summaryrefslogtreecommitdiffstats
path: root/src
diff options
context:
space:
mode:
Diffstat (limited to 'src')
-rw-r--r--src/corelib/codecs/qsimplecodec.cpp2
-rw-r--r--src/corelib/codecs/qtextcodec.cpp46
-rw-r--r--src/gui/embedded/directfb.pri2
-rw-r--r--src/gui/graphicsview/qgraphicsitem.cpp3
-rw-r--r--src/gui/image/qicon.cpp17
-rw-r--r--src/gui/image/qimagereader.cpp28
-rw-r--r--src/gui/image/qpixmapfilter.cpp14
-rw-r--r--src/gui/itemviews/qlistview.cpp2
-rw-r--r--src/gui/kernel/qapplication_s60.cpp11
-rw-r--r--src/gui/kernel/qapplication_win.cpp28
-rw-r--r--src/gui/kernel/qkeymapper_x11.cpp14
-rw-r--r--src/gui/kernel/qwidget.cpp2
-rw-r--r--src/gui/kernel/qwidget_p.h5
-rw-r--r--src/gui/kernel/qwidget_s60.cpp2
-rw-r--r--src/gui/painting/qdrawhelper.cpp36
-rw-r--r--src/gui/painting/qdrawhelper_mmx_p.h45
-rw-r--r--src/gui/painting/qdrawhelper_p.h3
-rw-r--r--src/gui/painting/qemulationpaintengine.cpp5
-rw-r--r--src/gui/painting/qemulationpaintengine_p.h1
-rw-r--r--src/gui/painting/qpaintbuffer.cpp27
-rw-r--r--src/gui/painting/qpaintbuffer_p.h2
-rw-r--r--src/gui/painting/qpaintengine_raster.cpp41
-rw-r--r--src/gui/painting/qpaintengine_raster_p.h5
-rw-r--r--src/gui/painting/qpaintengineex_p.h3
-rw-r--r--src/gui/painting/qpainter.cpp137
-rw-r--r--src/gui/painting/qpainter.h15
-rw-r--r--src/gui/painting/qtextureglyphcache.cpp17
-rw-r--r--src/gui/painting/qtextureglyphcache_p.h10
-rw-r--r--src/gui/painting/qwindowsurface_s60.cpp11
-rw-r--r--src/gui/text/qstatictext.cpp587
-rw-r--r--src/gui/text/qstatictext.h100
-rw-r--r--src/gui/text/qstatictext_p.h145
-rw-r--r--src/gui/text/text.pri7
-rw-r--r--src/gui/widgets/qlinecontrol.cpp2
-rw-r--r--src/network/access/qhttpnetworkconnectionchannel.cpp7
-rw-r--r--src/network/access/qhttpnetworkreply.cpp68
-rw-r--r--src/network/access/qnetworkcookie.h2
-rw-r--r--src/network/access/qnetworkcookiejar.h2
-rw-r--r--src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp6
-rw-r--r--src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h30
-rw-r--r--src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp161
-rw-r--r--src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h5
-rw-r--r--src/opengl/qgl_mac.mm2
-rw-r--r--src/opengl/qgl_p.h4
-rw-r--r--src/opengl/qglextensions_p.h8
-rw-r--r--src/opengl/qglpixmapfilter.cpp1
-rw-r--r--src/opengl/qpaintengine_opengl.cpp94
-rw-r--r--src/opengl/qpaintengine_opengl_p.h1
-rw-r--r--src/openvg/qpaintengine_vg.cpp73
-rw-r--r--src/openvg/qpaintengine_vg_p.h4
-rw-r--r--src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp10
-rw-r--r--src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h2
-rw-r--r--src/qt3support/dialogs/q3filedialog.cpp40
-rw-r--r--src/qt3support/itemviews/q3iconview.cpp13
-rw-r--r--src/qt3support/itemviews/q3listview.cpp3
-rw-r--r--src/sql/drivers/odbc/qsql_odbc.cpp37
-rw-r--r--src/sql/drivers/sqlite/qsql_sqlite.cpp47
-rw-r--r--src/sql/kernel/qsqldatabase.cpp1
-rw-r--r--src/xmlpatterns/data/qatomicvalue.cpp2
59 files changed, 1687 insertions, 311 deletions
diff --git a/src/corelib/codecs/qsimplecodec.cpp b/src/corelib/codecs/qsimplecodec.cpp
index 445565a..4cc7912 100644
--- a/src/corelib/codecs/qsimplecodec.cpp
+++ b/src/corelib/codecs/qsimplecodec.cpp
@@ -681,7 +681,7 @@ QByteArray QSimpleTextCodec::convertFromUnicode(const QChar *in, int length, Con
int u;
const QChar* ucp = in;
unsigned char* rp = (unsigned char *)r.data();
- const unsigned char* rmp = (const unsigned char *)reverseMap->data();
+ const unsigned char* rmp = (const unsigned char *)reverseMap->constData();
int rmsize = (int) reverseMap->size();
while(i--)
{
diff --git a/src/corelib/codecs/qtextcodec.cpp b/src/corelib/codecs/qtextcodec.cpp
index 43ea1c8..1c607a6 100644
--- a/src/corelib/codecs/qtextcodec.cpp
+++ b/src/corelib/codecs/qtextcodec.cpp
@@ -79,7 +79,7 @@
# endif
#endif // QT_NO_CODECS
#include "qlocale.h"
-#include "private/qmutexpool_p.h"
+#include "qmutex.h"
#include <stdlib.h>
#include <ctype.h>
@@ -659,13 +659,13 @@ static void setupLocaleMapper()
#endif
}
-
-static void setup()
-{
#ifndef QT_NO_THREAD
- QMutexLocker locker(QMutexPool::globalInstanceGet(&all));
+Q_GLOBAL_STATIC_WITH_ARGS(QMutex, textCodecsMutex, (QMutex::Recursive));
#endif
+// textCodecsMutex need to be locked to enter this function
+static void setup()
+{
if (all)
return;
@@ -903,8 +903,6 @@ QTextCodec::ConverterState::~ConverterState()
*/
/*!
- \nonreentrant
-
Constructs a QTextCodec, and gives it the highest precedence. The
QTextCodec should always be constructed on the heap (i.e. with \c
new). Qt takes ownership and will delete it when the application
@@ -912,6 +910,9 @@ QTextCodec::ConverterState::~ConverterState()
*/
QTextCodec::QTextCodec()
{
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
all->prepend(this);
}
@@ -929,8 +930,12 @@ QTextCodec::~QTextCodec()
if (!destroying_is_ok)
qWarning("QTextCodec::~QTextCodec: Called by application");
#endif
- if (all)
+ if (all) {
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
all->removeAll(this);
+ }
}
/*!
@@ -951,6 +956,9 @@ QTextCodec *QTextCodec::codecForName(const QByteArray &name)
if (name.isEmpty())
return 0;
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
for (int i = 0; i < all->size(); ++i) {
@@ -973,6 +981,9 @@ QTextCodec *QTextCodec::codecForName(const QByteArray &name)
*/
QTextCodec* QTextCodec::codecForMib(int mib)
{
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
// Qt 3 used 1000 (mib for UCS2) as its identifier for the utf16 codec. Map
@@ -1001,6 +1012,9 @@ QTextCodec* QTextCodec::codecForMib(int mib)
*/
QList<QByteArray> QTextCodec::availableCodecs()
{
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
QList<QByteArray> codecs;
@@ -1008,6 +1022,11 @@ QList<QByteArray> QTextCodec::availableCodecs()
codecs += all->at(i)->name();
codecs += all->at(i)->aliases();
}
+
+#ifndef QT_NO_THREAD
+ locker.unlock();
+#endif
+
#ifndef QT_NO_TEXTCODECPLUGIN
QFactoryLoader *l = loader();
QStringList keys = l->keys();
@@ -1031,11 +1050,19 @@ QList<QByteArray> QTextCodec::availableCodecs()
*/
QList<int> QTextCodec::availableMibs()
{
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
QList<int> codecs;
for (int i = 0; i < all->size(); ++i)
codecs += all->at(i)->mibEnum();
+
+#ifndef QT_NO_THREAD
+ locker.unlock();
+#endif
+
#ifndef QT_NO_TEXTCODECPLUGIN
QFactoryLoader *l = loader();
QStringList keys = l->keys();
@@ -1082,6 +1109,9 @@ QTextCodec* QTextCodec::codecForLocale()
if (localeMapper)
return localeMapper;
+#ifndef QT_NO_THREAD
+ QMutexLocker locker(textCodecsMutex());
+#endif
setup();
return localeMapper;
diff --git a/src/gui/embedded/directfb.pri b/src/gui/embedded/directfb.pri
index bd1d947..d6d77b4 100644
--- a/src/gui/embedded/directfb.pri
+++ b/src/gui/embedded/directfb.pri
@@ -15,7 +15,7 @@
#DEFINES += QT_DIRECTFB_TIMING
#DEFINES += QT_NO_DIRECTFB_OPAQUE_DETECTION
#DEFINES += QT_NO_DIRECTFB_STRETCHBLIT
-#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT
+#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT|DRAW_STATICTEXT
#DEFINES += \"QT_DIRECTFB_WARN_ON_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\"
#DEFINES += \"QT_DIRECTFB_DISABLE_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\"
diff --git a/src/gui/graphicsview/qgraphicsitem.cpp b/src/gui/graphicsview/qgraphicsitem.cpp
index b4e19d1..39c41c4 100644
--- a/src/gui/graphicsview/qgraphicsitem.cpp
+++ b/src/gui/graphicsview/qgraphicsitem.cpp
@@ -1392,7 +1392,8 @@ QGraphicsItem::~QGraphicsItem()
}
delete d_ptr->transformData;
- qt_dataStore()->data.remove(this);
+ if (QGraphicsItemCustomDataStore *dataStore = qt_dataStore())
+ dataStore->data.remove(this);
}
/*!
diff --git a/src/gui/image/qicon.cpp b/src/gui/image/qicon.cpp
index ac1d303..bf6eb8d 100644
--- a/src/gui/image/qicon.cpp
+++ b/src/gui/image/qicon.cpp
@@ -104,6 +104,15 @@ QT_BEGIN_NAMESPACE
static QBasicAtomicInt serialNumCounter = Q_BASIC_ATOMIC_INITIALIZER(1);
+static void qt_cleanup_icon_cache();
+typedef QCache<QString, QIcon> IconCache;
+Q_GLOBAL_STATIC_WITH_INITIALIZER(IconCache, qtIconCache, qAddPostRoutine(qt_cleanup_icon_cache))
+
+static void qt_cleanup_icon_cache()
+{
+ qtIconCache()->clear();
+}
+
QIconPrivate::QIconPrivate()
: engine(0), ref(1),
serialNum(serialNumCounter.fetchAndAddRelaxed(1)),
@@ -963,15 +972,13 @@ QString QIcon::themeName()
*/
QIcon QIcon::fromTheme(const QString &name, const QIcon &fallback)
{
- static QCache <QString, QIcon> iconCache;
-
QIcon icon;
- if (iconCache.contains(name)) {
- icon = *iconCache.object(name);
+ if (qtIconCache()->contains(name)) {
+ icon = *qtIconCache()->object(name);
} else {
QIcon *cachedIcon = new QIcon(new QIconLoaderEngine(name));
- iconCache.insert(name, cachedIcon);
+ qtIconCache()->insert(name, cachedIcon);
icon = *cachedIcon;
}
diff --git a/src/gui/image/qimagereader.cpp b/src/gui/image/qimagereader.cpp
index c9e015c..9320cfc 100644
--- a/src/gui/image/qimagereader.cpp
+++ b/src/gui/image/qimagereader.cpp
@@ -263,25 +263,37 @@ static QImageIOHandler *createReadHandlerHelper(QIODevice *device,
device->seek(pos);
}
- if (!handler && !testFormat.isEmpty() && autoDetectImageFormat && !ignoresFormatAndExtension) {
+ if (!handler && !testFormat.isEmpty() && !ignoresFormatAndExtension) {
// check if any plugin supports the format (they are not allowed to
// read from the device yet).
const qint64 pos = device ? device->pos() : 0;
- for (int i = 0; i < keys.size(); ++i) {
- if (i != suffixPluginIndex) {
- QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i)));
- if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) {
+
+ if (autoDetectImageFormat) {
+ for (int i = 0; i < keys.size(); ++i) {
+ if (i != suffixPluginIndex) {
+ QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i)));
+ if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) {
#ifdef QIMAGEREADER_DEBUG
- qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format";
+ qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format";
#endif
- handler = plugin->create(device, testFormat);
- break;
+ handler = plugin->create(device, testFormat);
+ break;
+ }
}
}
+ } else {
+ QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(QLatin1String(testFormat)));
+ if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) {
+#ifdef QIMAGEREADER_DEBUG
+ qDebug() << "QImageReader::createReadHandler: the" << testFormat << "plugin can read this format";
+#endif
+ handler = plugin->create(device, testFormat);
+ }
}
if (device && !device->isSequential())
device->seek(pos);
}
+
#endif // QT_NO_LIBRARY
// if we don't have a handler yet, check if we have built-in support for
diff --git a/src/gui/image/qpixmapfilter.cpp b/src/gui/image/qpixmapfilter.cpp
index 37a6a18..7cf942c 100644
--- a/src/gui/image/qpixmapfilter.cpp
+++ b/src/gui/image/qpixmapfilter.cpp
@@ -422,6 +422,9 @@ void QPixmapConvolutionFilter::draw(QPainter *painter, const QPointF &p, const Q
if(d->kernelWidth<=0 || d->kernelHeight <= 0)
return;
+ if (src.isNull())
+ return;
+
QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ?
static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0;
QPixmapConvolutionFilter *convolutionFilter = static_cast<QPixmapConvolutionFilter*>(filter);
@@ -902,6 +905,9 @@ void QPixmapBlurFilter::draw(QPainter *painter, const QPointF &p, const QPixmap
if (!painter->isActive())
return;
+ if (src.isNull())
+ return;
+
QRectF srcRect = rect;
if (srcRect.isNull())
srcRect = src.rect();
@@ -1082,6 +1088,10 @@ void QPixmapColorizeFilter::setStrength(qreal strength)
void QPixmapColorizeFilter::draw(QPainter *painter, const QPointF &dest, const QPixmap &src, const QRectF &srcRect) const
{
Q_D(const QPixmapColorizeFilter);
+
+ if (src.isNull())
+ return;
+
QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ?
static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0;
QPixmapColorizeFilter *colorizeFilter = static_cast<QPixmapColorizeFilter*>(filter);
@@ -1312,6 +1322,10 @@ void QPixmapDropShadowFilter::draw(QPainter *p,
const QRectF &src) const
{
Q_D(const QPixmapDropShadowFilter);
+
+ if (px.isNull())
+ return;
+
QPixmapFilter *filter = p->paintEngine() && p->paintEngine()->isExtended() ?
static_cast<QPaintEngineEx *>(p->paintEngine())->pixmapFilter(type(), this) : 0;
QPixmapDropShadowFilter *dropShadowFilter = static_cast<QPixmapDropShadowFilter*>(filter);
diff --git a/src/gui/itemviews/qlistview.cpp b/src/gui/itemviews/qlistview.cpp
index 19b1e8c..b2def39 100644
--- a/src/gui/itemviews/qlistview.cpp
+++ b/src/gui/itemviews/qlistview.cpp
@@ -2160,7 +2160,7 @@ void QListModeViewBase::scrollContentsBy(int dx, int dy, bool scrollElasticBand)
} else {
if (flowPositions.isEmpty())
return;
- const int max = flowPositions.count() - 1;
+ const int max = scrollValueMap.count() - 1;
if (vertical && flow() == QListView::TopToBottom && dy != 0) {
int currentValue = qBound(0, verticalValue, max);
int previousValue = qBound(0, currentValue + dy, max);
diff --git a/src/gui/kernel/qapplication_s60.cpp b/src/gui/kernel/qapplication_s60.cpp
index 87de602..3e2e6f6 100644
--- a/src/gui/kernel/qapplication_s60.cpp
+++ b/src/gui/kernel/qapplication_s60.cpp
@@ -809,12 +809,15 @@ TCoeInputCapabilities QSymbianControl::InputCapabilities() const
void QSymbianControl::Draw(const TRect& controlRect) const
{
// Set flag to avoid calling DrawNow in window surface
- QWExtra *extra = qwidget->d_func()->extraData();
- if (extra && !extra->inExpose) {
- extra->inExpose = true;
+ QWidget *window = qwidget->window();
+ Q_ASSERT(window);
+ QTLWExtra *topExtra = window->d_func()->maybeTopData();
+ Q_ASSERT(topExtra);
+ if (!topExtra->inExpose) {
+ topExtra->inExpose = true;
QRect exposeRect = qt_TRect2QRect(controlRect);
qwidget->d_func()->syncBackingStore(exposeRect);
- extra->inExpose = false;
+ topExtra->inExpose = false;
}
QWindowSurface *surface = qwidget->windowSurface();
diff --git a/src/gui/kernel/qapplication_win.cpp b/src/gui/kernel/qapplication_win.cpp
index 3355272..0a4869b 100644
--- a/src/gui/kernel/qapplication_win.cpp
+++ b/src/gui/kernel/qapplication_win.cpp
@@ -928,7 +928,11 @@ const QString qt_reg_winclass(QWidget *w) // register window class
uint style;
bool icon;
QString cname;
- if (flags & Qt::MSWindowsOwnDC) {
+ if (qt_widget_private(w)->isGLWidget) {
+ cname = QLatin1String("QGLWidget");
+ style = CS_DBLCLKS;
+ icon = true;
+ } else if (flags & Qt::MSWindowsOwnDC) {
cname = QLatin1String("QWidgetOwnDC");
style = CS_DBLCLKS;
#ifndef Q_WS_WINCE
@@ -1021,7 +1025,7 @@ const QString qt_reg_winclass(QWidget *w) // register window class
}
wc.hCursor = 0;
#ifndef Q_WS_WINCE
- wc.hbrBackground = (HBRUSH)GetSysColorBrush(COLOR_WINDOW);
+ wc.hbrBackground = qt_widget_private(w)->isGLWidget ? 0 : (HBRUSH)GetSysColorBrush(COLOR_WINDOW);
#else
wc.hbrBackground = 0;
#endif
@@ -3616,13 +3620,19 @@ bool QETWidget::translatePaintEvent(const MSG &msg)
return true;
setAttribute(Qt::WA_PendingUpdate, false);
- const QRegion dirtyInBackingStore(qt_dirtyRegion(this));
- // Make sure the invalidated region contains the region we're about to repaint.
- // BeginPaint will set the clip to the invalidated region and it is impossible
- // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient
- // as it may return an invalid context (especially on Windows Vista).
- if (!dirtyInBackingStore.isEmpty())
- InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false);
+
+ if (d_func()->isGLWidget) {
+ if (d_func()->usesDoubleBufferedGLContext)
+ InvalidateRect(internalWinId(), 0, false);
+ } else {
+ const QRegion dirtyInBackingStore(qt_dirtyRegion(this));
+ // Make sure the invalidated region contains the region we're about to repaint.
+ // BeginPaint will set the clip to the invalidated region and it is impossible
+ // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient
+ // as it may return an invalid context (especially on Windows Vista).
+ if (!dirtyInBackingStore.isEmpty())
+ InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false);
+ }
PAINTSTRUCT ps;
d_func()->hd = BeginPaint(internalWinId(), &ps);
diff --git a/src/gui/kernel/qkeymapper_x11.cpp b/src/gui/kernel/qkeymapper_x11.cpp
index 70574e7..4e6c847 100644
--- a/src/gui/kernel/qkeymapper_x11.cpp
+++ b/src/gui/kernel/qkeymapper_x11.cpp
@@ -360,6 +360,13 @@ QList<int> QKeyMapperPrivate::possibleKeysXKB(QKeyEvent *event)
if (code && code < 0xfffe)
code = QChar(code).toUpper().unicode();
+
+ if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) {
+ // map shift+tab to shift+backtab
+ code = Qt::Key_Backtab;
+ text = QString();
+ }
+
if (code == baseCode)
continue;
@@ -448,6 +455,13 @@ QList<int> QKeyMapperPrivate::possibleKeysCore(QKeyEvent *event)
if (code && code < 0xfffe)
code = QChar(code).toUpper().unicode();
+
+ if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) {
+ // map shift+tab to shift+backtab
+ code = Qt::Key_Backtab;
+ text = QString();
+ }
+
if (code == baseCode)
continue;
diff --git a/src/gui/kernel/qwidget.cpp b/src/gui/kernel/qwidget.cpp
index 2e951b6..1e92507 100644
--- a/src/gui/kernel/qwidget.cpp
+++ b/src/gui/kernel/qwidget.cpp
@@ -192,6 +192,7 @@ QWidgetPrivate::QWidgetPrivate(int version)
, inDirtyList(0)
, isScrolled(0)
, isMoved(0)
+ , isGLWidget(0)
, usesDoubleBufferedGLContext(0)
#if defined(Q_WS_X11)
, picture(0)
@@ -200,7 +201,6 @@ QWidgetPrivate::QWidgetPrivate(int version)
, nativeGesturePanEnabled(0)
#elif defined(Q_WS_MAC)
, needWindowChange(0)
- , isGLWidget(0)
, window_event(0)
, qd_hd(0)
#endif
diff --git a/src/gui/kernel/qwidget_p.h b/src/gui/kernel/qwidget_p.h
index ff8f276..75b4c12 100644
--- a/src/gui/kernel/qwidget_p.h
+++ b/src/gui/kernel/qwidget_p.h
@@ -174,6 +174,8 @@ struct QTLWExtra {
#ifndef QT_NO_QWS_MANAGER
QWSManager *qwsManager;
#endif
+#elif defined(Q_OS_SYMBIAN)
+ uint inExpose : 1; // Prevents drawing recursion
#endif
};
@@ -230,7 +232,6 @@ struct QWExtra {
#endif
#elif defined(Q_OS_SYMBIAN) // <----------------------------------------------------- Symbian
uint activated : 1; // RWindowBase::Activated has been called
- uint inExpose : 1; // Prevents drawing recursion
/**
* Defines the behaviour of QSymbianControl::Draw.
@@ -685,6 +686,7 @@ public:
uint inDirtyList : 1;
uint isScrolled : 1;
uint isMoved : 1;
+ uint isGLWidget : 1;
uint usesDoubleBufferedGLContext : 1;
// *************************** Platform specific ************************************
@@ -716,7 +718,6 @@ public:
#elif defined(Q_WS_MAC) // <--------------------------------------------------------- MAC
// This is new stuff
uint needWindowChange : 1;
- uint isGLWidget : 1;
// Each wiget keeps a list of all its child and grandchild OpenGL widgets.
// This list is used to update the gl context whenever a parent and a granparent
diff --git a/src/gui/kernel/qwidget_s60.cpp b/src/gui/kernel/qwidget_s60.cpp
index a844430..ebd289c 100644
--- a/src/gui/kernel/qwidget_s60.cpp
+++ b/src/gui/kernel/qwidget_s60.cpp
@@ -878,6 +878,7 @@ void QWidgetPrivate::registerDropSite(bool /* on */)
void QWidgetPrivate::createTLSysExtra()
{
extra->topextra->backingStore = 0;
+ extra->topextra->inExpose = 0;
}
void QWidgetPrivate::deleteTLSysExtra()
@@ -891,7 +892,6 @@ void QWidgetPrivate::createSysExtra()
extra->activated = 0;
extra->nativePaintMode = QWExtra::Default;
extra->receiveNativePaintEvents = 0;
- extra->inExpose = 0;
}
void QWidgetPrivate::deleteSysExtra()
diff --git a/src/gui/painting/qdrawhelper.cpp b/src/gui/painting/qdrawhelper.cpp
index 660a2a8..7a3da20 100644
--- a/src/gui/painting/qdrawhelper.cpp
+++ b/src/gui/painting/qdrawhelper.cpp
@@ -1267,32 +1267,28 @@ static const uint L2CacheLineLengthInInts = L2CacheLineLength/sizeof(uint);
result = 0
d = d * cia
*/
+#define comp_func_Clear_impl(dest, length, const_alpha)\
+{\
+ if (const_alpha == 255) {\
+ QT_MEMFILL_UINT(dest, length, 0);\
+ } else {\
+ int ialpha = 255 - const_alpha;\
+ PRELOAD_INIT(dest)\
+ for (int i = 0; i < length; ++i) {\
+ PRELOAD_COND(dest)\
+ dest[i] = BYTE_MUL(dest[i], ialpha);\
+ }\
+ }\
+}
+
static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha)
{
- if (const_alpha == 255) {
- QT_MEMFILL_UINT(dest, length, 0);
- } else {
- int ialpha = 255 - const_alpha;
- PRELOAD_INIT(dest)
- for (int i = 0; i < length; ++i) {
- PRELOAD_COND(dest)
- dest[i] = BYTE_MUL(dest[i], ialpha);
- }
- }
+ comp_func_Clear_impl(dest, length, const_alpha);
}
static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha)
{
- if (const_alpha == 255) {
- QT_MEMFILL_UINT(dest, length, 0);
- } else {
- int ialpha = 255 - const_alpha;
- PRELOAD_INIT(dest)
- for (int i = 0; i < length; ++i) {
- PRELOAD_COND(dest)
- dest[i] = BYTE_MUL(dest[i], ialpha);
- }
- }
+ comp_func_Clear_impl(dest, length, const_alpha);
}
/*
diff --git a/src/gui/painting/qdrawhelper_mmx_p.h b/src/gui/painting/qdrawhelper_mmx_p.h
index 8482262..59b3804 100644
--- a/src/gui/painting/qdrawhelper_mmx_p.h
+++ b/src/gui/painting/qdrawhelper_mmx_p.h
@@ -146,36 +146,30 @@ struct QMMXCommonIntrinsics
result = 0
d = d * cia
*/
+#define comp_func_Clear_impl(dest, length, const_alpha)\
+{\
+ if (const_alpha == 255) {\
+ qt_memfill(static_cast<quint32*>(dest), quint32(0), length);\
+ } else {\
+ C_FF; C_80; C_00;\
+ m64 ia = MM::negate(MM::load_alpha(const_alpha));\
+ for (int i = 0; i < length; ++i) {\
+ dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia));\
+ }\
+ MM::end();\
+ }\
+}
+
template <class MM>
static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha)
{
- if (!length)
- return;
-
- if (const_alpha == 255) {
- qt_memfill(static_cast<quint32*>(dest), quint32(0), length);
- } else {
- C_FF; C_80; C_00;
- m64 ia = MM::negate(MM::load_alpha(const_alpha));
- for (int i = 0; i < length; ++i) {
- dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia));
- }
- }
- MM::end();
+ comp_func_Clear_impl(dest, length, const_alpha);
}
template <class MM>
static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha)
{
- if (const_alpha == 255) {
- qt_memfill(static_cast<quint32*>(dest), quint32(0), length);
- } else {
- C_FF; C_80; C_00;
- m64 ia = MM::negate(MM::load_alpha(const_alpha));
- for (int i = 0; i < length; ++i)
- dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia));
- }
- MM::end();
+ comp_func_Clear_impl(dest, length, const_alpha);
}
/*
@@ -246,7 +240,10 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le
C_FF; C_80; C_00;
if (const_alpha == 255) {
for (int i = 0; i < length; ++i) {
- if ((0xff000000 & src[i]) == 0xff000000) {
+ const uint alphaMaskedSource = 0xff000000 & src[i];
+ if (alphaMaskedSource == 0)
+ continue;
+ if (alphaMaskedSource == 0xff000000) {
dest[i] = src[i];
} else {
m64 s = MM::load(src[i]);
@@ -257,6 +254,8 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le
} else {
m64 ca = MM::load_alpha(const_alpha);
for (int i = 0; i < length; ++i) {
+ if ((0xff000000 & src[i]) == 0)
+ continue;
m64 s = MM::byte_mul(MM::load(src[i]), ca);
m64 ia = MM::negate(MM::alpha(s));
dest[i] = MM::store(MM::add(s, MM::byte_mul(MM::load(dest[i]), ia)));
diff --git a/src/gui/painting/qdrawhelper_p.h b/src/gui/painting/qdrawhelper_p.h
index 6c47aac..cb0db4f 100644
--- a/src/gui/painting/qdrawhelper_p.h
+++ b/src/gui/painting/qdrawhelper_p.h
@@ -1549,6 +1549,9 @@ template<> inline void qt_memfill(quint8 *dest, quint8 color, int count)
template <class T>
inline void qt_memfill(T *dest, T value, int count)
{
+ if (!count)
+ return;
+
int n = (count + 7) / 8;
switch (count & 0x07)
{
diff --git a/src/gui/painting/qemulationpaintengine.cpp b/src/gui/painting/qemulationpaintengine.cpp
index fd42736..0510b10 100644
--- a/src/gui/painting/qemulationpaintengine.cpp
+++ b/src/gui/painting/qemulationpaintengine.cpp
@@ -205,6 +205,11 @@ void QEmulationPaintEngine::drawTextItem(const QPointF &p, const QTextItem &text
real_engine->drawTextItem(p, textItem);
}
+void QEmulationPaintEngine::drawStaticTextItem(QStaticTextItem *item)
+{
+ real_engine->drawStaticTextItem(item);
+}
+
void QEmulationPaintEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s)
{
if (state()->bgMode == Qt::OpaqueMode && pixmap.isQBitmap())
diff --git a/src/gui/painting/qemulationpaintengine_p.h b/src/gui/painting/qemulationpaintengine_p.h
index 0ed641b..5835f10 100644
--- a/src/gui/painting/qemulationpaintengine_p.h
+++ b/src/gui/painting/qemulationpaintengine_p.h
@@ -78,6 +78,7 @@ public:
virtual void drawPixmap(const QRectF &r, const QPixmap &pm, const QRectF &sr);
virtual void drawTextItem(const QPointF &p, const QTextItem &textItem);
+ virtual void drawStaticTextItem(QStaticTextItem *item);
virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s);
virtual void drawImage(const QRectF &r, const QImage &pm, const QRectF &sr, Qt::ImageConversionFlags flags);
diff --git a/src/gui/painting/qpaintbuffer.cpp b/src/gui/painting/qpaintbuffer.cpp
index 2344c04..664d864 100644
--- a/src/gui/painting/qpaintbuffer.cpp
+++ b/src/gui/painting/qpaintbuffer.cpp
@@ -45,6 +45,8 @@
#include <private/qfontengine_p.h>
#include <private/qemulationpaintengine_p.h>
#include <private/qimage_p.h>
+#include <qstatictext.h>
+#include <private/qstatictext_p.h>
#include <QDebug>
@@ -960,6 +962,18 @@ void QPaintBufferEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pm, con
buffer->updateBoundingRect(r);
}
+void QPaintBufferEngine::drawStaticTextItem(QStaticTextItem *staticTextItem)
+{
+ QString text = QString(staticTextItem->chars, staticTextItem->numChars);
+
+ QStaticText staticText(text);
+ staticText.prepare(state()->matrix, staticTextItem->font);
+
+ QVariantList variants;
+ variants << QVariant(staticTextItem->font) << QVariant::fromValue(staticText);
+ buffer->addCommand(QPaintBufferPrivate::Cmd_DrawStaticText, QVariant(variants));
+}
+
void QPaintBufferEngine::drawTextItem(const QPointF &pos, const QTextItem &ti)
{
#ifdef QPAINTBUFFER_DEBUG_DRAW
@@ -1425,6 +1439,19 @@ void QPainterReplayer::process(const QPaintBufferCommand &cmd)
#endif
painter->setClipRegion(region, Qt::ClipOperation(cmd.extra));
break; }
+
+ case QPaintBufferPrivate::Cmd_DrawStaticText: {
+
+ QVariantList variants(d->variants.at(cmd.offset).value<QVariantList>());
+
+ QFont font(variants.at(0).value<QFont>());
+ QStaticText text(variants.at(0).value<QStaticText>());
+
+ painter->setFont(font);
+ painter->drawStaticText(QPointF(0, 0), text);
+
+ break;
+ }
case QPaintBufferPrivate::Cmd_DrawText: {
QPointF pos(d->floats.at(cmd.extra), d->floats.at(cmd.extra+1));
diff --git a/src/gui/painting/qpaintbuffer_p.h b/src/gui/painting/qpaintbuffer_p.h
index 79d7b35..41a26c5 100644
--- a/src/gui/painting/qpaintbuffer_p.h
+++ b/src/gui/painting/qpaintbuffer_p.h
@@ -175,6 +175,7 @@ public:
Cmd_DrawText,
Cmd_DrawTextItem,
+ Cmd_DrawStaticText,
Cmd_DrawImagePos,
Cmd_DrawImageRect,
@@ -394,6 +395,7 @@ public:
virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s);
virtual void drawTextItem(const QPointF &pos, const QTextItem &ti);
+ virtual void drawStaticTextItem(QStaticTextItem *staticTextItem);
virtual void setState(QPainterState *s);
virtual uint flags() const {return QPaintEngineEx::DoNotEmulate;}
diff --git a/src/gui/painting/qpaintengine_raster.cpp b/src/gui/painting/qpaintengine_raster.cpp
index bc56ed0..41c4f14 100644
--- a/src/gui/painting/qpaintengine_raster.cpp
+++ b/src/gui/painting/qpaintengine_raster.cpp
@@ -67,6 +67,7 @@
// #include <private/qpolygonclipper_p.h>
// #include <private/qrasterizer_p.h>
#include <private/qimage_p.h>
+#include <private/qstatictext_p.h>
#include "qpaintengine_raster_p.h"
// #include "qbezier_p.h"
@@ -3006,27 +3007,22 @@ void QRasterPaintEngine::alphaPenBlt(const void* src, int bpl, int depth, int rx
blend(current, spans, &s->penData);
}
-void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti)
+void QRasterPaintEngine::drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs,
+ const QFixedPoint *positions, QFontEngine *fontEngine)
{
Q_D(QRasterPaintEngine);
QRasterPaintEngineState *s = state();
- QVarLengthArray<QFixedPoint> positions;
- QVarLengthArray<glyph_t> glyphs;
- QTransform matrix = s->matrix;
- matrix.translate(p.x(), p.y());
- ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
-
- QFontEngineGlyphCache::Type glyphType = ti.fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(ti.fontEngine->glyphFormat) : d->glyphCacheType;
+ QFontEngineGlyphCache::Type glyphType = fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(fontEngine->glyphFormat) : d->glyphCacheType;
QImageTextureGlyphCache *cache =
- (QImageTextureGlyphCache *) ti.fontEngine->glyphCache(0, glyphType, s->matrix);
+ static_cast<QImageTextureGlyphCache *>(fontEngine->glyphCache(0, glyphType, s->matrix));
if (!cache) {
cache = new QImageTextureGlyphCache(glyphType, s->matrix);
- ti.fontEngine->setGlyphCache(0, cache);
+ fontEngine->setGlyphCache(0, cache);
}
- cache->populate(ti, glyphs, positions);
+ cache->populate(fontEngine, numGlyphs, glyphs, positions);
const QImage &image = cache->image();
int bpl = image.bytesPerLine();
@@ -3044,7 +3040,7 @@ void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt &
const QFixed offs = QFixed::fromReal(aliasedCoordinateDelta);
const uchar *bits = image.bits();
- for (int i=0; i<glyphs.size(); ++i) {
+ for (int i=0; i<numGlyphs; ++i) {
const QTextureGlyphCache::Coord &c = cache->coords.value(glyphs[i]);
int x = qFloor(positions[i].x + offs) + c.baseLineX - margin;
int y = qFloor(positions[i].y + offs) - c.baseLineY - margin;
@@ -3221,6 +3217,15 @@ QRasterPaintEnginePrivate::getPenFunc(const QRectF &rect,
return isUnclipped(rect, penWidth) ? data->unclipped_blend : data->blend;
}
+void QRasterPaintEngine::drawStaticTextItem(QStaticTextItem *textItem)
+{
+ ensurePen();
+ ensureState();
+
+ drawCachedGlyphs(textItem->numGlyphs, textItem->glyphs, textItem->glyphPositions,
+ textItem->fontEngine);
+}
+
/*!
\reimp
*/
@@ -3269,7 +3274,17 @@ void QRasterPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte
drawCached = false;
#endif
if (drawCached) {
- drawCachedGlyphs(p, ti);
+ QRasterPaintEngineState *s = state();
+
+ QVarLengthArray<QFixedPoint> positions;
+ QVarLengthArray<glyph_t> glyphs;
+
+ QTransform matrix = s->matrix;
+ matrix.translate(p.x(), p.y());
+
+ ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
+
+ drawCachedGlyphs(glyphs.size(), glyphs.constData(), positions.constData(), ti.fontEngine);
return;
}
diff --git a/src/gui/painting/qpaintengine_raster_p.h b/src/gui/painting/qpaintengine_raster_p.h
index a1c73cc..55eb82e 100644
--- a/src/gui/painting/qpaintengine_raster_p.h
+++ b/src/gui/painting/qpaintengine_raster_p.h
@@ -203,6 +203,8 @@ public:
void clip(const QRect &rect, Qt::ClipOperation op);
void clip(const QRegion &region, Qt::ClipOperation op);
+ void drawStaticTextItem(QStaticTextItem *textItem);
+
enum ClipType {
RectClip,
ComplexClip
@@ -257,7 +259,8 @@ private:
void fillRect(const QRectF &rect, QSpanData *data);
void drawBitmap(const QPointF &pos, const QImage &image, QSpanData *fill);
- void drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti);
+ void drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFixedPoint *positions,
+ QFontEngine *fontEngine);
#if defined(Q_OS_SYMBIAN) && defined(QT_NO_FREETYPE)
void drawGlyphsS60(const QPointF &p, const QTextItemInt &ti);
diff --git a/src/gui/painting/qpaintengineex_p.h b/src/gui/painting/qpaintengineex_p.h
index fccd1dc..90c4f9f 100644
--- a/src/gui/painting/qpaintengineex_p.h
+++ b/src/gui/painting/qpaintengineex_p.h
@@ -70,6 +70,7 @@ QT_MODULE(Gui)
class QPainterState;
class QPaintEngineExPrivate;
+class QStaticTextItem;
struct StrokeHandler;
struct QIntRect {
@@ -200,6 +201,8 @@ public:
virtual void updateState(const QPaintEngineState &state);
+ virtual void drawStaticTextItem(QStaticTextItem *) = 0;
+
virtual void setState(QPainterState *s);
inline QPainterState *state() { return static_cast<QPainterState *>(QPaintEngine::state); }
inline const QPainterState *state() const { return static_cast<const QPainterState *>(QPaintEngine::state); }
diff --git a/src/gui/painting/qpainter.cpp b/src/gui/painting/qpainter.cpp
index bf12c6b..2b5a0c5 100644
--- a/src/gui/painting/qpainter.cpp
+++ b/src/gui/painting/qpainter.cpp
@@ -69,6 +69,8 @@
#include <private/qwidget_p.h>
#include <private/qpaintengine_raster_p.h>
#include <private/qmath_p.h>
+#include <qstatictext.h>
+#include <private/qstatictext_p.h>
QT_BEGIN_NAMESPACE
@@ -1986,12 +1988,25 @@ QPaintEngine *QPainter::paintEngine() const
endNativePainting().
Note that only the states the underlying paint engine changes will be reset
- to their respective default states. If, for example, the OpenGL polygon
- mode is changed by the user inside a beginNativePaint()/endNativePainting()
- block, it will not be reset to the default state by endNativePainting().
+ to their respective default states. The states we reset may change from
+ release to release. The following states are currently reset in the OpenGL
+ 2 engine:
- Here is an example that shows intermixing of painter commands
- and raw OpenGL commands:
+ \list
+ \i blending is disabled
+ \i the depth, stencil and scissor tests are disabled
+ \i the active texture unit is reset to 0
+ \i the depth mask, depth function and the clear depth are reset to their
+ default values
+ \i the stencil mask, stencil operation and stencil function are reset to
+ their default values
+ \i the current color is reset to solid white
+ \endlist
+
+ If, for example, the OpenGL polygon mode is changed by the user inside a
+ beginNativePaint()/endNativePainting() block, it will not be reset to the
+ default state by endNativePainting(). Here is an example that shows
+ intermixing of painter commands and raw OpenGL commands:
\snippet doc/src/snippets/code/src_gui_painting_qpainter.cpp 21
@@ -5684,6 +5699,19 @@ void QPainter::drawImage(const QRectF &targetRect, const QImage &image, const QR
}
/*!
+
+ \fn void QPainter::drawStaticText(const QPoint &position, const QStaticText &staticText)
+
+ \overload
+*/
+
+/*!
+ \fn void QPainter::drawStaticText(int x, int y, const QStaticText &staticText)
+
+ \overload
+*/
+
+/*!
\fn void QPainter::drawText(const QPointF &position, const QString &text)
Draws the given \a text with the currently defined text direction,
@@ -5705,6 +5733,105 @@ void QPainter::drawText(const QPointF &p, const QString &str)
drawText(p, str, 0, 0);
}
+void QPainter::drawStaticText(const QPointF &position, const QStaticText &staticText)
+{
+ Q_D(QPainter);
+ if (!d->engine || staticText.isEmpty() || pen().style() == Qt::NoPen)
+ return;
+
+ QStaticTextPrivate *staticText_d =
+ const_cast<QStaticTextPrivate *>(QStaticTextPrivate::get(&staticText));
+
+ // If we don't have an extended paint engine, or if the painter is projected,
+ // we go through standard code path
+ if (d->extended == 0 || !d->state->matrix.isAffine()) {
+ staticText_d->paintText(this);
+ return;
+ }
+
+ // Don't recalculate entire layout because of translation, rather add the dx and dy
+ // into the position to move each text item the correct distance.
+ QPointF transformedPosition = position * d->state->matrix;
+ QTransform matrix = d->state->matrix;
+
+ // The translation has been applied to transformedPosition. Remove translation
+ // component from matrix.
+ if (d->state->matrix.isTranslating()) {
+ qreal m11 = d->state->matrix.m11();
+ qreal m12 = d->state->matrix.m12();
+ qreal m13 = d->state->matrix.m13();
+ qreal m21 = d->state->matrix.m21();
+ qreal m22 = d->state->matrix.m22();
+ qreal m23 = d->state->matrix.m23();
+ qreal m33 = d->state->matrix.m33();
+
+ d->state->matrix.setMatrix(m11, m12, m13,
+ m21, m22, m23,
+ 0.0, 0.0, m33);
+ }
+
+ // If the transform is not identical to the text transform,
+ // we have to relayout the text (for other transformations than plain translation)
+ bool staticTextNeedsReinit = false;
+ if (staticText_d->matrix != d->state->matrix) {
+ staticText_d->matrix = d->state->matrix;
+ staticTextNeedsReinit = true;
+ }
+
+ bool restoreWhenFinished = false;
+ if (staticText_d->needsClipRect) {
+ save();
+ setClipRect(QRectF(position, staticText_d->maximumSize));
+
+ restoreWhenFinished = true;
+ }
+
+ if (font() != staticText_d->font) {
+ staticText_d->font = font();
+ staticTextNeedsReinit = true;
+ }
+
+ // Recreate the layout of the static text because the matrix or font has changed
+ if (staticTextNeedsReinit)
+ staticText_d->init();
+
+ if (transformedPosition != staticText_d->position) { // Translate to actual position
+ QFixed fx = QFixed::fromReal(transformedPosition.x());
+ QFixed fy = QFixed::fromReal(transformedPosition.y());
+ QFixed oldX = QFixed::fromReal(staticText_d->position.x());
+ QFixed oldY = QFixed::fromReal(staticText_d->position.y());
+ for (int item=0; item<staticText_d->itemCount;++item) {
+ QStaticTextItem *textItem = staticText_d->items + item;
+ for (int i=0; i<textItem->numGlyphs; ++i) {
+ textItem->glyphPositions[i].x += fx - oldX;
+ textItem->glyphPositions[i].y += fy - oldY;
+ }
+ textItem->userDataNeedsUpdate = true;
+ }
+
+ staticText_d->position = transformedPosition;
+ }
+
+ QPen oldPen = d->state->pen;
+ QColor currentColor = oldPen.color();
+ for (int i=0; i<staticText_d->itemCount; ++i) {
+ QStaticTextItem *item = staticText_d->items + i;
+ if (currentColor != item->color) {
+ setPen(item->color);
+ currentColor = item->color;
+ }
+ d->extended->drawStaticTextItem(item);
+ }
+ if (currentColor != oldPen.color())
+ setPen(oldPen);
+
+ if (restoreWhenFinished)
+ restore();
+
+ if (matrix.isTranslating())
+ d->state->matrix = matrix;
+}
+
/*!
\internal
*/
diff --git a/src/gui/painting/qpainter.h b/src/gui/painting/qpainter.h
index ffddcba..e9fd532 100644
--- a/src/gui/painting/qpainter.h
+++ b/src/gui/painting/qpainter.h
@@ -78,6 +78,7 @@ class QPolygon;
class QTextItem;
class QMatrix;
class QTransform;
+class QStaticText;
class QPainterPrivateDeleter;
@@ -369,6 +370,10 @@ public:
void setLayoutDirection(Qt::LayoutDirection direction);
Qt::LayoutDirection layoutDirection() const;
+ void drawStaticText(const QPointF &p, const QStaticText &staticText);
+ inline void drawStaticText(const QPoint &p, const QStaticText &staticText);
+ inline void drawStaticText(int x, int y, const QStaticText &staticText);
+
void drawText(const QPointF &p, const QString &s);
inline void drawText(const QPoint &p, const QString &s);
inline void drawText(int x, int y, const QString &s);
@@ -896,6 +901,16 @@ inline void QPainter::drawImage(int x, int y, const QImage &image, int sx, int s
drawImage(QRectF(x, y, -1, -1), image, QRectF(sx, sy, sw, sh), flags);
}
+inline void QPainter::drawStaticText(const QPoint &p, const QStaticText &staticText)
+{
+ drawStaticText(QPointF(p), staticText);
+}
+
+inline void QPainter::drawStaticText(int x, int y, const QStaticText &staticText)
+{
+ drawStaticText(QPointF(x, y), staticText);
+}
+
inline void QPainter::drawTextItem(const QPoint &p, const QTextItem &ti)
{
drawTextItem(QPointF(p), ti);
diff --git a/src/gui/painting/qtextureglyphcache.cpp b/src/gui/painting/qtextureglyphcache.cpp
index 7b7f325..7f32d19 100644
--- a/src/gui/painting/qtextureglyphcache.cpp
+++ b/src/gui/painting/qtextureglyphcache.cpp
@@ -55,29 +55,28 @@ QT_BEGIN_NAMESPACE
// #define CACHE_DEBUG
-void QTextureGlyphCache::populate(const QTextItemInt &ti,
- const QVarLengthArray<glyph_t> &glyphs,
- const QVarLengthArray<QFixedPoint> &)
+void QTextureGlyphCache::populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs,
+ const QFixedPoint *)
{
#ifdef CACHE_DEBUG
printf("Populating with '%s'\n", QString::fromRawData(ti.chars, ti.num_chars).toLatin1().data());
qDebug() << " -> current transformation: " << m_transform;
#endif
- m_current_textitem = &ti;
+ m_current_fontengine = fontEngine;
const int margin = glyphMargin();
QHash<glyph_t, Coord> listItemCoordinates;
int rowHeight = 0;
// check each glyph for its metrics and get the required rowHeight.
- for (int i=0; i < glyphs.size(); ++i) {
+ for (int i=0; i < numGlyphs; ++i) {
const glyph_t glyph = glyphs[i];
if (coords.contains(glyph))
continue;
if (listItemCoordinates.contains(glyph))
continue;
- glyph_metrics_t metrics = ti.fontEngine->boundingBox(glyph, m_transform);
+ glyph_metrics_t metrics = fontEngine->boundingBox(glyph, m_transform);
#ifdef CACHE_DEBUG
printf("'%c' (%4x): w=%.2f, h=%.2f, xoff=%.2f, yoff=%.2f, x=%.2f, y=%.2f, ti.ascent=%.2f, ti.descent=%.2f\n",
@@ -182,7 +181,7 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const
break;
};
- QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_textitem->fontEngine);
+ QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_fontengine);
QFontEngineFT::QGlyphSet *gset = ft->loadTransformedGlyphSet(m_transform);
if (gset && ft->loadGlyphs(gset, &g, 1, format)) {
@@ -194,9 +193,9 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const
} else
#endif
if (m_type == QFontEngineGlyphCache::Raster_RGBMask)
- return m_current_textitem->fontEngine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform);
+ return m_current_fontengine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform);
else
- return m_current_textitem->fontEngine->alphaMapForGlyph(g, m_transform);
+ return m_current_fontengine->alphaMapForGlyph(g, m_transform);
return QImage();
}
diff --git a/src/gui/painting/qtextureglyphcache_p.h b/src/gui/painting/qtextureglyphcache_p.h
index d347e61..b8717b1 100644
--- a/src/gui/painting/qtextureglyphcache_p.h
+++ b/src/gui/painting/qtextureglyphcache_p.h
@@ -76,7 +76,8 @@ class Q_GUI_EXPORT QTextureGlyphCache : public QFontEngineGlyphCache
{
public:
QTextureGlyphCache(QFontEngineGlyphCache::Type type, const QTransform &matrix)
- : QFontEngineGlyphCache(matrix, type), m_w(0), m_h(0), m_cx(0), m_cy(0) { }
+ : QFontEngineGlyphCache(matrix, type), m_w(0), m_h(0), m_cx(0), m_cy(0),
+ m_current_fontengine(0) { }
virtual ~QTextureGlyphCache() { }
@@ -90,9 +91,8 @@ public:
int baseLineY;
};
- void populate(const QTextItemInt &ti,
- const QVarLengthArray<glyph_t> &glyphs,
- const QVarLengthArray<QFixedPoint> &positions);
+ void populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs,
+ const QFixedPoint *positions);
virtual void createTextureData(int width, int height) = 0;
virtual void resizeTextureData(int width, int height) = 0;
@@ -113,7 +113,7 @@ public:
QImage textureMapForGlyph(glyph_t g) const;
protected:
- const QTextItemInt *m_current_textitem;
+ QFontEngine *m_current_fontengine;
int m_w; // image width
int m_h; // image height
diff --git a/src/gui/painting/qwindowsurface_s60.cpp b/src/gui/painting/qwindowsurface_s60.cpp
index b41dc2c..6cbf3d9 100644
--- a/src/gui/painting/qwindowsurface_s60.cpp
+++ b/src/gui/painting/qwindowsurface_s60.cpp
@@ -145,12 +145,15 @@ QImage* QS60WindowSurface::buffer(const QWidget *widget)
void QS60WindowSurface::flush(QWidget *widget, const QRegion &region, const QPoint &)
{
- QWExtra *extra = widget->d_func()->extraData();
- if (extra && !extra->inExpose) {
- extra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again
+ QWidget *window = widget->window();
+ Q_ASSERT(window);
+ QTLWExtra *topExtra = window->d_func()->maybeTopData();
+ Q_ASSERT(topExtra);
+ if (!topExtra->inExpose) {
+ topExtra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again
TRect tr = qt_QRect2TRect(region.boundingRect());
widget->winId()->DrawNow(tr);
- extra->inExpose = false;
+ topExtra->inExpose = false;
}
}
diff --git a/src/gui/text/qstatictext.cpp b/src/gui/text/qstatictext.cpp
new file mode 100644
index 0000000..2fe23e5
--- /dev/null
+++ b/src/gui/text/qstatictext.cpp
@@ -0,0 +1,587 @@
+/****************************************************************************
+**
+** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies).
+** Contact: Qt Software Information (qt-info@nokia.com)
+**
+** This file is part of the QtGui module of the Qt Toolkit.
+**
+** $QT_BEGIN_LICENSE:LGPL$
+** No Commercial Usage
+** This file contains pre-release code and may not be distributed.
+** You may use this file in accordance with the terms and conditions
+** contained in the either Technology Preview License Agreement or the
+** Beta Release License Agreement.
+**
+** GNU Lesser General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU Lesser
+** General Public License version 2.1 as published by the Free Software
+** Foundation and appearing in the file LICENSE.LGPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU Lesser General Public License version 2.1 requirements
+** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html.
+**
+** In addition, as a special exception, Nokia gives you certain
+** additional rights. These rights are described in the Nokia Qt LGPL
+** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this
+** package.
+**
+** GNU General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU
+** General Public License version 3.0 as published by the Free Software
+** Foundation and appearing in the file LICENSE.GPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU General Public License version 3.0 requirements will be
+** met: http://www.gnu.org/copyleft/gpl.html.
+**
+** If you are unsure which license is appropriate for your use, please
+** contact the sales department at qt-sales@nokia.com.
+** $QT_END_LICENSE$
+**
+****************************************************************************/
+
+#include "qstatictext.h"
+#include "qstatictext_p.h"
+#include <private/qtextengine_p.h>
+#include <private/qfontengine_p.h>
+
+#include <QtGui/qapplication.h>
+
+QT_BEGIN_NAMESPACE
+
+/*!
+ \class QStaticText
+ \internal
+ \brief The QStaticText class enables optimized drawing of text when the text and its layout
+ is updated rarely.
+ \since 4.7
+
+ \ingroup multimedia
+ \ingroup text
+ \mainclass
+
+ QStaticText provides a way to cache layout data for a block of text so that it can be drawn
+ more efficiently than by using QPainter::drawText() in which the layout information is
+ recalculated with every call.
+
+ The class primarily provides an optimization for cases where text and the transformations on
+ the painter are static over several paint events. If the text or its layout is changed
+ regularly, QPainter::drawText() is the more efficient alternative. Translating the painter
+ will not cause the layout of the text to be recalculated, but will cause a very small
+ performance impact on drawStaticText(). Altering any other parts of the painter's
+ transformation or the painter's font will cause the layout of the static text to be
+ recalculated. This should be avoided as often as possible to maximize the performance
+ benefit of using QStaticText.
+
+ In addition, only affine transformations are supported by drawStaticText(). Calling
+ drawStaticText() on a projected painter will perform slightly worse than using the regular
+ drawText() call, so this should be avoided.
+
+ \code
+ class MyWidget: public QWidget
+ {
+ public:
+ MyWidget(QWidget *parent = 0) : QWidget(parent), m_staticText("This is static text")
+
+ protected:
+ void paintEvent(QPaintEvent *)
+ {
+ QPainter painter(this);
+ painter.drawStaticText(0, 0, m_staticText);
+ }
+
+ private:
+ QStaticText m_staticText;
+ };
+ \endcode
+
+ The QStaticText class can be used to mimic the behavior of QPainter::drawText() to a specific
+ point with no boundaries, and also when QPainter::drawText() is called with a bounding
+ rectangle.
+
+ If a bounding rectangle is not required, create a QStaticText object without setting a maximum
+ size. The text will then occupy a single line.
+
+ If you set a maximum size on the QStaticText object, this will bound the text. The text will
+ be formatted so that no line exceeds the given width. When the object is painted, it will
+ be clipped at the given size. The position of the text is decided by the argument
+ passed to QPainter::drawStaticText() and can change from call to call with a minimal impact
+ on performance.
+
+ \sa QPainter::drawText(), QPainter::drawStaticText(), QTextLayout, QTextDocument
+*/
+
+/*!
+ Constructs an empty QStaticText
+*/
+QStaticText::QStaticText()
+ : data(new QStaticTextPrivate)
+{
+}
+
+/*!
+ \fn QStaticText::QStaticText(const QString &text, const QFont &font, const QSizeF &maximumSize)
+
+ Constructs a QStaticText object with the given \a text which is to be rendered in the given
+ \a font and bounded by the given \a maximumSize. If an invalid size is passed for \a maximumSize
+ the text will be unbounded.
+*/
+QStaticText::QStaticText(const QString &text, const QSizeF &size)
+ : data(new QStaticTextPrivate)
+{
+ data->text = text;
+ data->maximumSize = size;
+ data->init();
+}
+
+/*!
+ Constructs a QStaticText object which is a copy of \a other.
+*/
+QStaticText::QStaticText(const QStaticText &other)
+{
+ data = other.data;
+}
+
+/*!
+ Destroys the QStaticText.
+*/
+QStaticText::~QStaticText()
+{
+ Q_ASSERT(!data || data->ref >= 1);
+}
+
+/*!
+ \internal
+*/
+void QStaticText::detach()
+{
+ if (data->ref != 1)
+ data.detach();
+}
+
+/*!
+ Prepares the QStaticText object for being painted with the given \a matrix and the given
+ \a font to avoid overhead when the actual drawStaticText() call is made.
+
+ When drawStaticText() is called, the layout of the QStaticText will be recalculated if the
+ painter's font or matrix is different from the one used for the currently cached layout. By
+ default, QStaticText will use a default constructed QFont and an identity matrix to create
+ its layout.
+
+ To avoid the overhead of creating the layout the first time you draw the QStaticText with
+ a painter whose matrix or font are different from the defaults, you can use the prepare()
+ function and pass in the matrix and font you expect to use when drawing the text.
+
+ \sa QPainter::setFont(), QPainter::setMatrix()
+*/
+void QStaticText::prepare(const QTransform &matrix, const QFont &font)
+{
+ data->matrix = matrix;
+ data->font = font;
+ data->init();
+}
+
+
+/*!
+ Assigns \a other to this QStaticText.
+*/
+QStaticText &QStaticText::operator=(const QStaticText &other)
+{
+ data = other.data;
+ return *this;
+}
+
+/*!
+ Compares \a other to this QStaticText. Returns true if the texts, fonts and maximum sizes
+ are equal.
+*/
+bool QStaticText::operator==(const QStaticText &other) const
+{
+ return (data == other.data
+ || (data->text == other.data->text
+ && data->font == other.data->font
+ && data->maximumSize == other.data->maximumSize));
+}
+
+/*!
+ Compares \a other to this QStaticText. Returns true if the texts, fonts or maximum sizes
+ are different.
+*/
+bool QStaticText::operator!=(const QStaticText &other) const
+{
+ return !(*this == other);
+}
+
+/*!
+ Sets the text of the QStaticText to \a text. If \a textFormat is set to Qt::AutoText
+ (the default), the format of the text will try to be determined using the function
+ Qt::mightBeRichText(). If the text format is Qt::PlainText, then the text will be displayed
+ as is, whereas it will be interpreted as HTML if the format is Qt::RichText. HTML tags
+ that alter the font of the text, its color, or its layout are supported by QStaticText.
+
+ \note This function will cause the layout of the text to be recalculated.
+
+ \sa text()
+*/
+void QStaticText::setText(const QString &text, Qt::TextFormat textFormat)
+{
+ detach();
+ data->text = text;
+ data->preferRichText = (textFormat == Qt::RichText
+ || (textFormat == Qt::AutoText && Qt::mightBeRichText(text)));
+ data->init();
+}
+
+/*!
+ Returns the text of the QStaticText.
+
+ \sa setText()
+*/
+QString QStaticText::text() const
+{
+ return data->text;
+}
+
+/*!
+ Sets whether the QStaticText object should use optimizations specific to the paint engine
+ backend if they are available. If \a on is set to true, backend optimizations will be turned
+ on, otherwise they will be turned off. The default value is false.
+
+ If backend optimizations are on, the paint engine used to draw the static text is allowed to
+ store data in the object which will assist it in future calls to drawStaticText. In particular,
+ when using the opengl graphics system, or when painting on a QGLWidget, turning this flag on will
+ improve performance, but increase the memory footprint of the QStaticText object.
+
+ The default value is false.
+
+ \note This function will cause the layout of the text to be recalculated.
+
+ \sa useBackendOptimizations()
+*/
+void QStaticText::setUseBackendOptimizations(bool on)
+{
+ if ((!on && !data->useBackendOptimizations)
+ || (on && data->useBackendOptimizations))
+ return;
+
+ detach();
+ data->useBackendOptimizations = on;
+ data->init();
+}
+
+/*!
+ Returns whether the QStaticText object should use optimizations specific to the paint engine
+ backend when possible. By default this setting is false.
+
+ \sa setUseBackendOptimizations()
+*/
+bool QStaticText::useBackendOptimizations() const
+{
+ return data->useBackendOptimizations;
+}
+
+/*!
+ Sets the maximum size of the QStaticText to \a maximumSize.
+
+ \note This function will cause the layout of the text to be recalculated.
+
+ \sa maximumSize()
+*/
+void QStaticText::setMaximumSize(const QSizeF &size)
+{
+ detach();
+ data->maximumSize = size;
+ data->init();
+}
+
+/*!
+ Returns the maximum size of the QStaticText.
+
+ \sa setMaximumSize()
+*/
+QSizeF QStaticText::maximumSize() const
+{
+ return data->maximumSize;
+}
+
+/*!
+ Returns the size of the bounding rect for this QStaticText.
+
+ \sa maximumSize()
+*/
+QSizeF QStaticText::size() const
+{
+ return data->actualSize;
+}
+
+/*!
+ Returns true if the text of the QStaticText is empty, and false if not.
+
+ \sa text()
+*/
+bool QStaticText::isEmpty() const
+{
+ return data->text.isEmpty();
+}
+
+QStaticTextPrivate::QStaticTextPrivate()
+ : items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false),
+ useBackendOptimizations(false)
+{
+ ref = 1;
+}
+
+QStaticTextPrivate::QStaticTextPrivate(const QStaticTextPrivate &other)
+ : text(other.text), font(other.font), maximumSize(other.maximumSize), matrix(other.matrix),
+ items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false),
+ useBackendOptimizations(false)
+{
+ ref = 1;
+}
+
+QStaticTextPrivate::~QStaticTextPrivate()
+{
+ delete[] items;
+ delete[] glyphPool;
+ delete[] positionPool;
+}
+
+QStaticTextPrivate *QStaticTextPrivate::get(const QStaticText *q)
+{
+ return q->data.data();
+}
+
+extern int qt_defaultDpiX();
+extern int qt_defaultDpiY();
+
+namespace {
+
+ class DrawTextItemRecorder: public QPaintEngine
+ {
+ public:
+ DrawTextItemRecorder(int expectedItemCount, QStaticTextItem *items,
+ int expectedGlyphCount, QFixedPoint *positionPool, glyph_t *glyphPool)
+ : m_items(items),
+ m_expectedItemCount(expectedItemCount),
+ m_expectedGlyphCount(expectedGlyphCount),
+ m_itemCount(0), m_glyphCount(0),
+ m_positionPool(positionPool),
+ m_glyphPool(glyphPool)
+ {
+ }
+
+ virtual void drawTextItem(const QPointF &position, const QTextItem &textItem)
+ {
+ const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem);
+
+ m_itemCount++;
+ m_glyphCount += ti.glyphs.numGlyphs;
+ if (m_items == 0)
+ return;
+
+ Q_ASSERT(m_itemCount <= m_expectedItemCount);
+ Q_ASSERT(m_glyphCount <= m_expectedGlyphCount);
+
+ QStaticTextItem *currentItem = (m_items + (m_itemCount - 1));
+ currentItem->fontEngine = ti.fontEngine;
+ currentItem->font = ti.font();
+ currentItem->chars = ti.chars;
+ currentItem->numChars = ti.num_chars;
+ currentItem->numGlyphs = ti.glyphs.numGlyphs;
+ currentItem->glyphs = m_glyphPool;
+ currentItem->glyphPositions = m_positionPool;
+ currentItem->color = state->pen().color();
+
+ QTransform matrix = state->transform();
+ matrix.translate(position.x(), position.y());
+
+ QVarLengthArray<glyph_t> glyphs;
+ QVarLengthArray<QFixedPoint> positions;
+ ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
+
+ int size = glyphs.size();
+ Q_ASSERT(size == ti.glyphs.numGlyphs);
+ Q_ASSERT(size == positions.size());
+
+ memmove(currentItem->glyphs, glyphs.constData(), sizeof(glyph_t) * size);
+ memmove(currentItem->glyphPositions, positions.constData(), sizeof(QFixedPoint) * size);
+
+ m_glyphPool += size;
+ m_positionPool += size;
+ }
+
+
+ virtual bool begin(QPaintDevice *) { return true; }
+ virtual bool end() { return true; }
+ virtual void updateState(const QPaintEngineState &) {}
+ virtual void drawPixmap(const QRectF &, const QPixmap &, const QRectF &) {}
+ virtual Type type() const
+ {
+ return User;
+ }
+
+ int itemCount() const
+ {
+ return m_itemCount;
+ }
+
+ int glyphCount() const
+ {
+ return m_glyphCount;
+ }
+
+ private:
+ QStaticTextItem *m_items;
+ int m_itemCount;
+ int m_glyphCount;
+ int m_expectedItemCount;
+ int m_expectedGlyphCount;
+
+ glyph_t *m_glyphPool;
+ QFixedPoint *m_positionPool;
+ };
+
+ class DrawTextItemDevice: public QPaintDevice
+ {
+ public:
+ DrawTextItemDevice(int expectedItemCount = -1, QStaticTextItem *items = 0,
+ int expectedGlyphCount = -1, QFixedPoint *positionPool = 0,
+ glyph_t *glyphPool = 0)
+ {
+ m_paintEngine = new DrawTextItemRecorder(expectedItemCount, items,
+ expectedGlyphCount, positionPool, glyphPool);
+ }
+
+ ~DrawTextItemDevice()
+ {
+ delete m_paintEngine;
+ }
+
+ int metric(PaintDeviceMetric m) const
+ {
+ int val;
+ switch (m) {
+ case PdmWidth:
+ case PdmHeight:
+ case PdmWidthMM:
+ case PdmHeightMM:
+ val = 0;
+ break;
+ case PdmDpiX:
+ case PdmPhysicalDpiX:
+ val = qt_defaultDpiX();
+ break;
+ case PdmDpiY:
+ case PdmPhysicalDpiY:
+ val = qt_defaultDpiY();
+ break;
+ case PdmNumColors:
+ val = 16777216;
+ break;
+ case PdmDepth:
+ val = 24;
+ break;
+ default:
+ val = 0;
+ qWarning("DrawTextItemDevice::metric: Invalid metric command");
+ }
+ return val;
+ }
+
+ virtual QPaintEngine *paintEngine() const
+ {
+ return m_paintEngine;
+ }
+
+ int itemCount() const
+ {
+ return m_paintEngine->itemCount();
+ }
+
+ int glyphCount() const
+ {
+ return m_paintEngine->glyphCount();
+ }
+
+ private:
+ DrawTextItemRecorder *m_paintEngine;
+ };
+}
+
+void QStaticTextPrivate::paintText(QPainter *p)
+{
+ if (!preferRichText) {
+ if (maximumSize.isValid()) {
+ QRectF boundingRect;
+ p->drawText(QRectF(QPointF(0, 0), maximumSize), Qt::TextWordWrap, text, &boundingRect);
+
+ actualSize = boundingRect.size();
+ needsClipRect = boundingRect.width() > maximumSize.width()
+ || boundingRect.height() > maximumSize.height();
+ } else {
+ p->drawText(0, 0, text);
+ needsClipRect = false;
+
+ QFontMetrics fm(font);
+ actualSize = fm.boundingRect(text).size();
+ }
+ } else {
+ QTextDocument document;
+ document.setDefaultFont(font);
+ document.setHtml(text);
+
+ QRectF rect = maximumSize.isValid() ? QRectF(QPointF(0, 0), maximumSize) : QRectF();
+ document.adjustSize();
+ document.drawContents(p, rect);
+ actualSize = document.size();
+ needsClipRect = maximumSize.isValid()
+ && (actualSize.width() > maximumSize.width()
+ || actualSize.height() > maximumSize.height());
+ }
+}
+
+void QStaticTextPrivate::init()
+{
+ delete[] items;
+ delete[] glyphPool;
+ delete[] positionPool;
+
+ position = QPointF(0, 0);
+
+ // Draw once to count number of items and glyphs, so that we can use as little memory
+ // as possible to store the data
+ DrawTextItemDevice counterDevice;
+ {
+ QPainter painter(&counterDevice);
+ painter.setFont(font);
+ painter.setTransform(matrix);
+
+ paintText(&painter);
+
+ }
+
+ itemCount = counterDevice.itemCount();
+ items = new QStaticTextItem[itemCount];
+
+ if (useBackendOptimizations) {
+ for (int i=0; i<itemCount; ++i)
+ items[i].useBackendOptimizations = true;
+ }
+
+
+ int glyphCount = counterDevice.glyphCount();
+ glyphPool = new glyph_t[glyphCount];
+ positionPool = new QFixedPoint[glyphCount];
+
+ // Draw again to actually record the items and glyphs
+ DrawTextItemDevice recorderDevice(itemCount, items, glyphCount, positionPool, glyphPool);
+ {
+ QPainter painter(&recorderDevice);
+ painter.setFont(font);
+ painter.setTransform(matrix);
+
+ paintText(&painter);
+ }
+
+}
+
+QT_END_NAMESPACE
diff --git a/src/gui/text/qstatictext.h b/src/gui/text/qstatictext.h
new file mode 100644
index 0000000..7498ad4
--- /dev/null
+++ b/src/gui/text/qstatictext.h
@@ -0,0 +1,100 @@
+/****************************************************************************
+**
+** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies).
+** Contact: Qt Software Information (qt-info@nokia.com)
+**
+** This file is part of the QtGui module of the Qt Toolkit.
+**
+** $QT_BEGIN_LICENSE:LGPL$
+** No Commercial Usage
+** This file contains pre-release code and may not be distributed.
+** You may use this file in accordance with the terms and conditions
+** contained in the either Technology Preview License Agreement or the
+** Beta Release License Agreement.
+**
+** GNU Lesser General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU Lesser
+** General Public License version 2.1 as published by the Free Software
+** Foundation and appearing in the file LICENSE.LGPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU Lesser General Public License version 2.1 requirements
+** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html.
+**
+** In addition, as a special exception, Nokia gives you certain
+** additional rights. These rights are described in the Nokia Qt LGPL
+** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this
+** package.
+**
+** GNU General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU
+** General Public License version 3.0 as published by the Free Software
+** Foundation and appearing in the file LICENSE.GPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU General Public License version 3.0 requirements will be
+** met: http://www.gnu.org/copyleft/gpl.html.
+**
+** If you are unsure which license is appropriate for your use, please
+** contact the sales department at qt-sales@nokia.com.
+** $QT_END_LICENSE$
+**
+****************************************************************************/
+
+#ifndef QSTATICTEXT_H
+#define QSTATICTEXT_H
+
+#include <QtCore/qsize.h>
+#include <QtCore/qstring.h>
+#include <QtCore/qmetatype.h>
+
+#include <QtGui/qtransform.h>
+#include <QtGui/qfont.h>
+
+
+QT_BEGIN_HEADER
+
+QT_BEGIN_NAMESPACE
+
+QT_MODULE(Gui)
+
+class QStaticTextPrivate;
+class Q_GUI_EXPORT QStaticText
+{
+public:
+ QStaticText();
+ QStaticText(const QString &text, const QSizeF &maximumSize = QSizeF());
+ QStaticText(const QStaticText &other);
+ ~QStaticText();
+
+ void setText(const QString &text, Qt::TextFormat textFormat = Qt::AutoText);
+ QString text() const;
+
+ void setMaximumSize(const QSizeF &maximumSize);
+ QSizeF maximumSize() const;
+
+ QSizeF size() const;
+
+ void prepare(const QTransform &matrix, const QFont &font);
+
+ void setUseBackendOptimizations(bool on);
+ bool useBackendOptimizations() const;
+
+ QStaticText &operator=(const QStaticText &);
+ bool operator==(const QStaticText &) const;
+ bool operator!=(const QStaticText &) const;
+
+ bool isEmpty() const;
+
+private:
+ void detach();
+
+ QExplicitlySharedDataPointer<QStaticTextPrivate> data;
+ friend class QStaticTextPrivate;
+};
+
+Q_DECLARE_METATYPE(QStaticText)
+
+QT_END_NAMESPACE
+
+QT_END_HEADER
+
+#endif // QSTATICTEXT_H
diff --git a/src/gui/text/qstatictext_p.h b/src/gui/text/qstatictext_p.h
new file mode 100644
index 0000000..7aee5c4
--- /dev/null
+++ b/src/gui/text/qstatictext_p.h
@@ -0,0 +1,145 @@
+/****************************************************************************
+**
+** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies).
+** Contact: Qt Software Information (qt-info@nokia.com)
+**
+** This file is part of the QtGui module of the Qt Toolkit.
+**
+** $QT_BEGIN_LICENSE:LGPL$
+** No Commercial Usage
+** This file contains pre-release code and may not be distributed.
+** You may use this file in accordance with the terms and conditions
+** contained in the either Technology Preview License Agreement or the
+** Beta Release License Agreement.
+**
+** GNU Lesser General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU Lesser
+** General Public License version 2.1 as published by the Free Software
+** Foundation and appearing in the file LICENSE.LGPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU Lesser General Public License version 2.1 requirements
+** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html.
+**
+** In addition, as a special exception, Nokia gives you certain
+** additional rights. These rights are described in the Nokia Qt LGPL
+** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this
+** package.
+**
+** GNU General Public License Usage
+** Alternatively, this file may be used under the terms of the GNU
+** General Public License version 3.0 as published by the Free Software
+** Foundation and appearing in the file LICENSE.GPL included in the
+** packaging of this file. Please review the following information to
+** ensure the GNU General Public License version 3.0 requirements will be
+** met: http://www.gnu.org/copyleft/gpl.html.
+**
+** If you are unsure which license is appropriate for your use, please
+** contact the sales department at qt-sales@nokia.com.
+** $QT_END_LICENSE$
+**
+****************************************************************************/
+
+#ifndef QSTATICTEXT_P_H
+#define QSTATICTEXT_P_H
+
+//
+// W A R N I N G
+// -------------
+//
+// This file is not part of the Qt API. It exists for the convenience
+// of internal files. This header file may change from version to version
+// without notice, or even be removed.
+//
+// We mean it.
+//
+
+#include <private/qtextureglyphcache_p.h>
+
+QT_BEGIN_NAMESPACE
+
+class QStaticTextUserData
+{
+public:
+ enum Type {
+ NoUserData,
+ OpenGLUserData
+ };
+
+ QStaticTextUserData(Type t) : type(t) {}
+ virtual ~QStaticTextUserData() {}
+
+ Type type;
+};
+
+class Q_GUI_EXPORT QStaticTextItem
+{
+public:
+ QStaticTextItem() : chars(0), numChars(0), fontEngine(0), userData(0),
+ useBackendOptimizations(false), userDataNeedsUpdate(0) {}
+ ~QStaticTextItem() { delete userData; }
+
+ void setUserData(QStaticTextUserData *newUserData)
+ {
+ if (userData == newUserData)
+ return;
+
+ delete userData;
+ userData = newUserData;
+ }
+
+ QFixedPoint *glyphPositions; // 8 bytes per glyph
+ glyph_t *glyphs; // 4 bytes per glyph
+ const QChar *chars; // 2 bytes per glyph
+ // =================
+ // 14 bytes per glyph
+
+ // 12 bytes for pointers
+ int numGlyphs; // 4 bytes per item
+ int numChars; // 4 bytes per item
+ QFontEngine *fontEngine; // 4 bytes per item
+ QFont font; // 8 bytes per item
+ QColor color; // 10 bytes per item
+ QStaticTextUserData *userData; // 8 bytes per item
+ char useBackendOptimizations : 1; // 1 byte per item
+ char userDataNeedsUpdate : 1; //
+ // ================
+ // 51 bytes per item
+};
+
+class QStaticText;
+class Q_AUTOTEST_EXPORT QStaticTextPrivate
+{
+public:
+ QStaticTextPrivate();
+ QStaticTextPrivate(const QStaticTextPrivate &other);
+ ~QStaticTextPrivate();
+
+ void init();
+ void paintText(QPainter *p);
+
+ QAtomicInt ref; // 4 bytes per text
+
+ QString text; // 4 bytes per text
+ QFont font; // 8 bytes per text
+ QSizeF maximumSize; // 16 bytes per text
+ QSizeF actualSize; // 16 bytes per text
+ QPointF position; // 16 bytes per text
+
+ QTransform matrix; // 80 bytes per text
+ QStaticTextItem *items; // 4 bytes per text
+ int itemCount; // 4 bytes per text
+ glyph_t *glyphPool; // 4 bytes per text
+ QFixedPoint *positionPool; // 4 bytes per text
+
+ char needsClipRect : 1; // 1 byte per text
+ char useBackendOptimizations : 1;
+ char preferRichText : 1;
+ // ================
+ // 171 bytes per text
+
+ static QStaticTextPrivate *get(const QStaticText *q);
+};
+
+QT_END_NAMESPACE
+
+#endif // QSTATICTEXT_P_H
diff --git a/src/gui/text/text.pri b/src/gui/text/text.pri
index b7615a4..9ec3142 100644
--- a/src/gui/text/text.pri
+++ b/src/gui/text/text.pri
@@ -37,7 +37,9 @@ HEADERS += \
text/qtexttable_p.h \
text/qzipreader_p.h \
text/qzipwriter_p.h \
- text/qtextodfwriter_p.h
+ text/qtextodfwriter_p.h \
+ text/qstatictext_p.h \
+ text/qstatictext.h
SOURCES += \
text/qfont.cpp \
@@ -66,7 +68,8 @@ SOURCES += \
text/qsyntaxhighlighter.cpp \
text/qcssparser.cpp \
text/qzip.cpp \
- text/qtextodfwriter.cpp
+ text/qtextodfwriter.cpp \
+ text/qstatictext.cpp
win32 {
SOURCES += \
diff --git a/src/gui/widgets/qlinecontrol.cpp b/src/gui/widgets/qlinecontrol.cpp
index b0a64ea..db099e8 100644
--- a/src/gui/widgets/qlinecontrol.cpp
+++ b/src/gui/widgets/qlinecontrol.cpp
@@ -1371,6 +1371,8 @@ bool QLineControl::processEvent(QEvent* ev)
processInputMethodEvent(static_cast<QInputMethodEvent*>(ev)); break;
#ifndef QT_NO_SHORTCUT
case QEvent::ShortcutOverride:{
+ if (isReadOnly())
+ return false;
QKeyEvent* ke = static_cast<QKeyEvent*>(ev);
if (ke == QKeySequence::Copy
|| ke == QKeySequence::Paste
diff --git a/src/network/access/qhttpnetworkconnectionchannel.cpp b/src/network/access/qhttpnetworkconnectionchannel.cpp
index 70a301d..5bd972c 100644
--- a/src/network/access/qhttpnetworkconnectionchannel.cpp
+++ b/src/network/access/qhttpnetworkconnectionchannel.cpp
@@ -305,9 +305,12 @@ void QHttpNetworkConnectionChannel::_q_receiveReply()
while (socket->bytesAvailable()) {
QHttpNetworkReplyPrivate::ReplyState state = reply ? reply->d_func()->state : QHttpNetworkReplyPrivate::AllDoneState;
switch (state) {
- case QHttpNetworkReplyPrivate::NothingDoneState:
- case QHttpNetworkReplyPrivate::ReadingStatusState: {
+ case QHttpNetworkReplyPrivate::NothingDoneState: {
+ // only eat whitespace on the first call
eatWhitespace();
+ state = reply->d_func()->state = QHttpNetworkReplyPrivate::ReadingStatusState;
+ }
+ case QHttpNetworkReplyPrivate::ReadingStatusState: {
qint64 statusBytes = reply->d_func()->readStatus(socket);
if (statusBytes == -1 && reconnectAttempts <= 0) {
// too many errors reading/receiving/parsing the status, close the socket and emit error
diff --git a/src/network/access/qhttpnetworkreply.cpp b/src/network/access/qhttpnetworkreply.cpp
index a5223d1..512c045 100644
--- a/src/network/access/qhttpnetworkreply.cpp
+++ b/src/network/access/qhttpnetworkreply.cpp
@@ -423,13 +423,26 @@ int QHttpNetworkReplyPrivate::gunzipBodyPartially(QByteArray &compressed, QByteA
qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket)
{
+ if (fragment.isEmpty()) {
+ // reserve bytes for the status line. This is better than always append() which reallocs the byte array
+ fragment.reserve(32);
+ }
+
qint64 bytes = 0;
char c;
+ qint64 haveRead = 0;
+
+ do {
+ haveRead = socket->read(&c, 1);
+ if (haveRead == -1)
+ return -1; // unexpected EOF
+ else if (haveRead == 0)
+ break; // read more later
+
+ bytes++;
- while (socket->bytesAvailable()) {
// allow both CRLF & LF (only) line endings
- if (socket->peek(&c, 1) == 1 && c == '\n') {
- bytes += socket->read(&c, 1); // read the "n"
+ if (c == '\n') {
// remove the CR at the end
if (fragment.endsWith('\r')) {
fragment.truncate(fragment.length()-1);
@@ -442,11 +455,6 @@ qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket)
}
break;
} else {
- c = 0;
- int haveRead = socket->read(&c, 1);
- if (haveRead == -1)
- return -1;
- bytes += haveRead;
fragment.append(c);
}
@@ -456,8 +464,7 @@ qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket)
fragment.clear();
return -1;
}
-
- }
+ } while (haveRead == 1);
return bytes;
}
@@ -500,20 +507,41 @@ bool QHttpNetworkReplyPrivate::parseStatus(const QByteArray &status)
qint64 QHttpNetworkReplyPrivate::readHeader(QAbstractSocket *socket)
{
+ if (fragment.isEmpty()) {
+ // according to http://dev.opera.com/articles/view/mama-http-headers/ the average size of the header
+ // block is 381 bytes.
+ // reserve bytes. This is better than always append() which reallocs the byte array.
+ fragment.reserve(512);
+ }
+
qint64 bytes = 0;
char c = 0;
bool allHeaders = false;
- while (!allHeaders && socket->bytesAvailable()) {
- if (socket->peek(&c, 1) == 1 && c == '\n') {
- // check for possible header endings. As per HTTP rfc,
- // the header endings will be marked by CRLFCRLF. But
- // we will allow CRLFLF, LFLF & CRLFCRLF
- if (fragment.endsWith("\n\r") || fragment.endsWith('\n'))
- allHeaders = true;
+ qint64 haveRead = 0;
+ do {
+ haveRead = socket->read(&c, 1);
+ if (haveRead == 0) {
+ // read more later
+ break;
+ } else if (haveRead == -1) {
+ // connection broke down
+ return -1;
+ } else {
+ fragment.append(c);
+ bytes++;
+
+ if (c == '\n') {
+ // check for possible header endings. As per HTTP rfc,
+ // the header endings will be marked by CRLFCRLF. But
+ // we will allow CRLFCRLF, CRLFLF, LFLF
+ if (fragment.endsWith("\r\n\r\n")
+ || fragment.endsWith("\r\n\n")
+ || fragment.endsWith("\n\n"))
+ allHeaders = true;
+ }
}
- bytes += socket->read(&c, 1);
- fragment.append(c);
- }
+ } while (!allHeaders && haveRead > 0);
+
// we received all headers now parse them
if (allHeaders) {
parseHeader(fragment);
diff --git a/src/network/access/qnetworkcookie.h b/src/network/access/qnetworkcookie.h
index f34396f..3cc4cee 100644
--- a/src/network/access/qnetworkcookie.h
+++ b/src/network/access/qnetworkcookie.h
@@ -114,7 +114,7 @@ Q_NETWORK_EXPORT QDebug operator<<(QDebug, const QNetworkCookie &);
QT_END_NAMESPACE
// ### Qt5 remove this include
-#include "qnetworkcookiejar.h"
+#include <QtNetwork/QNetworkCookieJar>
Q_DECLARE_METATYPE(QNetworkCookie)
Q_DECLARE_METATYPE(QList<QNetworkCookie>)
diff --git a/src/network/access/qnetworkcookiejar.h b/src/network/access/qnetworkcookiejar.h
index 813bf3e..8086f38 100644
--- a/src/network/access/qnetworkcookiejar.h
+++ b/src/network/access/qnetworkcookiejar.h
@@ -46,7 +46,7 @@
#include <QtCore/QUrl>
// ### Qt5 remove this include
-#include "qnetworkcookie.h"
+#include <QtNetwork/QNetworkCookie>
QT_BEGIN_HEADER
diff --git a/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp b/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp
index 03b1bf0..559a6fd 100644
--- a/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp
+++ b/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp
@@ -61,12 +61,6 @@ QGLRect QGL2PEXVertexArray::boundingRect() const
return QGLRect(minX, minY, maxX, maxY);
}
-void QGL2PEXVertexArray::addRect(const QRectF &rect)
-{
- vertexArray << rect.topLeft() << rect.topRight() << rect.bottomRight()
- << rect.bottomRight() << rect.bottomLeft() << rect.topLeft();
-}
-
void QGL2PEXVertexArray::addClosingLine(int index)
{
if (QPointF(vertexArray.at(index)) != QPointF(vertexArray.last()))
diff --git a/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h b/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h
index e0497b1..d1e7615 100644
--- a/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h
+++ b/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h
@@ -102,8 +102,36 @@ public:
QGL2PEXVertexArray() :
maxX(-2e10), maxY(-2e10), minX(2e10), minY(2e10),
boundingRectDirty(true) {}
+
+ inline void addRect(const QRectF &rect)
+ {
+ qreal top = rect.top();
+ qreal left = rect.left();
+ qreal bottom = rect.bottom();
+ qreal right = rect.right();
+
+ vertexArray << QGLPoint(left, top)
+ << QGLPoint(right, top)
+ << QGLPoint(right, bottom)
+ << QGLPoint(right, bottom)
+ << QGLPoint(left, bottom)
+ << QGLPoint(left, top);
+ }
+
+ inline void addQuad(const QRectF &rect)
+ {
+ qreal top = rect.top();
+ qreal left = rect.left();
+ qreal bottom = rect.bottom();
+ qreal right = rect.right();
+
+ vertexArray << QGLPoint(left, top)
+ << QGLPoint(right, top)
+ << QGLPoint(left, bottom)
+ << QGLPoint(right, bottom);
+
+ }
- void addRect(const QRectF &rect);
void addPath(const QVectorPath &path, GLfloat curveInverseScale, bool outline = true);
void clear();
diff --git a/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp b/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp
index d2fb925..12ac69d 100644
--- a/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp
+++ b/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp
@@ -77,6 +77,7 @@
#include <private/qfontengine_p.h>
#include <private/qpixmapdata_gl_p.h>
#include <private/qdatabuffer_p.h>
+#include <private/qstatictext_p.h>
#include <private/qtriangulator_p.h>
#include "qglgradientcache_p.h"
@@ -1290,6 +1291,20 @@ void QGL2PaintEngineEx::drawImage(const QRectF& dest, const QImage& image, const
d->drawTexture(dest, src, image.size(), !image.hasAlphaChannel());
}
+void QGL2PaintEngineEx::drawStaticTextItem(QStaticTextItem *textItem)
+{
+ Q_D(QGL2PaintEngineEx);
+
+ ensureActive();
+
+ QFontEngineGlyphCache::Type glyphType = textItem->fontEngine->glyphFormat >= 0
+ ? QFontEngineGlyphCache::Type(textItem->fontEngine->glyphFormat)
+ : d->glyphCacheType;
+
+ // ### What about huge fonts? These are not passed through cache in drawTextItem().
+ d->drawCachedGlyphs(glyphType, textItem, true);
+}
+
void QGL2PaintEngineEx::drawTexture(const QRectF &dest, GLuint textureId, const QSize &size, const QRectF &src)
{
Q_D(QGL2PaintEngineEx);
@@ -1343,33 +1358,70 @@ void QGL2PaintEngineEx::drawTextItem(const QPointF &p, const QTextItem &textItem
}
if (drawCached) {
- d->drawCachedGlyphs(p, glyphType, ti);
+ QVarLengthArray<QFixedPoint> positions;
+ QVarLengthArray<glyph_t> glyphs;
+ QTransform matrix = QTransform::fromTranslate(p.x(), p.y());
+ ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
+
+ {
+ QStaticTextItem staticTextItem;
+ staticTextItem.chars = ti.chars;
+ staticTextItem.fontEngine = ti.fontEngine;
+ staticTextItem.glyphs = glyphs.data();
+ staticTextItem.numChars = ti.num_chars;
+ staticTextItem.numGlyphs = glyphs.size();
+ staticTextItem.glyphPositions = positions.data();
+
+ d->drawCachedGlyphs(glyphType, &staticTextItem, false);
+ }
return;
}
QPaintEngineEx::drawTextItem(p, ti);
}
-void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGlyphCache::Type glyphType,
- const QTextItemInt &ti)
+namespace {
+
+ class QOpenGLStaticTextUserData: public QStaticTextUserData
+ {
+ public:
+ QOpenGLStaticTextUserData()
+ : QStaticTextUserData(OpenGLUserData)
+ {
+ }
+
+ ~QOpenGLStaticTextUserData()
+ {
+ }
+
+ QGL2PEXVertexArray vertexCoordinateArray;
+ QGL2PEXVertexArray textureCoordinateArray;
+ };
+
+}
+
+void QGL2PaintEngineExPrivate::drawCachedGlyphs(QFontEngineGlyphCache::Type glyphType,
+ QStaticTextItem *staticTextItem,
+ bool includeMatrixInCache)
{
Q_Q(QGL2PaintEngineEx);
- QVarLengthArray<QFixedPoint> positions;
- QVarLengthArray<glyph_t> glyphs;
- QTransform matrix = QTransform::fromTranslate(p.x(), p.y());
- ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
+ QOpenGL2PaintEngineState *s = q->state();
QGLTextureGlyphCache *cache =
- (QGLTextureGlyphCache *) ti.fontEngine->glyphCache(ctx, glyphType, QTransform());
-
+ (QGLTextureGlyphCache *) staticTextItem->fontEngine->glyphCache(ctx, glyphType,
+ includeMatrixInCache
+ ? s->matrix
+ : QTransform());
if (!cache || cache->cacheType() != glyphType) {
- cache = new QGLTextureGlyphCache(ctx, glyphType, QTransform());
- ti.fontEngine->setGlyphCache(ctx, cache);
+ cache = new QGLTextureGlyphCache(ctx, glyphType,
+ includeMatrixInCache ? s->matrix : QTransform());
+ staticTextItem->fontEngine->setGlyphCache(ctx, cache);
}
cache->setPaintEnginePrivate(this);
- cache->populate(ti, glyphs, positions);
+ cache->populate(staticTextItem->fontEngine, staticTextItem->numGlyphs, staticTextItem->glyphs,
+ staticTextItem->glyphPositions);
if (cache->width() == 0 || cache->height() == 0)
return;
@@ -1381,20 +1433,70 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly
GLfloat dx = 1.0 / cache->width();
GLfloat dy = 1.0 / cache->height();
- vertexCoordinateArray.clear();
- textureCoordinateArray.clear();
+ bool recreateVertexArrays = false;
+ if (staticTextItem->userDataNeedsUpdate)
+ recreateVertexArrays = true;
+ else if (staticTextItem->userData == 0)
+ recreateVertexArrays = true;
+ else if (staticTextItem->userData->type != QStaticTextUserData::OpenGLUserData)
+ recreateVertexArrays = true;
+
+ // Use global arrays by default
+ QGL2PEXVertexArray *vertexCoordinates = &vertexCoordinateArray;
+ QGL2PEXVertexArray *textureCoordinates = &textureCoordinateArray;
+
+ if (staticTextItem->useBackendOptimizations) {
+ QOpenGLStaticTextUserData *userData = 0;
+
+ if (staticTextItem->userData == 0
+ || staticTextItem->userData->type != QStaticTextUserData::OpenGLUserData) {
- for (int i=0; i<glyphs.size(); ++i) {
- const QTextureGlyphCache::Coord &c = cache->coords.value(glyphs[i]);
- int x = positions[i].x.toInt() + c.baseLineX - margin;
- int y = positions[i].y.toInt() - c.baseLineY - margin;
+ userData = new QOpenGLStaticTextUserData();
+ staticTextItem->setUserData(userData);
- vertexCoordinateArray.addRect(QRectF(x, y, c.w, c.h));
- textureCoordinateArray.addRect(QRectF(c.x*dx, c.y*dy, c.w * dx, c.h * dy));
+ } else {
+ userData = static_cast<QOpenGLStaticTextUserData*>(staticTextItem->userData);
+ }
+
+ // Use cache if backend optimizations is turned on
+ vertexCoordinates = &userData->vertexCoordinateArray;
+ textureCoordinates = &userData->textureCoordinateArray;
}
- setVertexAttributePointer(QT_VERTEX_COORDS_ATTR, (GLfloat*)vertexCoordinateArray.data());
- setVertexAttributePointer(QT_TEXTURE_COORDS_ATTR, (GLfloat*)textureCoordinateArray.data());
+
+ if (recreateVertexArrays) {
+ vertexCoordinates->clear();
+ textureCoordinates->clear();
+
+ for (int i=0; i<staticTextItem->numGlyphs; ++i) {
+ const QTextureGlyphCache::Coord &c = cache->coords.value(staticTextItem->glyphs[i]);
+ int x = staticTextItem->glyphPositions[i].x.toInt() + c.baseLineX - margin;
+ int y = staticTextItem->glyphPositions[i].y.toInt() - c.baseLineY - margin;
+
+ vertexCoordinates->addQuad(QRectF(x, y, c.w, c.h));
+ textureCoordinates->addQuad(QRectF(c.x*dx, c.y*dy, c.w * dx, c.h * dy));
+ }
+
+ staticTextItem->userDataNeedsUpdate = false;
+ }
+
+ if (elementIndices.size() < staticTextItem->numGlyphs*6) {
+ Q_ASSERT(elementIndices.size() % 6 == 0);
+ int j = elementIndices.size() / 6 * 4;
+ while (j < staticTextItem->numGlyphs*4) {
+ elementIndices.append(j + 0);
+ elementIndices.append(j + 0);
+ elementIndices.append(j + 1);
+ elementIndices.append(j + 2);
+ elementIndices.append(j + 3);
+ elementIndices.append(j + 3);
+
+ j += 4;
+ }
+ }
+
+ setVertexAttributePointer(QT_VERTEX_COORDS_ATTR, (GLfloat*)vertexCoordinates->data());
+ setVertexAttributePointer(QT_TEXTURE_COORDS_ATTR, (GLfloat*)textureCoordinates->data());
if (addOffset) {
addOffset = false;
@@ -1408,6 +1510,13 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly
QBrush pensBrush = q->state()->pen.brush();
setBrush(pensBrush);
+ // When painting a QStaticTextItem, the glyph positions are already in device coordinates,
+ // therefore we temporarily set an identity matrix on the painter for the draw call to
+ // avoid transforming the positions twice.
+ QTransform old = s->matrix;
+ if (includeMatrixInCache)
+ s->matrix = QTransform();
+
if (glyphType == QFontEngineGlyphCache::Raster_RGBMask) {
// Subpixel antialiasing without gamma correction
@@ -1461,7 +1570,7 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly
updateTextureFilter(GL_TEXTURE_2D, GL_REPEAT, false);
shaderManager->currentProgram()->setUniformValue(location(QGLEngineShaderManager::MaskTexture), QT_MASK_TEXTURE_UNIT);
- glDrawArrays(GL_TRIANGLES, 0, 6 * glyphs.size());
+ glDrawElements(GL_TRIANGLE_STRIP, 6 * staticTextItem->numGlyphs, GL_UNSIGNED_SHORT, elementIndices.data());
shaderManager->setMaskType(QGLEngineShaderManager::SubPixelMaskPass2);
@@ -1491,7 +1600,11 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly
updateTextureFilter(GL_TEXTURE_2D, GL_REPEAT, false);
shaderManager->currentProgram()->setUniformValue(location(QGLEngineShaderManager::MaskTexture), QT_MASK_TEXTURE_UNIT);
- glDrawArrays(GL_TRIANGLES, 0, 6 * glyphs.size());
+
+ glDrawElements(GL_TRIANGLE_STRIP, 6 * staticTextItem->numGlyphs, GL_UNSIGNED_SHORT, elementIndices.data());
+
+ if (includeMatrixInCache)
+ s->matrix = old;
}
void QGL2PaintEngineEx::drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QDrawPixmaps::DrawingHints hints)
diff --git a/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h b/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h
index e816e17..c60eac1 100644
--- a/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h
+++ b/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h
@@ -133,6 +133,7 @@ public:
virtual void stroke(const QVectorPath &path, const QPen &pen);
virtual void clip(const QVectorPath &path, Qt::ClipOperation op);
+ virtual void drawStaticTextItem(QStaticTextItem *textItem);
Type type() const { return OpenGL2; }
@@ -194,7 +195,8 @@ public:
void stroke(const QVectorPath &path, const QPen &pen);
void drawTexture(const QGLRect& dest, const QGLRect& src, const QSize &textureSize, bool opaque, bool pattern = false);
void drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QDrawPixmaps::DrawingHints hints);
- void drawCachedGlyphs(const QPointF &p, QFontEngineGlyphCache::Type glyphType, const QTextItemInt &ti);
+ void drawCachedGlyphs(QFontEngineGlyphCache::Type glyphType, QStaticTextItem *staticTextItem,
+ bool includeMatrixInCache);
// Calls glVertexAttributePointer if the pointer has changed
inline void setVertexAttributePointer(unsigned int arrayIndex, const GLfloat *pointer);
@@ -265,6 +267,7 @@ public:
QGL2PEXVertexArray vertexCoordinateArray;
QGL2PEXVertexArray textureCoordinateArray;
+ QVector<GLushort> elementIndices;
QDataBuffer<GLfloat> opacityArray;
GLfloat staticVertexCoordinateArray[8];
GLfloat staticTextureCoordinateArray[8];
diff --git a/src/opengl/qgl_mac.mm b/src/opengl/qgl_mac.mm
index c01575b..4d7532e 100644
--- a/src/opengl/qgl_mac.mm
+++ b/src/opengl/qgl_mac.mm
@@ -951,8 +951,6 @@ void QGLWidgetPrivate::init(QGLContext *context, const QGLWidget *shareWidget)
break;
current = current->parentWidget();
}
-
- isGLWidget = 1;
}
bool QGLWidgetPrivate::renderCxPm(QPixmap*)
diff --git a/src/opengl/qgl_p.h b/src/opengl/qgl_p.h
index 18fc9c2..efd2090 100644
--- a/src/opengl/qgl_p.h
+++ b/src/opengl/qgl_p.h
@@ -173,7 +173,9 @@ public:
#if defined(Q_WS_X11) && defined(QT_OPENGL_ES)
, eglSurfaceWindowId(0)
#endif
- {}
+ {
+ isGLWidget = 1;
+ }
~QGLWidgetPrivate() {}
diff --git a/src/opengl/qglextensions_p.h b/src/opengl/qglextensions_p.h
index 4edd5f7..f6926f3 100644
--- a/src/opengl/qglextensions_p.h
+++ b/src/opengl/qglextensions_p.h
@@ -452,6 +452,14 @@ struct QGLExtensionFuncs
// OpenGL constants
+#ifndef GL_ARRAY_BUFFER
+#define GL_ARRAY_BUFFER 0x8892
+#endif
+
+#ifndef GL_STATIC_DRAW
+#define GL_STATIC_DRAW 0x88E4
+#endif
+
/* NV_texture_rectangle */
#ifndef GL_NV_texture_rectangle
#define GL_TEXTURE_RECTANGLE_NV 0x84F5
diff --git a/src/opengl/qglpixmapfilter.cpp b/src/opengl/qglpixmapfilter.cpp
index 37bb7c0..d5a11d9 100644
--- a/src/opengl/qglpixmapfilter.cpp
+++ b/src/opengl/qglpixmapfilter.cpp
@@ -394,6 +394,7 @@ void QGLBlurTextureCache::insertBlurTextureInfo(const QPixmap &pixmap, QGLBlurTe
static bool hookAdded = false;
if (!hookAdded) {
QImagePixmapCleanupHooks::instance()->addPixmapDataDestructionHook(pixmapDestroyed);
+ QImagePixmapCleanupHooks::instance()->addPixmapDataModificationHook(pixmapDestroyed);
hookAdded = true;
}
diff --git a/src/opengl/qpaintengine_opengl.cpp b/src/opengl/qpaintengine_opengl.cpp
index 3845e43..c8307a0 100644
--- a/src/opengl/qpaintengine_opengl.cpp
+++ b/src/opengl/qpaintengine_opengl.cpp
@@ -60,6 +60,7 @@
#include <private/qglpixelbuffer_p.h>
#include <private/qbezier_p.h>
#include <qglframebufferobject.h>
+#include <private/qstatictext_p.h>
#include "private/qtessellator_p.h"
@@ -4548,7 +4549,7 @@ public:
QGLGlyphCache() : QObject(0) { current_cache = 0; }
~QGLGlyphCache();
QGLGlyphCoord *lookup(QFontEngine *, glyph_t);
- void cacheGlyphs(QGLContext *, const QTextItemInt &, const QVarLengthArray<glyph_t> &);
+ void cacheGlyphs(QGLContext *, QFontEngine *, glyph_t *glyphs, int numGlyphs);
void cleanCache();
void allocTexture(int width, int height, GLuint texture);
@@ -4700,8 +4701,8 @@ static QImage getCurrentTexture(const QColor &color, QGLFontTexture *font_tex)
}
#endif
-void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti,
- const QVarLengthArray<glyph_t> &glyphs)
+void QGLGlyphCache::cacheGlyphs(QGLContext *context, QFontEngine *fontEngine,
+ glyph_t *glyphs, int numGlyphs)
{
QGLContextHash::const_iterator dev_it = qt_context_cache.constFind(context);
QGLFontGlyphHash *font_cache = 0;
@@ -4737,25 +4738,25 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti,
}
Q_ASSERT(font_cache != 0);
- QGLFontGlyphHash::const_iterator cache_it = font_cache->constFind(ti.fontEngine);
+ QGLFontGlyphHash::const_iterator cache_it = font_cache->constFind(fontEngine);
QGLGlyphHash *cache = 0;
if (cache_it == font_cache->constEnd()) {
cache = new QGLGlyphHash;
- font_cache->insert(ti.fontEngine, cache);
- connect(ti.fontEngine, SIGNAL(destroyed(QObject*)), SLOT(fontEngineDestroyed(QObject*)));
+ font_cache->insert(fontEngine, cache);
+ connect(fontEngine, SIGNAL(destroyed(QObject*)), SLOT(fontEngineDestroyed(QObject*)));
} else {
cache = cache_it.value();
}
current_cache = cache;
quint64 font_key = (reinterpret_cast<quint64>(context_key ? context_key : context) << 32)
- | reinterpret_cast<quint64>(ti.fontEngine);
+ | reinterpret_cast<quint64>(fontEngine);
QGLFontTexHash::const_iterator it = qt_font_textures.constFind(font_key);
QGLFontTexture *font_tex;
if (it == qt_font_textures.constEnd()) {
GLuint font_texture;
glGenTextures(1, &font_texture);
- GLint tex_height = qt_next_power_of_two(qRound(ti.ascent.toReal() + ti.descent.toReal())+2);
+ GLint tex_height = qt_next_power_of_two(qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2);
GLint tex_width = qt_next_power_of_two(tex_height*30); // ###
GLint max_tex_size;
glGetIntegerv(GL_MAX_TEXTURE_SIZE, &max_tex_size);
@@ -4777,16 +4778,16 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti,
glBindTexture(GL_TEXTURE_2D, font_tex->texture);
}
- for (int i=0; i< glyphs.size(); ++i) {
+ for (int i=0; i< numGlyphs; ++i) {
QGLGlyphHash::const_iterator it = cache->constFind(glyphs[i]);
if (it == cache->constEnd()) {
// render new glyph and put it in the cache
- glyph_metrics_t metrics = ti.fontEngine->boundingBox(glyphs[i]);
+ glyph_metrics_t metrics = fontEngine->boundingBox(glyphs[i]);
int glyph_width = qRound(metrics.width.toReal())+2;
- int glyph_height = qRound(ti.ascent.toReal() + ti.descent.toReal())+2;
+ int glyph_height = qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2;
if (font_tex->x_offset + glyph_width + x_margin > font_tex->width) {
- int strip_height = qt_next_power_of_two(qRound(ti.ascent.toReal() + ti.descent.toReal())+2);
+ int strip_height = qt_next_power_of_two(qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2);
font_tex->x_offset = x_margin;
font_tex->y_offset += strip_height;
if (font_tex->y_offset >= font_tex->height) {
@@ -4819,7 +4820,7 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti,
}
}
- QImage glyph_im(ti.fontEngine->alphaMapForGlyph(glyphs[i]));
+ QImage glyph_im(fontEngine->alphaMapForGlyph(glyphs[i]));
glyph_im = glyph_im.convertToFormat(QImage::Format_Indexed8);
glyph_width = glyph_im.width();
Q_ASSERT(glyph_width >= 0);
@@ -4899,30 +4900,15 @@ void qgl_cleanup_glyph_cache(QGLContext *ctx)
qt_glyph_cache()->cleanupContext(ctx);
}
-void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
+void QOpenGLPaintEngine::drawStaticTextItem(QStaticTextItem *textItem)
{
Q_D(QOpenGLPaintEngine);
- const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem);
-
- // fall back to drawing a polygon if the scale factor is large, or
- // we use a gradient pen
- if ((d->matrix.det() > 1) || (d->pen_brush_style >= Qt::LinearGradientPattern
- && d->pen_brush_style <= Qt::ConicalGradientPattern)) {
- QPaintEngine::drawTextItem(p, textItem);
- return;
- }
-
d->flushDrawQueue();
- // add the glyphs used to the glyph texture cache
- QVarLengthArray<QFixedPoint> positions;
- QVarLengthArray<glyph_t> glyphs;
- QTransform matrix = QTransform::fromTranslate(qRound(p.x()), qRound(p.y()));
- ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
-
// make sure the glyphs we want to draw are in the cache
- qt_glyph_cache()->cacheGlyphs(d->device->context(), ti, glyphs);
+ qt_glyph_cache()->cacheGlyphs(d->device->context(), textItem->fontEngine, textItem->glyphs,
+ textItem->numGlyphs);
d->setGradientOps(Qt::SolidPattern, QRectF()); // turns off gradient ops
qt_glColor4ubv(d->pen_color);
@@ -4944,13 +4930,13 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte
glEnableClientState(GL_VERTEX_ARRAY);
glEnableClientState(GL_TEXTURE_COORD_ARRAY);
- bool antialias = !(ti.fontEngine->fontDef.styleStrategy & QFont::NoAntialias)
- && (d->matrix.type() > QTransform::TxTranslate);
+ bool antialias = !(textItem->fontEngine->fontDef.styleStrategy & QFont::NoAntialias)
+ && (d->matrix.type() > QTransform::TxTranslate);
glTexParameterf(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, antialias ? GL_LINEAR : GL_NEAREST);
glTexParameterf(GL_TEXTURE_2D, GL_TEXTURE_MAG_FILTER, antialias ? GL_LINEAR : GL_NEAREST);
- for (int i=0; i< glyphs.size(); ++i) {
- QGLGlyphCoord *g = qt_glyph_cache()->lookup(ti.fontEngine, glyphs[i]);
+ for (int i=0; i< textItem->numGlyphs; ++i) {
+ QGLGlyphCoord *g = qt_glyph_cache()->lookup(textItem->fontEngine, textItem->glyphs[i]);
// we don't cache glyphs with no width/height
if (!g)
@@ -4962,8 +4948,8 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte
x2 = x1 + g->width;
y2 = y1 + g->height;
- QPointF logical_pos((positions[i].x - g->x_offset).toReal(),
- (positions[i].y + g->y_offset).toReal());
+ QPointF logical_pos((textItem->glyphPositions[i].x - g->x_offset).toReal(),
+ (textItem->glyphPositions[i].y + g->y_offset).toReal());
qt_add_rect_to_array(QRectF(logical_pos, QSizeF(g->log_width, g->log_height)), vertexArray);
qt_add_texcoords_to_array(x1, y1, x2, y2, texCoordArray);
@@ -4980,6 +4966,40 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte
// XXX: This may not be needed as this behavior does seem to be caused by driver bug
glColorMask(GL_TRUE, GL_TRUE, GL_TRUE, GL_TRUE);
#endif
+
+}
+
+void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
+{
+ Q_D(QOpenGLPaintEngine);
+
+ const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem);
+
+ // fall back to drawing a polygon if the scale factor is large, or
+ // we use a gradient pen
+ if ((d->matrix.det() > 1) || (d->pen_brush_style >= Qt::LinearGradientPattern
+ && d->pen_brush_style <= Qt::ConicalGradientPattern)) {
+ QPaintEngine::drawTextItem(p, textItem);
+ return;
+ }
+
+ // add the glyphs used to the glyph texture cache
+ QVarLengthArray<QFixedPoint> positions;
+ QVarLengthArray<glyph_t> glyphs;
+ QTransform matrix = QTransform::fromTranslate(qRound(p.x()), qRound(p.y()));
+ ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions);
+
+ {
+ QStaticTextItem staticTextItem;
+ staticTextItem.chars = ti.chars;
+ staticTextItem.fontEngine = ti.fontEngine;
+ staticTextItem.glyphs = glyphs.data();
+ staticTextItem.numChars = ti.num_chars;
+ staticTextItem.numGlyphs = glyphs.size();
+ staticTextItem.glyphPositions = positions.data();
+ drawStaticTextItem(&staticTextItem);
+ }
+
}
diff --git a/src/opengl/qpaintengine_opengl_p.h b/src/opengl/qpaintengine_opengl_p.h
index de0086a..55f7792 100644
--- a/src/opengl/qpaintengine_opengl_p.h
+++ b/src/opengl/qpaintengine_opengl_p.h
@@ -133,6 +133,7 @@ public:
void drawImage(const QRectF &r, const QImage &image, const QRectF &sr,
Qt::ImageConversionFlags conversionFlags);
void drawTextItem(const QPointF &p, const QTextItem &ti);
+ void drawStaticTextItem(QStaticTextItem *staticTextItem);
void drawEllipse(const QRectF &rect);
diff --git a/src/openvg/qpaintengine_vg.cpp b/src/openvg/qpaintengine_vg.cpp
index 18d6b0a..62f0293 100644
--- a/src/openvg/qpaintengine_vg.cpp
+++ b/src/openvg/qpaintengine_vg.cpp
@@ -50,10 +50,10 @@
#endif
#include <QtCore/qvarlengtharray.h>
#include <QtGui/private/qdrawhelper_p.h>
-#include <QtGui/private/qtextureglyphcache_p.h>
#include <QtGui/private/qtextengine_p.h>
#include <QtGui/private/qfontengine_p.h>
#include <QtGui/private/qpainterpath_p.h>
+#include <QtGui/private/qstatictext_p.h>
#include <QDebug>
#include <QSet>
@@ -86,10 +86,9 @@ public:
QVGFontGlyphCache();
~QVGFontGlyphCache();
- void cacheGlyphs(QVGPaintEnginePrivate *d,
- const QTextItemInt &ti,
- const QVarLengthArray<glyph_t> &glyphs);
- void setScaleFromText(const QTextItemInt &ti);
+ void cacheGlyphs(QVGPaintEnginePrivate *d, QFontEngine *fontEngine, const glyph_t *g, int count);
+
+ void setScaleFromText(const QFont &font, QFontEngine *fontEngine);
VGFont font;
VGfloat scaleX;
@@ -3185,22 +3184,20 @@ QVGFontGlyphCache::~QVGFontGlyphCache()
vgDestroyFont(font);
}
-void QVGFontGlyphCache::setScaleFromText(const QTextItemInt &ti)
+void QVGFontGlyphCache::setScaleFromText(const QFont &font, QFontEngine *fontEngine)
{
- QFontInfo fi(ti.font());
+ QFontInfo fi(font);
qreal pixelSize = fi.pixelSize();
- qreal emSquare = ti.fontEngine->properties().emSquare.toReal();
+ qreal emSquare = fontEngine->properties().emSquare.toReal();
scaleX = scaleY = static_cast<VGfloat>(pixelSize / emSquare);
}
-void QVGFontGlyphCache::cacheGlyphs
- (QVGPaintEnginePrivate *d, const QTextItemInt &ti,
- const QVarLengthArray<glyph_t> &glyphs)
+void QVGFontGlyphCache::cacheGlyphs(QVGPaintEnginePrivate *d,
+ QFontEngine *fontEngine,
+ const glyph_t *g, int count)
{
VGfloat origin[2];
VGfloat escapement[2];
- const glyph_t *g = glyphs.constData();
- int count = glyphs.size();
glyph_metrics_t metrics;
// Some Qt font engines don't set yoff in getUnscaledGlyph().
// Zero the metric structure so that everything has a default value.
@@ -3219,9 +3216,9 @@ void QVGFontGlyphCache::cacheGlyphs
}
#if !defined(QVG_NO_IMAGE_GLYPHS)
Q_UNUSED(d);
- QImage scaledImage = ti.fontEngine->alphaMapForGlyph(glyph);
+ QImage scaledImage = fontEngine->alphaMapForGlyph(glyph);
VGImage vgImage = VG_INVALID_HANDLE;
- metrics = ti.fontEngine->boundingBox(glyph);
+ metrics = fontEngine->boundingBox(glyph);
if (!scaledImage.isNull()) { // Not a space character
if (scaledImage.format() == QImage::Format_Indexed8) {
vgImage = vgCreateImage(VG_A_8, scaledImage.width(), scaledImage.height(), VG_IMAGE_QUALITY_FASTER);
@@ -3245,7 +3242,7 @@ void QVGFontGlyphCache::cacheGlyphs
#else
// Calculate the path for the glyph and cache it.
QPainterPath path;
- ti.fontEngine->getUnscaledGlyph(glyph, &path, &metrics);
+ fontEngine->getUnscaledGlyph(glyph, &path, &metrics);
VGPath vgPath;
if (!path.isEmpty()) {
vgPath = d->painterPathToVGPath(path);
@@ -3286,8 +3283,28 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
ti.fontEngine->getGlyphPositions
(ti.glyphs, matrix, ti.flags, glyphs, positions);
+ if (!drawCachedGlyphs(glyphs.size(), glyphs.data(), ti.font(), ti.fontEngine, p))
+ QPaintEngineEx::drawTextItem(p, textItem);
+#else
+ // OpenGL 1.0 does not have support for VGFont and glyphs,
+ // so fall back to the default Qt path stroking algorithm.
+ QPaintEngineEx::drawTextItem(p, textItem);
+#endif
+}
+
+void QVGPaintEngine::drawStaticTextItem(QStaticTextItem *textItem)
+{
+ drawCachedGlyphs(textItem->numGlyphs, textItem->glyphs, textItem->font, textItem->fontEngine,
+ QPointF(0, 0));
+}
+
+ bool QVGPaintEngine::drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFont &font,
+ QFontEngine *fontEngine, const QPointF &p)
+ {
+ Q_D(QVGPaintEngine);
+
// Find the glyph cache for this font.
- QVGFontCache::ConstIterator it = d->fontCache.constFind(ti.fontEngine);
+ QVGFontCache::ConstIterator it = d->fontCache.constFind(fontEngine);
QVGFontGlyphCache *glyphCache;
if (it != d->fontCache.constEnd()) {
glyphCache = it.value();
@@ -3295,15 +3312,14 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
glyphCache = new QVGFontGlyphCache();
if (glyphCache->font == VG_INVALID_HANDLE) {
qWarning("QVGPaintEngine::drawTextItem: OpenVG fonts are not supported by the OpenVG engine");
- delete glyphCache;
- QPaintEngineEx::drawTextItem(p, textItem);
- return;
+ delete glyphCache;
+ return false;
}
- glyphCache->setScaleFromText(ti);
- d->fontCache.insert(ti.fontEngine, glyphCache);
+ glyphCache->setScaleFromText(font, fontEngine);
+ d->fontCache.insert(fontEngine, glyphCache);
if (!d->fontEngineCleaner)
d->fontEngineCleaner = new QVGFontEngineCleaner(d);
- QObject::connect(ti.fontEngine, SIGNAL(destroyed()),
+ QObject::connect(fontEngine, SIGNAL(destroyed()),
d->fontEngineCleaner, SLOT(fontEngineDestroyed()));
}
@@ -3316,7 +3332,7 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
d->setTransform(VG_MATRIX_GLYPH_USER_TO_SURFACE, glyphTransform);
// Add the glyphs from the text item into the glyph cache.
- glyphCache->cacheGlyphs(d, ti, glyphs);
+ glyphCache->cacheGlyphs(d, fontEngine, glyphs, numGlyphs);
// Set the glyph drawing origin.
VGfloat origin[2];
@@ -3335,13 +3351,10 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem)
// Draw the glyphs. We need to fill with the brush associated with
// the Qt pen, not the Qt brush.
d->ensureBrush(state()->pen.brush());
- vgDrawGlyphs(glyphCache->font, glyphs.size(), (VGuint*)glyphs.data(),
+ vgDrawGlyphs(glyphCache->font, numGlyphs, (VGuint*)glyphs,
NULL, NULL, VG_FILL_PATH, VG_TRUE);
-#else
- // OpenGL 1.0 does not have support for VGFont and glyphs,
- // so fall back to the default Qt path stroking algorithm.
- QPaintEngineEx::drawTextItem(p, textItem);
-#endif
+
+ return true;
}
void QVGPaintEngine::setState(QPainterState *s)
diff --git a/src/openvg/qpaintengine_vg_p.h b/src/openvg/qpaintengine_vg_p.h
index 3f87a72..3f73fed 100644
--- a/src/openvg/qpaintengine_vg_p.h
+++ b/src/openvg/qpaintengine_vg_p.h
@@ -54,6 +54,7 @@
//
#include <QtGui/private/qpaintengineex_p.h>
+#include <QtGui/private/qtextureglyphcache_p.h>
QT_BEGIN_NAMESPACE
@@ -139,6 +140,9 @@ public:
void drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QFlags<QDrawPixmaps::DrawingHint> hints);
void drawTextItem(const QPointF &p, const QTextItem &textItem);
+ void drawStaticTextItem(QStaticTextItem *staticTextItem);
+ bool drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFont &font,
+ QFontEngine *fontEngine, const QPointF &p);
void setState(QPainterState *s);
QVGPainterState *state() { return static_cast<QVGPainterState *>(QPaintEngineEx::state()); }
diff --git a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp
index 2b11058..12f4c6b 100644
--- a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp
+++ b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp
@@ -176,7 +176,7 @@ enum PaintOperation {
DRAW_PATH = 0x0040, DRAW_POINTS = 0x0080, DRAW_ELLIPSE = 0x0100,
DRAW_POLYGON = 0x0200, DRAW_TEXT = 0x0400, FILL_PATH = 0x0800,
FILL_RECT = 0x1000, DRAW_COLORSPANS = 0x2000, DRAW_ROUNDED_RECT = 0x4000,
- ALL = 0xffff
+ DRAW_STATICTEXT = 0x8000, ALL = 0xffff
};
#endif
@@ -711,6 +711,14 @@ void QDirectFBPaintEngine::drawRoundedRect(const QRectF &rect, qreal xrad, qreal
QRasterPaintEngine::drawRoundedRect(rect, xrad, yrad, mode);
}
+void QDirectFBPaintEngine::drawStaticTextItem(QStaticTextItem *item)
+{
+ RASTERFALLBACK(DRAW_STATICTEXT, item, VOID_ARG(), VOID_ARG());
+ Q_D(QDirectFBPaintEngine);
+ d->lock();
+ QRasterPaintEngine::drawStaticTextItem(item);
+}
+
void QDirectFBPaintEngine::fillRect(const QRectF &rect, const QBrush &brush)
{
Q_D(QDirectFBPaintEngine);
diff --git a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h
index 64609d7..19e8b84 100644
--- a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h
+++ b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h
@@ -109,6 +109,8 @@ public:
virtual void clip(const QRegion &region, Qt::ClipOperation op);
virtual void clip(const QRect &rect, Qt::ClipOperation op);
+ virtual void drawStaticTextItem(QStaticTextItem *item);
+
static void initImageCache(int size);
};
diff --git a/src/qt3support/dialogs/q3filedialog.cpp b/src/qt3support/dialogs/q3filedialog.cpp
index 9b8e4d3..35f7890 100644
--- a/src/qt3support/dialogs/q3filedialog.cpp
+++ b/src/qt3support/dialogs/q3filedialog.cpp
@@ -475,9 +475,17 @@ static int sortFilesBy = (int)QDir::Name;
static bool sortAscending = true;
static bool detailViewMode = false;
-static Q3CleanupHandler<QPixmap> qfd_cleanup_pixmap;
static Q3CleanupHandler<QString> qfd_cleanup_string;
+static void qt_cleanup_fd_pixmaps();
+typedef QList<QPixmap *> FDPixmaps;
+Q_GLOBAL_STATIC_WITH_INITIALIZER(FDPixmaps, qfd_pixmaps, qAddPostRoutine(qt_cleanup_fd_pixmaps))
+
+static void qt_cleanup_fd_pixmaps()
+{
+ qDeleteAll(*qfd_pixmaps());
+}
+
static QString toRootIfNotExists( const QString &path )
{
if ( !path.isEmpty() )
@@ -533,37 +541,37 @@ static void makeVariables() {
qfd_cleanup_string.add(&workingDirectory);
openFolderIcon = new QPixmap((const char **)open_xpm);
- qfd_cleanup_pixmap.add(&openFolderIcon);
+ qfd_pixmaps()->append(openFolderIcon);
symLinkDirIcon = new QPixmap((const char **)link_dir_xpm);
- qfd_cleanup_pixmap.add(&symLinkDirIcon);
+ qfd_pixmaps()->append(symLinkDirIcon);
symLinkFileIcon = new QPixmap((const char **)link_file_xpm);
- qfd_cleanup_pixmap.add(&symLinkFileIcon);
+ qfd_pixmaps()->append(symLinkFileIcon);
fileIcon = new QPixmap((const char **)file_xpm);
- qfd_cleanup_pixmap.add(&fileIcon);
+ qfd_pixmaps()->append(fileIcon);
closedFolderIcon = new QPixmap((const char **)closed_xpm);
- qfd_cleanup_pixmap.add(&closedFolderIcon);
+ qfd_pixmaps()->append(closedFolderIcon);
detailViewIcon = new QPixmap((const char **)detailedview_xpm);
- qfd_cleanup_pixmap.add(&detailViewIcon);
+ qfd_pixmaps()->append(detailViewIcon);
multiColumnListViewIcon = new QPixmap((const char **)mclistview_xpm);
- qfd_cleanup_pixmap.add(&multiColumnListViewIcon);
+ qfd_pixmaps()->append(multiColumnListViewIcon);
cdToParentIcon = new QPixmap((const char **)cdtoparent_xpm);
- qfd_cleanup_pixmap.add(&cdToParentIcon);
+ qfd_pixmaps()->append(cdToParentIcon);
newFolderIcon = new QPixmap((const char **)newfolder_xpm);
- qfd_cleanup_pixmap.add(&newFolderIcon);
+ qfd_pixmaps()->append(newFolderIcon);
previewInfoViewIcon
= new QPixmap((const char **)previewinfoview_xpm);
- qfd_cleanup_pixmap.add(&previewInfoViewIcon);
+ qfd_pixmaps()->append(previewInfoViewIcon);
previewContentsViewIcon
= new QPixmap((const char **)previewcontentsview_xpm);
- qfd_cleanup_pixmap.add(&previewContentsViewIcon);
+ qfd_pixmaps()->append(previewContentsViewIcon);
startCopyIcon = new QPixmap((const char **)start_xpm);
- qfd_cleanup_pixmap.add(&startCopyIcon);
+ qfd_pixmaps()->append(startCopyIcon);
endCopyIcon = new QPixmap((const char **)end_xpm);
- qfd_cleanup_pixmap.add(&endCopyIcon);
+ qfd_pixmaps()->append(endCopyIcon);
goBackIcon = new QPixmap((const char **)back_xpm);
- qfd_cleanup_pixmap.add(&goBackIcon);
+ qfd_pixmaps()->append(goBackIcon);
fifteenTransparentPixels = new QPixmap(closedFolderIcon->width(), 1);
- qfd_cleanup_pixmap.add(&fifteenTransparentPixels);
+ qfd_pixmaps()->append(fifteenTransparentPixels);
QBitmap m(fifteenTransparentPixels->width(), 1);
m.fill(Qt::color0);
fifteenTransparentPixels->setMask(m);
diff --git a/src/qt3support/itemviews/q3iconview.cpp b/src/qt3support/itemviews/q3iconview.cpp
index 67c956e..683e3d6 100644
--- a/src/qt3support/itemviews/q3iconview.cpp
+++ b/src/qt3support/itemviews/q3iconview.cpp
@@ -132,14 +132,21 @@ static QPixmap *qiv_selection = 0;
#endif
static bool optimize_layout = false;
-static Q3CleanupHandler<QPixmap> qiv_cleanup_pixmap;
+static void qt_cleanup_iv_pixmaps();
+typedef QList<QPixmap *> IVPixmaps;
+Q_GLOBAL_STATIC_WITH_INITIALIZER(IVPixmaps, qiv_pixmaps, qAddPostRoutine(qt_cleanup_iv_pixmaps))
+
+static void qt_cleanup_iv_pixmaps()
+{
+ qDeleteAll(*qiv_pixmaps());
+}
static QPixmap *get_qiv_buffer_pixmap(const QSize &s)
{
if (!qiv_buffer_pixmap) {
qiv_buffer_pixmap = new QPixmap(s);
- qiv_cleanup_pixmap.add(&qiv_buffer_pixmap);
+ qiv_pixmaps()->append(qiv_buffer_pixmap);
return qiv_buffer_pixmap;
}
@@ -2580,7 +2587,7 @@ Q3IconView::Q3IconView(QWidget *parent, const char *name, Qt::WindowFlags f)
{
if (!unknown_icon) {
unknown_icon = new QPixmap((const char **)unknown_xpm);
- qiv_cleanup_pixmap.add(&unknown_icon);
+ qiv_pixmaps()->append(unknown_icon);
}
d = new Q3IconViewPrivate;
diff --git a/src/qt3support/itemviews/q3listview.cpp b/src/qt3support/itemviews/q3listview.cpp
index 2c15ad0..12dad84 100644
--- a/src/qt3support/itemviews/q3listview.cpp
+++ b/src/qt3support/itemviews/q3listview.cpp
@@ -70,9 +70,6 @@ QT_BEGIN_NAMESPACE
const int Unsorted = 16383;
-static Q3CleanupHandler<QBitmap> qlv_cleanup_bitmap;
-
-
struct Q3ListViewPrivate
{
// classes that are here to avoid polluting the global name space
diff --git a/src/sql/drivers/odbc/qsql_odbc.cpp b/src/sql/drivers/odbc/qsql_odbc.cpp
index 18bc743..6b82692 100644
--- a/src/sql/drivers/odbc/qsql_odbc.cpp
+++ b/src/sql/drivers/odbc/qsql_odbc.cpp
@@ -137,6 +137,7 @@ public:
QSqlRecord rInf;
QVector<QVariant> fieldCache;
+ QVector<wchar_t *> paramCache;
int fieldCacheIdx;
int disconnectCount;
bool hasSQLFetchScroll;
@@ -195,7 +196,7 @@ static QString qWarnODBCHandle(int handleType, SQLHANDLE handle, int *nativeCode
*nativeCode = nativeCode_;
QString tmpstore;
#ifdef UNICODE
- tmpstore = QString((const QChar*)description_.data(), msgLen);
+ tmpstore = QString::fromWCharArray((const wchar_t*)description_, msgLen);
#else
tmpstore = QString::fromLocal8Bit((const char*)description_.data(), msgLen);
#endif
@@ -323,7 +324,7 @@ static QString qGetStringData(SQLHANDLE hStmt, int column, int colSize, bool uni
} else {
colSize++; // make sure there is room for more than the 0 termination
if (unicode) {
- colSize *= 2; // a tiny bit faster, since it saves a SQLGetData() call
+ colSize *= sizeof(wchar_t); // a tiny bit faster, since it saves a SQLGetData() call
}
}
QVarLengthArray<char> buf(colSize);
@@ -344,9 +345,9 @@ static QString qGetStringData(SQLHANDLE hStmt, int column, int colSize, bool uni
// contain the number of bytes returned - it contains the
// total number of bytes that CAN be fetched
// colSize-1: remove 0 termination when there is more data to fetch
- int rSize = (r == SQL_SUCCESS_WITH_INFO) ? (unicode ? colSize-2 : colSize-1) : lengthIndicator;
+ int rSize = (r == SQL_SUCCESS_WITH_INFO) ? (unicode ? colSize-sizeof(wchar_t) : colSize-1) : lengthIndicator;
if (unicode) {
- fieldVal += QString((const QChar*) buf.constData(), rSize / 2);
+ fieldVal += QString::fromWCharArray((wchar_t*)buf.constData(), rSize / sizeof(wchar_t));
} else {
fieldVal += QString::fromAscii(buf.constData(), rSize);
}
@@ -542,7 +543,7 @@ static QSqlField qMakeFieldInfo(const QODBCPrivate* p, int i )
}
#ifdef UNICODE
- QString qColName((const QChar*)colName, colNameLen);
+ QString qColName = QString::fromWCharArray((const wchar_t*)colName, colNameLen);
#else
QString qColName = QString::fromLocal8Bit((const char*)colName);
#endif
@@ -1257,9 +1258,12 @@ bool QODBCResult::exec()
// bind parameters - only positional binding allowed
QVector<QVariant>& values = boundValues();
+ QVector<wchar_t *> wcharstorage;
+
int i;
SQLRETURN r;
for (i = 0; i < values.count(); ++i) {
+ wcharstorage.append(NULL);
if (bindValueType(i) & QSql::Out)
values[i].detach();
const QVariant &val = values.at(i);
@@ -1421,13 +1425,14 @@ bool QODBCResult::exec()
case QVariant::String:
if (d->unicode) {
QString str = val.toString();
- str.utf16();
+ int strSize = str.length() * sizeof(wchar_t);
if (*ind != SQL_NULL_DATA)
- *ind = str.length() * sizeof(QChar);
- int strSize = str.length() * sizeof(QChar);
+ *ind = strSize;
if (bindValueType(i) & QSql::Out) {
- QByteArray ba((char*)str.constData(), str.capacity() * sizeof(QChar));
+ wchar_t *temp=new wchar_t[str.capacity()*sizeof(wchar_t)];
+ str.toWCharArray(temp);
+ QByteArray ba((char*)temp, str.capacity() * sizeof(wchar_t));
r = SQLBindParameter(d->hStmt,
i + 1,
qParamType[(QFlag)(bindValueType(i)) & QSql::InOut],
@@ -1439,9 +1444,13 @@ bool QODBCResult::exec()
ba.size(),
ind);
tmpStorage.append(ba);
+ wcharstorage.replace(i,temp);
break;
}
+ wchar_t *temp=new wchar_t[(1+str.length())*sizeof(wchar_t)];
+ str.toWCharArray(temp);
+ temp[str.length()]=0;
r = SQLBindParameter(d->hStmt,
i + 1,
qParamType[(QFlag)(bindValueType(i)) & QSql::InOut],
@@ -1449,9 +1458,10 @@ bool QODBCResult::exec()
strSize > 254 ? SQL_WLONGVARCHAR : SQL_WVARCHAR,
strSize,
0,
- (void *)str.constData(),
+ (void *)temp,
strSize,
ind);
+ wcharstorage.replace(i,temp);
break;
}
else
@@ -1500,6 +1510,13 @@ bool QODBCResult::exec()
}
}
r = SQLExecute(d->hStmt);
+
+ for(int i=0;i<wcharstorage.size();i++)
+ {
+ if(wcharstorage.at(i))
+ delete [](wcharstorage.at(i));
+ }
+
if (r != SQL_SUCCESS && r != SQL_SUCCESS_WITH_INFO) {
qWarning() << "QODBCResult::exec: Unable to execute statement:" << qODBCWarn(d);
setLastError(qMakeError(QCoreApplication::translate("QODBCResult",
diff --git a/src/sql/drivers/sqlite/qsql_sqlite.cpp b/src/sql/drivers/sqlite/qsql_sqlite.cpp
index 9fff552..d3be304 100644
--- a/src/sql/drivers/sqlite/qsql_sqlite.cpp
+++ b/src/sql/drivers/sqlite/qsql_sqlite.cpp
@@ -500,32 +500,6 @@ bool QSQLiteDriver::hasFeature(DriverFeature f) const
return false;
}
-static int qGetSqliteTimeout(QString opts)
-{
- enum { DefaultTimeout = 5000 };
-
- opts.remove(QLatin1Char(' '));
- foreach(QString option, opts.split(QLatin1Char(';'))) {
- if (option.startsWith(QLatin1String("QSQLITE_BUSY_TIMEOUT="))) {
- bool ok;
- int nt = option.mid(21).toInt(&ok);
- if (ok)
- return nt;
- }
- }
- return DefaultTimeout;
-}
-
-static int qGetSqliteOpenMode(QString opts)
-{
- opts.remove(QLatin1Char(' '));
- foreach(QString option, opts.split(QLatin1Char(';'))) {
- if (option == QLatin1String("QSQLITE_OPEN_READONLY"))
- return SQLITE_OPEN_READONLY;
- }
- return SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE;
-}
-
/*
SQLite dbs have no user name, passwords, hosts or ports.
just file names.
@@ -537,9 +511,26 @@ bool QSQLiteDriver::open(const QString & db, const QString &, const QString &, c
if (db.isEmpty())
return false;
+ bool sharedCache = false;
+ int openMode = SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE, timeOut=5000;
+ QStringList opts=QString(conOpts).remove(QLatin1Char(' ')).split(QLatin1Char(';'));
+ foreach(const QString &option, opts) {
+ if (option.startsWith(QLatin1String("QSQLITE_BUSY_TIMEOUT="))) {
+ bool ok;
+ int nt = option.mid(21).toInt(&ok);
+ if (ok)
+ timeOut = nt;
+ }
+ if (option == QLatin1String("QSQLITE_OPEN_READONLY"))
+ openMode = SQLITE_OPEN_READONLY;
+ if (option == QLatin1String("QSQLITE_ENABLE_SHARED_CACHE"))
+ sharedCache = true;
+ }
+
+ sqlite3_enable_shared_cache(sharedCache);
- if (sqlite3_open_v2(db.toUtf8().constData(), &d->access, qGetSqliteOpenMode(conOpts), NULL) == SQLITE_OK) {
- sqlite3_busy_timeout(d->access, qGetSqliteTimeout(conOpts));
+ if (sqlite3_open_v2(db.toUtf8().constData(), &d->access, openMode, NULL) == SQLITE_OK) {
+ sqlite3_busy_timeout(d->access, timeOut);
setOpen(true);
setOpenError(false);
return true;
diff --git a/src/sql/kernel/qsqldatabase.cpp b/src/sql/kernel/qsqldatabase.cpp
index 031261d..1416ee3 100644
--- a/src/sql/kernel/qsqldatabase.cpp
+++ b/src/sql/kernel/qsqldatabase.cpp
@@ -1267,6 +1267,7 @@ QSqlRecord QSqlDatabase::record(const QString& tablename) const
\list
\i QSQLITE_BUSY_TIMEOUT
\i QSQLITE_OPEN_READONLY
+ \i QSQLITE_ENABLE_SHARED_CACHE
\endlist
\i
diff --git a/src/xmlpatterns/data/qatomicvalue.cpp b/src/xmlpatterns/data/qatomicvalue.cpp
index 6858e27..c4f3578 100644
--- a/src/xmlpatterns/data/qatomicvalue.cpp
+++ b/src/xmlpatterns/data/qatomicvalue.cpp
@@ -226,6 +226,8 @@ ItemType::Ptr AtomicValue::qtToXDMType(const QXmlItem &item)
/* Fallthrough. */
case QVariant::Time:
return BuiltinTypes::xsDateTime;
+ case QMetaType::Float:
+ return BuiltinTypes::xsFloat;
case QVariant::Double:
return BuiltinTypes::xsDouble;
default: