| Commit message (Collapse) | Author | Age | Files | Lines |
| |
|
|
|
|
|
|
| |
Got introduced with change f62f6effab8d1551d8e5e5843dc478addee96de1
Reviewed-by: Roberto Raggi
|
|
|
|
|
|
|
|
|
|
| |
As the changedCursors list grew large, the function used to spend an
extraordinate amount of time in QList::contains.
The fix removes the changedCursors list outright and replaces it with a
flag in QTextCursorPrivate.
Done-with: mae
|
|\
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
* '4.7' of scm.dev.nokia.troll.no:qt/qt-qml: (53 commits)
ListView.onRemove animation is not played when the list has only one item.
Move listview/itemlist.qml to a separate visualitemmodel example
Make snapping work properly for highlight ranges > item size
Fix test - sizeHint should not change after initial load. Also use
Minor doc fixes
Doc improvements, including snippet fixes, linking to examples, making
Fix qmlviewer test failure on windows
Do not keep flush timer running once no pixmaps are detached.
Avoid recursive refill() in List/GridView
Make snippet compile and pass license test, and add missing snippet file
Remove accidentaly added characters.
Update on color change.
Update on color change.
Add go button to webbrowser example.
Remove 'XXX Experimental' from VisualItemModel/VisualDataModel and
Document attached properties
Add 'on' prefix to documentation of signals
Stablize qmlviewer test
Improve test stability.
qmlviewer: ensure that only clicks on the current file list are handled.
...
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
QTextDocument had no way of storing the cursor position from which
a document change was initiated in the undo stack. That means that
any undo operation would reposition the text cursor to the text
position where the actual change happened. This works in many cases,
but not always.
In Qt Creator we have standard IDE shortcuts like e.g.
Ctrl+Return for InsertLineBelowCurrentLine, which insert a newline
at the end of the current line, not at the cursor position. Using
undo there resulted in a surprisingly wrong cursor position.
The problem becomes worse with more advanced refactoring and
productivity tools (like snippets).
The patch creates a synthetic CursorMoved undo item with the position
which was current at the time of calling QTextCursor::beginEditBlock(),
but only if necesary, i.e. only in those cases where the cursor would
be positioned wrongly.
Reviewed-by: Roberto Raggi
|
|/
|
|
|
| |
Task-number: Part of QT-3292
Reviewed-by: Simon Hausmann
|
|
|
|
|
|
|
|
| |
The mechanism allows the cursor to move up and down on a visually
straight line with proportional fonts, and to gently "jump"
over short lines.
Reviewed-by: mae
|
|
|
|
|
|
|
|
|
|
|
|
|
| |
Defines whether the cursor should keep its position when
text gets inserted at the current position of the cursor.
For example, we don't want QTextCursor to extend the selection
when inserting characters at the end of an extra selection
representing a user-type but we do want the selection to grow
when rewriting a region of code (e.g. when using our QuickFix engine).
Task-number: QTBUG-11075
Reviewed-by: mae
|
|
|
|
|
|
|
|
|
|
| |
We have a missleading function QTextCursor::columnNumber() since 4.2,
which almost never returns what you want.
The pattern cursor.position() - cursor.block().position() is used
frequently in code using QTextCursor.
Reviewed-by: Roberto Raggi
|
|
|
|
| |
Reviewed-by: Trust Me
|
|
|
|
| |
Task-number: QTBUG-6763
|
|
|
|
|
|
|
|
|
| |
The change makes QTextCursor not extend the selection when inserting
characters at the end of the selection, provided that the cursor
position is at the end.
Reviewed-by: Simon Hausmann
Reviewed-by: Roberto Raggi
|
|
|
|
|
|
|
|
|
|
|
| |
When loading binary files as text, QTextCursor did not check for
beginning and end of frame (QChar(0xfdd0) and QChar(0xfdd1)), while
QTextDocument asserted that those characters were absent.
The patch makes QTextCursor::insertText() treat frame bounderies like
paragraph separators.
Reviewed-by: ck
|
|
|
|
| |
Reviewed-by: Trust Me
|
|\
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
Conflicts:
demos/boxes/glshaders.cpp
demos/boxes/vector.h
demos/embedded/fluidlauncher/pictureflow.cpp
demos/embedded/fluidlauncher/pictureflow.h
doc/src/desktop-integration.qdoc
doc/src/distributingqt.qdoc
doc/src/examples-overview.qdoc
doc/src/examples.qdoc
doc/src/frameworks-technologies/dbus-adaptors.qdoc
doc/src/geometry.qdoc
doc/src/groups.qdoc
doc/src/objecttrees.qdoc
doc/src/platform-notes.qdoc
doc/src/plugins-howto.qdoc
doc/src/qt3support.qdoc
doc/src/qtdbus.qdoc
doc/src/qtdesigner.qdoc
doc/src/qtgui.qdoc
doc/src/qtmain.qdoc
doc/src/qtopengl.qdoc
doc/src/qtsvg.qdoc
doc/src/qtuiloader.qdoc
doc/src/qundo.qdoc
doc/src/richtext.qdoc
doc/src/topics.qdoc
src/corelib/tools/qdumper.cpp
src/gui/embedded/qkbdpc101_qws.cpp
src/gui/embedded/qkbdsl5000_qws.cpp
src/gui/embedded/qkbdusb_qws.cpp
src/gui/embedded/qkbdvr41xx_qws.cpp
src/gui/embedded/qkbdyopy_qws.cpp
src/gui/embedded/qmousebus_qws.cpp
src/gui/embedded/qmousevr41xx_qws.cpp
src/gui/embedded/qmouseyopy_qws.cpp
src/gui/painting/qpaintengine_d3d.cpp
src/gui/painting/qwindowsurface_d3d.cpp
src/opengl/gl2paintengineex/glgc_shader_source.h
src/opengl/gl2paintengineex/qglpexshadermanager.cpp
src/opengl/gl2paintengineex/qglpexshadermanager_p.h
src/opengl/gl2paintengineex/qglshader.cpp
src/opengl/gl2paintengineex/qglshader_p.h
src/opengl/util/fragmentprograms_p.h
src/plugins/kbddrivers/linuxis/linuxiskbdhandler.cpp
src/plugins/mousedrivers/linuxis/linuxismousehandler.cpp
src/script/parser/qscript.g
src/script/qscriptarray_p.h
src/script/qscriptasm_p.h
src/script/qscriptbuffer_p.h
src/script/qscriptclass.cpp
src/script/qscriptclassdata_p.h
src/script/qscriptcompiler.cpp
src/script/qscriptcompiler_p.h
src/script/qscriptcontext.cpp
src/script/qscriptcontext_p.cpp
src/script/qscriptcontext_p.h
src/script/qscriptcontextfwd_p.h
src/script/qscriptecmaarray.cpp
src/script/qscriptecmaarray_p.h
src/script/qscriptecmaboolean.cpp
src/script/qscriptecmacore.cpp
src/script/qscriptecmadate.cpp
src/script/qscriptecmadate_p.h
src/script/qscriptecmaerror.cpp
src/script/qscriptecmaerror_p.h
src/script/qscriptecmafunction.cpp
src/script/qscriptecmafunction_p.h
src/script/qscriptecmaglobal.cpp
src/script/qscriptecmaglobal_p.h
src/script/qscriptecmamath.cpp
src/script/qscriptecmamath_p.h
src/script/qscriptecmanumber.cpp
src/script/qscriptecmanumber_p.h
src/script/qscriptecmaobject.cpp
src/script/qscriptecmaobject_p.h
src/script/qscriptecmaregexp.cpp
src/script/qscriptecmaregexp_p.h
src/script/qscriptecmastring.cpp
src/script/qscriptecmastring_p.h
src/script/qscriptengine.cpp
src/script/qscriptengine_p.cpp
src/script/qscriptengine_p.h
src/script/qscriptenginefwd_p.h
src/script/qscriptextenumeration.cpp
src/script/qscriptextenumeration_p.h
src/script/qscriptextqobject.cpp
src/script/qscriptextqobject_p.h
src/script/qscriptextvariant.cpp
src/script/qscriptfunction.cpp
src/script/qscriptfunction_p.h
src/script/qscriptgc_p.h
src/script/qscriptmember_p.h
src/script/qscriptobject_p.h
src/script/qscriptprettypretty.cpp
src/script/qscriptprettypretty_p.h
src/script/qscriptvalue.cpp
src/script/qscriptvalueimpl.cpp
src/script/qscriptvalueimpl_p.h
src/script/qscriptvalueimplfwd_p.h
src/script/qscriptvalueiteratorimpl.cpp
src/script/qscriptxmlgenerator.cpp
src/script/qscriptxmlgenerator_p.h
tests/auto/linguist/lupdate/testdata/recursivescan/project.ui
tests/auto/linguist/lupdate/testdata/recursivescan/sub/finddialog.cpp
tests/auto/qkeyevent/tst_qkeyevent.cpp
tools/linguist/shared/cpp.cpp
|
| |
| |
| |
| | |
Reviewed-by: Trust Me
|
| |
| |
| |
| | |
Reviewed-by: Trust Me
|
| | |
|
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| |
| | |
- directory structure in doc/src
- moving of class-specific documentation together with classes
- new, less cluttered index page
- significantely reduced number of "groups of classes"
- categorized all (?) documentation into "Frameworks" or "Howtos"
- reformatting of examples pages
- splitting of very long documentation pages into walkthroughs
- some writing where it was missing
Squashed commit of the following:
commit b44ea6c917a7470a678509f4c6c9b8836d277346
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 18:32:09 2009 +0200
Some cleaning up in the categories.
commit b592c6eba72332fd23911251d836cf0af4514bae
Merge: 1e10d9e 285d4b1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 18:20:57 2009 +0200
Merge branch 'master' into doccleanup
commit 1e10d9e732f4171e61b3d1ecf0b64f7509e71607
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 18:19:03 2009 +0200
Split the "io" group into "io" and "network".
And list the network classes in the respective overview documentation.
commit fae86d24becb69c532a9c3b4fbf744c44a54f49d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 18:00:32 2009 +0200
Move the string-processing classes together with the Unicode in Qt docu.
commit d2a6dd3307b0306bd7a8e283e11a99e833206963
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 18:00:14 2009 +0200
Not a toplevel topic, it's within the "paint system" set of pages.
commit 44cba00cdf7fb086dd3bb62b15c0f9a7915e20c2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 17:57:37 2009 +0200
"Canvas UI" is not a stand-alone concept in Qt - yet!
commit 5f6e69b38fbca661709bc20b502ab0bc1b251b96
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 17:43:01 2009 +0200
Can just as well delete the old index.
commit aa5ec5327dceb1d3df62b990a32c970cce03ba9c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 17:39:52 2009 +0200
Some rephrasing and easier access to the "Keyboard Focus" docu.
commit 6248de281565cafce12221c902e9944867b338b3
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 17:37:02 2009 +0200
Replace the old index with the new index.
commit 110acab8af0c99db9905b0f4cc6e93c325b1e3c6
Merge: d88d526 53807e5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 17 16:04:59 2009 +0200
Merge branch 'master' into doccleanup
commit d88d52681d758e9e730de0e69290472728bf8c40
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 16 17:34:14 2009 +0200
Give the "Widgets and Layouts" topic a bit more content.
commit 01e108a5f2d1d0948c2093987a77f222d6cc4d09
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 16 14:21:41 2009 +0200
Move OpenVG "best practices" documentation into howtos directory.
commit 86f4ca38f965909a29cee0478c537558a4ea8f5a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 16 14:18:32 2009 +0200
Add module documentation for OpenVG and Multimedia.
commit 9fef923acbbb75cdc3fc4e984aec177ddcd24c53
Merge: e7e5cd9 72c1cb2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 16 13:20:23 2009 +0200
Merge branch 'master' into doccleanup
commit e7e5cd9444ac0e7be55ecfbeb8c9ace23784205b
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 16 13:20:08 2009 +0200
Add Google custom search box.
Not sure why that change was never merged in by git.
commit 348372947a3d7da2b28325731ac02bbc67cdec41
Merge: 3ff51b9 aa09d4f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 15 02:14:31 2009 +0200
Merge branch 'master' into doccleanup
commit 3ff51b9b52af39c00a938db380809e36b6c701c9
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 15 02:09:38 2009 +0200
Minor word-smithing.
commit da612b4130061e094a16d47a450f3f3fe6f547c7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 15 01:55:16 2009 +0200
Separating the "multimedia" group into reasonable sets of classes.
commit 838955a1a780e41ea77676e1bef8e471c7a2a2f5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 23:12:33 2009 +0200
Just one file, doesn't need a separate directory.
commit b99f56262faa4410880d08787f2c8d9a509d303d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 23:05:59 2009 +0200
Move documentation for Asian codecs into src/corelib/codecs.
Not ideal, the source of most of those codecs live in src/plugins/codecs,
but since this is no real API documentation it's probably appropriate.
commit ba2258c0b6587d959cdfe6ff99c4d36319077aac
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 22:24:33 2009 +0200
Renaming of files that used old product/company names.
commit 30ee7deb935bb3de4257cd71be5ba9610376047c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 22:14:30 2009 +0200
Those will only used by "Qt 4 for Qt 3" users, so leave the original text.
commit d0c110d047bbbd2dde70fc51ad702db59fa3883b
Merge: c5eccd5 8198d35
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 22:12:15 2009 +0200
Merge branch 'master' into doccleanup
commit c5eccd51ad85cfaf07ea8522a977b7bef70f70fd
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 22:09:43 2009 +0200
Moving some last files from doc/src into subdirectories.
commit d2dc303d92c1f66bf721b65fca1c6d55ab7ec01d
Merge: 0bdf16e a835ec7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 15:39:59 2009 +0200
Merge branch 'master' into doccleanup
commit 0bdf16e1bb04e532d4cc72c5646cb28470d5e627
Merge: 04bb351 c73fd72
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 14 13:08:37 2009 +0200
Merge branch 'master' into doccleanup
Conflicts:
src/3rdparty/webkit/WebKit/qt/Api/qwebelement.cpp
commit 04bb3513f107a895cfbbf98f8c4f9a67e392c72a
Merge: 8a52ce8 07d2ce1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 12 19:58:04 2009 +0200
Merge branch 'master' into doccleanup
Conflicts:
tools/qdoc3/test/qt-html-templates.qdocconf
commit 8a52ce8055d5d8b1bf799bf1fdde18aaf8b940c7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 12 13:30:50 2009 +0200
Fix some links to the qt.nokia.com page, and at least some linking to IO.
commit f7823801bf750b0b76ce0871c3f9e8e59c7901fe
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 12 12:27:19 2009 +0200
Make links in header point to the pages with links to everything else.
commit 335012b7e96698d6ec7994fdfd52813140f12413
Merge: 21b1263 96b6a3c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 12 12:17:57 2009 +0200
Merge branch 'master' into doccleanup
Conflicts:
doc/src/classes/qtdesigner-api.qdoc
doc/src/desktop-integration.qdoc
doc/src/distributingqt.qdoc
doc/src/examples-overview.qdoc
doc/src/examples.qdoc
doc/src/frameworks-technologies/dbus-adaptors.qdoc
doc/src/geometry.qdoc
doc/src/groups.qdoc
doc/src/objecttrees.qdoc
doc/src/plugins-howto.qdoc
doc/src/qt4-accessibility.qdoc
doc/src/qt4-scribe.qdoc
doc/src/qt4-sql.qdoc
doc/src/qt4-styles.qdoc
doc/src/qtdbus.qdoc
doc/src/qtgui.qdoc
doc/src/qtmain.qdoc
doc/src/qtopengl.qdoc
doc/src/qtscripttools.qdoc
doc/src/qtsvg.qdoc
doc/src/qtuiloader.qdoc
doc/src/qundo.qdoc
doc/src/richtext.qdoc
doc/src/topics.qdoc
doc/src/xml-processing/xml-processing.qdoc
commit 21b126346989a86a828ee8a66bb12108d2bb2b71
Merge: 88e7d76 204c771
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 11 18:15:17 2009 +0200
Merge branch 'master' into doccleanup
commit 88e7d76ceec664404a913469025ed9a7ca6f4fb0
Merge: 97c4128 1c62dc4
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 11 18:00:56 2009 +0200
Merge branch 'master' into doccleanup
commit 97c412815162859d853c5a4ede1eb9bd4be4af9b
Merge: cf5d8ae 4096911
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 19:27:08 2009 +0200
Merge branch 'master' into doccleanup
commit cf5d8ae4b09a92fed5b4e4cabbcfd49116e9e13f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 19:09:57 2009 +0200
This should link to the platform specific documentation.
commit 38610f0ff210286f92528495d48f434d2c0db8e8
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:59:35 2009 +0200
These groups are embedded in the respective framework overview already.
commit 1e58a90c561d33aada9427b17db8e0f7bbe02fa7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:54:47 2009 +0200
Remove howtos and overviews from script group.
The "Making Applications Scriptable" page needs to be split into a
walkthrough anyway.
commit 1e68b8d7d53500b8fb6c9c821d46e045ed7efe6f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:30:10 2009 +0200
Groups are for classes. The objectmodel framework overview links to those.
commit a0a95420c82e2a77150b070e98609aa3e1b3b1a6
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:22:20 2009 +0200
Kill the "buildsystem" group.
All documents can be reached through the "Developing with Qt" page.
commit 7b23a40c5ba3a215fba6032ad96199b5c9797e98
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:07:23 2009 +0200
This guide should only be in the porting group.
commit ef731bcc53a9b34ba3b42e5ad7caf4234941c4a9
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 18:06:21 2009 +0200
Phonon is a framework on its own.
The whole "multimedia" group is a rather random collection of stuff...
commit 5d290d48fc428573ccd31861cf57d214051ba349
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:59:36 2009 +0200
Move the Qt Help documentation into frameworks.
This needs a bit of a rewrite, and the list of classes needs to be
integrated.
commit 5e4d094c8712bfb46d844e09746aad5da3ac4a91
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:58:52 2009 +0200
The list of all classes that use implicit sharing is not useful on its own.
commit 2059a0be23c5953f9758098cb7a9416cb86d5ad1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:55:20 2009 +0200
Make the QtScript overview documentation part of frameworks.
commit 3413696bd745ee5862aa517dcfc9c8446fee9b82
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:54:59 2009 +0200
Make the list of drag & drop classes part of the framework docu.
commit f1c85ea263b30de1e1a1f6c5cb8b8d9ee12254cb
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:44:57 2009 +0200
Porting guides are part of the Howto's
commit cfcc742f938cf7c278f1f8b11b24a61f62fb4c62
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 17:44:26 2009 +0200
All platform specific docu is available through one toplevel page.
commit 53c642fe4cbc2dbd44fe5b9b4e32feeca438b5c3
Merge: c564285 41537bb
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 16:48:09 2009 +0200
Merge branch 'master' into doccleanup
commit c5642857b2f2364134f58776661cc08a9da13b2c
Merge: 9cdeba7 24aa363
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 10 15:53:47 2009 +0200
Merge branch 'master' into doccleanup
commit 9cdeba712c51eb0bf71eab35080734a2b93efcc5
Merge: 09dac33 d13418e
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 8 11:46:42 2009 +0200
Merge branch 'master' into doccleanup
commit 09dac333d427792a8d33fa311a63c620678e7920
Merge: f7b211e dfa2842
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Aug 7 15:40:33 2009 +0200
Merge branch 'master' into doccleanup
Conflicts:
doc/src/examples.qdoc
commit f7b211e5588fee20913a8d02c55cca0e05ea2859
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 14:58:49 2009 +0200
Rename file to follow naming scheme and resulting html.
commit ed6432fea376e60e4dd7c8987ed61a063af11ac7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 14:58:10 2009 +0200
Structure the XML documentation into a walk-through.
The XmlPatterns docu should probably be split into two or three sections,
XQuery, XPath and XML Schema.
commit 3dbc1d4ca08d3cac47ca2709b6fb1a2419442c36
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 14:15:00 2009 +0200
Add a table of contents.
commit 1569c35cb90c10ead72dcea2c4b99a0a6cbfcc13
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 14:04:52 2009 +0200
Splitting the long SQL documentation into walkthrough steps.
commit 6a05688bce3cca34dd1b8b323b8feb49d3133d7e
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 13:49:50 2009 +0200
Combining various desktop integration topics into one document.
commit c02c9adca98ba1d4494dd9c7de4ef5b191d9721a
Merge: 4cc4a81 2a286b0
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 08:16:04 2009 +0200
Merge branch 'doccleanup' of git@scm.dev.nokia.troll.no:qt/vohis-docuwork into doccleanup
commit 4cc4a81324cff3c1ad91867cf3acb87d9b4184c6
Merge: a88dc5d 06d57fc
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Aug 6 08:15:52 2009 +0200
Merge branch 'master' into doccleanup
commit 2a286b03167ce028821b4007bf08537d2c5637c2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 23:23:28 2009 +0200
Some writing on windows and dialogs.
Also some restructuring of the existing content.
commit a88dc5d72bec7abeec23b289c212418499c25e4a
Merge: 86f956c fb8bb14
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 18:09:58 2009 +0200
Merge branch 'master' into doccleanup
commit 86f956c89b9b8fb3d684665797d4a5b5e538fb2c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 17:09:36 2009 +0200
All "Qt 4 vs Qt 3" docu lives in porting.
Some of those files have been changed by now to move docu into overview
files where the respective information was missing.
commit ac6f1fc8b1e760ae69ce799e13ac92144eeb89e2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 17:06:15 2009 +0200
Start work on windows and dialogs docu.
commit 4253dea2661dc3526a9dec53f336301992b543cb
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 16:03:52 2009 +0200
Make QtWebKit module documentation follow the other modules:
- Module overview only lists classes, library, header and license
implication
- Usage-documentation is separated
commit a27f1b8498ba8d06743e70ecde4fc1e44d5f02f0
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 16:01:25 2009 +0200
Make QtWebKit classes show up in the module overview.
commit d38d185ec8b7d32037e86b4ecbbc725343aabea7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 15:40:17 2009 +0200
Make the most important sections a bit larger.
commit 70991dcdfb8c00baa960381b297fdcb8ed7f50d0
Merge: deb4c2b e95166d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 14:35:07 2009 +0200
Merge branch 'master' into doccleanup
commit deb4c2bb4d7120579fda541b03c0a77d989089d5
Merge: 37e5373 f78bd88
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 12:59:22 2009 +0200
Merge branch 'master' into doccleanup
commit 37e5373dcc5455b1e029ee389ce7985a98f579d9
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 11:32:43 2009 +0200
These new examples are not yet fully documented
commit 85fb40ea11458040e09302bb898d89664eb280b5
Merge: 8b78e18 bcf41cf
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 11:30:26 2009 +0200
Merge branch 'master' into doccleanup
Conflicts:
doc/src/examples-overview.qdoc
doc/src/examples.qdoc
tools/qdoc3/htmlgenerator.cpp
commit 8b78e1828b93a9762301d80cb110a1f1b7c4211f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 00:04:36 2009 +0200
Line-feed fixes.
commit 2fa80a411dd96369c0e09defc54af44118930ae5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 00:04:00 2009 +0200
The "buildsystem" docu seems a reasonable start for proper documentation.
Three lists of tools - in the buildsystem table, in the tools-list docu
and implicitly through \ingroup qttools. Needs to be consolidated.
commit 8d4043feab66698664cfa17bd150eabf4fe2420d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 00:01:32 2009 +0200
Restructure the i18n page.
The list of classes needs to be reviewed.
commit 49f718b1e75c02bc43feac93d5b233064c032555
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Wed Aug 5 00:00:45 2009 +0200
The Accessibility group is just a group of classes.
commit b17db7dc54c1945cd2651fdebde471c71ef4001d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 23:40:21 2009 +0200
Remove the "Topics" group.
Things are part of frameworks or how-to documentation. Top-level groups are
right now still on the "all overviews" document.
commit 31e5c276b50130542dbd824b0b8cc20b16ca1cb1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 22:45:43 2009 +0200
Splitting the thread documentation into multiple pages.
Also add relevant classes from QtConcurrent to the thread group.
commit d491ffb0e949f1d8653d73495e091b241a025558
Merge: e99794c 3ff7afd
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 19:29:18 2009 +0200
Merge branch 'doccleanup' of git@scm.dev.nokia.troll.no:qt/vohis-docuwork into doccleanup
commit 3ff7afd6c11d824af38c72afdea4b6578f6de784
Merge: 1dae0ad 2df403d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 18:07:11 2009 +0200
Merge branch 'doccleanup' of git@scm.dev.nokia.troll.no:qt/vohis-docuwork into doccleanup
Conflicts:
doc/src/accessible.qdoc
doc/src/activeqt.qdoc
doc/src/animation.qdoc
doc/src/containers.qdoc
doc/src/custom-types.qdoc
doc/src/desktop-integration.qdoc
doc/src/dnd.qdoc
doc/src/frameworks-technologies/accessible.qdoc
doc/src/frameworks-technologies/activeqt-container.qdoc
doc/src/frameworks-technologies/activeqt-server.qdoc
doc/src/frameworks-technologies/activeqt.qdoc
doc/src/frameworks-technologies/animation.qdoc
doc/src/frameworks-technologies/containers.qdoc
doc/src/frameworks-technologies/dbus-adaptors.qdoc
doc/src/frameworks-technologies/dbus-intro.qdoc
doc/src/frameworks-technologies/desktop-integration.qdoc
doc/src/frameworks-technologies/dnd.qdoc
doc/src/frameworks-technologies/implicit-sharing.qdoc
doc/src/frameworks-technologies/ipc.qdoc
doc/src/frameworks-technologies/model-view-programming.qdoc
doc/src/frameworks-technologies/phonon.qdoc
doc/src/frameworks-technologies/qt4-interview.qdoc
doc/src/frameworks-technologies/qtdesigner.qdoc
doc/src/frameworks-technologies/qthelp.qdoc
doc/src/frameworks-technologies/statemachine.qdoc
doc/src/frameworks-technologies/templates.qdoc
doc/src/frameworks-technologies/unicode.qdoc
doc/src/frameworks/accessible.qdoc
doc/src/frameworks/activeqt-container.qdoc
doc/src/frameworks/activeqt-server.qdoc
doc/src/frameworks/activeqt.qdoc
doc/src/frameworks/animation.qdoc
doc/src/frameworks/containers.qdoc
doc/src/frameworks/dbus-adaptors.qdoc
doc/src/frameworks/dbus-intro.qdoc
doc/src/frameworks/desktop-integration.qdoc
doc/src/frameworks/dnd.qdoc
doc/src/frameworks/ipc.qdoc
doc/src/frameworks/model-view-programming.qdoc
doc/src/frameworks/phonon.qdoc
doc/src/frameworks/qt4-interview.qdoc
doc/src/frameworks/qtdesigner.qdoc
doc/src/frameworks/qthelp.qdoc
doc/src/frameworks/qundo.qdoc
doc/src/frameworks/richtext.qdoc
doc/src/frameworks/statemachine.qdoc
doc/src/graphicsview.qdoc
doc/src/howtos/custom-types.qdoc
doc/src/howtos/session.qdoc
doc/src/implicit-sharing.qdoc
doc/src/introtodbus.qdoc
doc/src/ipc.qdoc
doc/src/model-view-programming.qdoc
doc/src/modules.qdoc
doc/src/new_index.qdoc
doc/src/objectmodel/custom-types.qdoc
doc/src/objectmodel/object.qdoc
doc/src/objectmodel/objecttrees.qdoc
doc/src/overviews.qdoc
doc/src/phonon.qdoc
doc/src/porting/qt4-tulip.qdoc
doc/src/qaxcontainer.qdoc
doc/src/qaxserver.qdoc
doc/src/qdbusadaptors.qdoc
doc/src/qt4-interview.qdoc
doc/src/qtdesigner.qdoc
doc/src/qthelp.qdoc
doc/src/statemachine.qdoc
doc/src/technologies/implicit-sharing.qdoc
doc/src/technologies/templates.qdoc
doc/src/technologies/unicode.qdoc
doc/src/templates.qdoc
doc/src/unicode.qdoc
doc/src/widgets-and-layouts/layout.qdoc
doc/src/widgets-and-layouts/styles.qdoc
doc/src/widgets-and-layouts/widgets.qdoc
src/gui/kernel/qstandardgestures.cpp
commit 1dae0adf3d85620f7574a2a0475510a627a896dc
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:46:58 2009 +0200
This way it appears as part of the overview, and the moc docu links to it.
commit 5802092887e46dc5eb034bb9b45dd34a265607f5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:45:09 2009 +0200
Not sure what it is yet, but definitely not an architecture.
QDataStream links to this page, that might just as well be enough.
commit 69d32c4ff079bcaea098b34de70b7d9587e51e88
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:43:42 2009 +0200
Use \annotatedlist command to list all widget classes.
Needs nicer formatting, ie qdoc could be \table aware for those lists and
skip the header.
commit 02057d7575bb4f0875e82ea4cb76552f2d8ac17a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:35:46 2009 +0200
This should be together with all the other licensing documentation.
commit be91b2fe15c67cb90eaa59121d7ff51eb21b4dba
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:26:02 2009 +0200
These are best practices.
commit 8e0b104db1266a736ac246c9466656c058df18f2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:25:35 2009 +0200
Another technology.
commit 19c16384d712c652716776c94c749030b0742752
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:24:55 2009 +0200
Remove duplicate and out-of-date license headers.
commit 689aa91de0f840fc0f98f0adfbb2f18d72c6b985
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 17:21:00 2009 +0200
Move into frameworks.
Add explicitly printed list of classes instead of using a separate
\group page. The \group page is still there as long as qdoc requires it.
Threading and WebKit are still "architectures", coming later.
commit 3f96833ab78dacd7ae66e6dd58a3a0dee22229e7
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 16:35:17 2009 +0200
Remove IPC group.
Only two classes, and those are explicitly listed in the real
documentation about IPC in Qt.
commit bbb02d8cc55c9595226f42fe5b617261584c6bdd
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 15:54:46 2009 +0200
Use the new \annotatedlist command, and make it a framework.
commit ba3a0376acb44ae5cafc8bd3802bd425dcb663a5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 15:38:24 2009 +0200
Make \annotatedlist <group> work.
commit c80fb8d6a143c81700c2aefe7af1e83dd487dde4
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 15:37:51 2009 +0200
These are API documentation, not architecture.
commit 713744520bd35d510864ad48464575f1c8a35668
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 15:10:25 2009 +0200
Frameworks and technologies used in Qt are really one thing.
commit a86d4248c1e3c13f245c49f3f2d018ec4babc822
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 15:00:35 2009 +0200
Move into correct groups and make the howto a walk-through.
commit 7cc88f310e0dfa37d39026d67443f518531d7fe9
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 12:50:58 2009 +0200
Architecture -> Frameworks and Technologies
commit 4a3ba3f19d78c4df5343af951c761df47e22759a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 12:50:41 2009 +0200
Some consolidation of the Tulip documentation.
commit d3dab98b96d83ce408523f8ccb9363a09eed1f34
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 12:01:10 2009 +0200
Start with "Frameworks and Technologies" vs "howtos and best practices".
commit 37a8e364442e6234c6a83667eb64af1c79b38e9b
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 12:00:34 2009 +0200
Beautify.
commit c86d844a79406d4b9fee67578efd67e27ce96b83
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 00:04:40 2009 +0200
Fix some headers.
commit 20b775d781d3b1d91164320807c21c8a6efcf011
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:48:17 2009 +0200
Split the accessibility docu into a "compared to Qt 3" section, and move
real information into the overview.
commit 6846a1bccf7d212f7ee0471f992cfb16efb71c43
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:47:37 2009 +0200
The gui-programming seems rather arbitrary and should go away.
Some things fit into the desktop integration, which is probably more a
howto. Focus is a concept in the widgets context, and application-wide
techniques like accelerators should probably be part of the "window"
docu.
commit 8c7bc99e78a69751080de07618bf003bc227e2db
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:45:28 2009 +0200
Move "Getting Started" documentation into getting-started directory.
commit 561cc3eafa20903243f3946ac4b7b724554c341c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 19:06:16 2009 +0200
Group "getting started" documents into a walkthrough structure.
commit 6d703807348923a068dea7360fb4456cbde071b6
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 17:35:15 2009 +0200
Add screenshots for example-overview page.
commit f7a47536305e157c16e8a863f145a2617606a2cc
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 2 16:57:04 2009 +0200
Link to the real documentation, not just to the modules overview.
commit 92ce250ba206f4dde198637f1a30cd10768d9ae5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 2 16:56:41 2009 +0200
A new layout for the examples.
Needs a bit of shuffeling around, and more screenshots and descriptive text
for some categories.
commit a5e2e2939b32dee0aceabe136aa4c13b12c88070
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 22:39:27 2009 +0200
Cleanup the script-related groups a bit.
commit ca469165a9f55ca6bd31e53d85d74883fe892ed4
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 22:17:16 2009 +0200
Add QContiguousCache to the list of containers as a special case.
commit a21292704bd12daf2495195b216424442e097220
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 21:52:37 2009 +0200
Cleaning up groups of text- and string-related classes.
Make a clear separation between classes that deal with string data (ie
QString, QByteArray, QTextStream) and classes that are part of the "scribe"
framework.
Merge documentation from the Qt 4.0 introduction of Scribe into the
richtext processing guide.
commit 3854592806e23955f69613bdc1e2998d5d6f3a8a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 20:50:06 2009 +0200
One group of thread-related classes should be enough.
commit b8935bc0ec3d33b6a3fe7b3b220b5781ad79d68d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 19:32:21 2009 +0200
Move documentation for classes into same directory as the respective
header files (or implementation file, if one exists).
This follows the Qt standard, and there is no particular reason why .qdoc
files cannot live in src. Since there are a number of .cpp files that have
only documentation it might also be an idea to rename the .qdoc files to
.cpp and add them to the .pro-files to have them included in generated
project files for easier access.
commit b61cc5eaf2f2bf72cff209ab0f69fde48fb87471
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 19:29:46 2009 +0200
Starting to tie together the widgets and layouts groups and documentation.
commit 47fb0c6cf1dacdbfa07a59cf4dc703dd2c35eb8c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 18:43:34 2009 +0200
This is all duplicate information that is better covered in the
sql-programming guide.
commit d3c70dd9ed84b4688cbabf30f6b906665b676b76
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 18:37:53 2009 +0200
Consolidate style documentation.
commit 1d8d30eee1e2fe9f8e77ce1462803921b2132ade
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 17:13:44 2009 +0200
Split plugin-documentation into two: writing plugins and deploying plugins.
commit a329665353a78749b0d4fdd6e75403252d34f679
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 14:19:47 2009 +0200
Some final module cleaning up.
commit e3de6579d43cc9796b69188cfb9d3d415a91a770
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:51:54 2009 +0200
Move remaining overview groups into one file.
commit 7d783342f520f8376e561246268371d0b74a4e44
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:51:34 2009 +0200
The "io" group should be about file access (be it local or networked).
commit 961fcefb034fea89d1aab2bfed5acaabb65e8d34
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:36:51 2009 +0200
Kill the "time" group.
The "How to use timers in your application" documentation covers the usecase.
commit c7bebf1a4c3e2da54ce6a5d649926d76bf65e41e
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:28:21 2009 +0200
Kill the group "misc".
commit e414a8945cb938ccc6bd1bd8cd52adbfade096c2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:09:24 2009 +0200
Kill the "Environment" group.
It was a random collection of classes, mostly ending up in there because
of copy/paste (I suspect).
commit 9236a04e7ac6dd3910f035d15b8ab23297fd5f24
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:08:37 2009 +0200
More moving of files and content.
commit 1ef3134bade2df33ff68c7c906cf20343abd86a5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 02:03:07 2009 +0200
Workaround qdoc being difficult.
commit 49064b0570088fe749fc08c02c5ab6d23855089f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 01:49:52 2009 +0200
Some more moving of files into meaningful directories.
commit df4ced831cf9f49c638c231fa9f2754699a8a59d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 01:41:14 2009 +0200
Separate module documentation from frameworks documentation.
Module documentation will list the classes in each module, how to use the
respective libraries and headerfiles from a build-system perspective and
what the legal implications are when linking against those libraries.
The documentation of frameworks lives now in the frameworks subdirectory,
or in dedicated subdirectories for the key frameworks.
commit f4ccabe1abb97f91f196dab1948fee6135c9fa6e
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 00:47:54 2009 +0200
Group files in subdirectories that would correspond to top level topics.
commit ceb0110a364185b8b5d7bea3d3d1d54500035fcc
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 21:48:45 2009 +0200
Group files in subdirectories that would correspond to top level topics.
commit 72a4dae65b25c9df400218252f1c68d59724ff75
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 20:57:39 2009 +0200
Fix a few links.
commit ecb79681417e8bc3d8e46065dc12146f4d4dfc5f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 20:20:55 2009 +0200
Consolidate the two example documents into one page.
commit d30d980055e7c531c9e73cdf9a1b220ce9691eef
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 19:25:16 2009 +0200
The QtAssistant module is obsolete, remove it.
QAssistantClient is in the list of obsolete classes.
commit 137ecd1ee70f0766fd94c6199d8a6b8217d020ca
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 18:56:14 2009 +0200
Get rid of \mainclass
If we want to select a list of main classes, then we can use \ingroup for
that, and document them coherently as part of the Fundamentals or a
relevant framework.
commit 042a7f21e68120e43b68444cbf3cfeca3aad4488
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 18:23:55 2009 +0200
The new index page and respective style changes.
commit 5245d784eb46287f8e1ae41addb2765eb19b0663
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 17:05:46 2009 +0200
Deployment group is gone.
commit 567d737a8d08f227133674ebfe2d161888862b8c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 16:48:53 2009 +0200
All "lists of classes etc" are now in classes.qdoc... I hope.
commit 0bb6074c0b38f07697e72a50a2ef60b561e718fe
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 16:47:20 2009 +0200
Cleaning up files documenting deployment. Text need to be reviewed and merged.
commit 2df403da24a2959c02d0d845d1d4fac0c3aa38e0
Author: Thierry Bastian <thierry.bastian@nokia.com>
Date: Mon Aug 3 16:49:46 2009 +0200
fix warnings on mingw (gcc4.4)
basically reordering members initialization in constructors or fixing
singed/unsigned checks.
Reviewed-by: Trustme
commit e887c7705b8b7f218b3605eeefb316dea274fe27
Author: Richard Moe Gustavsen <richard.gustavsen@nokia.com>
Date: Tue Aug 4 10:00:01 2009 +0200
Mac: Remove debug work output
commit 62687960508b2855b48d64825b445e5738c44142
Author: Richard Moe Gustavsen <richard.gustavsen@nokia.com>
Date: Tue Aug 4 09:45:47 2009 +0200
Modify imagewidget example so it works with new API
commit 9c7aed68270b336ae9a309d9eb0107d49729c1f3
Author: Richard Moe Gustavsen <richard.gustavsen@nokia.com>
Date: Tue Aug 4 09:43:14 2009 +0200
Add support for pan gesture on mac (carbon and cocoa)
commit be5783878a977148b34dc64c464e951be312964e
Author: Morten Sorvig <msorvig@trolltech.com>
Date: Tue Aug 4 09:47:05 2009 +0200
Remove the "preliminary support" warning for 10.6
Also make the "usupported on > 10.6" error a warning. No need
to stop the build, the warning will be printed enough times.
commit f6282eec434d073fef46d50ef141df6fa36033b9
Author: Morten Sorvig <msorvig@trolltech.com>
Date: Tue Aug 4 09:31:56 2009 +0200
Build on snow leopard.
Don't error out when building qmake, just let it build a 64-bit binary (even for carbon)
RebBy: Richard Moe Gustavsen
commit abae82a26f4dec34635827acf0784058be638e31
Author: Morten Sorvig <msorvig@trolltech.com>
Date: Tue Aug 4 08:15:21 2009 +0200
Make Cocoa builds 64-bit by default on snow leopard.
commit 4672e771c164503d998ccb6ca05cf7e7906fb031
Author: Jason McDonald <jason.mcdonald@nokia.com>
Date: Tue Aug 4 15:40:15 2009 +1000
Fix incorrect license headers.
Reviewed-by: Trust Me
commit a3bd65e8eb0fd39e14539919cc9ced645c969883
Author: Bill King <bill.king@nokia.com>
Date: Tue Aug 4 14:57:36 2009 +1000
Fixes failed queries when mysql auto-prepares
Queries like "Show Index" etc, fail on mysql when automatically prepared
due to a bug in several versions of mysql. Basically anything but a
select query will fail. This fixes this by making the user explicitly
prepare the query if they want to, and the blame then falls on them
if they try and prepare a statement likely to fail. This fix also
seems to result in a speedup for single-execution queries, possibly
due to reduction in roundtrip communications.
All autotests pass & behaviour conforms to documentation.
Task-number: 252450, 246125
commit 4612596a6a945ab0199fe06727ff3ea350092ec1
Author: Jason McDonald <jason.mcdonald@nokia.com>
Date: Tue Aug 4 14:49:14 2009 +1000
Fix obsolete license headers
Reviewed-by: Trust Me
commit c3bcc8b094341e0dc768ef5820ba359e2c23436a
Author: Aaron Kennedy <aaron.kennedy@nokia.com>
Date: Tue Aug 4 10:59:02 2009 +1000
Doc fixes
Reviewed-by: TrustMe
commit 1d60528ced1f6818a60889d672089bfe4d2290bb
Author: Morten Sorvig <msorvig@trolltech.com>
Date: Mon Aug 3 15:57:44 2009 +0200
Fix spelling error.
commit e99794c1200515f18ffdd0bec9c143db46e009a1
Merge: 199db81 d65f893
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 09:24:14 2009 +0200
Merge branch 'master' into doccleanup
commit 199db8104a680f91451cf2c93d2d41077b5605bb
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Tue Aug 4 00:04:40 2009 +0200
Fix some headers.
commit e8f8193b951a9f9e4b6d309c44151c47b715e901
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:48:17 2009 +0200
Split the accessibility docu into a "compared to Qt 3" section, and move
real information into the overview.
commit 8006ec36024e972be21e8397c2cc758a0e9b2ba0
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:47:37 2009 +0200
The gui-programming seems rather arbitrary and should go away.
Some things fit into the desktop integration, which is probably more a
howto. Focus is a concept in the widgets context, and application-wide
techniques like accelerators should probably be part of the "window"
docu.
commit 8dab96460280b8af6726905e8d5d24020930b882
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 23:45:28 2009 +0200
Move "Getting Started" documentation into getting-started directory.
commit 523fd47c29c24a865855d085a0036fc741203930
Merge: a1e50f6 2076f15
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 19:10:51 2009 +0200
Merge branch 'master' into doccleanup
commit a1e50f6619ff1a302dd1fefbcb6b0cd62a653e7d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 19:06:16 2009 +0200
Group "getting started" documents into a walkthrough structure.
commit e393b4f458263cb2f011cc5e5e67cdcc48610ea9
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 17:35:15 2009 +0200
Add screenshots for example-overview page.
commit 8c84f307f73ab7b77a91e61ed18fdc685afebcc5
Merge: a16033a 34e272a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Mon Aug 3 11:03:41 2009 +0200
Merge branch 'master' into doccleanup
commit a16033a287afe2f494401e24f02f046ec98d944c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 2 16:57:04 2009 +0200
Link to the real documentation, not just to the modules overview.
commit 6c4ed0361c860e738b9344dfb191f55d35b3309f
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sun Aug 2 16:56:41 2009 +0200
A new layout for the examples.
Needs a bit of shuffeling around, and more screenshots and descriptive text
for some categories.
commit 2dde2faa8f6e86acf738a808412c5e3c21c44658
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 22:39:27 2009 +0200
Cleanup the script-related groups a bit.
commit a66227d0bed87c633a22a4d155f6a7f0061fc34e
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 22:17:16 2009 +0200
Add QContiguousCache to the list of containers as a special case.
commit b22133eef28566f1c3c5d57aa0e8272af26da86a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 21:52:37 2009 +0200
Cleaning up groups of text- and string-related classes.
Make a clear separation between classes that deal with string data (ie
QString, QByteArray, QTextStream) and classes that are part of the "scribe"
framework.
Merge documentation from the Qt 4.0 introduction of Scribe into the
richtext processing guide.
commit b30ba739308905b6c06987cec47d4de1e5d172de
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 20:50:06 2009 +0200
One group of thread-related classes should be enough.
commit a2511650577126026f98cb7416c159498f6f2db5
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 19:32:21 2009 +0200
Move documentation for classes into same directory as the respective
header files (or implementation file, if one exists).
This follows the Qt standard, and there is no particular reason why .qdoc
files cannot live in src. Since there are a number of .cpp files that have
only documentation it might also be an idea to rename the .qdoc files to
.cpp and add them to the .pro-files to have them included in generated
project files for easier access.
commit f333ad71384cf42c20219a55d9dfa1e29a8c263e
Merge: bad9ba5 5aed3db
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Sat Aug 1 12:04:55 2009 +0200
Merge branch 'master' into doccleanup
commit bad9ba5468333be2f08da7f28950c980bc63c787
Merge: 49f38b7 c57ed13
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 19:31:04 2009 +0200
Merge branch 'master' into doccleanup
commit 49f38b7afe3205eedccf655c0ad749d685cb3d52
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 19:29:46 2009 +0200
Starting to tie together the widgets and layouts groups and documentation.
commit e6c4b8316b7c90b19815c0008a282983012c68b3
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 18:43:34 2009 +0200
This is all duplicate information that is better covered in the
sql-programming guide.
commit 620620ae969bed86d970519bead45762bd39ede1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 18:37:53 2009 +0200
Consolidate style documentation.
commit 01c78ff78888d3ccb50189206b9bcacaf13f5c80
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 17:13:44 2009 +0200
Split plugin-documentation into two: writing plugins and deploying plugins.
commit a21f510c982dce06ac1769e61e93574f90cc48c4
Merge: da93c4c c6cdfcb
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 16:04:51 2009 +0200
Merge branch 'master' into doccleanup
commit da93c4ccc25dd189dfb9b71bda28bd1e3a7230c1
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 14:19:47 2009 +0200
Some final module cleaning up.
commit 9eb0815bbd01b7e30877110b53aa6f82b8e9221d
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:51:54 2009 +0200
Move remaining overview groups into one file.
commit 65d4c4145386a409aeb1372ae5adc6f3e71e444b
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:51:34 2009 +0200
The "io" group should be about file access (be it local or networked).
commit 1a3de3a7add6d9e7653e46b57b00852845384a42
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:36:51 2009 +0200
Kill the "time" group.
The "How to use timers in your application" documentation covers the usecase.
commit dbadf1c060e051dbac7f5c72528ef6a3125d5ba3
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:28:21 2009 +0200
Kill the group "misc".
commit 7b7484b37b074d52af5c4ff9b138087a75965508
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:09:24 2009 +0200
Kill the "Environment" group.
It was a random collection of classes, mostly ending up in there because
of copy/paste (I suspect).
commit b5271d81e7da6666d339041d028a0ae6c8ed75c4
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 13:08:37 2009 +0200
More moving of files and content.
commit 96a707d25342c273cdd7629fc1e24b0ead4118de
Merge: 4ffe572 18fbfdf
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 11:08:11 2009 +0200
Merge branch 'master' into doccleanup
commit 4ffe572a954e99d604c1360fc55db25e8586436c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 02:03:07 2009 +0200
Workaround qdoc being difficult.
commit 7f0e965c7cf613782e8189069444a4b549f0c11a
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 01:49:52 2009 +0200
Some more moving of files into meaningful directories.
commit b0d67674469e57b29e60110888352ae955adcdd8
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 01:41:14 2009 +0200
Separate module documentation from frameworks documentation.
Module documentation will list the classes in each module, how to use the
respective libraries and headerfiles from a build-system perspective and
what the legal implications are when linking against those libraries.
The documentation of frameworks lives now in the frameworks subdirectory,
or in dedicated subdirectories for the key frameworks.
commit 45240a9c0eba9e42e6e441a55a407173a81a7344
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Fri Jul 31 00:47:54 2009 +0200
Group files in subdirectories that would correspond to top level topics.
commit 896507f2f4fdc541fc436cf901a2beb72d35f6aa
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 21:48:45 2009 +0200
Group files in subdirectories that would correspond to top level topics.
commit 37eb554f75d8b1d9d76993f6fcf632933c9616a2
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 20:57:39 2009 +0200
Fix a few links.
commit 74027c3568c1bdbb9960d203266f4ccc5e89c05c
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 20:20:55 2009 +0200
Consolidate the two example documents into one page.
commit cfc0fd3df050cf6c0e3229d22adfbff35aed46af
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 19:25:16 2009 +0200
The QtAssistant module is obsolete, remove it.
QAssistantClient is in the list of obsolete classes.
commit 0f86c7a176fc920669ca8a880afa141434f37767
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 18:56:14 2009 +0200
Get rid of \mainclass
If we want to select a list of main classes, then we can use \ingroup for
that, and document them coherently as part of the Fundamentals or a
relevant framework.
commit c4dfbc6bf58ef741fdab01538e75e9472e8370bf
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 18:23:55 2009 +0200
The new index page and respective style changes.
commit a3e4eb6712e24a4d6156c340ee98671887a2b2fa
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 17:05:46 2009 +0200
Deployment group is gone.
commit f03ee6192450db977bc2e4b07ffc613314b63a80
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 16:48:53 2009 +0200
All "lists of classes etc" are now in classes.qdoc... I hope.
commit c5fb9a4b5208498454812d27578ac62ae23652a4
Author: Volker Hilsheimer <volker.hilsheimer@nokia.com>
Date: Thu Jul 30 16:47:20 2009 +0200
Cleaning up files documenting deployment. Text need to be reviewed and merged.
|
| |
| |
| |
| |
| | |
the test was wrong on the QPrinter pointer
In addition, priv is never null
|
| |
| |
| |
| | |
Reviewed-by: Trust Me
|
| | |
|
|\ \
| |/ |
|
| |
| |
| |
| | |
Reviewed-by: Trust Me
|
| |
| |
| |
| | |
This is a small fix to 4af30f47c37fd0e6826aca2984dd0f567dc7e465
|
|/
|
|
|
|
|
|
|
| |
With this patch, commands no longer merge across block bounderies.
In order to have merging still work for the normal insertion and deletion
case, the unnecessary beginEditBlock()/endEditBlock() calls where
cleaned up.
Reviewed-by: Simon Hausmann
|
|
|
|
|
|
| |
QTextCursor::operator=
Task-number: 247955
|
|
|