfo info);
+ void resultsReady(const QHostInfo &info);
};
// needs to be QObject because fromName calls tr()
@@ -173,6 +173,8 @@ public:
bool wasAborted(int id);
QHostInfoCache cache;
+
+ friend class QHostInfoRunnable;
protected:
QList<QHostInfoRunnable*> currentLookups; // in progress
QList<QHostInfoRunnable*> postponedLookups; // postponed because in progress for same host
diff --git a/src/network/socket/qtcpserver.cpp b/src/network/socket/qtcpserver.cpp
index 932126d..55f926d 100644
--- a/src/network/socket/qtcpserver.cpp
+++ b/src/network/socket/qtcpserver.cpp
@@ -562,7 +562,7 @@ QTcpSocket *QTcpServer::nextPendingConnection()
to the other thread and create the QTcpSocket object there and
use its setSocketDescriptor() method.
- \sa newConnection(), nextPendingConnection()
+ \sa newConnection(), nextPendingConnection(), addPendingConnection()
*/
void QTcpServer::incomingConnection(int socketDescriptor)
{
@@ -572,6 +572,22 @@ void QTcpServer::incomingConnection(int socketDescriptor)
QTcpSocket *socket = new QTcpSocket(this);
socket->setSocketDescriptor(socketDescriptor);
+ addPendingConnection(socket);
+}
+
+/*!
+ This function is called by QTcpServer::incomingConnection()
+ to add a socket to the list of pending incoming connections.
+
+ \note Don't forget to call this member from reimplemented
+ incomingConnection() if you do not want to break the
+ Pending Connections mechanism.
+
+ \sa incomingConnection()
+ \since 4.7
+*/
+void QTcpServer::addPendingConnection(QTcpSocket* socket)
+{
d_func()->pendingConnections.append(socket);
}
diff --git a/src/network/socket/qtcpserver.h b/src/network/socket/qtcpserver.h
index 7aebffe..b206678 100644
--- a/src/network/socket/qtcpserver.h
+++ b/src/network/socket/qtcpserver.h
@@ -93,6 +93,7 @@ public:
protected:
virtual void incomingConnection(int handle);
+ void addPendingConnection(QTcpSocket* socket);
Q_SIGNALS:
void newConnection();
diff --git a/tests/auto/gestures/tst_gestures.cpp b/tests/auto/gestures/tst_gestures.cpp
index f8ecca3..dfadf48 100644
--- a/tests/auto/gestures/tst_gestures.cpp
+++ b/tests/auto/gestures/tst_gestures.cpp
@@ -50,6 +50,7 @@
#include <qgesturerecognizer.h>
#include <qgraphicsitem.h>
#include <qgraphicsview.h>
+#include <qmainwindow.h>
#include <qdebug.h>
@@ -355,6 +356,7 @@ private slots:
void deleteGestureTargetItem();
void viewportCoordinates();
void partialGesturePropagation();
+ void testQGestureRecognizerCleanup();
};
tst_Gestures::tst_Gestures()
@@ -1949,5 +1951,74 @@ void tst_Gestures::partialGesturePropagation()
QCOMPARE(item4->gestureEventsReceived, 0);
}
+class WinNativePan : public QPanGesture {
+public:
+ WinNativePan() {}
+};
+
+class Pan : public QPanGesture {
+public:
+ Pan() {}
+};
+
+class CustomPan : public QPanGesture {
+public:
+ CustomPan() {}
+};
+
+// Recognizer for active gesture triggers on mouse press
+class PanRecognizer : public QGestureRecognizer {
+public:
+ enum PanType { Platform, Default, Custom };
+
+ PanRecognizer(int id) : m_id(id) {}
+ QGesture *create(QObject *) {
+ switch(m_id) {
+ case Platform: return new WinNativePan();
+ case Default: return new Pan();
+ default: return new CustomPan();
+ }
+ }
+
+ Result recognize(QGesture *, QObject *, QEvent *) { return QGestureRecognizer::Ignore; }
+
+ const int m_id;
+};
+
+void tst_Gestures::testQGestureRecognizerCleanup()
+{
+ // Clean first the current recognizers in QGManager
+ QGestureRecognizer::unregisterRecognizer(Qt::PanGesture);
+
+ // v-- Qt singleton QGManager initialization
+
+ // Mimic QGestureManager: register both default and "platform" recognizers
+ // (this is done in windows when QT_NO_NATIVE_GESTURES is not defined)
+ PanRecognizer *def = new PanRecognizer(PanRecognizer::Default);
+ QGestureRecognizer::registerRecognizer(def);
+ PanRecognizer *plt = new PanRecognizer(PanRecognizer::Platform);
+ QGestureRecognizer::registerRecognizer(plt);
+ qDebug () << "register: default =" << def << "; platform =" << plt;
+
+ // ^-- Qt singleton QGManager initialization
+
+ // Here, application code would start
+
+ // Create QGV (has a QAScrollArea, which uses Qt::PanGesture)
+ QMainWindow *w = new QMainWindow;
+ QGraphicsView *v = new QGraphicsView();
+ w->setCentralWidget(v);
+
+ // Unregister Qt recognizers
+ QGestureRecognizer::unregisterRecognizer(Qt::PanGesture);
+
+ // Register a custom Pan recognizer
+ //QGestureRecognizer::registerRecognizer(new PanRecognizer(PanRecognizer::Custom));
+
+ w->show();
+ QTest::qWaitForWindowShown(w);
+ delete w;
+}
+
QTEST_MAIN(tst_Gestures)
#include "tst_gestures.moc"
diff --git a/tests/auto/qdatetime/tst_qdatetime.cpp b/tests/auto/qdatetime/tst_qdatetime.cpp
index 6aca996..47c54a5 100644
--- a/tests/auto/qdatetime/tst_qdatetime.cpp
+++ b/tests/auto/qdatetime/tst_qdatetime.cpp
@@ -106,6 +106,8 @@ private slots:
void daysTo();
void secsTo_data();
void secsTo();
+ void msecsTo_data();
+ void msecsTo();
void operator_eqeq();
void currentDateTime();
void currentDateTimeUtc();
@@ -910,6 +912,30 @@ void tst_QDateTime::secsTo()
QVERIFY((dt >= result) == (0 >= nsecs));
}
+void tst_QDateTime::msecsTo_data()
+{
+ addMSecs_data();
+}
+
+void tst_QDateTime::msecsTo()
+{
+ QFETCH(QDateTime, dt);
+ QFETCH(int, nsecs);
+ QFETCH(QDateTime, result);
+
+#ifdef Q_OS_IRIX
+ QEXPECT_FAIL("cet4", "IRIX databases say 1970 had DST", Abort);
+#endif
+ QCOMPARE(dt.msecsTo(result), qint64(nsecs) * 1000);
+ QCOMPARE(result.msecsTo(dt), -qint64(nsecs) * 1000);
+ QVERIFY((dt == result) == (0 == (qint64(nsecs) * 1000)));
+ QVERIFY((dt != result) == (0 != (qint64(nsecs) * 1000)));
+ QVERIFY((dt < result) == (0 < (qint64(nsecs) * 1000)));
+ QVERIFY((dt <= result) == (0 <= (qint64(nsecs) * 1000)));
+ QVERIFY((dt > result) == (0 > (qint64(nsecs) * 1000)));
+ QVERIFY((dt >= result) == (0 >= (qint64(nsecs) * 1000)));
+}
+
void tst_QDateTime::currentDateTime()
{
#if defined(Q_OS_WINCE)
diff --git a/tests/auto/qfile/largefile/tst_largefile.cpp b/tests/auto/qfile/largefile/tst_largefile.cpp
index 041e5f2..60c5f89 100644
--- a/tests/auto/qfile/largefile/tst_largefile.cpp
+++ b/tests/auto/qfile/largefile/tst_largefile.cpp
@@ -523,6 +523,10 @@ void tst_LargeFile::mapFile()
void tst_LargeFile::mapOffsetOverflow()
{
+#if defined(Q_OS_MAC)
+ QSKIP("mmap'ping beyond EOF may succeed; generate bus error on access", SkipAll);
+#endif
+
// Out-of-range mappings should fail, and not silently clip the offset
for (int i = 50; i < 63; ++i) {
uchar *address = 0;
diff --git a/tests/auto/qnetworkreply/smb-file.txt b/tests/auto/qnetworkreply/smb-file.txt
new file mode 100644
index 0000000..73c3ac2
--- /dev/null
+++ b/tests/auto/qnetworkreply/smb-file.txt
@@ -0,0 +1 @@
+This is 34 bytes. Do not change... \ No newline at end of file
diff --git a/tests/auto/qnetworkreply/tst_qnetworkreply.cpp b/tests/auto/qnetworkreply/tst_qnetworkreply.cpp
index ff79c09..9d942bf 100644
--- a/tests/auto/qnetworkreply/tst_qnetworkreply.cpp
+++ b/tests/auto/qnetworkreply/tst_qnetworkreply.cpp
@@ -522,8 +522,8 @@ public:
active->connectToHost("127.0.0.1", server.serverPort());
#ifndef Q_OS_SYMBIAN
// need more time as working with embedded
- // device and testing from emualtor
- // things tend to get slower
+ // device and testing from emualtor
+ // things tend to get slower
if (!active->waitForConnected(1000))
return false;
@@ -929,7 +929,7 @@ void tst_QNetworkReply::invalidProtocol()
void tst_QNetworkReply::getFromData_data()
{
- QTest::addColumn<QString>("request");
+ QTest::addColumn<QString>("request");
QTest::addColumn<QByteArray>("expected");
QTest::addColumn<QString>("mimeType");
@@ -1025,7 +1025,7 @@ void tst_QNetworkReply::getFromData()
void tst_QNetworkReply::getFromFile()
{
- // create the file:
+ // create the file:
QTemporaryFile file(QDir::currentPath() + "/temp-XXXXXX");
file.setAutoRemove(true);
QVERIFY(file.open());
@@ -1073,11 +1073,14 @@ void tst_QNetworkReply::getFromFileSpecial_data()
QTest::newRow("resource") << ":/resource" << "qrc:/resource";
QTest::newRow("search-path") << "srcdir:/rfc3252.txt" << "srcdir:/rfc3252.txt";
QTest::newRow("bigfile-path") << "srcdir:/bigfile" << "srcdir:/bigfile";
+#ifdef Q_OS_WIN
+ QTest::newRow("smb-path") << "srcdir:/smb-file.txt" << "file://" + QtNetworkSettings::winServerName() + "/testshare/test.pri";
+#endif
}
void tst_QNetworkReply::getFromFileSpecial()
{
- QFETCH(QString, fileName);
+ QFETCH(QString, fileName);
QFETCH(QString, url);
// open the resource so we can find out its size
@@ -1107,7 +1110,7 @@ void tst_QNetworkReply::getFromFtp_data()
void tst_QNetworkReply::getFromFtp()
{
- QFETCH(QString, referenceName);
+ QFETCH(QString, referenceName);
QFETCH(QString, url);
QFile reference(referenceName);
@@ -1136,7 +1139,7 @@ void tst_QNetworkReply::getFromHttp_data()
void tst_QNetworkReply::getFromHttp()
{
- QFETCH(QString, referenceName);
+ QFETCH(QString, referenceName);
QFETCH(QString, url);
QFile reference(referenceName);
@@ -3456,8 +3459,8 @@ void tst_QNetworkReply::downloadProgress_data()
QTest::newRow("big") << 4096;
#else
// it can run even with 4096
- // but it takes lot time
- //especially on emulator
+ // but it takes lot time
+ //especially on emulator
QTest::newRow("big") << 1024;
#endif
}
@@ -3646,7 +3649,7 @@ void tst_QNetworkReply::receiveCookiesFromHttp_data()
void tst_QNetworkReply::receiveCookiesFromHttp()
{
- QFETCH(QString, cookieString);
+ QFETCH(QString, cookieString);
QByteArray data = cookieString.toLatin1() + '\n';
QUrl url("http://" + QtNetworkSettings::serverName() + "/qtest/cgi-bin/set-cookie.cgi");
diff --git a/tests/auto/qprinter/tst_qprinter.cpp b/tests/auto/qprinter/tst_qprinter.cpp
index 49bddb2..8b79533 100644
--- a/tests/auto/qprinter/tst_qprinter.cpp
+++ b/tests/auto/qprinter/tst_qprinter.cpp
@@ -110,6 +110,7 @@ private slots:
void testCurrentPage();
void taskQTBUG4497_reusePrinterOnDifferentFiles();
+ void testPdfTitle();
private:
};
@@ -417,7 +418,7 @@ void tst_QPrinter::testMargins()
printer.setFullPage(fullpage);
printer.setPageSize((QPrinter::PageSize)pagesize);
if (withPainter)
- painter = new QPainter(&printer);
+ painter = new QPainter(&printer);
#ifdef QT3_SUPPORT
Q3PaintDeviceMetrics metrics(&printer);
@@ -1028,5 +1029,30 @@ void tst_QPrinter::testCurrentPage()
}
+void tst_QPrinter::testPdfTitle()
+{
+ // Check the document name is represented correctly in produced pdf
+ {
+ QPainter painter;
+ QPrinter printer;
+ // This string is just the UTF-8 encoding of the string: \()f &oslash; hiragana o
+ const char title[]={0x5c, 0x28, 0x29, 0x66, 0xc3, 0xb8, 0xe3, 0x81, 0x8a, 0x00};
+ printer.setOutputFileName("file.pdf");
+ printer.setDocName(QString::fromUtf8(title));
+ painter.begin(&printer);
+ painter.end();
+ }
+ QFile file("file.pdf");
+ QVERIFY(file.open(QIODevice::ReadOnly));
+ // The we expect the title to appear in the PDF as:
+ // ASCII('\title (') UTF16(\\\(\)f &oslash; hiragana o) ASCII(')').
+ // which has the following binary representation
+ const char expected[] = {
+ 0x2f, 0x54, 0x69, 0x74, 0x6c, 0x65, 0x20, 0x28, 0xfe,
+ 0xff, 0x00, 0x5c, 0x5c, 0x00, 0x5c, 0x28, 0x00, 0x5c,
+ 0x29, 0x00, 0x66, 0x00, 0xf8, 0x30, 0x4a, 0x29};
+ QVERIFY(file.readAll().contains(QByteArray(expected, 26)));
+}
+
QTEST_MAIN(tst_QPrinter)
#include "tst_qprinter.moc"
diff --git a/tests/auto/qxmlquery/tst_qxmlquery.cpp b/tests/auto/qxmlquery/tst_qxmlquery.cpp
index be0d708..6fd9b93 100644
--- a/tests/auto/qxmlquery/tst_qxmlquery.cpp
+++ b/tests/auto/qxmlquery/tst_qxmlquery.cpp
@@ -857,7 +857,7 @@ void tst_QXmlQuery::bindVariableXSLTSuccess() const
stylesheet.bindVariable(QLatin1String("paramSelectWithTypeIntBoundWithBindVariableRequired"),
QVariant(QLatin1String("param5")));
- stylesheet.setQuery(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/parameters.xsl"))));
+ stylesheet.setQuery(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/parameters.xsl"))));
QVERIFY(stylesheet.isValid());
@@ -1798,11 +1798,11 @@ void tst_QXmlQuery::setFocusQUrl() const
{
QXmlQuery query(QXmlQuery::XSLT20);
- const TestURIResolver resolver(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
+ const TestURIResolver resolver(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
query.setUriResolver(&resolver);
QVERIFY(query.setFocus(QUrl(QLatin1String("arbitraryURI"))));
- query.setQuery(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/copyWholeDocument.xsl"))));
+ query.setQuery(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/copyWholeDocument.xsl"))));
QVERIFY(query.isValid());
QBuffer result;
@@ -2997,7 +2997,7 @@ void tst_QXmlQuery::setInitialTemplateNameQXmlName() const
QCOMPARE(query.initialTemplateName(), name);
- query.setQuery(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/namedTemplate.xsl"))));
+ query.setQuery(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/namedTemplate.xsl"))));
QVERIFY(query.isValid());
QBuffer result;
@@ -3059,7 +3059,7 @@ void tst_QXmlQuery::setNetworkAccessManager() const
/* Ensure fn:doc() picks up the right QNetworkAccessManager. */
{
NetworkOverrider networkOverrider(QUrl(QLatin1String("tag:example.com:DOESNOTEXIST")),
- QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/queries/simpleDocument.xml"))));
+ QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/queries/simpleDocument.xml"))));
QXmlQuery query;
query.setNetworkAccessManager(&networkOverrider);
@@ -3075,7 +3075,7 @@ void tst_QXmlQuery::setNetworkAccessManager() const
/* Ensure setQuery() is using the right network manager. */
{
NetworkOverrider networkOverrider(QUrl(QLatin1String("tag:example.com:DOESNOTEXIST")),
- QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/queries/concat.xq"))));
+ QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/queries/concat.xq"))));
QXmlQuery query;
query.setNetworkAccessManager(&networkOverrider);
@@ -3135,7 +3135,7 @@ void tst_QXmlQuery::multipleDocsAndFocus() const
query.setQuery(QLatin1String("string(doc('") +
inputFile(QLatin1String(SRCDIR "../xmlpatterns/queries/simpleDocument.xml")) +
QLatin1String("'))"));
- query.setFocus(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
+ query.setFocus(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
query.setQuery(QLatin1String("string(.)"));
QStringList result;
@@ -3159,11 +3159,11 @@ void tst_QXmlQuery::multipleEvaluationsWithDifferentFocus() const
QXmlQuery query;
QStringList result;
- query.setFocus(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
+ query.setFocus(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
query.setQuery(QLatin1String("string(.)"));
QVERIFY(query.evaluateTo(&result));
- query.setFocus(QUrl(inputFile(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
+ query.setFocus(QUrl(inputFileAsURI(QLatin1String(SRCDIR "../xmlpatterns/stylesheets/documentElement.xml"))));
QVERIFY(query.evaluateTo(&result));
}
diff --git a/tests/auto/xmlpatternsxqts/tst_suitetest.cpp b/tests/auto/xmlpatternsxqts/tst_suitetest.cpp
index 64120c7..ec63858 100644
--- a/tests/auto/xmlpatternsxqts/tst_suitetest.cpp
+++ b/tests/auto/xmlpatternsxqts/tst_suitetest.cpp
@@ -89,10 +89,17 @@ void tst_SuiteTest::runTestSuite() const
TestSuite::SuiteType suiteType;
switch (m_suiteType) {
- case XQuerySuite: suiteType = TestSuite::XQuerySuite;
- case XsltSuite: suiteType = TestSuite::XsltSuite;
- case XsdSuite: suiteType = TestSuite::XsdSuite;
- default: break;
+ case XQuerySuite:
+ suiteType = TestSuite::XQuerySuite;
+ break;
+ case XsltSuite:
+ suiteType = TestSuite::XsltSuite;
+ break;
+ case XsdSuite:
+ suiteType = TestSuite::XsdSuite;
+ break;
+ default:
+ break;
}
TestSuite *const ts = TestSuite::openCatalog(catalogPath, errMsg, true, suiteType);
diff --git a/tools/configure/configureapp.cpp b/tools/configure/configureapp.cpp
index bfa7445..e264426 100644
--- a/tools/configure/configureapp.cpp
+++ b/tools/configure/configureapp.cpp
@@ -2373,7 +2373,7 @@ void Configure::generateBuildKey()
+ buildSymbianKey + "\"\n"
"#else\n"
// Debug builds
- "# if (defined(_DEBUG) || defined(DEBUG))\n"
+ "# if (!QT_NO_DEBUG)\n"
"# if (defined(WIN64) || defined(_WIN64) || defined(__WIN64__))\n"
+ build64Key.arg("debug") + "\"\n"
"# else\n"
@@ -3457,7 +3457,7 @@ void Configure::displayConfig()
cout << "NOTE: When linking against OpenSSL, you can override the default" << endl;
cout << "library names through OPENSSL_LIBS." << endl;
cout << "For example:" << endl;
- cout << " configure -openssl-linked OPENSSL_LIBS='-lssleay32 -llibeay32'" << endl;
+ cout << " configure -openssl-linked OPENSSL_LIBS=\"-lssleay32 -llibeay32\"" << endl;
}
if( dictionary[ "ZLIB_FORCED" ] == "yes" ) {
QString which_zlib = "supplied";
diff --git a/tools/designer/src/designer/qdesigner_actions.cpp b/tools/designer/src/designer/qdesigner_actions.cpp
index a593a76..86b6214 100644
--- a/tools/designer/src/designer/qdesigner_actions.cpp
+++ b/tools/designer/src/designer/qdesigner_actions.cpp
@@ -347,6 +347,7 @@ QDesignerActions::QDesignerActions(QDesignerWorkbench *workbench)
connect(m_editWidgetsAction, SIGNAL(triggered()), this, SLOT(editWidgetsSlot()));
m_editWidgetsAction->setChecked(true);
m_editWidgetsAction->setEnabled(false);
+ m_editWidgetsAction->setProperty(QDesignerActions::defaultToolbarPropertyName, true);
m_toolActions->addAction(m_editWidgetsAction);
connect(formWindowManager, SIGNAL(activeFormWindowChanged(QDesignerFormWindowInterface*)),
diff --git a/tools/qdoc3/htmlgenerator.cpp b/tools/qdoc3/htmlgenerator.cpp
index 6004c74..5495e34 100644
--- a/tools/qdoc3/htmlgenerator.cpp
+++ b/tools/qdoc3/htmlgenerator.cpp
@@ -599,7 +599,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
generateAnnotatedList(relative, marker, nonCompatClasses);
}
else if (atom->string() == "classes") {
- generateCompactList(relative, marker, nonCompatClasses);
+ generateCompactList(relative, marker, nonCompatClasses, true);
}
else if (atom->string().contains("classesbymodule")) {
QString arg = atom->string().trimmed();
@@ -647,10 +647,10 @@ int HtmlGenerator::generateAtom(const Atom *atom,
generateClassHierarchy(relative, marker, nonCompatClasses);
}
else if (atom->string() == "compatclasses") {
- generateCompactList(relative, marker, compatClasses);
+ generateCompactList(relative, marker, compatClasses, false);
}
else if (atom->string() == "obsoleteclasses") {
- generateCompactList(relative, marker, obsoleteClasses);
+ generateCompactList(relative, marker, obsoleteClasses, false);
}
else if (atom->string() == "functionindex") {
generateFunctionIndex(relative, marker);
@@ -659,10 +659,10 @@ int HtmlGenerator::generateAtom(const Atom *atom,
generateLegaleseList(relative, marker);
}
else if (atom->string() == "mainclasses") {
- generateCompactList(relative, marker, mainClasses);
+ generateCompactList(relative, marker, mainClasses, true);
}
else if (atom->string() == "services") {
- generateCompactList(relative, marker, serviceClasses);
+ generateCompactList(relative, marker, serviceClasses, false);
}
else if (atom->string() == "overviews") {
generateOverviewList(relative, marker);
@@ -802,9 +802,9 @@ int HtmlGenerator::generateAtom(const Atom *atom,
<< "\"></a>\n";
out() << "<h3>" << protectEnc((*s).name) << "</h3>\n";
if (idx == Class)
- generateCompactList(0, marker, ncmap.value(), QString("Q"));
+ generateCompactList(0, marker, ncmap.value(), false, QString("Q"));
else if (idx == QmlClass)
- generateCompactList(0, marker, nqcmap.value(), QString("Q"));
+ generateCompactList(0, marker, nqcmap.value(), false, QString("Q"));
else if (idx == MemberFunction) {
ParentMaps parentmaps;
ParentMaps::iterator pmap;
@@ -830,7 +830,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
out() << "</a>" << ":</p>\n";
generateSection(nlist, 0, marker, CodeMarker::Summary);
- out() << "<br />";
+ out() << "<br/>";
++pmap;
}
}
@@ -876,7 +876,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
out() << "</div>";
break;
case Atom::LineBreak:
- out() << "<br />";
+ out() << "<br/>";
break;
case Atom::Link:
{
@@ -912,8 +912,14 @@ int HtmlGenerator::generateAtom(const Atom *atom,
else if (atom->string() == ATOM_LIST_VALUE) {
threeColumnEnumValueTable = isThreeColumnEnumValueTable(atom);
if (threeColumnEnumValueTable) {
- out() << "<table class=\"valuelist\">"
- << "<tr><th>Constant</th>"
+ out() << "<table class=\"valuelist\">";
+ // << "<tr>"
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd\">";
+ else
+ out() << "<tr class=\"even\">";
+
+ out() << "<tr><th>Constant</th>"
<< "<th>Value</th>"
<< "<th>Description</th></tr>\n";
}
@@ -926,7 +932,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
out() << "<ol type=";
if (atom->string() == ATOM_LIST_UPPERALPHA) {
out() << "\"A\"";
- }
+ } /* why type? */
else if (atom->string() == ATOM_LIST_LOWERALPHA) {
out() << "\"a\"";
}
@@ -956,7 +962,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
out() << "<tr><td class=\"topAlign\"><tt>"
<< protectEnc(plainCode(marker->markedUpEnumValue(atom->next()->string(),
relative)))
- << "</tt></td><td class=\"centerAlign topAlign\">";
+ << "</tt></td><td class=\" topAlign\">";
QString itemValue;
if (relative->type() == Node::Enum) {
@@ -1093,13 +1099,13 @@ int HtmlGenerator::generateAtom(const Atom *atom,
}
if (!atom->string().isEmpty()) {
if (atom->string().contains("%"))
- out() << "<table class=\"generic centerAlign\" width=\"" << atom->string() << "\">\n ";
+ out() << "<table class=\"generic\">\n "; // width=\"" << atom->string() << "\">\n ";
else {
- out() << "<table class=\"generic centerAlign\">\n";
+ out() << "<table class=\"generic\">\n";
}
}
else {
- out() << "<table class=\"generic centerAlign\">\n";
+ out() << "<table class=\"generic\">\n";
}
numTableRows = 0;
break;
@@ -1143,7 +1149,10 @@ int HtmlGenerator::generateAtom(const Atom *atom,
out() << " colspan=\"" << spans.at(0) << "\"";
if (spans.at(1) != "1")
out() << " rowspan=\"" << spans.at(1) << "\"";
+ if (inTableHeader)
out() << ">";
+ else
+ out() << "><p>";
}
if (matchAhead(atom, Atom::ParaLeft))
skipAhead = 1;
@@ -1153,7 +1162,7 @@ int HtmlGenerator::generateAtom(const Atom *atom,
if (inTableHeader)
out() << "</th>";
else
- out() << "</td>";
+ out() << "</p></td>";
if (matchAhead(atom, Atom::ParaLeft))
skipAhead = 1;
break;
@@ -1243,6 +1252,8 @@ void HtmlGenerator::generateClassLikeNode(const InnerNode *inner,
subtitleText << "(" << Atom(Atom::AutoLink, fullTitle) << ")"
<< Atom(Atom::LineBreak);
+#if 0
+ // No longer used because the modeule name is a breadcrumb.
QString fixedModule = inner->moduleName();
if (fixedModule == "Qt3SupportLight")
fixedModule = "Qt3Support";
@@ -1263,6 +1274,7 @@ void HtmlGenerator::generateClassLikeNode(const InnerNode *inner,
subtitleText << "]";
}
}
+#endif
generateHeader(title, inner, marker);
sections = marker->sections(inner, CodeMarker::Summary, CodeMarker::Okay);
@@ -1585,7 +1597,7 @@ void HtmlGenerator::generateFakeNode(const FakeNode *fake, CodeMarker *marker)
NodeList::ConstIterator m = (*s).members.begin();
while (m != (*s).members.end()) {
generateDetailedQmlMember(*m, fake, marker);
- out() << "<br />\n";
+ out() << "<br/>\n";
fakeSection.keywords += qMakePair((*m)->name(),
linkForNode(*m,0));
++m;
@@ -1739,6 +1751,9 @@ void HtmlGenerator::generateBreadCrumbs(const QString& title,
}
}
else if (node->subType() == Node::QmlClass) {
+ out() << " <li><a href=\"qdeclarativeelements.html\">QML Elements</a></li>";
+ out() << " <li><a href=\"" << fn->name() << "\">" << title
+ << "</a></li>";
}
else if (node->subType() == Node::Example) {
out() << " <li><a href=\"examples.html\">All Examples</a></li>";
@@ -1788,27 +1803,14 @@ void HtmlGenerator::generateHeader(const QString& title,
//out() << " <title>Qt Reference Documentation</title>";
out() << " <link rel=\"stylesheet\" type=\"text/css\" href=\"style/style.css\" />\n";
- out() << " <!--[if IE]>\n";
- out() << " <meta name=\"MSSmartTagsPreventParsing\" content=\"true\">\n";
- out() << " <meta http-equiv=\"imagetoolbar\" content=\"no\">\n";
- out() << " <![endif]-->\n";
- out() << " <!--[if lt IE 7]>\n";
- out() << " <link rel=\"stylesheet\" type=\"text/css\" href=\"style/style_ie6.css\">\n";
- out() << " <![endif]-->\n";
- out() << " <!--[if IE 7]>\n";
- out() << " <link rel=\"stylesheet\" type=\"text/css\" href=\"style/style_ie7.css\">\n";
- out() << " <![endif]-->\n";
- out() << " <!--[if IE 8]>\n";
- out() << " <link rel=\"stylesheet\" type=\"text/css\" href=\"style/style_ie8.css\">\n";
- out() << " <![endif]-->\n";
out() << " <script src=\"scripts/jquery.js\" type=\"text/javascript\"></script>\n";
out() << " <script src=\"scripts/functions.js\" type=\"text/javascript\"></script>\n";
out() << "</head>\n";
if (offlineDocs)
- out() << "<body class=\"offline\">\n";
+ out() << "<body class=\"offline\" onload=\"CheckEmptyAndLoadList();\">\n";
else
- out() << "<body class=\"\">\n";
+ out() << "<body class=\"\" onload=\"CheckEmptyAndLoadList();\">\n";
#ifdef GENERATE_MAC_REFS
if (mainPage)
@@ -1831,18 +1833,16 @@ void HtmlGenerator::generateTitle(const QString& title,
CodeMarker *marker)
{
if (!title.isEmpty())
- out() << "<h1 class=\"title\">" << protectEnc(title);
+ out() << "<h1 class=\"title\">" << protectEnc(title) << "</h1>\n";
if (!subTitle.isEmpty()) {
- out() << "<br />";
- if (subTitleSize == SmallSubTitle)
- out() << "<span class=\"small-subtitle\">";
+ out() << "<span";
+ if (subTitleSize == SmallSubTitle)
+ out() << " class=\"small-subtitle\">";
else
- out() << "<span class=\"subtitle\">";
+ out() << " class=\"subtitle\">";
generateText(subTitle, relative, marker);
out() << "</span>\n";
}
- if (!title.isEmpty())
- out() << "</h1>\n";
}
void HtmlGenerator::generateFooter(const Node *node)
@@ -1851,9 +1851,10 @@ void HtmlGenerator::generateFooter(const Node *node)
out() << "<p>\n" << navigationLinks << "</p>\n";
out() << QString(footer).replace("\\" + COMMAND_VERSION, myTree->version())
- << QString(address).replace("\\" + COMMAND_VERSION, myTree->version())
- << "</body>\n"
- "</html>\n";
+ << QString(address).replace("\\" + COMMAND_VERSION, myTree->version());
+ out() << " <script src=\"scripts/functions.js\" type=\"text/javascript\"></script>\n";
+ out() << "</body>\n";
+ out() << "</html>\n";
}
void HtmlGenerator::generateBrief(const Node *node, CodeMarker *marker,
@@ -1874,7 +1875,7 @@ void HtmlGenerator::generateBrief(const Node *node, CodeMarker *marker,
void HtmlGenerator::generateIncludes(const InnerNode *inner, CodeMarker *marker)
{
if (!inner->includes().isEmpty()) {
- out() << "<pre clas=\"highlightedCode\">"
+ out() << "<pre class=\"highlightedCode\">"
<< trimmedTrailing(highlightedCode(indent(codeIndent,
marker->markedUpIncludes(inner->includes())),
marker,inner))
@@ -2278,22 +2279,22 @@ void HtmlGenerator::generateAnnotatedList(const Node *relative,
out() << "<tr class=\"odd topAlign\">";
else
out() << "<tr class=\"even topAlign\">";
- out() << "<th>";
+ out() << "<td><p>";
generateFullName(node, relative, marker);
- out() << "</th>";
+ out() << "</p></td>";
if (!(node->type() == Node::Fake)) {
Text brief = node->doc().trimmedBriefText(name);
if (!brief.isEmpty()) {
- out() << "<td>";
+ out() << "<td><p>";
generateText(brief, node, marker);
- out() << "</td>";
+ out() << "</p></td>";
}
}
else {
- out() << "<td>";
+ out() << "<td><p>";
out() << protectEnc(node->doc().briefText().toString());
- out() << "</td>";
+ out() << "</p></td>";
}
out() << "</tr>\n";
}
@@ -2312,10 +2313,11 @@ void HtmlGenerator::generateAnnotatedList(const Node *relative,
void HtmlGenerator::generateCompactList(const Node *relative,
CodeMarker *marker,
const NodeMap &classMap,
+ bool includeAlphabet,
QString commonPrefix)
{
const int NumParagraphs = 37; // '0' to '9', 'A' to 'Z', '_'
- const int NumColumns = 3; // number of columns in the result
+ const int NumColumns = 2; // number of columns in the result
if (classMap.isEmpty())
return;
@@ -2384,6 +2386,7 @@ void HtmlGenerator::generateCompactList(const Node *relative,
*/
NodeMap paragraph[NumParagraphs+1];
QString paragraphName[NumParagraphs+1];
+ QSet<char> usedParagraphNames;
NodeMap::ConstIterator c = classMap.begin();
while (c != classMap.end()) {
@@ -2407,6 +2410,7 @@ void HtmlGenerator::generateCompactList(const Node *relative,
}
paragraphName[paragraphNo] = key[0].toUpper();
+ usedParagraphNames.insert(key[0].toLower().cell());
paragraph[paragraphNo].insert(key, c.value());
++c;
}
@@ -2426,15 +2430,15 @@ void HtmlGenerator::generateCompactList(const Node *relative,
for (j = 0; j < NumParagraphs; j++) // j = 0..36
paragraphOffset[j + 1] = paragraphOffset[j] + paragraph[j].count();
- int firstOffset[NumColumns + 1]; // 4 + 1
- int currentOffset[NumColumns]; // 4
- int currentParagraphNo[NumColumns]; // 4
- int currentOffsetInParagraph[NumColumns]; // 4
+ int firstOffset[NumColumns + 1];
+ int currentOffset[NumColumns];
+ int currentParagraphNo[NumColumns];
+ int currentOffsetInParagraph[NumColumns];
int numRows = (classMap.count() + NumColumns - 1) / NumColumns;
int curParagNo = 0;
- for (i = 0; i < NumColumns; i++) { // i = 0..3
+ for (i = 0; i < NumColumns; i++) {
firstOffset[i] = qMin(i * numRows, classMap.size());
currentOffset[i] = firstOffset[i];
@@ -2450,13 +2454,29 @@ void HtmlGenerator::generateCompactList(const Node *relative,
}
firstOffset[NumColumns] = classMap.count();
+ if (includeAlphabet) {
+ out() << "<p class=\"centerAlign functionIndex\"><b>";
+ for (int i = 0; i < 26; i++) {
+ QChar ch('a' + i);
+ if (usedParagraphNames.contains(char('a' + i)))
+ out() << QString("<a href=\"#%1\">%2</a>&nbsp;").arg(ch).arg(ch.toUpper());
+ }
+ out() << "</b></p>\n";
+ }
+
out() << "<table class=\"generic\">\n";
for (k = 0; k < numRows; k++) {
- out() << "<tr>\n";
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd topAlign\">";
+ else
+ out() << "<tr class=\"even topAlign\">";
+ //break;
+
+// out() << "<tr>\n";
for (i = 0; i < NumColumns; i++) {
if (currentOffset[i] >= firstOffset[i + 1]) {
// this column is finished
- out() << "<td>\n</td>\n";
+ out() << "<td>\n</td>\n"; // check why?
}
else {
while ((currentParagraphNo[i] < NumParagraphs) &&
@@ -2471,16 +2491,20 @@ void HtmlGenerator::generateCompactList(const Node *relative,
currentParagraphNo[i] = NumParagraphs - 1;
}
#endif
- out() << "<td class=\"rightAlign\">";
+ out() << "<th class=\"rightAlign alphaChar\"><p>";
if (currentOffsetInParagraph[i] == 0) {
// start a new paragraph
+ if (includeAlphabet) {
+ QChar c = paragraphName[currentParagraphNo[i]][0].toLower();
+ out() << QString("<a name=\"%1\"></a>").arg(c);
+ }
out() << "<b>"
<< paragraphName[currentParagraphNo[i]]
- << "&nbsp;</b>";
+ << "</b>";
}
- out() << "</td>\n";
+ out() << "</p></th>\n";
- out() << "<td>";
+ out() << "<td><p>";
if ((currentParagraphNo[i] < NumParagraphs) &&
!paragraphName[currentParagraphNo[i]].isEmpty()) {
NodeMap::Iterator it;
@@ -2506,7 +2530,7 @@ void HtmlGenerator::generateCompactList(const Node *relative,
out() << ")";
}
}
- out() << "</td>\n";
+ out() << "</p></td>\n";
currentOffset[i]++;
currentOffsetInParagraph[i]++;
@@ -2646,7 +2670,7 @@ void HtmlGenerator::generateQmlItem(const Node *node,
if (summary)
marked.replace("@name>", "b>");
- marked.replace("<@extra>", "&nbsp;&nbsp;<tt>");
+ marked.replace("<@extra>", "<tt>");
marked.replace("</@extra>", "</tt>");
if (summary) {
@@ -2812,14 +2836,14 @@ void HtmlGenerator::generateSection(const NodeList& nl,
else {
if (twoColumn && i == (int) (nl.count() + 1) / 2)
out() << "</ul></td><td class=\"topAlign\"><ul>\n";
- out() << "<li><div class=\"fn\">";
+ out() << "<li class=\"fn\">";
}
generateSynopsis(*m, relative, marker, style, name_alignment);
if (name_alignment)
out() << "</td></tr>\n";
else
- out() << "</div></li>\n";
+ out() << "</li>\n";
i++;
++m;
}
@@ -2873,14 +2897,14 @@ void HtmlGenerator::generateSectionList(const Section& section,
else {
if (twoColumn && i == (int) (section.members.count() + 1) / 2)
out() << "</ul></td><td class=\"topAlign\"><ul>\n";
- out() << "<li><div class=\"fn\">";
+ out() << "<li class=\"fn\">";
}
generateSynopsis(*m, relative, marker, style, name_alignment);
if (name_alignment)
out() << "</td></tr>\n";
else
- out() << "</div></li>\n";
+ out() << "</li>\n";
i++;
++m;
}
@@ -2908,9 +2932,9 @@ void HtmlGenerator::generateSectionInheritedList(const Section& section,
QList<QPair<ClassNode *, int> >::ConstIterator p = section.inherited.begin();
while (p != section.inherited.end()) {
if (nameAlignment)
- out() << "<li><div bar=\"2\" class=\"fn\"></div>";
+ out() << "<li class=\"fn\">";
else
- out() << "<li><div class=\"fn\"></div>";
+ out() << "<li class=\"fn\">";
out() << (*p).second << " ";
if ((*p).second == 1) {
out() << section.singularMember;
@@ -2955,7 +2979,7 @@ void HtmlGenerator::generateSynopsis(const Node *node,
extraRegExp.setMinimal(true);
marked.replace(extraRegExp, "");
} else {
- marked.replace("<@extra>", "&nbsp;&nbsp;<tt>");
+ marked.replace("<@extra>", "<tt>");
marked.replace("</@extra>", "</tt>");
}
@@ -3151,8 +3175,13 @@ void HtmlGenerator::generateSectionList(const Section& section,
twoColumn = (section.members.count() >= 5);
}
if (twoColumn)
- out() << "<table class=\"generic\">\n"
- << "<tr><td class=\"topAlign\">";
+ out() << "<table class=\"generic\">\n";
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd topAlign\">";
+ else
+ out() << "<tr class=\"even topAlign\">";
+
+// << "<tr><td class=\"topAlign\">";
out() << "<ul>\n";
int i = 0;
@@ -3166,7 +3195,7 @@ void HtmlGenerator::generateSectionList(const Section& section,
if (twoColumn && i == (int) (section.members.count() + 1) / 2)
out() << "</ul></td><td class=\"topAlign\"><ul>\n";
- out() << "<li><div class=\"fn\"></div>";
+ out() << "<li class=\"fn\">";
if (style == CodeMarker::Accessors)
out() << "<b>";
generateSynopsis(*m, relative, marker, style);
@@ -3194,7 +3223,7 @@ void HtmlGenerator::generateSectionInheritedList(const Section& section,
{
QList<QPair<ClassNode *, int> >::ConstIterator p = section.inherited.begin();
while (p != section.inherited.end()) {
- out() << "<li><div bar=\"2\" class=\"fn\"></div>";
+ out() << "<li class=\"fn\">";
out() << (*p).second << " ";
if ((*p).second == 1) {
out() << section.singularMember;
@@ -3234,7 +3263,7 @@ void HtmlGenerator::generateSynopsis(const Node *node,
extraRegExp.setMinimal(true);
marked.replace(extraRegExp, "");
} else {
- marked.replace("<@extra>", "&nbsp;&nbsp;<tt>");
+ marked.replace("<@extra>", "<tt>");
marked.replace("</@extra>", "</tt>");
}
@@ -3764,7 +3793,7 @@ void HtmlGenerator::generateDetailedMember(const Node *node,
out() << "<h3 class=\"flags\">";
out() << "<a name=\"" + refForNode(node) + "\"></a>";
generateSynopsis(enume, relative, marker, CodeMarker::Detailed);
- out() << "<br />";
+ out() << "<br/>";
generateSynopsis(enume->flagsType(),
relative,
marker,
@@ -4359,8 +4388,12 @@ void HtmlGenerator::generateQmlSummary(const Section& section,
twoColumn = (count >= 5);
}
if (twoColumn)
- out() << "<table class=\"qmlsummary\">\n"
- << "<tr><td class=\"topAlign\">";
+ out() << "<table class=\"qmlsummary\">\n";
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd topAlign\">";
+ else
+ out() << "<tr class=\"even topAlign\">";
+ // << "<tr><td class=\"topAlign\">";
out() << "<ul>\n";
int row = 0;
@@ -4368,7 +4401,7 @@ void HtmlGenerator::generateQmlSummary(const Section& section,
while (m != section.members.end()) {
if (twoColumn && row == (int) (count + 1) / 2)
out() << "</ul></td><td class=\"topAlign\"><ul>\n";
- out() << "<li><div class=\"fn\"></div>";
+ out() << "<li class=\"fn\">";
generateQmlItem(*m,relative,marker,true);
out() << "</li>\n";
row++;
@@ -4402,12 +4435,19 @@ void HtmlGenerator::generateDetailedQmlMember(const Node *node,
while (p != qpgn->childNodes().end()) {
if ((*p)->type() == Node::QmlProperty) {
qpn = static_cast<const QmlPropertyNode*>(*p);
- out() << "<tr><td>";
+
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd\">";
+ else
+ out() << "<tr class=\"even\">";
+
+ out() << "<td><p>";
+ //out() << "<tr><td>"; // old
out() << "<a name=\"" + refForNode(qpn) + "\"></a>";
if (!qpn->isWritable())
- out() << "<span class=\"qmlreadonly\">read-only&nbsp;</span>";
+ out() << "<span class=\"qmlreadonly\">read-only</span>";
if (qpgn->isDefault())
- out() << "<span class=\"qmldefault\">default&nbsp;</span>";
+ out() << "<span class=\"qmldefault\">default</span>";
generateQmlItem(qpn, relative, marker, false);
out() << "</td></tr>";
}
@@ -4420,11 +4460,16 @@ void HtmlGenerator::generateDetailedQmlMember(const Node *node,
const FunctionNode* qsn = static_cast<const FunctionNode*>(node);
out() << "<div class=\"qmlproto\">";
out() << "<table class=\"qmlname\">";
- out() << "<tr><td>";
+ //out() << "<tr>";
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd\">";
+ else
+ out() << "<tr class=\"even\">";
+ out() << "<td><p>";
out() << "<a name=\"" + refForNode(qsn) + "\"></a>";
generateSynopsis(qsn,relative,marker,CodeMarker::Detailed,false);
//generateQmlItem(qsn,relative,marker,false);
- out() << "</td></tr>";
+ out() << "</p></td></tr>";
out() << "</table>";
out() << "</div>";
}
@@ -4432,10 +4477,15 @@ void HtmlGenerator::generateDetailedQmlMember(const Node *node,
const FunctionNode* qmn = static_cast<const FunctionNode*>(node);
out() << "<div class=\"qmlproto\">";
out() << "<table class=\"qmlname\">";
- out() << "<tr><td>";
+ //out() << "<tr>";
+ if (++numTableRows % 2 == 1)
+ out() << "<tr class=\"odd\">";
+ else
+ out() << "<tr class=\"even\">";
+ out() << "<td><p>";
out() << "<a name=\"" + refForNode(qmn) + "\"></a>";
generateSynopsis(qmn,relative,marker,CodeMarker::Detailed,false);
- out() << "</td></tr>";
+ out() << "</p></td></tr>";
out() << "</table>";
out() << "</div>";
}
diff --git a/tools/qdoc3/htmlgenerator.h b/tools/qdoc3/htmlgenerator.h
index d80cbdb..e060257 100644
--- a/tools/qdoc3/htmlgenerator.h
+++ b/tools/qdoc3/htmlgenerator.h
@@ -173,6 +173,7 @@ class HtmlGenerator : public PageGenerator
void generateCompactList(const Node *relative,
CodeMarker *marker,
const NodeMap &classMap,
+ bool includeAlphabet,
QString commonPrefix = QString());
void generateFunctionIndex(const Node *relative, CodeMarker *marker);
void generateLegaleseList(const Node *relative, CodeMarker *marker);
diff --git a/tools/qdoc3/node.cpp b/tools/qdoc3/node.cpp
index a2bd948..4ba3a32 100644
--- a/tools/qdoc3/node.cpp
+++ b/tools/qdoc3/node.cpp
@@ -1289,7 +1289,7 @@ QmlClassNode::QmlClassNode(InnerNode *parent,
const ClassNode* cn)
: FakeNode(parent, name, QmlClass), cnode(cn)
{
- setTitle((qmlOnly ? "" : "QML ") + name + " Element Reference");
+ setTitle((qmlOnly ? "" : "QML ") + name + " Element");
}
/*!
diff --git a/tools/qdoc3/test/assistant.qdocconf b/tools/qdoc3/test/assistant.qdocconf
index 1deefce..112b1b2 100644
--- a/tools/qdoc3/test/assistant.qdocconf
+++ b/tools/qdoc3/test/assistant.qdocconf
@@ -16,45 +16,28 @@ qhp.Assistant.file = assistant.qhp
qhp.Assistant.namespace = com.trolltech.assistant.470
qhp.Assistant.virtualFolder = qdoc
qhp.Assistant.indexTitle = Qt Assistant Manual
-qhp.Assistant.extraFiles = images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
+qhp.Assistant.extraFiles = images/bg_l.png \
images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
+ images/bullet_sq.png \
images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
images/feedbackground.png \
- images/form_bg.png \
images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
images/stylesheet-coffee-plastique.png \
images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
style/style.css
+
qhp.Assistant.filterAttributes = qt 4.7.0 tools assistant
qhp.Assistant.customFilters.Assistant.name = Qt Assistant Manual
qhp.Assistant.customFilters.Assistant.filterAttributes = qt tools assistant
diff --git a/tools/qdoc3/test/designer.qdocconf b/tools/qdoc3/test/designer.qdocconf
index 513801a..d4da292 100644
--- a/tools/qdoc3/test/designer.qdocconf
+++ b/tools/qdoc3/test/designer.qdocconf
@@ -16,45 +16,28 @@ qhp.Designer.file = designer.qhp
qhp.Designer.namespace = com.trolltech.designer.470
qhp.Designer.virtualFolder = qdoc
qhp.Designer.indexTitle = Qt Designer Manual
-qhp.Designer.extraFiles = images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
+qhp.Designer.extraFiles = images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
images/coloreditorfactoryimage.png \
- images/content_bg.png \
images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
+
qhp.Designer.filterAttributes = qt 4.7.0 tools designer
qhp.Designer.customFilters.Designer.name = Qt Designer Manual
qhp.Designer.customFilters.Designer.filterAttributes = qt tools designer
diff --git a/tools/qdoc3/test/linguist.qdocconf b/tools/qdoc3/test/linguist.qdocconf
index a3f4f00..7420b4f 100644
--- a/tools/qdoc3/test/linguist.qdocconf
+++ b/tools/qdoc3/test/linguist.qdocconf
@@ -16,45 +16,28 @@ qhp.Linguist.file = linguist.qhp
qhp.Linguist.namespace = com.trolltech.linguist.470
qhp.Linguist.virtualFolder = qdoc
qhp.Linguist.indexTitle = Qt Linguist Manual
-qhp.Linguist.extraFiles = images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
+qhp.Linguist.extraFiles = images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
images/coloreditorfactoryimage.png \
- images/content_bg.png \
images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
+
qhp.Linguist.filterAttributes = qt 4.7.0 tools linguist
qhp.Linguist.customFilters.Linguist.name = Qt Linguist Manual
qhp.Linguist.customFilters.Linguist.filterAttributes = qt tools linguist
diff --git a/tools/qdoc3/test/qdeclarative.qdocconf b/tools/qdoc3/test/qdeclarative.qdocconf
index 80050e3..8015f57 100644
--- a/tools/qdoc3/test/qdeclarative.qdocconf
+++ b/tools/qdoc3/test/qdeclarative.qdocconf
@@ -27,45 +27,27 @@ qhp.Qml.indexTitle = Qml Reference
# Files not referenced in any qdoc file
# See also extraimages.HTML
-qhp.Qml.extraFiles = images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+qhp.Qml.extraFiles = images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
qhp.Qml.filterAttributes = qt 4.6.0 qtrefdoc
qhp.Qml.customFilters.Qt.name = Qt 4.6.0
diff --git a/tools/qdoc3/test/qmake.qdocconf b/tools/qdoc3/test/qmake.qdocconf
index f38a2a4..49d088e 100644
--- a/tools/qdoc3/test/qmake.qdocconf
+++ b/tools/qdoc3/test/qmake.qdocconf
@@ -16,45 +16,28 @@ qhp.qmake.file = qmake.qhp
qhp.qmake.namespace = com.trolltech.qmake.470
qhp.qmake.virtualFolder = qdoc
qhp.qmake.indexTitle = QMake Manual
-qhp.qmake.extraFiles = images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+qhp.qmake.extraFiles = images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
+
qhp.qmake.filterAttributes = qt 4.7.0 tools qmake
qhp.qmake.customFilters.qmake.name = qmake Manual
qhp.qmake.customFilters.qmake.filterAttributes = qt tools qmake
diff --git a/tools/qdoc3/test/qt-build-docs.qdocconf b/tools/qdoc3/test/qt-build-docs.qdocconf
index 0694748..f0c2535 100644
--- a/tools/qdoc3/test/qt-build-docs.qdocconf
+++ b/tools/qdoc3/test/qt-build-docs.qdocconf
@@ -22,45 +22,27 @@ qhp.Qt.indexTitle = Qt Reference Documentation
# Files not referenced in any qdoc file (last four are needed by qtdemo)
# See also extraimages.HTML
qhp.Qt.extraFiles = index.html \
- images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+ images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
diff --git a/tools/qdoc3/test/qt-build-docs_zh_CN.qdocconf b/tools/qdoc3/test/qt-build-docs_zh_CN.qdocconf
index 5a3d726..a00d5a1 100644
--- a/tools/qdoc3/test/qt-build-docs_zh_CN.qdocconf
+++ b/tools/qdoc3/test/qt-build-docs_zh_CN.qdocconf
@@ -30,45 +30,27 @@ qhp.Qt.customFilters.Qt.filterAttributes = qt 4.7.0
# Files not referenced in any qdoc file (last four are needed by qtdemo)
# See also extraimages.HTML
qhp.Qt.extraFiles = index.html \
- images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+ images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
language = Cpp
diff --git a/tools/qdoc3/test/qt-defines.qdocconf b/tools/qdoc3/test/qt-defines.qdocconf
index 0426f4d..f3291df 100644
--- a/tools/qdoc3/test/qt-defines.qdocconf
+++ b/tools/qdoc3/test/qt-defines.qdocconf
@@ -20,37 +20,20 @@ codeindent = 1
# See also qhp.Qt.extraFiles
extraimages.HTML = qt-logo \
trolltech-logo \
- api_examples.png \
- bg_ll.png \
- bg_ul_blank.png \
+ bg_l.png \
+ bg_l_blank.png \
+ bg_r.png \
+ box_bg.png \
+ breadcrumb.png \
bullet_gt.png \
- horBar.png \
- qt_ref_doc.png \
- api_lookup.png \
- bg_ll_blank.png \
- bg_ur.png \
+ bullet_dn.png \
bullet_sq.png \
- bullet_dn.png \
- bullet_up.png \
+ bullet_up.png \
+ feedbackground.png \
+ horBar.png \
+ page.png \
page_bg.png \
- qt_tools.png \
- api_topics.png \
- bg_lr.png \
- bg_ur_blank.png \
- content_bg.png \
- print.png \
- sep.png \
- bg_l.png \
- bg_r.png \
- box_bg.png \
- feedbackground.png \
- qt_guide.png \
sprites-combined.png \
- bg_l_blank.png \
- bg_ul.png \
- breadcrumb.png \
- form_bg.png \
- qt_icon.png \
taskmenuextension-example.png \
coloreditorfactoryimage.png \
dynamiclayouts-example.png \
diff --git a/tools/qdoc3/test/qt-html-templates.qdocconf b/tools/qdoc3/test/qt-html-templates.qdocconf
index 85a29c2..9af2f92 100644
--- a/tools/qdoc3/test/qt-html-templates.qdocconf
+++ b/tools/qdoc3/test/qt-html-templates.qdocconf
@@ -31,55 +31,55 @@ HTML.postheader = " <div class=\"header\" id=\"qtdocheader\">\n" \
" <div class=\"searchlabel\">\n" \
" Search index:</div>\n" \
" <div class=\"search\">\n" \
- " <form id=\"qtdocsearch\" action=\"#\">\n" \
+ " <form id=\"qtdocsearch\" action=\"\">\n" \
" <fieldset>\n" \
- " <input type=\"text\" name=\"searchstring\" id=\"searchstring\" value=\"\" onkeyup=\"doSearch(this.value);\" />\n" \
+ " <input type=\"text\" name=\"searchstring\" id=\"pageType\" value=\"\" />\n" \
" </fieldset>\n" \
" </form>\n" \
" </div>\n" \
" <div class=\"box first bottombar\" id=\"lookup\">\n" \
- " <h2>\n" \
+ " <h2><span></span>\n" \
" API Lookup</h2>\n" \
- " <div class=\"list\">\n" \
- " <ul>\n" \
- " <li><a href=\"modules.html\">All modules</a></li>\n" \
- " <li><a href=\"classes.html\">All classes</a></li>\n" \
- " <li><a href=\"functions.html\">All functions</a></li>\n" \
- " <li><a href=\"namespaces.html\">All namespaces</a></li>\n" \
- " <li><a href=\"platform-specific.html\">Platform specifics</a></li>\n" \
- " </ul>\n" \
+ " <div id=\"list001\" class=\"list\">\n" \
+ " <ul id=\"ul001\" >\n" \
+ " <li class=\"defaultLink\"><a href=\"classes.html\">Class index</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"functions.html\">Function index</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"modules.html\">Modules</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"namespaces.html\">Namespaces</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"qtglobal.html\">Global stuff</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"qdeclarativeelements.html\">QML elements</a></li>\n" \
+ " </ul> \n" \
" </div>\n" \
- " <div class=\"live\">\n" \
+ " <div id=\"live001\" class=\"live\">\n" \
" </div>\n" \
" </div>\n" \
" <div class=\"box bottombar\" id=\"topics\">\n" \
- " <h2>\n" \
- " API Topics</h2>\n" \
- " <div class=\"list\">\n" \
- " <ul>\n" \
- " <li><a href=\"object.html\">QObject model</a></li>\n" \
- " <li><a href=\"eventsandfilters.html\">Events, signals &amp; slots</a></li>\n" \
- " <li><a href=\"paintsystem.html\">Graphics &amp; Paint system</a></li>\n" \
- " <li><a href=\"declarativeui.html\">Qt Quick</a></li>\n" \
- " <li><a href=\"widgets-and-layouts.html\">Widget style &amp; layout</a></li>\n" \
- " </ul>\n" \
+ " <h2><span></span>\n" \
+ " Qt Topics</h2>\n" \
+ " <div id=\"list002\" class=\"list\">\n" \
+ " <ul id=\"ul002\" >\n" \
+ " <li class=\"defaultLink\"><a href=\"qt-basic-concepts.html\">Basic Qt architecture</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"declarativeui.html\">Device UI's &amp; Qt Quick</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"qt-gui-concepts.html\">Desktop UI components</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"platform-specific.html\">Platform-specific info</a></li>\n" \
+ " </ul> \n" \
" </div>\n" \
- " <div class=\"live\">\n" \
+ " <div id=\"live002\" class=\"live\">\n" \
" </div>\n" \
" </div>\n" \
" <div class=\"box\" id=\"examples\">\n" \
- " <h2>\n" \
- " API Examples</h2>\n" \
- " <div class=\"list\">\n" \
- " <ul>\n" \
- " <li><a href=\"examples.html\">All examples</a></li>\n" \
- " <li><a href=\"tutorials.html\">All tutorials</a></li>\n" \
- " <li><a href=\"examples.html\">Qt Quick examples</a></li>\n" \
- " <li><a href=\"examples.html\">Desktop examples</a></li>\n" \
- " <li><a href=\"examples.html\">Device examples</a></li>\n" \
- " </ul>\n" \
+ " <h2><span></span>\n" \
+ " Examples</h2>\n" \
+ " <div id=\"list003\" class=\"list\">\n" \
+ " <ul id=\"ul003\">\n" \
+ " <li class=\"defaultLink\"><a href=\"all-examples.html\">Examples</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"tutorials.html\">Tutorials</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"demos.html\">Demos</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"qdeclarativeexamples.html\">QML Examples</a></li>\n" \
+ " <li class=\"defaultLink\"><a href=\"qdeclarativeexamples.html#Demos\">QML Demos</a></li>\n" \
+ " </ul> \n" \
" </div>\n" \
- " <div class=\"live\">\n" \
+ " <div id=\"live003\" class=\"live\">\n" \
" </div>\n" \
" </div>\n" \
" </div>\n" \
@@ -98,20 +98,21 @@ HTML.postpostheader = " </ul>\n" \
" <li id=\"medA\" class=\"t_button active\">A</li>\n" \
" <li id=\"bigA\" class=\"t_button\">A</li>\n" \
" <li id=\"print\" class=\"t_button\"><a href=\"javascript:this.print();\">\n" \
- " <img src=\"images/sep.png\" alt=\"\" /><img id=\"printIcon\" src=\"images/print.png\" alt=\"Print this page\" /></a></li>\n" \
+ " <span>Print</span></a></li>\n" \
" </ul>\n" \
" </div>\n" \
" </div>\n" \
" <div class=\"content\">\n"
-HTML.footer = " </div>\n" \
- " <div class=\"feedback t_button\" onclick=\"\$(\'#feedbackBox\').show();\$(\'#blurpage\').show()\">\n" \
+HTML.footer = " <!-- /div -->\n" \
+ " <div class=\"feedback t_button\" onclick=\"\$(\'.bd\').hide();\$(\'.hd\').hide();\$(\'.footer\').hide();\$(\'#feedbackBox\').show();\$(\'#blurpage\').show()\">\n" \
" [+] Documentation Feedback</div>\n" \
" </div>\n" \
" </div>\n" \
" <div class=\"ft\">\n" \
" <span></span>\n" \
" </div>\n" \
+ " </div> \n" \
" <div class=\"footer\">\n" \
" <p>\n" \
" <acronym title=\"Copyright\">&copy;</acronym> 2008-2010 Nokia Corporation and/or its\n" \
@@ -123,17 +124,18 @@ HTML.footer = " </div>\n" \
" </div>\n" \
" <div id=\"feedbackBox\">\n" \
" <div id=\"feedcloseX\">\n" \
- " <a href=\"#\" onclick=\"\$(\'#feedbackBox\').hide();\$(\'#blurpage\').hide()\">X</a>\n" \
+ " <a href=\"#\" onclick=\"\$(\'.bd\').show();\$(\'.hd\').show();\$(\'.footer\').show();\$(\'#feedbackBox\').hide();\$(\'#blurpage\').hide()\">X</a>\n" \
" </div>\n" \
- " <form action=\"#\">\n" \
- " <textarea id=\"feedbox\" rows=\"5\" cols=\"40\">Please submit you feedback...</textarea>\n" \
- " <input id=\"feedsubmit\" type=\"submit\" onclick=\"\$(\'#feedbackBox\').hide();\$(\'#blurpage\').hide()\"\n" \
- " name=\"feedback\" />\n" \
+ " <form id=\"feedform\" action=\"feedback.php\" method=\"get\">\n" \
+ " <p><textarea id=\"feedbox\" name=\"feedText\" rows=\"5\" cols=\"40\">Please submit you feedback...</textarea></p>\n" \
+ " <input id=\"page\" name=\"pageVal\" value=\"\$(\'title\').html();\" style=\"display:none;\">\n" \
+ " <p><input id=\"feedsubmit\" type=\"submit\" onclick=\"\$(\'.bd\').show();\$(\'.hd\').show();\$(\'.footer\').show();\$(\'#feedbackBox\').hide();\$(\'#blurpage\').hide()\"\n" \
+ " name=\"feedback\" /></p>\n" \
" </form>\n" \
" </div>\n" \
" <div id=\"blurpage\">\n" \
" </div>\n" \
- "<script type=\"text/javascript\">\n" \
+ "<!-- <script type=\"text/javascript\">\n" \
" var _gaq = _gaq || [];\n" \
" _gaq.push([\'_setAccount\', \'UA-4457116-5\']);\n" \
" _gaq.push([\'_trackPageview\']);\n" \
@@ -142,4 +144,4 @@ HTML.footer = " </div>\n" \
" ga.src = (\'https:\' == document.location.protocol ? \'https://ssl\' : \'http://www\') + \'.google-analytics.com/ga.js\';\n" \
" var s = document.getElementsByTagName(\'script\')[0]; s.parentNode.insertBefore(ga, s);\n" \
" })();\n" \
- "</script>\n"
+ "</script> -->\n"
diff --git a/tools/qdoc3/test/qt.qdocconf b/tools/qdoc3/test/qt.qdocconf
index 69ab4e1..2f6983a 100644
--- a/tools/qdoc3/test/qt.qdocconf
+++ b/tools/qdoc3/test/qt.qdocconf
@@ -26,45 +26,27 @@ qhp.Qt.indexRoot =
# Files not referenced in any qdoc file (last four are needed by qtdemo)
# See also extraimages.HTML
qhp.Qt.extraFiles = index.html \
- images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
+ images/bg_l.png \
+ images/bg_l_blank.png \
images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
scripts/functions.js \
scripts/jquery.js \
- style/style.css
+ style/style.css
qhp.Qt.filterAttributes = qt 4.7.0 qtrefdoc
qhp.Qt.customFilters.Qt.name = Qt 4.7.0
diff --git a/tools/qdoc3/test/qt_zh_CN.qdocconf b/tools/qdoc3/test/qt_zh_CN.qdocconf
index a5a65d8..9275b5c 100644
--- a/tools/qdoc3/test/qt_zh_CN.qdocconf
+++ b/tools/qdoc3/test/qt_zh_CN.qdocconf
@@ -32,45 +32,27 @@ qhp.Qt.customFilters.Qt.filterAttributes = qt 4.7.0
# Files not referenced in any qdoc file (last four are needed by qtdemo)
# See also extraimages.HTML
qhp.Qt.extraFiles = index.html \
- images/api_examples.png \
- images/api_lookup.png \
- images/api_topics.png \
- images/bg_l_blank.png \
- images/bg_ll_blank.png \
- images/bg_ll.png \
- images/bg_l.png \
- images/bg_lr.png \
- images/bg_r.png \
- images/bg_ul_blank.png \
- images/bg_ul.png \
- images/bg_ur_blank.png \
- images/bg_ur.png \
- images/box_bg.png \
- images/breadcrumb.png \
- images/bullet_dn.png \
- images/bullet_gt.png \
- images/bullet_sq.png \
- images/bullet_up.png \
- images/coloreditorfactoryimage.png \
- images/content_bg.png \
- images/dynamiclayouts-example.png \
- images/feedbackground.png \
- images/form_bg.png \
- images/horBar.png \
- images/page_bg.png \
- images/print.png \
- images/qt_guide.png \
- images/qt_icon.png \
- images/qt-logo.png \
- images/qt_ref_doc.png \
- images/qt_tools.png \
- images/sep.png \
- images/sprites-combined.png \
- images/stylesheet-coffee-plastique.png \
- images/taskmenuextension-example.png \
- scripts/functions.js \
- scripts/jquery.js \
- style/style.css
+ images/bg_l.png \
+ images/bg_l_blank.png \
+ images/bg_r.png \
+ images/box_bg.png \
+ images/breadcrumb.png \
+ images/bullet_gt.png \
+ images/bullet_dn.png \
+ images/bullet_sq.png \
+ images/bullet_up.png \
+ images/feedbackground.png \
+ images/horBar.png \
+ images/page.png \
+ images/page_bg.png \
+ images/sprites-combined.png \
+ images/stylesheet-coffee-plastique.png \
+ images/taskmenuextension-example.png \
+ images/coloreditorfactoryimage.png \
+ images/dynamiclayouts-example.png \
+ scripts/functions.js \
+ scripts/jquery.js \
+ style/style.css
language = Cpp
diff --git a/tools/qdoc3/test/style/style.css b/tools/qdoc3/test/style/style.css
index 1ed49fa..9c290f5 100644
--- a/tools/qdoc3/test/style/style.css
+++ b/tools/qdoc3/test/style/style.css
@@ -58,6 +58,19 @@
{
vertical-align: baseline;
}
+ .heading
+ {
+ font: normal 600 16px/1.0 Arial;
+ padding-bottom: 15px;
+ }
+ .subtitle
+ {
+ font-size: 13px;
+ }
+ .small-subtitle
+ {
+ font-size: 13px;
+ }
legend
{
color: #000000;
@@ -73,7 +86,6 @@
{
font-size: 100%;
}
- /* Page style */
html
{
background-color: #e5e5e5;
@@ -92,6 +104,11 @@
{
font-style: italic;
}
+ a
+ {
+ color: #00732f;
+ text-decoration: none;
+ }
.header, .footer, .wrapper
{
min-width: 600px;
@@ -106,23 +123,19 @@
{
padding-left: 216px;
height: 15px;
- background: url(../images/bg_ul.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 0;
overflow: hidden;
}
.offline .wrapper .hd
{
- background: url(../images/bg_ul_blank.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -15px;
}
.wrapper .hd span
{
height: 15px;
display: block;
- background: url(../images/bg_ur.png) no-repeat 100% 0;
overflow: hidden;
- }
- .offline .wrapper .hd span
- {
- /* background: url(../images/bg_ur_blank.png) no-repeat 100% 0; */
+ background: url(../images/page.png) no-repeat 100% -30px;
}
.wrapper .bd
{
@@ -137,18 +150,18 @@
{
padding-left: 216px;
height: 15px;
- background: url(../images/bg_ll.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -75px;
overflow: hidden;
}
.offline .wrapper .ft
{
- background: url(../images/bg_ll_blank.png) no-repeat 0 0;
+ background: url(../images/page.png) no-repeat 0 -90px;
}
.wrapper .ft span
{
height: 15px;
display: block;
- background: url(../images/bg_lr.png) no-repeat 100% 0;
+ background: url(../images/page.png) no-repeat 100% -60px;
overflow: hidden;
}
.header, .footer
@@ -182,186 +195,9 @@
width: 302px;
height: 22px;
text-indent: -999em;
- background: url(../images/header.png) no-repeat 0 0;
- }
- /* header elements */
- #nav-topright
- {
- height: 70px;
- }
-
- #nav-topright ul
- {
- list-style-type: none;
- float: right;
- width: 370px;
- margin-top: 11px;
- }
-
- #nav-topright li
- {
- display: inline-block;
- margin-right: 20px;
- float: left;
- }
-
- #nav-topright li.nav-topright-last
- {
- margin-right: 0;
- }
-
- #nav-topright li a
- {
- background: transparent url(../images/sprites-combined.png) no-repeat;
- height: 18px;
- display: block;
- overflow: hidden;
- text-indent: -9999px;
- }
-
- #nav-topright li.nav-topright-home a
- {
- width: 65px;
- background-position: -2px -91px;
- }
-
- #nav-topright li.nav-topright-home a:hover
- {
- background-position: -2px -117px;
- }
-
-
- #nav-topright li.nav-topright-dev a
- {
- width: 30px;
- background-position: -76px -91px;
- }
-
- #nav-topright li.nav-topright-dev a:hover
- {
- background-position: -76px -117px;
- }
-
-
- #nav-topright li.nav-topright-labs a
- {
- width: 40px;
- background-position: -114px -91px;
- }
-
- #nav-topright li.nav-topright-labs a:hover
- {
- background-position: -114px -117px;
- }
-
- #nav-topright li.nav-topright-doc a
- {
- width: 32px;
- background-position: -162px -91px;
- }
-
- #nav-topright li.nav-topright-doc a:hover, #nav-topright li.nav-topright-doc-active a
- {
- background-position: -162px -117px;
- }
-
- #nav-topright li.nav-topright-blog a
- {
- width: 40px;
- background-position: -203px -91px;
- }
-
- #nav-topright li.nav-topright-blog a:hover, #nav-topright li.nav-topright-blog-active a
- {
- background-position: -203px -117px;
- }
-
- #nav-topright li.nav-topright-shop a
- {
- width: 40px;
- background-position: -252px -91px;
- }
-
- #nav-topright li.nav-topright-shop a:hover, #nav-topright li.nav-topright-shop-active a
- {
- background-position: -252px -117px;
- }
-
- #nav-logo
- {
- background: transparent url( "../images/sprites-combined.png" ) no-repeat 0 -225px;
- left: -3px;
- position: absolute;
- width: 75px;
- height: 75px;
- top: 13px;
- }
- #nav-logo a
- {
- width: 75px;
- height: 75px;
- display: block;
- text-indent: -9999px;
- overflow: hidden;
- }
- /* Clearing */
- .header:after, .footer:after, .breadcrumb:after, .wrap .content:after, .group:after
- {
- content: ".";
- display: block;
- height: 0;
- clear: both;
- visibility: hidden;
- }
- /* ^ Clearing */
-
-
-
- .shortCut-topleft-inactive
- {
- padding-left: 3px;
- background: transparent url( "../images/sprites-combined.png" ) no-repeat 0px -58px;
- height: 20px;
- width: 93px;
- }
- .shortCut-topleft-inactive span
- {
- font-variant: normal;
- }
- #shortCut
- {
- padding-top: 10px;
- font-weight: bolder;
- color: #b0adab;
- }
- #shortCut ul
- {
- list-style-type: none;
- float: left;
- width: 347px;
- margin-left: 100px;
- }
- #shortCut li
- {
- display: inline-block;
- margin-right: 25px;
- float: left;
- white-space: nowrap;
- }
- #shortCut li a
- {
- color: #b0adab;
- text-decoration: none;
- }
- #shortCut li a:hover
- {
- color: #44a51c;
- text-decoration: none;
+ background: url(../images/sprites-combined.png) no-repeat -78px -235px;
}
- /* end of header elements */
-
- /* menu element */
.sidebar
{
float: left;
@@ -369,32 +205,32 @@
width: 200px;
font-size: 11px;
}
- .sidebar a
- {
- color: #00732f;
- text-decoration: none;
- }
- .offline .sidebar, .offline .feedback
+
+ .offline .sidebar, .offline .feedback, .offline .t_button
{
display: none;
}
+
.sidebar .searchlabel
{
padding: 0 0 2px 17px;
font: normal bold 11px/1.2 Verdana;
}
+
.sidebar .search
{
padding: 0 15px 0 16px;
}
+
.sidebar .search form
{
- width: 167px;
- height: 21px;
- padding: 2px 0 0 5px;
- background: url(../images/form_bg.png) no-repeat 0 0;
+ background: url(../images/sprites-combined.png) no-repeat -6px -348px;
+ height:21px;
+ padding:2px 0 0 5px;
+ width:167px;
}
- .sidebar .search form fieldset input#searchstring
+
+ .sidebar .search form input#pageType
{
width: 158px;
height: 19px;
@@ -403,32 +239,62 @@
outline: none;
font: 13px/1.2 Verdana;
}
+
.sidebar .box
{
padding: 17px 15px 5px 16px;
}
+
.sidebar .box .first
{
background-image: none;
}
+
.sidebar .box h2
{
font: normal 18px/1.2 Arial;
- padding: 15px 0 0 40px;
+ padding: 0;
min-height: 32px;
}
+ .sidebar .box h2 span
+ {
+ overflow: hidden;
+ display: inline-block;
+ }
.sidebar .box#lookup h2
{
- background: url(../images/api_lookup.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #lookup.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -6px -311px;
+ width: 27px;
+ height: 35px;
+ margin-right: 13px;
}
.sidebar .box#topics h2
{
- background: url(../images/api_topics.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #topics.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -94px -311px;
+ width: 27px;
+ height: 32px;
+ margin-right: 13px;
}
.sidebar .box#examples h2
{
- background: url(../images/api_examples.png) no-repeat 0 0;
+ background-image: none;
+ }
+ .sidebar #examples.box h2 span
+ {
+ background: url(../images/sprites-combined.png) no-repeat -48px -311px;
+ width: 30px;
+ height: 31px;
+ margin-right: 9px;
}
+
.sidebar .box .list
{
display: block;
@@ -443,6 +309,9 @@
{
text-decoration: underline;
}
+ .sidebar .box ul
+ {
+ }
.sidebar .box ul li
{
padding-left: 12px;
@@ -453,23 +322,20 @@
{
background: url(../images/box_bg.png) repeat-x 0 bottom;
}
- /* content elements */
.wrap
{
- overflow: hidden;
+ margin: 0 5px 0 208px;
+ overflow: visible;
}
.offline .wrap
{
margin: 0 5px 0 5px;
}
- /* tool bar */
.wrap .toolbar
{
background-color: #fafafa;
border-bottom: 1px solid #d1d1d1;
- height: 20px;
- margin-left: 3px;
- margin-right: 5px;
+ height: 20px;
position: relative;
}
.wrap .toolbar .toolblock
@@ -487,7 +353,7 @@
{
padding: 0 0 10px 21px;
right: 5px;
- vertical-align: top;
+ vertical-align: middle;
overflow: hidden;
}
.wrap .toolbar .toolbuttons .active
@@ -507,32 +373,56 @@
font-weight: bold;
color: #B0ADAB;
}
- #smallA
+
+ .toolbuttons #print
+ {
+ border-left: 1px solid #c5c4c4;
+ margin-top: 0;
+ padding-left: 7px;
+ text-indent: 0;
+ }
+ .toolbuttons #print a
+ {
+ width: 16px;
+ height: 16px;
+ }
+
+ .toolbuttons #print a span
+ {
+ width: 16px;
+ height: 16px;
+ text-indent: -999em;
+ display: block;
+ overflow: hidden;
+ background: url(../images/sprites-combined.png) no-repeat -137px -311px;
+ }
+
+ .toolbuttons #smallA
{
font-size: 10pt;
}
- #medA
+ .toolbuttons #medA
{
font-size: 12pt;
}
- #bigA
+ .toolbuttons #bigA
{
font-size: 14pt;
+ margin-right: 7px;
}
+
#smallA:hover, #medA:hover, #bigA:hover
{
color: #00732F;
}
- #print
+
+ .offline .wrap .breadcrumb
{
- font-size: 14pt;
- line-height: 20pt;
}
- #printIcon
+
+ .wrap .breadcrumb ul
{
- margin-left: 5px;
}
- /* bread crumbs */
.wrap .breadcrumb ul li
{
float: left;
@@ -545,6 +435,10 @@
{
font-weight: normal;
}
+ .wrap .breadcrumb ul li a
+ {
+ color: #363534;
+ }
.wrap .breadcrumb ul li.first
{
background-image: none;
@@ -554,29 +448,29 @@
.wrap .content
{
padding: 30px;
- position: relative;
}
- /* text elements */
- .heading
+
+ .wrap .content li
{
- font: normal 600 16px/1.0 Arial;
- padding-bottom: 15px;
+ padding-left: 12px;
+ background: url(../images/bullet_sq.png) no-repeat 0 5px;
+ font: normal 400 10pt/1 Verdana;
+ color: #44a51c;
+ margin-bottom: 10px;
}
-
- .subtitle
+ .content li:hover
{
- font-size: 13px;
+ text-decoration: underline;
}
- .small-subtitle
+ .offline .wrap .content
{
- font-size: 13px;
+ padding-top: 15px;
}
-
+
.wrap .content h1
{
font: 600 18px/1.2 Arial;
- padding-bottom: 15px;
}
.wrap .content h2
{
@@ -588,26 +482,13 @@
}
.wrap .content p
{
- line-height:20px;
- padding:10px 5px 10px 5px;
+ line-height: 20px;
+ padding: 10px 5px 10px 5px;
}
.wrap .content ul
{
padding-left: 25px;
}
- .wrap .content li
- {
- padding-left: 12px;
- background: url(../images/bullet_sq.png) no-repeat 0 5px;
- font: normal 400 10pt/1 Verdana;
- margin-bottom: 10px;
- line-height: 14px;
- }
- a
- {
- color: #00732F;
- text-decoration: none;
- }
a:hover
{
color: #4c0033;
@@ -618,10 +499,6 @@
color: #4c0033;
text-decoration: none;
}
- .offline .wrap .content
- {
- padding-top: 15px;
- }
.footer
{
min-height: 100px;
@@ -629,11 +506,15 @@
font: normal 9px/1 Verdana;
text-align: center;
padding-top: 40px;
+ background-color: #E6E7E8;
+ margin: 0;
}
.feedback
{
- float: right;
- padding-right: 10px;
+ float: none;
+ position: absolute;
+ right: 15px;
+ bottom: 10px;
font: normal 8px/1 Verdana;
color: #B0ADAB;
}
@@ -644,37 +525,223 @@
color: #00732F;
text-decoration: underline;
}
+ .header:after, .footer:after, .breadcrumb:after, .wrap .content:after, .group:after
+ {
+ content: ".";
+ display: block;
+ height: 0;
+ clear: both;
+ visibility: hidden;
+ }
+ #nav-topright
+ {
+ height: 70px;
+ }
+
+ #nav-topright ul
+ {
+ list-style-type: none;
+ float: right;
+ width: 370px;
+ margin-top: 11px;
+ }
+
+ #nav-topright li
+ {
+ display: inline-block;
+ margin-right: 20px;
+ float: left;
+ }
+
+ #nav-topright li.nav-topright-last
+ {
+ margin-right: 0;
+ }
+
+ #nav-topright li a
+ {
+ background: transparent url(../images/sprites-combined.png) no-repeat;
+ height: 18px;
+ display: block;
+ overflow: hidden;
+ text-indent: -9999px;
+ }
+
+ #nav-topright li.nav-topright-home a
+ {
+ width: 65px;
+ background-position: -2px -91px;
+ }
+
+ #nav-topright li.nav-topright-home a:hover
+ {
+ background-position: -2px -117px;
+ }
+
+
+ #nav-topright li.nav-topright-dev a
+ {
+ width: 30px;
+ background-position: -76px -91px;
+ }
+
+ #nav-topright li.nav-topright-dev a:hover
+ {
+ background-position: -76px -117px;
+ }
+
+
+ #nav-topright li.nav-topright-labs a
+ {
+ width: 40px;
+ background-position: -114px -91px;
+ }
+
+ #nav-topright li.nav-topright-labs a:hover
+ {
+ background-position: -114px -117px;
+ }
+
+ #nav-topright li.nav-topright-doc a
+ {
+ width: 32px;
+ background-position: -162px -91px;
+ }
+
+ #nav-topright li.nav-topright-doc a:hover, #nav-topright li.nav-topright-doc-active a
+ {
+ background-position: -162px -117px;
+ }
+
+ #nav-topright li.nav-topright-blog a
+ {
+ width: 40px;
+ background-position: -203px -91px;
+ }
+
+ #nav-topright li.nav-topright-blog a:hover, #nav-topright li.nav-topright-blog-active a
+ {
+ background-position: -203px -117px;
+ }
+
+ #nav-topright li.nav-topright-shop a
+ {
+ width: 40px;
+ background-position: -252px -91px;
+ }
+
+ #nav-topright li.nav-topright-shop a:hover, #nav-topright li.nav-topright-shop-active a
+ {
+ background-position: -252px -117px;
+ }
+
+ #nav-logo
+ {
+ background: transparent url(../images/sprites-combined.png ) no-repeat 0 -225px;
+ left: -3px;
+ position: absolute;
+ width: 75px;
+ height: 75px;
+ top: 13px;
+ }
+ #nav-logo a
+ {
+ width: 75px;
+ height: 75px;
+ display: block;
+ text-indent: -9999px;
+ overflow: hidden;
+ }
+
+
+ .shortCut-topleft-inactive
+ {
+ padding-left: 3px;
+ background: transparent url( ../images/sprites-combined.png) no-repeat 0px -58px;
+ height: 20px;
+ width: 47px;
+ }
+ .shortCut-topleft-inactive span
+ {
+ font-variant: normal;
+ }
+ #shortCut
+ {
+ padding-top: 10px;
+ font-weight: bolder;
+ color: #b0adab;
+ }
+ #shortCut ul
+ {
+ list-style-type: none;
+ float: left;
+ width: 347px;
+ margin-left: 100px;
+ }
+ #shortCut li
+ {
+ display: inline-block;
+ margin-right: 25px;
+ float: left;
+ white-space: nowrap;
+ }
+ #shortCut li a
+ {
+ color: #b0adab;
+ }
+ #shortCut li a:hover
+ {
+ color: #44a51c;
+ }
+
hr
{
- background-color: #e0e0e0;
+ background-color: #E6E6E6;
+ border: 1px solid #E6E6E6;
height: 1px;
width: 100%;
text-align: left;
margin: 15px 0px 15px 0px;
}
-
+
.content .alignedsummary
{
margin: 15px;
}
- /* tables */
+ pre
+ {
+ border: 1px solid #DDDDDD;
+ margin: 0 20px 10px 10px;
+ padding: 20px 15px 20px 20px;
+ overflow-x: auto;
+ }
table, pre
{
-moz-border-radius: 7px 7px 7px 7px;
background-color: #F6F6F6;
border: 1px solid #E6E6E6;
border-collapse: separate;
- font-size: 11px;
- min-width: 395px;
+ font-size: 11px;
+ /*min-width: 395px;*/
margin-bottom: 25px;
+ display: inline-block;
+ }
+ thead
+ {
+ margin-top: 5px;
+ }
+ th
+ {
+ padding: 3px 15px 3px 15px;
+ }
+ td
+ {
+ padding: 3px 15px 3px 20px;
}
- thead{margin-top: 5px;}
- th{ padding: 3px 15px 3px 15px;}
- td{padding: 3px 15px 3px 20px;}
table tr.odd
{
border-left: 1px solid #E6E6E6;
- background-color: #F6F6F6;
+ background-color: #F6F6F6;
color: #66666E;
}
table tr.even
@@ -685,12 +752,13 @@
}
table tr.odd:hover
{
- background-color: #E6E6E6;
+ background-color: #E6E6E6;
}
table tr.even:hover
{
background-color: #E6E6E6;
}
+
span.comment
{
color: #8B0000;
@@ -700,15 +768,7 @@
{
color: #254117;
}
- pre
- {
- -moz-border-radius:7px 7px 7px 7px;
- background-color:#F6F6F6;
- border:1px solid #DDDDDD;
- margin:0 20px 10px 10px;
- padding:20px 15px 20px 20px;
- overflow-x:auto;
- }
+
.qmltype
{
text-align: center;
@@ -719,13 +779,28 @@
float: right;
color: #254117;
}
+
+ .qmldefault
+ {
+ float: right;
+ color: red;
+ }
+
+ .qmldoc
+ {
+ }
+
+ *.qmlitem p
+ {
+ }
+
#feedbackBox
{
- display:none;
- -moz-border-radius:7px 7px 7px 7px;
- border:1px solid #DDDDDD;
- position:fixed;
- top:100px;
+ display: none;
+ -moz-border-radius: 7px 7px 7px 7px;
+ border: 1px solid #DDDDDD;
+ position: fixed;
+ top: 100px;
left: 33%;
height: 190px;
width: 400px;
@@ -735,27 +810,27 @@
}
#feedcloseX a
{
- display:inline;
+ display: inline;
padding: 5px 5px 0 0;
- margin-bottom:3px;
+ margin-bottom: 3px;
color: #363534;
- font-weight:600;
+ font-weight: 600;
float: right;
text-decoration: none;
}
+
#feedbox
- /* here */
{
- display:inline;
+ display: inline;
width: 370px;
height: 120px;
- margin:0px 25px 10px 15px;
+ margin: 0px 25px 10px 15px;
}
#feedsubmit
{
- display:inline;
- float:right;
- margin:4px 32px 0 0;
+ display: inline;
+ float: right;
+ margin: 4px 32px 0 0;
}
#blurpage
{
@@ -771,141 +846,172 @@
}
.toc
{
- float: right;
- -moz-border-radius:7px 7px 7px 7px;
- background-color:#F6F6F6;
- border:1px solid #DDDDDD;
- margin:0 20px 10px 10px;
- padding:20px 15px 20px 20px;
+ float: right;
+ -moz-border-radius: 7px 7px 7px 7px;
+ background-color: #F6F6F6;
+ border: 1px solid #DDDDDD;
+ margin: 0 20px 10px 10px;
+ padding: 20px 15px 20px 20px;
height: auto;
width: 200px;
}
- .toc ul
+ .toc h3
{
- float: left;
- padding: 15px;
-
+ font: 600 12px/1.2 Arial;
+ }
+
+ .wrap .content .toc ul
+ {
+ padding-left: 0px;
+ }
+
+
+ .wrap .content .toc .level2
+ {
+ margin-left: 15px;
}
-
.content .toc li
{
- font: normal 12px/1.2 Verdana;
+ font: normal 10px/1.2 Verdana;
background: url(../images/bullet_dn.png) no-repeat 0 5px;
}
- .relpage
+ .relpage
{
-moz-border-radius: 7px 7px 7px 7px;
border: 1px solid #DDDDDD;
padding: 25px 25px;
- clear:both;
+ clear: both;
}
.relpage ul
{
float: none;
padding: 15px;
}
- .content .relpage li
+ .content .relpage li
{
font: normal 11px/1.2 Verdana;
}
- /* edit */
h3.fn, span.fn
{
background-color: #F6F6F6;
border-width: 1px;
border-style: solid;
border-color: #E6E6E6;
- font-weight: bold;
- /* padding: 6px 0px 6px 10px;*/
- /* margin: 42px 0px 0px 0px;*/
+ font-weight: bold;
}
- /* edit */
- .indexbox
- {
- width: 100%;
- }
- .content .indexboxcont li
- {
- font: normal 600 13px/1 Verdana;
- }
- /* .indexbox a
- {
- color: #00732f;
- text-decoration: none;
- }*/
- .indexbox a:hover, .indexbox a:visited:hover
- {
- color: #4c0033;
- text-decoration: underline;
- }
- .indexbox a:visited
+ /* start index box */
+ .indexbox
{
- color: #00732f;
- text-decoration: none;
+ width: 100%;
+ display:inline-block;
}
.indexboxcont
{
display: block;
+ /* overflow: hidden;*/
}
.indexboxbar
{
- background: transparent url( "../images/horBar.png" ) repeat-x left bottom;
+ background: transparent url(../images/horBar.png ) repeat-x left bottom;
margin-bottom: 25px;
+ /* background-image: none;
+ border-bottom: 1px solid #e2e2e2;*/
}
.indexboxcont .section
{
- display: inline-block;
+ display: inline-block;
width: 49%;
*width:42%;
_width:42%;
padding:0 2% 0 1%;
vertical-align:top;
+
}
.indexboxcont .indexIcon
- {
+ {
width: 11%;
*width:18%;
_width:18%;
overflow:hidden;
+
}
.indexboxcont .section p
- {
+ {
padding-top: 20px;
padding-bottom: 20px;
}
-
.indexboxcont .sectionlist
{
display: inline-block;
width: 33%;
- margin-right: -2px;
- vertical-align: top;
padding: 0;
}
- .tricol
- {
-
- }
.indexboxcont .sectionlist ul
{
- padding-left: 15px;
margin-bottom: 20px;
}
-/*
+
.indexboxcont .sectionlist ul li
{
line-height: 12px;
}
-*/
+
+ .content .indexboxcont li
+ {
+ font: normal 600 13px/1 Verdana;
+ }
+
+ .indexbox a:hover, .indexbox a:visited:hover
+ {
+ color: #4c0033;
+ text-decoration: underline;
+ }
+
+ .indexbox a:visited
+ {
+ color: #00732f;
+ text-decoration: none;
+ }
+
+ .indexboxcont:after
+ {
+ content: ".";
+ display: block;
+ height: 0;
+ clear: both;
+ visibility: hidden;
+ }
+
+ .indexbox .indexIcon span
+ {
+ display: block;
+ }
+
+ .indexbox.guide .indexIcon span
+ {
+ width: 96px;
+ height: 137px;
+ background: url(../images/sprites-combined.png) no-repeat -5px -376px;
+ padding: 0;
+ }
+
+ .indexbox.tools .indexIcon span
+ {
+ width: 115px;
+ height: 137px;
+ background: url(../images/sprites-combined.png) no-repeat -111px -376px;
+ padding: 0;
+ }
+
.lastcol
{
display: inline-block;
@@ -916,12 +1022,9 @@
.tricol .lastcol
{
- margin-left:-6px;
+ margin-left: -6px;
}
-
- /*.toc ul*/
-
- /* end page elements */
+ /* end indexbox */
}
/* end of screen media */
@@ -929,7 +1032,7 @@
@media print
{
- .header, .footer, .toolbar, .feedback, .wrapper .hd, .wrapper .bd .sidebar, .wrapper .ft
+ input, textarea, .header, .footer, .toolbar, .feedback, .wrapper .hd, .wrapper .bd .sidebar, .wrapper .ft
{
display: none;
background: none;