diff options
author | Eskil Abrahamsen Blomfeldt <eskil.abrahamsen-blomfeldt@nokia.com> | 2010-02-15 15:54:27 (GMT) |
---|---|---|
committer | Eskil Abrahamsen Blomfeldt <eskil.abrahamsen-blomfeldt@nokia.com> | 2010-02-15 15:54:27 (GMT) |
commit | 88fa17f5664e3839ffc04db1315e8d9d07f8b956 (patch) | |
tree | 65c63c815a169ffcb02fa3a3bdb63d2e2d9ba4cb /src | |
parent | 8d7046fbd798c6104eca6098b828c505ca32085c (diff) | |
parent | 925c41f2a1c38d958de3844785bcc8c83ff74004 (diff) | |
download | Qt-88fa17f5664e3839ffc04db1315e8d9d07f8b956.zip Qt-88fa17f5664e3839ffc04db1315e8d9d07f8b956.tar.gz Qt-88fa17f5664e3839ffc04db1315e8d9d07f8b956.tar.bz2 |
Merge branch 'qt-graphics-team-qstatictext-4.7'
Diffstat (limited to 'src')
59 files changed, 1703 insertions, 311 deletions
diff --git a/src/corelib/codecs/qsimplecodec.cpp b/src/corelib/codecs/qsimplecodec.cpp index 445565a..4cc7912 100644 --- a/src/corelib/codecs/qsimplecodec.cpp +++ b/src/corelib/codecs/qsimplecodec.cpp @@ -681,7 +681,7 @@ QByteArray QSimpleTextCodec::convertFromUnicode(const QChar *in, int length, Con int u; const QChar* ucp = in; unsigned char* rp = (unsigned char *)r.data(); - const unsigned char* rmp = (const unsigned char *)reverseMap->data(); + const unsigned char* rmp = (const unsigned char *)reverseMap->constData(); int rmsize = (int) reverseMap->size(); while(i--) { diff --git a/src/corelib/codecs/qtextcodec.cpp b/src/corelib/codecs/qtextcodec.cpp index 43ea1c8..1c607a6 100644 --- a/src/corelib/codecs/qtextcodec.cpp +++ b/src/corelib/codecs/qtextcodec.cpp @@ -79,7 +79,7 @@ # endif #endif // QT_NO_CODECS #include "qlocale.h" -#include "private/qmutexpool_p.h" +#include "qmutex.h" #include <stdlib.h> #include <ctype.h> @@ -659,13 +659,13 @@ static void setupLocaleMapper() #endif } - -static void setup() -{ #ifndef QT_NO_THREAD - QMutexLocker locker(QMutexPool::globalInstanceGet(&all)); +Q_GLOBAL_STATIC_WITH_ARGS(QMutex, textCodecsMutex, (QMutex::Recursive)); #endif +// textCodecsMutex need to be locked to enter this function +static void setup() +{ if (all) return; @@ -903,8 +903,6 @@ QTextCodec::ConverterState::~ConverterState() */ /*! - \nonreentrant - Constructs a QTextCodec, and gives it the highest precedence. The QTextCodec should always be constructed on the heap (i.e. with \c new). Qt takes ownership and will delete it when the application @@ -912,6 +910,9 @@ QTextCodec::ConverterState::~ConverterState() */ QTextCodec::QTextCodec() { +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); all->prepend(this); } @@ -929,8 +930,12 @@ QTextCodec::~QTextCodec() if (!destroying_is_ok) qWarning("QTextCodec::~QTextCodec: Called by application"); #endif - if (all) + if (all) { +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif all->removeAll(this); + } } /*! @@ -951,6 +956,9 @@ QTextCodec *QTextCodec::codecForName(const QByteArray &name) if (name.isEmpty()) return 0; +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); for (int i = 0; i < all->size(); ++i) { @@ -973,6 +981,9 @@ QTextCodec *QTextCodec::codecForName(const QByteArray &name) */ QTextCodec* QTextCodec::codecForMib(int mib) { +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); // Qt 3 used 1000 (mib for UCS2) as its identifier for the utf16 codec. Map @@ -1001,6 +1012,9 @@ QTextCodec* QTextCodec::codecForMib(int mib) */ QList<QByteArray> QTextCodec::availableCodecs() { +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); QList<QByteArray> codecs; @@ -1008,6 +1022,11 @@ QList<QByteArray> QTextCodec::availableCodecs() codecs += all->at(i)->name(); codecs += all->at(i)->aliases(); } + +#ifndef QT_NO_THREAD + locker.unlock(); +#endif + #ifndef QT_NO_TEXTCODECPLUGIN QFactoryLoader *l = loader(); QStringList keys = l->keys(); @@ -1031,11 +1050,19 @@ QList<QByteArray> QTextCodec::availableCodecs() */ QList<int> QTextCodec::availableMibs() { +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); QList<int> codecs; for (int i = 0; i < all->size(); ++i) codecs += all->at(i)->mibEnum(); + +#ifndef QT_NO_THREAD + locker.unlock(); +#endif + #ifndef QT_NO_TEXTCODECPLUGIN QFactoryLoader *l = loader(); QStringList keys = l->keys(); @@ -1082,6 +1109,9 @@ QTextCodec* QTextCodec::codecForLocale() if (localeMapper) return localeMapper; +#ifndef QT_NO_THREAD + QMutexLocker locker(textCodecsMutex()); +#endif setup(); return localeMapper; diff --git a/src/gui/embedded/directfb.pri b/src/gui/embedded/directfb.pri index bd1d947..d6d77b4 100644 --- a/src/gui/embedded/directfb.pri +++ b/src/gui/embedded/directfb.pri @@ -15,7 +15,7 @@ #DEFINES += QT_DIRECTFB_TIMING #DEFINES += QT_NO_DIRECTFB_OPAQUE_DETECTION #DEFINES += QT_NO_DIRECTFB_STRETCHBLIT -#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT +#DIRECTFB_DRAWINGOPERATIONS=DRAW_RECTS|DRAW_LINES|DRAW_IMAGE|DRAW_PIXMAP|DRAW_TILED_PIXMAP|STROKE_PATH|DRAW_PATH|DRAW_POINTS|DRAW_ELLIPSE|DRAW_POLYGON|DRAW_TEXT|FILL_PATH|FILL_RECT|DRAW_COLORSPANS|DRAW_ROUNDED_RECT|DRAW_STATICTEXT #DEFINES += \"QT_DIRECTFB_WARN_ON_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\" #DEFINES += \"QT_DIRECTFB_DISABLE_RASTERFALLBACKS=$$DIRECTFB_DRAWINGOPERATIONS\" diff --git a/src/gui/graphicsview/qgraphicsitem.cpp b/src/gui/graphicsview/qgraphicsitem.cpp index b4e19d1..39c41c4 100644 --- a/src/gui/graphicsview/qgraphicsitem.cpp +++ b/src/gui/graphicsview/qgraphicsitem.cpp @@ -1392,7 +1392,8 @@ QGraphicsItem::~QGraphicsItem() } delete d_ptr->transformData; - qt_dataStore()->data.remove(this); + if (QGraphicsItemCustomDataStore *dataStore = qt_dataStore()) + dataStore->data.remove(this); } /*! diff --git a/src/gui/image/qicon.cpp b/src/gui/image/qicon.cpp index ac1d303..bf6eb8d 100644 --- a/src/gui/image/qicon.cpp +++ b/src/gui/image/qicon.cpp @@ -104,6 +104,15 @@ QT_BEGIN_NAMESPACE static QBasicAtomicInt serialNumCounter = Q_BASIC_ATOMIC_INITIALIZER(1); +static void qt_cleanup_icon_cache(); +typedef QCache<QString, QIcon> IconCache; +Q_GLOBAL_STATIC_WITH_INITIALIZER(IconCache, qtIconCache, qAddPostRoutine(qt_cleanup_icon_cache)) + +static void qt_cleanup_icon_cache() +{ + qtIconCache()->clear(); +} + QIconPrivate::QIconPrivate() : engine(0), ref(1), serialNum(serialNumCounter.fetchAndAddRelaxed(1)), @@ -963,15 +972,13 @@ QString QIcon::themeName() */ QIcon QIcon::fromTheme(const QString &name, const QIcon &fallback) { - static QCache <QString, QIcon> iconCache; - QIcon icon; - if (iconCache.contains(name)) { - icon = *iconCache.object(name); + if (qtIconCache()->contains(name)) { + icon = *qtIconCache()->object(name); } else { QIcon *cachedIcon = new QIcon(new QIconLoaderEngine(name)); - iconCache.insert(name, cachedIcon); + qtIconCache()->insert(name, cachedIcon); icon = *cachedIcon; } diff --git a/src/gui/image/qimagereader.cpp b/src/gui/image/qimagereader.cpp index c9e015c..9320cfc 100644 --- a/src/gui/image/qimagereader.cpp +++ b/src/gui/image/qimagereader.cpp @@ -263,25 +263,37 @@ static QImageIOHandler *createReadHandlerHelper(QIODevice *device, device->seek(pos); } - if (!handler && !testFormat.isEmpty() && autoDetectImageFormat && !ignoresFormatAndExtension) { + if (!handler && !testFormat.isEmpty() && !ignoresFormatAndExtension) { // check if any plugin supports the format (they are not allowed to // read from the device yet). const qint64 pos = device ? device->pos() : 0; - for (int i = 0; i < keys.size(); ++i) { - if (i != suffixPluginIndex) { - QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i))); - if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { + + if (autoDetectImageFormat) { + for (int i = 0; i < keys.size(); ++i) { + if (i != suffixPluginIndex) { + QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(keys.at(i))); + if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { #ifdef QIMAGEREADER_DEBUG - qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format"; + qDebug() << "QImageReader::createReadHandler: the" << keys.at(i) << "plugin can read this format"; #endif - handler = plugin->create(device, testFormat); - break; + handler = plugin->create(device, testFormat); + break; + } } } + } else { + QImageIOPlugin *plugin = qobject_cast<QImageIOPlugin *>(l->instance(QLatin1String(testFormat))); + if (plugin && plugin->capabilities(device, testFormat) & QImageIOPlugin::CanRead) { +#ifdef QIMAGEREADER_DEBUG + qDebug() << "QImageReader::createReadHandler: the" << testFormat << "plugin can read this format"; +#endif + handler = plugin->create(device, testFormat); + } } if (device && !device->isSequential()) device->seek(pos); } + #endif // QT_NO_LIBRARY // if we don't have a handler yet, check if we have built-in support for diff --git a/src/gui/image/qpixmapfilter.cpp b/src/gui/image/qpixmapfilter.cpp index 37a6a18..7cf942c 100644 --- a/src/gui/image/qpixmapfilter.cpp +++ b/src/gui/image/qpixmapfilter.cpp @@ -422,6 +422,9 @@ void QPixmapConvolutionFilter::draw(QPainter *painter, const QPointF &p, const Q if(d->kernelWidth<=0 || d->kernelHeight <= 0) return; + if (src.isNull()) + return; + QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapConvolutionFilter *convolutionFilter = static_cast<QPixmapConvolutionFilter*>(filter); @@ -902,6 +905,9 @@ void QPixmapBlurFilter::draw(QPainter *painter, const QPointF &p, const QPixmap if (!painter->isActive()) return; + if (src.isNull()) + return; + QRectF srcRect = rect; if (srcRect.isNull()) srcRect = src.rect(); @@ -1082,6 +1088,10 @@ void QPixmapColorizeFilter::setStrength(qreal strength) void QPixmapColorizeFilter::draw(QPainter *painter, const QPointF &dest, const QPixmap &src, const QRectF &srcRect) const { Q_D(const QPixmapColorizeFilter); + + if (src.isNull()) + return; + QPixmapFilter *filter = painter->paintEngine() && painter->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(painter->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapColorizeFilter *colorizeFilter = static_cast<QPixmapColorizeFilter*>(filter); @@ -1312,6 +1322,10 @@ void QPixmapDropShadowFilter::draw(QPainter *p, const QRectF &src) const { Q_D(const QPixmapDropShadowFilter); + + if (px.isNull()) + return; + QPixmapFilter *filter = p->paintEngine() && p->paintEngine()->isExtended() ? static_cast<QPaintEngineEx *>(p->paintEngine())->pixmapFilter(type(), this) : 0; QPixmapDropShadowFilter *dropShadowFilter = static_cast<QPixmapDropShadowFilter*>(filter); diff --git a/src/gui/itemviews/qlistview.cpp b/src/gui/itemviews/qlistview.cpp index 19b1e8c..b2def39 100644 --- a/src/gui/itemviews/qlistview.cpp +++ b/src/gui/itemviews/qlistview.cpp @@ -2160,7 +2160,7 @@ void QListModeViewBase::scrollContentsBy(int dx, int dy, bool scrollElasticBand) } else { if (flowPositions.isEmpty()) return; - const int max = flowPositions.count() - 1; + const int max = scrollValueMap.count() - 1; if (vertical && flow() == QListView::TopToBottom && dy != 0) { int currentValue = qBound(0, verticalValue, max); int previousValue = qBound(0, currentValue + dy, max); diff --git a/src/gui/kernel/qapplication_s60.cpp b/src/gui/kernel/qapplication_s60.cpp index 87de602..3e2e6f6 100644 --- a/src/gui/kernel/qapplication_s60.cpp +++ b/src/gui/kernel/qapplication_s60.cpp @@ -809,12 +809,15 @@ TCoeInputCapabilities QSymbianControl::InputCapabilities() const void QSymbianControl::Draw(const TRect& controlRect) const { // Set flag to avoid calling DrawNow in window surface - QWExtra *extra = qwidget->d_func()->extraData(); - if (extra && !extra->inExpose) { - extra->inExpose = true; + QWidget *window = qwidget->window(); + Q_ASSERT(window); + QTLWExtra *topExtra = window->d_func()->maybeTopData(); + Q_ASSERT(topExtra); + if (!topExtra->inExpose) { + topExtra->inExpose = true; QRect exposeRect = qt_TRect2QRect(controlRect); qwidget->d_func()->syncBackingStore(exposeRect); - extra->inExpose = false; + topExtra->inExpose = false; } QWindowSurface *surface = qwidget->windowSurface(); diff --git a/src/gui/kernel/qapplication_win.cpp b/src/gui/kernel/qapplication_win.cpp index 3355272..0a4869b 100644 --- a/src/gui/kernel/qapplication_win.cpp +++ b/src/gui/kernel/qapplication_win.cpp @@ -928,7 +928,11 @@ const QString qt_reg_winclass(QWidget *w) // register window class uint style; bool icon; QString cname; - if (flags & Qt::MSWindowsOwnDC) { + if (qt_widget_private(w)->isGLWidget) { + cname = QLatin1String("QGLWidget"); + style = CS_DBLCLKS; + icon = true; + } else if (flags & Qt::MSWindowsOwnDC) { cname = QLatin1String("QWidgetOwnDC"); style = CS_DBLCLKS; #ifndef Q_WS_WINCE @@ -1021,7 +1025,7 @@ const QString qt_reg_winclass(QWidget *w) // register window class } wc.hCursor = 0; #ifndef Q_WS_WINCE - wc.hbrBackground = (HBRUSH)GetSysColorBrush(COLOR_WINDOW); + wc.hbrBackground = qt_widget_private(w)->isGLWidget ? 0 : (HBRUSH)GetSysColorBrush(COLOR_WINDOW); #else wc.hbrBackground = 0; #endif @@ -3616,13 +3620,19 @@ bool QETWidget::translatePaintEvent(const MSG &msg) return true; setAttribute(Qt::WA_PendingUpdate, false); - const QRegion dirtyInBackingStore(qt_dirtyRegion(this)); - // Make sure the invalidated region contains the region we're about to repaint. - // BeginPaint will set the clip to the invalidated region and it is impossible - // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient - // as it may return an invalid context (especially on Windows Vista). - if (!dirtyInBackingStore.isEmpty()) - InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false); + + if (d_func()->isGLWidget) { + if (d_func()->usesDoubleBufferedGLContext) + InvalidateRect(internalWinId(), 0, false); + } else { + const QRegion dirtyInBackingStore(qt_dirtyRegion(this)); + // Make sure the invalidated region contains the region we're about to repaint. + // BeginPaint will set the clip to the invalidated region and it is impossible + // to enlarge it afterwards (only shrink it). Using GetDCEx is not suffient + // as it may return an invalid context (especially on Windows Vista). + if (!dirtyInBackingStore.isEmpty()) + InvalidateRgn(internalWinId(), dirtyInBackingStore.handle(), false); + } PAINTSTRUCT ps; d_func()->hd = BeginPaint(internalWinId(), &ps); diff --git a/src/gui/kernel/qkeymapper_x11.cpp b/src/gui/kernel/qkeymapper_x11.cpp index 70574e7..4e6c847 100644 --- a/src/gui/kernel/qkeymapper_x11.cpp +++ b/src/gui/kernel/qkeymapper_x11.cpp @@ -360,6 +360,13 @@ QList<int> QKeyMapperPrivate::possibleKeysXKB(QKeyEvent *event) if (code && code < 0xfffe) code = QChar(code).toUpper().unicode(); + + if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) { + // map shift+tab to shift+backtab + code = Qt::Key_Backtab; + text = QString(); + } + if (code == baseCode) continue; @@ -448,6 +455,13 @@ QList<int> QKeyMapperPrivate::possibleKeysCore(QKeyEvent *event) if (code && code < 0xfffe) code = QChar(code).toUpper().unicode(); + + if (code == Qt::Key_Tab && (baseModifiers & Qt::ShiftModifier)) { + // map shift+tab to shift+backtab + code = Qt::Key_Backtab; + text = QString(); + } + if (code == baseCode) continue; diff --git a/src/gui/kernel/qwidget.cpp b/src/gui/kernel/qwidget.cpp index 2e951b6..1e92507 100644 --- a/src/gui/kernel/qwidget.cpp +++ b/src/gui/kernel/qwidget.cpp @@ -192,6 +192,7 @@ QWidgetPrivate::QWidgetPrivate(int version) , inDirtyList(0) , isScrolled(0) , isMoved(0) + , isGLWidget(0) , usesDoubleBufferedGLContext(0) #if defined(Q_WS_X11) , picture(0) @@ -200,7 +201,6 @@ QWidgetPrivate::QWidgetPrivate(int version) , nativeGesturePanEnabled(0) #elif defined(Q_WS_MAC) , needWindowChange(0) - , isGLWidget(0) , window_event(0) , qd_hd(0) #endif diff --git a/src/gui/kernel/qwidget_p.h b/src/gui/kernel/qwidget_p.h index ff8f276..75b4c12 100644 --- a/src/gui/kernel/qwidget_p.h +++ b/src/gui/kernel/qwidget_p.h @@ -174,6 +174,8 @@ struct QTLWExtra { #ifndef QT_NO_QWS_MANAGER QWSManager *qwsManager; #endif +#elif defined(Q_OS_SYMBIAN) + uint inExpose : 1; // Prevents drawing recursion #endif }; @@ -230,7 +232,6 @@ struct QWExtra { #endif #elif defined(Q_OS_SYMBIAN) // <----------------------------------------------------- Symbian uint activated : 1; // RWindowBase::Activated has been called - uint inExpose : 1; // Prevents drawing recursion /** * Defines the behaviour of QSymbianControl::Draw. @@ -685,6 +686,7 @@ public: uint inDirtyList : 1; uint isScrolled : 1; uint isMoved : 1; + uint isGLWidget : 1; uint usesDoubleBufferedGLContext : 1; // *************************** Platform specific ************************************ @@ -716,7 +718,6 @@ public: #elif defined(Q_WS_MAC) // <--------------------------------------------------------- MAC // This is new stuff uint needWindowChange : 1; - uint isGLWidget : 1; // Each wiget keeps a list of all its child and grandchild OpenGL widgets. // This list is used to update the gl context whenever a parent and a granparent diff --git a/src/gui/kernel/qwidget_s60.cpp b/src/gui/kernel/qwidget_s60.cpp index a844430..ebd289c 100644 --- a/src/gui/kernel/qwidget_s60.cpp +++ b/src/gui/kernel/qwidget_s60.cpp @@ -878,6 +878,7 @@ void QWidgetPrivate::registerDropSite(bool /* on */) void QWidgetPrivate::createTLSysExtra() { extra->topextra->backingStore = 0; + extra->topextra->inExpose = 0; } void QWidgetPrivate::deleteTLSysExtra() @@ -891,7 +892,6 @@ void QWidgetPrivate::createSysExtra() extra->activated = 0; extra->nativePaintMode = QWExtra::Default; extra->receiveNativePaintEvents = 0; - extra->inExpose = 0; } void QWidgetPrivate::deleteSysExtra() diff --git a/src/gui/painting/qdrawhelper.cpp b/src/gui/painting/qdrawhelper.cpp index 660a2a8..7a3da20 100644 --- a/src/gui/painting/qdrawhelper.cpp +++ b/src/gui/painting/qdrawhelper.cpp @@ -1267,32 +1267,28 @@ static const uint L2CacheLineLengthInInts = L2CacheLineLength/sizeof(uint); result = 0 d = d * cia */ +#define comp_func_Clear_impl(dest, length, const_alpha)\ +{\ + if (const_alpha == 255) {\ + QT_MEMFILL_UINT(dest, length, 0);\ + } else {\ + int ialpha = 255 - const_alpha;\ + PRELOAD_INIT(dest)\ + for (int i = 0; i < length; ++i) {\ + PRELOAD_COND(dest)\ + dest[i] = BYTE_MUL(dest[i], ialpha);\ + }\ + }\ +} + static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha) { - if (const_alpha == 255) { - QT_MEMFILL_UINT(dest, length, 0); - } else { - int ialpha = 255 - const_alpha; - PRELOAD_INIT(dest) - for (int i = 0; i < length; ++i) { - PRELOAD_COND(dest) - dest[i] = BYTE_MUL(dest[i], ialpha); - } - } + comp_func_Clear_impl(dest, length, const_alpha); } static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha) { - if (const_alpha == 255) { - QT_MEMFILL_UINT(dest, length, 0); - } else { - int ialpha = 255 - const_alpha; - PRELOAD_INIT(dest) - for (int i = 0; i < length; ++i) { - PRELOAD_COND(dest) - dest[i] = BYTE_MUL(dest[i], ialpha); - } - } + comp_func_Clear_impl(dest, length, const_alpha); } /* diff --git a/src/gui/painting/qdrawhelper_mmx_p.h b/src/gui/painting/qdrawhelper_mmx_p.h index 8482262..59b3804 100644 --- a/src/gui/painting/qdrawhelper_mmx_p.h +++ b/src/gui/painting/qdrawhelper_mmx_p.h @@ -146,36 +146,30 @@ struct QMMXCommonIntrinsics result = 0 d = d * cia */ +#define comp_func_Clear_impl(dest, length, const_alpha)\ +{\ + if (const_alpha == 255) {\ + qt_memfill(static_cast<quint32*>(dest), quint32(0), length);\ + } else {\ + C_FF; C_80; C_00;\ + m64 ia = MM::negate(MM::load_alpha(const_alpha));\ + for (int i = 0; i < length; ++i) {\ + dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia));\ + }\ + MM::end();\ + }\ +} + template <class MM> static void QT_FASTCALL comp_func_solid_Clear(uint *dest, int length, uint, uint const_alpha) { - if (!length) - return; - - if (const_alpha == 255) { - qt_memfill(static_cast<quint32*>(dest), quint32(0), length); - } else { - C_FF; C_80; C_00; - m64 ia = MM::negate(MM::load_alpha(const_alpha)); - for (int i = 0; i < length; ++i) { - dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia)); - } - } - MM::end(); + comp_func_Clear_impl(dest, length, const_alpha); } template <class MM> static void QT_FASTCALL comp_func_Clear(uint *dest, const uint *, int length, uint const_alpha) { - if (const_alpha == 255) { - qt_memfill(static_cast<quint32*>(dest), quint32(0), length); - } else { - C_FF; C_80; C_00; - m64 ia = MM::negate(MM::load_alpha(const_alpha)); - for (int i = 0; i < length; ++i) - dest[i] = MM::store(MM::byte_mul(MM::load(dest[i]), ia)); - } - MM::end(); + comp_func_Clear_impl(dest, length, const_alpha); } /* @@ -246,7 +240,10 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le C_FF; C_80; C_00; if (const_alpha == 255) { for (int i = 0; i < length; ++i) { - if ((0xff000000 & src[i]) == 0xff000000) { + const uint alphaMaskedSource = 0xff000000 & src[i]; + if (alphaMaskedSource == 0) + continue; + if (alphaMaskedSource == 0xff000000) { dest[i] = src[i]; } else { m64 s = MM::load(src[i]); @@ -257,6 +254,8 @@ static void QT_FASTCALL comp_func_SourceOver(uint *dest, const uint *src, int le } else { m64 ca = MM::load_alpha(const_alpha); for (int i = 0; i < length; ++i) { + if ((0xff000000 & src[i]) == 0) + continue; m64 s = MM::byte_mul(MM::load(src[i]), ca); m64 ia = MM::negate(MM::alpha(s)); dest[i] = MM::store(MM::add(s, MM::byte_mul(MM::load(dest[i]), ia))); diff --git a/src/gui/painting/qdrawhelper_p.h b/src/gui/painting/qdrawhelper_p.h index 6c47aac..cb0db4f 100644 --- a/src/gui/painting/qdrawhelper_p.h +++ b/src/gui/painting/qdrawhelper_p.h @@ -1549,6 +1549,9 @@ template<> inline void qt_memfill(quint8 *dest, quint8 color, int count) template <class T> inline void qt_memfill(T *dest, T value, int count) { + if (!count) + return; + int n = (count + 7) / 8; switch (count & 0x07) { diff --git a/src/gui/painting/qemulationpaintengine.cpp b/src/gui/painting/qemulationpaintengine.cpp index fd42736..0510b10 100644 --- a/src/gui/painting/qemulationpaintengine.cpp +++ b/src/gui/painting/qemulationpaintengine.cpp @@ -205,6 +205,11 @@ void QEmulationPaintEngine::drawTextItem(const QPointF &p, const QTextItem &text real_engine->drawTextItem(p, textItem); } +void QEmulationPaintEngine::drawStaticTextItem(QStaticTextItem *item) +{ + real_engine->drawStaticTextItem(item); +} + void QEmulationPaintEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s) { if (state()->bgMode == Qt::OpaqueMode && pixmap.isQBitmap()) diff --git a/src/gui/painting/qemulationpaintengine_p.h b/src/gui/painting/qemulationpaintengine_p.h index 0ed641b..5835f10 100644 --- a/src/gui/painting/qemulationpaintengine_p.h +++ b/src/gui/painting/qemulationpaintengine_p.h @@ -78,6 +78,7 @@ public: virtual void drawPixmap(const QRectF &r, const QPixmap &pm, const QRectF &sr); virtual void drawTextItem(const QPointF &p, const QTextItem &textItem); + virtual void drawStaticTextItem(QStaticTextItem *item); virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s); virtual void drawImage(const QRectF &r, const QImage &pm, const QRectF &sr, Qt::ImageConversionFlags flags); diff --git a/src/gui/painting/qpaintbuffer.cpp b/src/gui/painting/qpaintbuffer.cpp index 2344c04..664d864 100644 --- a/src/gui/painting/qpaintbuffer.cpp +++ b/src/gui/painting/qpaintbuffer.cpp @@ -45,6 +45,8 @@ #include <private/qfontengine_p.h> #include <private/qemulationpaintengine_p.h> #include <private/qimage_p.h> +#include <qstatictext.h> +#include <private/qstatictext_p.h> #include <QDebug> @@ -960,6 +962,18 @@ void QPaintBufferEngine::drawTiledPixmap(const QRectF &r, const QPixmap &pm, con buffer->updateBoundingRect(r); } +void QPaintBufferEngine::drawStaticTextItem(QStaticTextItem *staticTextItem) +{ + QString text = QString(staticTextItem->chars, staticTextItem->numChars); + + QStaticText staticText(text); + staticText.prepare(state()->matrix, staticTextItem->font); + + QVariantList variants; + variants << QVariant(staticTextItem->font) << QVariant::fromValue(staticText); + buffer->addCommand(QPaintBufferPrivate::Cmd_DrawStaticText, QVariant(variants)); +} + void QPaintBufferEngine::drawTextItem(const QPointF &pos, const QTextItem &ti) { #ifdef QPAINTBUFFER_DEBUG_DRAW @@ -1425,6 +1439,19 @@ void QPainterReplayer::process(const QPaintBufferCommand &cmd) #endif painter->setClipRegion(region, Qt::ClipOperation(cmd.extra)); break; } + + case QPaintBufferPrivate::Cmd_DrawStaticText: { + + QVariantList variants(d->variants.at(cmd.offset).value<QVariantList>()); + + QFont font(variants.at(0).value<QFont>()); + QStaticText text(variants.at(0).value<QStaticText>()); + + painter->setFont(font); + painter->drawStaticText(QPointF(0, 0), text); + + break; + } case QPaintBufferPrivate::Cmd_DrawText: { QPointF pos(d->floats.at(cmd.extra), d->floats.at(cmd.extra+1)); diff --git a/src/gui/painting/qpaintbuffer_p.h b/src/gui/painting/qpaintbuffer_p.h index 79d7b35..41a26c5 100644 --- a/src/gui/painting/qpaintbuffer_p.h +++ b/src/gui/painting/qpaintbuffer_p.h @@ -175,6 +175,7 @@ public: Cmd_DrawText, Cmd_DrawTextItem, + Cmd_DrawStaticText, Cmd_DrawImagePos, Cmd_DrawImageRect, @@ -394,6 +395,7 @@ public: virtual void drawTiledPixmap(const QRectF &r, const QPixmap &pixmap, const QPointF &s); virtual void drawTextItem(const QPointF &pos, const QTextItem &ti); + virtual void drawStaticTextItem(QStaticTextItem *staticTextItem); virtual void setState(QPainterState *s); virtual uint flags() const {return QPaintEngineEx::DoNotEmulate;} diff --git a/src/gui/painting/qpaintengine_raster.cpp b/src/gui/painting/qpaintengine_raster.cpp index bc56ed0..41c4f14 100644 --- a/src/gui/painting/qpaintengine_raster.cpp +++ b/src/gui/painting/qpaintengine_raster.cpp @@ -67,6 +67,7 @@ // #include <private/qpolygonclipper_p.h> // #include <private/qrasterizer_p.h> #include <private/qimage_p.h> +#include <private/qstatictext_p.h> #include "qpaintengine_raster_p.h" // #include "qbezier_p.h" @@ -3006,27 +3007,22 @@ void QRasterPaintEngine::alphaPenBlt(const void* src, int bpl, int depth, int rx blend(current, spans, &s->penData); } -void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti) +void QRasterPaintEngine::drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *positions, QFontEngine *fontEngine) { Q_D(QRasterPaintEngine); QRasterPaintEngineState *s = state(); - QVarLengthArray<QFixedPoint> positions; - QVarLengthArray<glyph_t> glyphs; - QTransform matrix = s->matrix; - matrix.translate(p.x(), p.y()); - ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); - - QFontEngineGlyphCache::Type glyphType = ti.fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(ti.fontEngine->glyphFormat) : d->glyphCacheType; + QFontEngineGlyphCache::Type glyphType = fontEngine->glyphFormat >= 0 ? QFontEngineGlyphCache::Type(fontEngine->glyphFormat) : d->glyphCacheType; QImageTextureGlyphCache *cache = - (QImageTextureGlyphCache *) ti.fontEngine->glyphCache(0, glyphType, s->matrix); + static_cast<QImageTextureGlyphCache *>(fontEngine->glyphCache(0, glyphType, s->matrix)); if (!cache) { cache = new QImageTextureGlyphCache(glyphType, s->matrix); - ti.fontEngine->setGlyphCache(0, cache); + fontEngine->setGlyphCache(0, cache); } - cache->populate(ti, glyphs, positions); + cache->populate(fontEngine, numGlyphs, glyphs, positions); const QImage &image = cache->image(); int bpl = image.bytesPerLine(); @@ -3044,7 +3040,7 @@ void QRasterPaintEngine::drawCachedGlyphs(const QPointF &p, const QTextItemInt & const QFixed offs = QFixed::fromReal(aliasedCoordinateDelta); const uchar *bits = image.bits(); - for (int i=0; i<glyphs.size(); ++i) { + for (int i=0; i<numGlyphs; ++i) { const QTextureGlyphCache::Coord &c = cache->coords.value(glyphs[i]); int x = qFloor(positions[i].x + offs) + c.baseLineX - margin; int y = qFloor(positions[i].y + offs) - c.baseLineY - margin; @@ -3221,6 +3217,15 @@ QRasterPaintEnginePrivate::getPenFunc(const QRectF &rect, return isUnclipped(rect, penWidth) ? data->unclipped_blend : data->blend; } +void QRasterPaintEngine::drawStaticTextItem(QStaticTextItem *textItem) +{ + ensurePen(); + ensureState(); + + drawCachedGlyphs(textItem->numGlyphs, textItem->glyphs, textItem->glyphPositions, + textItem->fontEngine); +} + /*! \reimp */ @@ -3269,7 +3274,17 @@ void QRasterPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte drawCached = false; #endif if (drawCached) { - drawCachedGlyphs(p, ti); + QRasterPaintEngineState *s = state(); + + QVarLengthArray<QFixedPoint> positions; + QVarLengthArray<glyph_t> glyphs; + + QTransform matrix = s->matrix; + matrix.translate(p.x(), p.y()); + + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + drawCachedGlyphs(glyphs.size(), glyphs.constData(), positions.constData(), ti.fontEngine); return; } diff --git a/src/gui/painting/qpaintengine_raster_p.h b/src/gui/painting/qpaintengine_raster_p.h index a1c73cc..55eb82e 100644 --- a/src/gui/painting/qpaintengine_raster_p.h +++ b/src/gui/painting/qpaintengine_raster_p.h @@ -203,6 +203,8 @@ public: void clip(const QRect &rect, Qt::ClipOperation op); void clip(const QRegion ®ion, Qt::ClipOperation op); + void drawStaticTextItem(QStaticTextItem *textItem); + enum ClipType { RectClip, ComplexClip @@ -257,7 +259,8 @@ private: void fillRect(const QRectF &rect, QSpanData *data); void drawBitmap(const QPointF &pos, const QImage &image, QSpanData *fill); - void drawCachedGlyphs(const QPointF &p, const QTextItemInt &ti); + void drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFixedPoint *positions, + QFontEngine *fontEngine); #if defined(Q_OS_SYMBIAN) && defined(QT_NO_FREETYPE) void drawGlyphsS60(const QPointF &p, const QTextItemInt &ti); diff --git a/src/gui/painting/qpaintengineex_p.h b/src/gui/painting/qpaintengineex_p.h index fccd1dc..90c4f9f 100644 --- a/src/gui/painting/qpaintengineex_p.h +++ b/src/gui/painting/qpaintengineex_p.h @@ -70,6 +70,7 @@ QT_MODULE(Gui) class QPainterState; class QPaintEngineExPrivate; +class QStaticTextItem; struct StrokeHandler; struct QIntRect { @@ -200,6 +201,8 @@ public: virtual void updateState(const QPaintEngineState &state); + virtual void drawStaticTextItem(QStaticTextItem *) = 0; + virtual void setState(QPainterState *s); inline QPainterState *state() { return static_cast<QPainterState *>(QPaintEngine::state); } inline const QPainterState *state() const { return static_cast<const QPainterState *>(QPaintEngine::state); } diff --git a/src/gui/painting/qpainter.cpp b/src/gui/painting/qpainter.cpp index bf12c6b..e26a24d 100644 --- a/src/gui/painting/qpainter.cpp +++ b/src/gui/painting/qpainter.cpp @@ -69,6 +69,8 @@ #include <private/qwidget_p.h> #include <private/qpaintengine_raster_p.h> #include <private/qmath_p.h> +#include <qstatictext.h> +#include <private/qstatictext_p.h> QT_BEGIN_NAMESPACE @@ -1986,12 +1988,25 @@ QPaintEngine *QPainter::paintEngine() const endNativePainting(). Note that only the states the underlying paint engine changes will be reset - to their respective default states. If, for example, the OpenGL polygon - mode is changed by the user inside a beginNativePaint()/endNativePainting() - block, it will not be reset to the default state by endNativePainting(). + to their respective default states. The states we reset may change from + release to release. The following states are currently reset in the OpenGL + 2 engine: - Here is an example that shows intermixing of painter commands - and raw OpenGL commands: + \list + \i blending is disabled + \i the depth, stencil and scissor tests are disabled + \i the active texture unit is reset to 0 + \i the depth mask, depth function and the clear depth are reset to their + default values + \i the stencil mask, stencil operation and stencil function are reset to + their default values + \i the current color is reset to solid white + \endlist + + If, for example, the OpenGL polygon mode is changed by the user inside a + beginNativePaint()/endNativePainting() block, it will not be reset to the + default state by endNativePainting(). Here is an example that shows + intermixing of painter commands and raw OpenGL commands: \snippet doc/src/snippets/code/src_gui_painting_qpainter.cpp 21 @@ -5684,6 +5699,19 @@ void QPainter::drawImage(const QRectF &targetRect, const QImage &image, const QR } /*! + + \fn void QPainter::drawStaticText(const QPoint &position, const QStaticText &staticText) + + \overload +*/ + +/*! + \fn void QPainter::drawStaticText(int x, int y, const QStaticText &staticText) + + \overload +*/ + +/*! \fn void QPainter::drawText(const QPointF &position, const QString &text) Draws the given \a text with the currently defined text direction, @@ -5705,6 +5733,105 @@ void QPainter::drawText(const QPointF &p, const QString &str) drawText(p, str, 0, 0); } +void QPainter::drawStaticText(const QPointF &position, const QStaticText &staticText) +{ + Q_D(QPainter); + if (!d->engine || staticText.text().isEmpty() || pen().style() == Qt::NoPen) + return; + + QStaticTextPrivate *staticText_d = + const_cast<QStaticTextPrivate *>(QStaticTextPrivate::get(&staticText)); + + // If we don't have an extended paint engine, or if the painter is projected, + // we go through standard code path + if (d->extended == 0 || !d->state->matrix.isAffine()) { + staticText_d->paintText(this); + return; + } + + // Don't recalculate entire layout because of translation, rather add the dx and dy + // into the position to move each text item the correct distance. + QPointF transformedPosition = position * d->state->matrix; + QTransform matrix = d->state->matrix; + + // The translation has been applied to transformedPosition. Remove translation + // component from matrix. + if (d->state->matrix.isTranslating()) { + qreal m11 = d->state->matrix.m11(); + qreal m12 = d->state->matrix.m12(); + qreal m13 = d->state->matrix.m13(); + qreal m21 = d->state->matrix.m21(); + qreal m22 = d->state->matrix.m22(); + qreal m23 = d->state->matrix.m23(); + qreal m33 = d->state->matrix.m33(); + + d->state->matrix.setMatrix(m11, m12, m13, + m21, m22, m23, + 0.0, 0.0, m33); + } + + // If the transform is not identical to the text transform, + // we have to relayout the text (for other transformations than plain translation) + bool staticTextNeedsReinit = false; + if (staticText_d->matrix != d->state->matrix) { + staticText_d->matrix = d->state->matrix; + staticTextNeedsReinit = true; + } + + bool restoreWhenFinished = false; + if (staticText_d->needsClipRect) { + save(); + setClipRect(QRectF(position, staticText_d->maximumSize)); + + restoreWhenFinished = true; + } + + if (font() != staticText_d->font) { + staticText_d->font = font(); + staticTextNeedsReinit = true; + } + + // Recreate the layout of the static text because the matrix or font has changed + if (staticTextNeedsReinit) + staticText_d->init(); + + if (transformedPosition != staticText_d->position) { // Translate to actual position + QFixed fx = QFixed::fromReal(transformedPosition.x()); + QFixed fy = QFixed::fromReal(transformedPosition.y()); + QFixed oldX = QFixed::fromReal(staticText_d->position.x()); + QFixed oldY = QFixed::fromReal(staticText_d->position.y()); + for (int item=0; item<staticText_d->itemCount;++item) { + QStaticTextItem *textItem = staticText_d->items + item; + for (int i=0; i<textItem->numGlyphs; ++i) { + textItem->glyphPositions[i].x += fx - oldX; + textItem->glyphPositions[i].y += fy - oldY; + } + textItem->userDataNeedsUpdate = true; + } + + staticText_d->position = transformedPosition; + } + + QPen oldPen = d->state->pen; + QColor currentColor = oldPen.color(); + for (int i=0; i<staticText_d->itemCount; ++i) { + QStaticTextItem *item = staticText_d->items + i; + if (currentColor != item->color) { + setPen(item->color); + currentColor = item->color; + } + d->extended->drawStaticTextItem(item); + } + if (currentColor != oldPen.color()) + setPen(oldPen); + + if (restoreWhenFinished) + restore(); + + if (matrix.isTranslating()) + d->state->matrix = matrix; +} + /*! \internal */ diff --git a/src/gui/painting/qpainter.h b/src/gui/painting/qpainter.h index ffddcba..e9fd532 100644 --- a/src/gui/painting/qpainter.h +++ b/src/gui/painting/qpainter.h @@ -78,6 +78,7 @@ class QPolygon; class QTextItem; class QMatrix; class QTransform; +class QStaticText; class QPainterPrivateDeleter; @@ -369,6 +370,10 @@ public: void setLayoutDirection(Qt::LayoutDirection direction); Qt::LayoutDirection layoutDirection() const; + void drawStaticText(const QPointF &p, const QStaticText &staticText); + inline void drawStaticText(const QPoint &p, const QStaticText &staticText); + inline void drawStaticText(int x, int y, const QStaticText &staticText); + void drawText(const QPointF &p, const QString &s); inline void drawText(const QPoint &p, const QString &s); inline void drawText(int x, int y, const QString &s); @@ -896,6 +901,16 @@ inline void QPainter::drawImage(int x, int y, const QImage &image, int sx, int s drawImage(QRectF(x, y, -1, -1), image, QRectF(sx, sy, sw, sh), flags); } +inline void QPainter::drawStaticText(const QPoint &p, const QStaticText &staticText) +{ + drawStaticText(QPointF(p), staticText); +} + +inline void QPainter::drawStaticText(int x, int y, const QStaticText &staticText) +{ + drawStaticText(QPointF(x, y), staticText); +} + inline void QPainter::drawTextItem(const QPoint &p, const QTextItem &ti) { drawTextItem(QPointF(p), ti); diff --git a/src/gui/painting/qtextureglyphcache.cpp b/src/gui/painting/qtextureglyphcache.cpp index 7b7f325..7f32d19 100644 --- a/src/gui/painting/qtextureglyphcache.cpp +++ b/src/gui/painting/qtextureglyphcache.cpp @@ -55,29 +55,28 @@ QT_BEGIN_NAMESPACE // #define CACHE_DEBUG -void QTextureGlyphCache::populate(const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs, - const QVarLengthArray<QFixedPoint> &) +void QTextureGlyphCache::populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *) { #ifdef CACHE_DEBUG printf("Populating with '%s'\n", QString::fromRawData(ti.chars, ti.num_chars).toLatin1().data()); qDebug() << " -> current transformation: " << m_transform; #endif - m_current_textitem = &ti; + m_current_fontengine = fontEngine; const int margin = glyphMargin(); QHash<glyph_t, Coord> listItemCoordinates; int rowHeight = 0; // check each glyph for its metrics and get the required rowHeight. - for (int i=0; i < glyphs.size(); ++i) { + for (int i=0; i < numGlyphs; ++i) { const glyph_t glyph = glyphs[i]; if (coords.contains(glyph)) continue; if (listItemCoordinates.contains(glyph)) continue; - glyph_metrics_t metrics = ti.fontEngine->boundingBox(glyph, m_transform); + glyph_metrics_t metrics = fontEngine->boundingBox(glyph, m_transform); #ifdef CACHE_DEBUG printf("'%c' (%4x): w=%.2f, h=%.2f, xoff=%.2f, yoff=%.2f, x=%.2f, y=%.2f, ti.ascent=%.2f, ti.descent=%.2f\n", @@ -182,7 +181,7 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const break; }; - QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_textitem->fontEngine); + QFontEngineFT *ft = static_cast<QFontEngineFT*> (m_current_fontengine); QFontEngineFT::QGlyphSet *gset = ft->loadTransformedGlyphSet(m_transform); if (gset && ft->loadGlyphs(gset, &g, 1, format)) { @@ -194,9 +193,9 @@ QImage QTextureGlyphCache::textureMapForGlyph(glyph_t g) const } else #endif if (m_type == QFontEngineGlyphCache::Raster_RGBMask) - return m_current_textitem->fontEngine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform); + return m_current_fontengine->alphaRGBMapForGlyph(g, glyphMargin(), m_transform); else - return m_current_textitem->fontEngine->alphaMapForGlyph(g, m_transform); + return m_current_fontengine->alphaMapForGlyph(g, m_transform); return QImage(); } diff --git a/src/gui/painting/qtextureglyphcache_p.h b/src/gui/painting/qtextureglyphcache_p.h index d347e61..b8717b1 100644 --- a/src/gui/painting/qtextureglyphcache_p.h +++ b/src/gui/painting/qtextureglyphcache_p.h @@ -76,7 +76,8 @@ class Q_GUI_EXPORT QTextureGlyphCache : public QFontEngineGlyphCache { public: QTextureGlyphCache(QFontEngineGlyphCache::Type type, const QTransform &matrix) - : QFontEngineGlyphCache(matrix, type), m_w(0), m_h(0), m_cx(0), m_cy(0) { } + : QFontEngineGlyphCache(matrix, type), m_w(0), m_h(0), m_cx(0), m_cy(0), + m_current_fontengine(0) { } virtual ~QTextureGlyphCache() { } @@ -90,9 +91,8 @@ public: int baseLineY; }; - void populate(const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs, - const QVarLengthArray<QFixedPoint> &positions); + void populate(QFontEngine *fontEngine, int numGlyphs, const glyph_t *glyphs, + const QFixedPoint *positions); virtual void createTextureData(int width, int height) = 0; virtual void resizeTextureData(int width, int height) = 0; @@ -113,7 +113,7 @@ public: QImage textureMapForGlyph(glyph_t g) const; protected: - const QTextItemInt *m_current_textitem; + QFontEngine *m_current_fontengine; int m_w; // image width int m_h; // image height diff --git a/src/gui/painting/qwindowsurface_s60.cpp b/src/gui/painting/qwindowsurface_s60.cpp index b41dc2c..6cbf3d9 100644 --- a/src/gui/painting/qwindowsurface_s60.cpp +++ b/src/gui/painting/qwindowsurface_s60.cpp @@ -145,12 +145,15 @@ QImage* QS60WindowSurface::buffer(const QWidget *widget) void QS60WindowSurface::flush(QWidget *widget, const QRegion ®ion, const QPoint &) { - QWExtra *extra = widget->d_func()->extraData(); - if (extra && !extra->inExpose) { - extra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again + QWidget *window = widget->window(); + Q_ASSERT(window); + QTLWExtra *topExtra = window->d_func()->maybeTopData(); + Q_ASSERT(topExtra); + if (!topExtra->inExpose) { + topExtra->inExpose = true; // Prevent DrawNow() from calling syncBackingStore() again TRect tr = qt_QRect2TRect(region.boundingRect()); widget->winId()->DrawNow(tr); - extra->inExpose = false; + topExtra->inExpose = false; } } diff --git a/src/gui/text/qstatictext.cpp b/src/gui/text/qstatictext.cpp new file mode 100644 index 0000000..6cf7022 --- /dev/null +++ b/src/gui/text/qstatictext.cpp @@ -0,0 +1,602 @@ +/**************************************************************************** +** +** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies). +** Contact: Qt Software Information (qt-info@nokia.com) +** +** This file is part of the QtGui module of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the either Technology Preview License Agreement or the +** Beta Release License Agreement. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain +** additional rights. These rights are described in the Nokia Qt LGPL +** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this +** package. +** +** GNU General Public License Usage +** Alternatively, this file may be used under the terms of the GNU +** General Public License version 3.0 as published by the Free Software +** Foundation and appearing in the file LICENSE.GPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU General Public License version 3.0 requirements will be +** met: http://www.gnu.org/copyleft/gpl.html. +** +** If you are unsure which license is appropriate for your use, please +** contact the sales department at qt-sales@nokia.com. +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#include "qstatictext.h" +#include "qstatictext_p.h" +#include <private/qtextengine_p.h> +#include <private/qfontengine_p.h> + +#include <QtGui/qapplication.h> + +QT_BEGIN_NAMESPACE + +/*! + \class QStaticText + \internal + \brief The QStaticText class enables optimized drawing of text when the text and its layout + is updated rarely. + \since 4.7 + + \ingroup multimedia + \ingroup text + \mainclass + + QStaticText provides a way to cache layout data for a block of text so that it can be drawn + more efficiently than by using QPainter::drawText() in which the layout information is + recalculated with every call. + + The class primarily provides an optimization for cases where text and the transformations on + the painter are static over several paint events. If the text or its layout is changed + regularly, QPainter::drawText() is the more efficient alternative. Translating the painter + will not cause the layout of the text to be recalculated, but will cause a very small + performance impact on drawStaticText(). Altering any other parts of the painter's + transformation or the painter's font will cause the layout of the static text to be + recalculated. This should be avoided as often as possible to maximize the performance + benefit of using QStaticText. + + In addition, only affine transformations are supported by drawStaticText(). Calling + drawStaticText() on a projected painter will perform slightly worse than using the regular + drawText() call, so this should be avoided. + + \code + class MyWidget: public QWidget + { + public: + MyWidget(QWidget *parent = 0) : QWidget(parent), m_staticText("This is static text") + + protected: + void paintEvent(QPaintEvent *) + { + QPainter painter(this); + painter.drawStaticText(0, 0, m_staticText); + } + + private: + QStaticText m_staticText; + }; + \endcode + + The QStaticText class can be used to mimic the behavior of QPainter::drawText() to a specific + point with no boundaries, and also when QPainter::drawText() is called with a bounding + rectangle. + + If a bounding rectangle is not required, create a QStaticText object without setting a maximum + size. The text will then occupy a single line. + + If you set a maximum size on the QStaticText object, this will bound the text. The text will + be formatted so that no line exceeds the given width. When the object is painted, it will + be clipped at the given size. The position of the text is decided by the argument + passed to QPainter::drawStaticText() and can change from call to call with a minimal impact + on performance. + + \sa QPainter::drawText(), QPainter::drawStaticText(), QTextLayout, QTextDocument +*/ + +/*! + Constructs an empty QStaticText +*/ +QStaticText::QStaticText() + : data(new QStaticTextPrivate) +{ +} + +/*! + \fn QStaticText::QStaticText(const QString &text, const QFont &font, const QSizeF &maximumSize) + + Constructs a QStaticText object with the given \a text which is to be rendered in the given + \a font and bounded by the given \a maximumSize. If an invalid size is passed for \a maximumSize + the text will be unbounded. +*/ +QStaticText::QStaticText(const QString &text, const QSizeF &size) + : data(new QStaticTextPrivate) +{ + data->text = text; + data->maximumSize = size; + data->init(); +} + +/*! + Constructs a QStaticText object which is a copy of \a other. +*/ +QStaticText::QStaticText(const QStaticText &other) +{ + data = other.data; +} + +/*! + Destroys the QStaticText. +*/ +QStaticText::~QStaticText() +{ + Q_ASSERT(!data || data->ref >= 1); +} + +/*! + \internal +*/ +void QStaticText::detach() +{ + if (data->ref != 1) + data.detach(); +} + +/*! + Prepares the QStaticText object for being painted with the given \a matrix and the given + \a font to avoid overhead when the actual drawStaticText() call is made. + + When drawStaticText() is called, the layout of the QStaticText will be recalculated if the + painter's font or matrix is different from the one used for the currently cached layout. By + default, QStaticText will use a default constructed QFont and an identity matrix to create + its layout. + + To avoid the overhead of creating the layout the first time you draw the QStaticText with + a painter whose matrix or font are different from the defaults, you can use the prepare() + function and pass in the matrix and font you expect to use when drawing the text. + + \sa QPainter::setFont(), QPainter::setMatrix() +*/ +void QStaticText::prepare(const QTransform &matrix, const QFont &font) +{ + data->matrix = matrix; + data->font = font; + data->init(); +} + + +/*! + Assigns \a other to this QStaticText. +*/ +QStaticText &QStaticText::operator=(const QStaticText &other) +{ + data = other.data; + return *this; +} + +/*! + Compares \a other to this QStaticText. Returns true if the texts, fonts and maximum sizes + are equal. +*/ +bool QStaticText::operator==(const QStaticText &other) const +{ + return (data == other.data + || (data->text == other.data->text + && data->font == other.data->font + && data->maximumSize == other.data->maximumSize)); +} + +/*! + Compares \a other to this QStaticText. Returns true if the texts, fonts or maximum sizes + are different. +*/ +bool QStaticText::operator!=(const QStaticText &other) const +{ + return !(*this == other); +} + +/*! + Sets the text of the QStaticText to \a text. + + \note This function will cause the layout of the text to be recalculated. + + \sa text() +*/ +void QStaticText::setText(const QString &text) +{ + detach(); + data->text = text; + data->init(); +} + +/*! + Sets the text format of the QStaticText to \a textFormat. If \a textFormat is set to + Qt::AutoText (the default), the format of the text will try to be determined using the + function Qt::mightBeRichText(). If the text format is Qt::PlainText, then the text will be + displayed as is, whereas it will be interpreted as HTML if the format is Qt::RichText. HTML tags + that alter the font of the text, its color, or its layout are supported by QStaticText. + + \note This function will cause the layout of the text to be recalculated. + + \sa textFormat(), setText(), text() +*/ +void QStaticText::setTextFormat(Qt::TextFormat textFormat) +{ + detach(); + data->textFormat = textFormat; + data->init(); +} + +/*! + Returns the text format of the QStaticText. + + \sa setTextFormat(), setText(), text() +*/ +Qt::TextFormat QStaticText::textFormat() const +{ + return Qt::TextFormat(data->textFormat); +} + +/*! + Returns the text of the QStaticText. + + \sa setText() +*/ +QString QStaticText::text() const +{ + return data->text; +} + +/*! + Sets whether the QStaticText object should use optimizations specific to the paint engine + backend if they are available. If \a on is set to true, backend optimizations will be turned + on, otherwise they will be turned off. The default value is false. + + If backend optimizations are on, the paint engine used to draw the static text is allowed to + store data in the object which will assist it in future calls to drawStaticText. In particular, + when using the opengl graphics system, or when painting on a QGLWidget, turning this flag on will + improve performance, but increase the memory footprint of the QStaticText object. + + The default value is false. + + \note This function will cause the layout of the text to be recalculated. + + \sa useBackendOptimizations() +*/ +void QStaticText::setUseBackendOptimizations(bool on) +{ + if ((!on && !data->useBackendOptimizations) + || (on && data->useBackendOptimizations)) + return; + + detach(); + data->useBackendOptimizations = on; + data->init(); +} + +/*! + Returns whether the QStaticText object should use optimizations specific to the paint engine + backend when possible. By default this setting is false. + + \sa setUseBackendOptimizations() +*/ +bool QStaticText::useBackendOptimizations() const +{ + return data->useBackendOptimizations; +} + +/*! + Sets the maximum size of the QStaticText to \a maximumSize. + + \note This function will cause the layout of the text to be recalculated. + + \sa maximumSize() +*/ +void QStaticText::setMaximumSize(const QSizeF &size) +{ + detach(); + data->maximumSize = size; + data->init(); +} + +/*! + Returns the maximum size of the QStaticText. + + \sa setMaximumSize() +*/ +QSizeF QStaticText::maximumSize() const +{ + return data->maximumSize; +} + +/*! + Returns the size of the bounding rect for this QStaticText. + + \sa maximumSize() +*/ +QSizeF QStaticText::size() const +{ + return data->actualSize; +} + +QStaticTextPrivate::QStaticTextPrivate() + : items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false), + useBackendOptimizations(false), textFormat(Qt::AutoText) +{ + ref = 1; +} + +QStaticTextPrivate::QStaticTextPrivate(const QStaticTextPrivate &other) + : text(other.text), font(other.font), maximumSize(other.maximumSize), matrix(other.matrix), + items(0), itemCount(0), glyphPool(0), positionPool(0), needsClipRect(false), + useBackendOptimizations(false), textFormat(other.textFormat) +{ + ref = 1; +} + +QStaticTextPrivate::~QStaticTextPrivate() +{ + delete[] items; + delete[] glyphPool; + delete[] positionPool; +} + +QStaticTextPrivate *QStaticTextPrivate::get(const QStaticText *q) +{ + return q->data.data(); +} + +extern int qt_defaultDpiX(); +extern int qt_defaultDpiY(); + +namespace { + + class DrawTextItemRecorder: public QPaintEngine + { + public: + DrawTextItemRecorder(int expectedItemCount, QStaticTextItem *items, + int expectedGlyphCount, QFixedPoint *positionPool, glyph_t *glyphPool) + : m_items(items), + m_expectedItemCount(expectedItemCount), + m_expectedGlyphCount(expectedGlyphCount), + m_itemCount(0), m_glyphCount(0), + m_positionPool(positionPool), + m_glyphPool(glyphPool) + { + } + + virtual void drawTextItem(const QPointF &position, const QTextItem &textItem) + { + const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem); + + m_itemCount++; + m_glyphCount += ti.glyphs.numGlyphs; + if (m_items == 0) + return; + + Q_ASSERT(m_itemCount <= m_expectedItemCount); + Q_ASSERT(m_glyphCount <= m_expectedGlyphCount); + + QStaticTextItem *currentItem = (m_items + (m_itemCount - 1)); + currentItem->fontEngine = ti.fontEngine; + currentItem->font = ti.font(); + currentItem->chars = ti.chars; + currentItem->numChars = ti.num_chars; + currentItem->numGlyphs = ti.glyphs.numGlyphs; + currentItem->glyphs = m_glyphPool; + currentItem->glyphPositions = m_positionPool; + currentItem->color = state->pen().color(); + + QTransform matrix = state->transform(); + matrix.translate(position.x(), position.y()); + + QVarLengthArray<glyph_t> glyphs; + QVarLengthArray<QFixedPoint> positions; + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + int size = glyphs.size(); + Q_ASSERT(size == ti.glyphs.numGlyphs); + Q_ASSERT(size == positions.size()); + + memmove(currentItem->glyphs, glyphs.constData(), sizeof(glyph_t) * size); + memmove(currentItem->glyphPositions, positions.constData(), sizeof(QFixedPoint) * size); + + m_glyphPool += size; + m_positionPool += size; + } + + + virtual bool begin(QPaintDevice *) { return true; } + virtual bool end() { return true; } + virtual void updateState(const QPaintEngineState &) {} + virtual void drawPixmap(const QRectF &, const QPixmap &, const QRectF &) {} + virtual Type type() const + { + return User; + } + + int itemCount() const + { + return m_itemCount; + } + + int glyphCount() const + { + return m_glyphCount; + } + + private: + QStaticTextItem *m_items; + int m_itemCount; + int m_glyphCount; + int m_expectedItemCount; + int m_expectedGlyphCount; + + glyph_t *m_glyphPool; + QFixedPoint *m_positionPool; + }; + + class DrawTextItemDevice: public QPaintDevice + { + public: + DrawTextItemDevice(int expectedItemCount = -1, QStaticTextItem *items = 0, + int expectedGlyphCount = -1, QFixedPoint *positionPool = 0, + glyph_t *glyphPool = 0) + { + m_paintEngine = new DrawTextItemRecorder(expectedItemCount, items, + expectedGlyphCount, positionPool, glyphPool); + } + + ~DrawTextItemDevice() + { + delete m_paintEngine; + } + + int metric(PaintDeviceMetric m) const + { + int val; + switch (m) { + case PdmWidth: + case PdmHeight: + case PdmWidthMM: + case PdmHeightMM: + val = 0; + break; + case PdmDpiX: + case PdmPhysicalDpiX: + val = qt_defaultDpiX(); + break; + case PdmDpiY: + case PdmPhysicalDpiY: + val = qt_defaultDpiY(); + break; + case PdmNumColors: + val = 16777216; + break; + case PdmDepth: + val = 24; + break; + default: + val = 0; + qWarning("DrawTextItemDevice::metric: Invalid metric command"); + } + return val; + } + + virtual QPaintEngine *paintEngine() const + { + return m_paintEngine; + } + + int itemCount() const + { + return m_paintEngine->itemCount(); + } + + int glyphCount() const + { + return m_paintEngine->glyphCount(); + } + + private: + DrawTextItemRecorder *m_paintEngine; + }; +} + +void QStaticTextPrivate::paintText(QPainter *p) +{ + bool preferRichText = textFormat == Qt::RichText + || (textFormat == Qt::AutoText && Qt::mightBeRichText(text)); + + if (!preferRichText) { + if (maximumSize.isValid()) { + QRectF boundingRect; + p->drawText(QRectF(QPointF(0, 0), maximumSize), Qt::TextWordWrap, text, &boundingRect); + + actualSize = boundingRect.size(); + needsClipRect = boundingRect.width() > maximumSize.width() + || boundingRect.height() > maximumSize.height(); + } else { + p->drawText(0, 0, text); + needsClipRect = false; + + QFontMetrics fm(font); + actualSize = fm.boundingRect(text).size(); + } + } else { + QTextDocument document; + document.setDefaultFont(font); + document.setHtml(text); + + QRectF rect = maximumSize.isValid() ? QRectF(QPointF(0, 0), maximumSize) : QRectF(); + document.adjustSize(); + document.drawContents(p, rect); + actualSize = document.size(); + needsClipRect = maximumSize.isValid() + && (actualSize.width() > maximumSize.width() + || actualSize.height() > maximumSize.height()); + } +} + +void QStaticTextPrivate::init() +{ + delete[] items; + delete[] glyphPool; + delete[] positionPool; + + position = QPointF(0, 0); + + // Draw once to count number of items and glyphs, so that we can use as little memory + // as possible to store the data + DrawTextItemDevice counterDevice; + { + QPainter painter(&counterDevice); + painter.setFont(font); + painter.setTransform(matrix); + + paintText(&painter); + + } + + itemCount = counterDevice.itemCount(); + items = new QStaticTextItem[itemCount]; + + if (useBackendOptimizations) { + for (int i=0; i<itemCount; ++i) + items[i].useBackendOptimizations = true; + } + + + int glyphCount = counterDevice.glyphCount(); + glyphPool = new glyph_t[glyphCount]; + positionPool = new QFixedPoint[glyphCount]; + + // Draw again to actually record the items and glyphs + DrawTextItemDevice recorderDevice(itemCount, items, glyphCount, positionPool, glyphPool); + { + QPainter painter(&recorderDevice); + painter.setFont(font); + painter.setTransform(matrix); + + paintText(&painter); + } + +} + +QT_END_NAMESPACE diff --git a/src/gui/text/qstatictext.h b/src/gui/text/qstatictext.h new file mode 100644 index 0000000..8eeb068 --- /dev/null +++ b/src/gui/text/qstatictext.h @@ -0,0 +1,101 @@ +/**************************************************************************** +** +** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies). +** Contact: Qt Software Information (qt-info@nokia.com) +** +** This file is part of the QtGui module of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the either Technology Preview License Agreement or the +** Beta Release License Agreement. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain +** additional rights. These rights are described in the Nokia Qt LGPL +** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this +** package. +** +** GNU General Public License Usage +** Alternatively, this file may be used under the terms of the GNU +** General Public License version 3.0 as published by the Free Software +** Foundation and appearing in the file LICENSE.GPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU General Public License version 3.0 requirements will be +** met: http://www.gnu.org/copyleft/gpl.html. +** +** If you are unsure which license is appropriate for your use, please +** contact the sales department at qt-sales@nokia.com. +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#ifndef QSTATICTEXT_H +#define QSTATICTEXT_H + +#include <QtCore/qsize.h> +#include <QtCore/qstring.h> +#include <QtCore/qmetatype.h> + +#include <QtGui/qtransform.h> +#include <QtGui/qfont.h> + + +QT_BEGIN_HEADER + +QT_BEGIN_NAMESPACE + +QT_MODULE(Gui) + +class QStaticTextPrivate; +class Q_GUI_EXPORT QStaticText +{ +public: + QStaticText(); + QStaticText(const QString &text, const QSizeF &maximumSize = QSizeF()); + QStaticText(const QStaticText &other); + ~QStaticText(); + + void setText(const QString &text); + QString text() const; + + void setTextFormat(Qt::TextFormat textFormat); + Qt::TextFormat textFormat() const; + + void setMaximumSize(const QSizeF &maximumSize); + QSizeF maximumSize() const; + + QSizeF size() const; + + void prepare(const QTransform &matrix, const QFont &font); + + void setUseBackendOptimizations(bool on); + bool useBackendOptimizations() const; + + QStaticText &operator=(const QStaticText &); + bool operator==(const QStaticText &) const; + bool operator!=(const QStaticText &) const; + +private: + void detach(); + + QExplicitlySharedDataPointer<QStaticTextPrivate> data; + friend class QStaticTextPrivate; +}; + +Q_DECLARE_METATYPE(QStaticText) + +QT_END_NAMESPACE + +QT_END_HEADER + +#endif // QSTATICTEXT_H diff --git a/src/gui/text/qstatictext_p.h b/src/gui/text/qstatictext_p.h new file mode 100644 index 0000000..95bd286 --- /dev/null +++ b/src/gui/text/qstatictext_p.h @@ -0,0 +1,145 @@ +/**************************************************************************** +** +** Copyright (C) 2009 Nokia Corporation and/or its subsidiary(-ies). +** Contact: Qt Software Information (qt-info@nokia.com) +** +** This file is part of the QtGui module of the Qt Toolkit. +** +** $QT_BEGIN_LICENSE:LGPL$ +** No Commercial Usage +** This file contains pre-release code and may not be distributed. +** You may use this file in accordance with the terms and conditions +** contained in the either Technology Preview License Agreement or the +** Beta Release License Agreement. +** +** GNU Lesser General Public License Usage +** Alternatively, this file may be used under the terms of the GNU Lesser +** General Public License version 2.1 as published by the Free Software +** Foundation and appearing in the file LICENSE.LGPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU Lesser General Public License version 2.1 requirements +** will be met: http://www.gnu.org/licenses/old-licenses/lgpl-2.1.html. +** +** In addition, as a special exception, Nokia gives you certain +** additional rights. These rights are described in the Nokia Qt LGPL +** Exception version 1.0, included in the file LGPL_EXCEPTION.txt in this +** package. +** +** GNU General Public License Usage +** Alternatively, this file may be used under the terms of the GNU +** General Public License version 3.0 as published by the Free Software +** Foundation and appearing in the file LICENSE.GPL included in the +** packaging of this file. Please review the following information to +** ensure the GNU General Public License version 3.0 requirements will be +** met: http://www.gnu.org/copyleft/gpl.html. +** +** If you are unsure which license is appropriate for your use, please +** contact the sales department at qt-sales@nokia.com. +** $QT_END_LICENSE$ +** +****************************************************************************/ + +#ifndef QSTATICTEXT_P_H +#define QSTATICTEXT_P_H + +// +// W A R N I N G +// ------------- +// +// This file is not part of the Qt API. It exists for the convenience +// of internal files. This header file may change from version to version +// without notice, or even be removed. +// +// We mean it. +// + +#include <private/qtextureglyphcache_p.h> + +QT_BEGIN_NAMESPACE + +class QStaticTextUserData +{ +public: + enum Type { + NoUserData, + OpenGLUserData + }; + + QStaticTextUserData(Type t) : type(t) {} + virtual ~QStaticTextUserData() {} + + Type type; +}; + +class Q_GUI_EXPORT QStaticTextItem +{ +public: + QStaticTextItem() : chars(0), numChars(0), fontEngine(0), userData(0), + useBackendOptimizations(false), userDataNeedsUpdate(0) {} + ~QStaticTextItem() { delete userData; } + + void setUserData(QStaticTextUserData *newUserData) + { + if (userData == newUserData) + return; + + delete userData; + userData = newUserData; + } + + QFixedPoint *glyphPositions; // 8 bytes per glyph + glyph_t *glyphs; // 4 bytes per glyph + const QChar *chars; // 2 bytes per glyph + // ================= + // 14 bytes per glyph + + // 12 bytes for pointers + int numGlyphs; // 4 bytes per item + int numChars; // 4 bytes per item + QFontEngine *fontEngine; // 4 bytes per item + QFont font; // 8 bytes per item + QColor color; // 10 bytes per item + QStaticTextUserData *userData; // 8 bytes per item + char useBackendOptimizations : 1; // 1 byte per item + char userDataNeedsUpdate : 1; // + // ================ + // 51 bytes per item +}; + +class QStaticText; +class Q_AUTOTEST_EXPORT QStaticTextPrivate +{ +public: + QStaticTextPrivate(); + QStaticTextPrivate(const QStaticTextPrivate &other); + ~QStaticTextPrivate(); + + void init(); + void paintText(QPainter *p); + + QAtomicInt ref; // 4 bytes per text + + QString text; // 4 bytes per text + QFont font; // 8 bytes per text + QSizeF maximumSize; // 16 bytes per text + QSizeF actualSize; // 16 bytes per text + QPointF position; // 16 bytes per text + + QTransform matrix; // 80 bytes per text + QStaticTextItem *items; // 4 bytes per text + int itemCount; // 4 bytes per text + glyph_t *glyphPool; // 4 bytes per text + QFixedPoint *positionPool; // 4 bytes per text + + char needsClipRect : 1; // 1 byte per text + char useBackendOptimizations : 1; + char textFormat : 2; + // ================ + // 171 bytes per text + + static QStaticTextPrivate *get(const QStaticText *q); +}; + +QT_END_NAMESPACE + +#endif // QSTATICTEXT_P_H diff --git a/src/gui/text/text.pri b/src/gui/text/text.pri index b7615a4..9ec3142 100644 --- a/src/gui/text/text.pri +++ b/src/gui/text/text.pri @@ -37,7 +37,9 @@ HEADERS += \ text/qtexttable_p.h \ text/qzipreader_p.h \ text/qzipwriter_p.h \ - text/qtextodfwriter_p.h + text/qtextodfwriter_p.h \ + text/qstatictext_p.h \ + text/qstatictext.h SOURCES += \ text/qfont.cpp \ @@ -66,7 +68,8 @@ SOURCES += \ text/qsyntaxhighlighter.cpp \ text/qcssparser.cpp \ text/qzip.cpp \ - text/qtextodfwriter.cpp + text/qtextodfwriter.cpp \ + text/qstatictext.cpp win32 { SOURCES += \ diff --git a/src/gui/widgets/qlinecontrol.cpp b/src/gui/widgets/qlinecontrol.cpp index b0a64ea..db099e8 100644 --- a/src/gui/widgets/qlinecontrol.cpp +++ b/src/gui/widgets/qlinecontrol.cpp @@ -1371,6 +1371,8 @@ bool QLineControl::processEvent(QEvent* ev) processInputMethodEvent(static_cast<QInputMethodEvent*>(ev)); break; #ifndef QT_NO_SHORTCUT case QEvent::ShortcutOverride:{ + if (isReadOnly()) + return false; QKeyEvent* ke = static_cast<QKeyEvent*>(ev); if (ke == QKeySequence::Copy || ke == QKeySequence::Paste diff --git a/src/network/access/qhttpnetworkconnectionchannel.cpp b/src/network/access/qhttpnetworkconnectionchannel.cpp index 70a301d..5bd972c 100644 --- a/src/network/access/qhttpnetworkconnectionchannel.cpp +++ b/src/network/access/qhttpnetworkconnectionchannel.cpp @@ -305,9 +305,12 @@ void QHttpNetworkConnectionChannel::_q_receiveReply() while (socket->bytesAvailable()) { QHttpNetworkReplyPrivate::ReplyState state = reply ? reply->d_func()->state : QHttpNetworkReplyPrivate::AllDoneState; switch (state) { - case QHttpNetworkReplyPrivate::NothingDoneState: - case QHttpNetworkReplyPrivate::ReadingStatusState: { + case QHttpNetworkReplyPrivate::NothingDoneState: { + // only eat whitespace on the first call eatWhitespace(); + state = reply->d_func()->state = QHttpNetworkReplyPrivate::ReadingStatusState; + } + case QHttpNetworkReplyPrivate::ReadingStatusState: { qint64 statusBytes = reply->d_func()->readStatus(socket); if (statusBytes == -1 && reconnectAttempts <= 0) { // too many errors reading/receiving/parsing the status, close the socket and emit error diff --git a/src/network/access/qhttpnetworkreply.cpp b/src/network/access/qhttpnetworkreply.cpp index a5223d1..512c045 100644 --- a/src/network/access/qhttpnetworkreply.cpp +++ b/src/network/access/qhttpnetworkreply.cpp @@ -423,13 +423,26 @@ int QHttpNetworkReplyPrivate::gunzipBodyPartially(QByteArray &compressed, QByteA qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket) { + if (fragment.isEmpty()) { + // reserve bytes for the status line. This is better than always append() which reallocs the byte array + fragment.reserve(32); + } + qint64 bytes = 0; char c; + qint64 haveRead = 0; + + do { + haveRead = socket->read(&c, 1); + if (haveRead == -1) + return -1; // unexpected EOF + else if (haveRead == 0) + break; // read more later + + bytes++; - while (socket->bytesAvailable()) { // allow both CRLF & LF (only) line endings - if (socket->peek(&c, 1) == 1 && c == '\n') { - bytes += socket->read(&c, 1); // read the "n" + if (c == '\n') { // remove the CR at the end if (fragment.endsWith('\r')) { fragment.truncate(fragment.length()-1); @@ -442,11 +455,6 @@ qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket) } break; } else { - c = 0; - int haveRead = socket->read(&c, 1); - if (haveRead == -1) - return -1; - bytes += haveRead; fragment.append(c); } @@ -456,8 +464,7 @@ qint64 QHttpNetworkReplyPrivate::readStatus(QAbstractSocket *socket) fragment.clear(); return -1; } - - } + } while (haveRead == 1); return bytes; } @@ -500,20 +507,41 @@ bool QHttpNetworkReplyPrivate::parseStatus(const QByteArray &status) qint64 QHttpNetworkReplyPrivate::readHeader(QAbstractSocket *socket) { + if (fragment.isEmpty()) { + // according to http://dev.opera.com/articles/view/mama-http-headers/ the average size of the header + // block is 381 bytes. + // reserve bytes. This is better than always append() which reallocs the byte array. + fragment.reserve(512); + } + qint64 bytes = 0; char c = 0; bool allHeaders = false; - while (!allHeaders && socket->bytesAvailable()) { - if (socket->peek(&c, 1) == 1 && c == '\n') { - // check for possible header endings. As per HTTP rfc, - // the header endings will be marked by CRLFCRLF. But - // we will allow CRLFLF, LFLF & CRLFCRLF - if (fragment.endsWith("\n\r") || fragment.endsWith('\n')) - allHeaders = true; + qint64 haveRead = 0; + do { + haveRead = socket->read(&c, 1); + if (haveRead == 0) { + // read more later + break; + } else if (haveRead == -1) { + // connection broke down + return -1; + } else { + fragment.append(c); + bytes++; + + if (c == '\n') { + // check for possible header endings. As per HTTP rfc, + // the header endings will be marked by CRLFCRLF. But + // we will allow CRLFCRLF, CRLFLF, LFLF + if (fragment.endsWith("\r\n\r\n") + || fragment.endsWith("\r\n\n") + || fragment.endsWith("\n\n")) + allHeaders = true; + } } - bytes += socket->read(&c, 1); - fragment.append(c); - } + } while (!allHeaders && haveRead > 0); + // we received all headers now parse them if (allHeaders) { parseHeader(fragment); diff --git a/src/network/access/qnetworkcookie.h b/src/network/access/qnetworkcookie.h index f34396f..3cc4cee 100644 --- a/src/network/access/qnetworkcookie.h +++ b/src/network/access/qnetworkcookie.h @@ -114,7 +114,7 @@ Q_NETWORK_EXPORT QDebug operator<<(QDebug, const QNetworkCookie &); QT_END_NAMESPACE // ### Qt5 remove this include -#include "qnetworkcookiejar.h" +#include <QtNetwork/QNetworkCookieJar> Q_DECLARE_METATYPE(QNetworkCookie) Q_DECLARE_METATYPE(QList<QNetworkCookie>) diff --git a/src/network/access/qnetworkcookiejar.h b/src/network/access/qnetworkcookiejar.h index 813bf3e..8086f38 100644 --- a/src/network/access/qnetworkcookiejar.h +++ b/src/network/access/qnetworkcookiejar.h @@ -46,7 +46,7 @@ #include <QtCore/QUrl> // ### Qt5 remove this include -#include "qnetworkcookie.h" +#include <QtNetwork/QNetworkCookie> QT_BEGIN_HEADER diff --git a/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp b/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp index 03b1bf0..559a6fd 100644 --- a/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp +++ b/src/opengl/gl2paintengineex/qgl2pexvertexarray.cpp @@ -61,12 +61,6 @@ QGLRect QGL2PEXVertexArray::boundingRect() const return QGLRect(minX, minY, maxX, maxY); } -void QGL2PEXVertexArray::addRect(const QRectF &rect) -{ - vertexArray << rect.topLeft() << rect.topRight() << rect.bottomRight() - << rect.bottomRight() << rect.bottomLeft() << rect.topLeft(); -} - void QGL2PEXVertexArray::addClosingLine(int index) { if (QPointF(vertexArray.at(index)) != QPointF(vertexArray.last())) diff --git a/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h b/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h index e0497b1..d1e7615 100644 --- a/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h +++ b/src/opengl/gl2paintengineex/qgl2pexvertexarray_p.h @@ -102,8 +102,36 @@ public: QGL2PEXVertexArray() : maxX(-2e10), maxY(-2e10), minX(2e10), minY(2e10), boundingRectDirty(true) {} + + inline void addRect(const QRectF &rect) + { + qreal top = rect.top(); + qreal left = rect.left(); + qreal bottom = rect.bottom(); + qreal right = rect.right(); + + vertexArray << QGLPoint(left, top) + << QGLPoint(right, top) + << QGLPoint(right, bottom) + << QGLPoint(right, bottom) + << QGLPoint(left, bottom) + << QGLPoint(left, top); + } + + inline void addQuad(const QRectF &rect) + { + qreal top = rect.top(); + qreal left = rect.left(); + qreal bottom = rect.bottom(); + qreal right = rect.right(); + + vertexArray << QGLPoint(left, top) + << QGLPoint(right, top) + << QGLPoint(left, bottom) + << QGLPoint(right, bottom); + + } - void addRect(const QRectF &rect); void addPath(const QVectorPath &path, GLfloat curveInverseScale, bool outline = true); void clear(); diff --git a/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp b/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp index d2fb925..12ac69d 100644 --- a/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp +++ b/src/opengl/gl2paintengineex/qpaintengineex_opengl2.cpp @@ -77,6 +77,7 @@ #include <private/qfontengine_p.h> #include <private/qpixmapdata_gl_p.h> #include <private/qdatabuffer_p.h> +#include <private/qstatictext_p.h> #include <private/qtriangulator_p.h> #include "qglgradientcache_p.h" @@ -1290,6 +1291,20 @@ void QGL2PaintEngineEx::drawImage(const QRectF& dest, const QImage& image, const d->drawTexture(dest, src, image.size(), !image.hasAlphaChannel()); } +void QGL2PaintEngineEx::drawStaticTextItem(QStaticTextItem *textItem) +{ + Q_D(QGL2PaintEngineEx); + + ensureActive(); + + QFontEngineGlyphCache::Type glyphType = textItem->fontEngine->glyphFormat >= 0 + ? QFontEngineGlyphCache::Type(textItem->fontEngine->glyphFormat) + : d->glyphCacheType; + + // ### What about huge fonts? These are not passed through cache in drawTextItem(). + d->drawCachedGlyphs(glyphType, textItem, true); +} + void QGL2PaintEngineEx::drawTexture(const QRectF &dest, GLuint textureId, const QSize &size, const QRectF &src) { Q_D(QGL2PaintEngineEx); @@ -1343,33 +1358,70 @@ void QGL2PaintEngineEx::drawTextItem(const QPointF &p, const QTextItem &textItem } if (drawCached) { - d->drawCachedGlyphs(p, glyphType, ti); + QVarLengthArray<QFixedPoint> positions; + QVarLengthArray<glyph_t> glyphs; + QTransform matrix = QTransform::fromTranslate(p.x(), p.y()); + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + { + QStaticTextItem staticTextItem; + staticTextItem.chars = ti.chars; + staticTextItem.fontEngine = ti.fontEngine; + staticTextItem.glyphs = glyphs.data(); + staticTextItem.numChars = ti.num_chars; + staticTextItem.numGlyphs = glyphs.size(); + staticTextItem.glyphPositions = positions.data(); + + d->drawCachedGlyphs(glyphType, &staticTextItem, false); + } return; } QPaintEngineEx::drawTextItem(p, ti); } -void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGlyphCache::Type glyphType, - const QTextItemInt &ti) +namespace { + + class QOpenGLStaticTextUserData: public QStaticTextUserData + { + public: + QOpenGLStaticTextUserData() + : QStaticTextUserData(OpenGLUserData) + { + } + + ~QOpenGLStaticTextUserData() + { + } + + QGL2PEXVertexArray vertexCoordinateArray; + QGL2PEXVertexArray textureCoordinateArray; + }; + +} + +void QGL2PaintEngineExPrivate::drawCachedGlyphs(QFontEngineGlyphCache::Type glyphType, + QStaticTextItem *staticTextItem, + bool includeMatrixInCache) { Q_Q(QGL2PaintEngineEx); - QVarLengthArray<QFixedPoint> positions; - QVarLengthArray<glyph_t> glyphs; - QTransform matrix = QTransform::fromTranslate(p.x(), p.y()); - ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + QOpenGL2PaintEngineState *s = q->state(); QGLTextureGlyphCache *cache = - (QGLTextureGlyphCache *) ti.fontEngine->glyphCache(ctx, glyphType, QTransform()); - + (QGLTextureGlyphCache *) staticTextItem->fontEngine->glyphCache(ctx, glyphType, + includeMatrixInCache + ? s->matrix + : QTransform()); if (!cache || cache->cacheType() != glyphType) { - cache = new QGLTextureGlyphCache(ctx, glyphType, QTransform()); - ti.fontEngine->setGlyphCache(ctx, cache); + cache = new QGLTextureGlyphCache(ctx, glyphType, + includeMatrixInCache ? s->matrix : QTransform()); + staticTextItem->fontEngine->setGlyphCache(ctx, cache); } cache->setPaintEnginePrivate(this); - cache->populate(ti, glyphs, positions); + cache->populate(staticTextItem->fontEngine, staticTextItem->numGlyphs, staticTextItem->glyphs, + staticTextItem->glyphPositions); if (cache->width() == 0 || cache->height() == 0) return; @@ -1381,20 +1433,70 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly GLfloat dx = 1.0 / cache->width(); GLfloat dy = 1.0 / cache->height(); - vertexCoordinateArray.clear(); - textureCoordinateArray.clear(); + bool recreateVertexArrays = false; + if (staticTextItem->userDataNeedsUpdate) + recreateVertexArrays = true; + else if (staticTextItem->userData == 0) + recreateVertexArrays = true; + else if (staticTextItem->userData->type != QStaticTextUserData::OpenGLUserData) + recreateVertexArrays = true; + + // Use global arrays by default + QGL2PEXVertexArray *vertexCoordinates = &vertexCoordinateArray; + QGL2PEXVertexArray *textureCoordinates = &textureCoordinateArray; + + if (staticTextItem->useBackendOptimizations) { + QOpenGLStaticTextUserData *userData = 0; + + if (staticTextItem->userData == 0 + || staticTextItem->userData->type != QStaticTextUserData::OpenGLUserData) { - for (int i=0; i<glyphs.size(); ++i) { - const QTextureGlyphCache::Coord &c = cache->coords.value(glyphs[i]); - int x = positions[i].x.toInt() + c.baseLineX - margin; - int y = positions[i].y.toInt() - c.baseLineY - margin; + userData = new QOpenGLStaticTextUserData(); + staticTextItem->setUserData(userData); - vertexCoordinateArray.addRect(QRectF(x, y, c.w, c.h)); - textureCoordinateArray.addRect(QRectF(c.x*dx, c.y*dy, c.w * dx, c.h * dy)); + } else { + userData = static_cast<QOpenGLStaticTextUserData*>(staticTextItem->userData); + } + + // Use cache if backend optimizations is turned on + vertexCoordinates = &userData->vertexCoordinateArray; + textureCoordinates = &userData->textureCoordinateArray; } - setVertexAttributePointer(QT_VERTEX_COORDS_ATTR, (GLfloat*)vertexCoordinateArray.data()); - setVertexAttributePointer(QT_TEXTURE_COORDS_ATTR, (GLfloat*)textureCoordinateArray.data()); + + if (recreateVertexArrays) { + vertexCoordinates->clear(); + textureCoordinates->clear(); + + for (int i=0; i<staticTextItem->numGlyphs; ++i) { + const QTextureGlyphCache::Coord &c = cache->coords.value(staticTextItem->glyphs[i]); + int x = staticTextItem->glyphPositions[i].x.toInt() + c.baseLineX - margin; + int y = staticTextItem->glyphPositions[i].y.toInt() - c.baseLineY - margin; + + vertexCoordinates->addQuad(QRectF(x, y, c.w, c.h)); + textureCoordinates->addQuad(QRectF(c.x*dx, c.y*dy, c.w * dx, c.h * dy)); + } + + staticTextItem->userDataNeedsUpdate = false; + } + + if (elementIndices.size() < staticTextItem->numGlyphs*6) { + Q_ASSERT(elementIndices.size() % 6 == 0); + int j = elementIndices.size() / 6 * 4; + while (j < staticTextItem->numGlyphs*4) { + elementIndices.append(j + 0); + elementIndices.append(j + 0); + elementIndices.append(j + 1); + elementIndices.append(j + 2); + elementIndices.append(j + 3); + elementIndices.append(j + 3); + + j += 4; + } + } + + setVertexAttributePointer(QT_VERTEX_COORDS_ATTR, (GLfloat*)vertexCoordinates->data()); + setVertexAttributePointer(QT_TEXTURE_COORDS_ATTR, (GLfloat*)textureCoordinates->data()); if (addOffset) { addOffset = false; @@ -1408,6 +1510,13 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly QBrush pensBrush = q->state()->pen.brush(); setBrush(pensBrush); + // When painting a QStaticTextItem, the glyph positions are already in device coordinates, + // therefore we temporarily set an identity matrix on the painter for the draw call to + // avoid transforming the positions twice. + QTransform old = s->matrix; + if (includeMatrixInCache) + s->matrix = QTransform(); + if (glyphType == QFontEngineGlyphCache::Raster_RGBMask) { // Subpixel antialiasing without gamma correction @@ -1461,7 +1570,7 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly updateTextureFilter(GL_TEXTURE_2D, GL_REPEAT, false); shaderManager->currentProgram()->setUniformValue(location(QGLEngineShaderManager::MaskTexture), QT_MASK_TEXTURE_UNIT); - glDrawArrays(GL_TRIANGLES, 0, 6 * glyphs.size()); + glDrawElements(GL_TRIANGLE_STRIP, 6 * staticTextItem->numGlyphs, GL_UNSIGNED_SHORT, elementIndices.data()); shaderManager->setMaskType(QGLEngineShaderManager::SubPixelMaskPass2); @@ -1491,7 +1600,11 @@ void QGL2PaintEngineExPrivate::drawCachedGlyphs(const QPointF &p, QFontEngineGly updateTextureFilter(GL_TEXTURE_2D, GL_REPEAT, false); shaderManager->currentProgram()->setUniformValue(location(QGLEngineShaderManager::MaskTexture), QT_MASK_TEXTURE_UNIT); - glDrawArrays(GL_TRIANGLES, 0, 6 * glyphs.size()); + + glDrawElements(GL_TRIANGLE_STRIP, 6 * staticTextItem->numGlyphs, GL_UNSIGNED_SHORT, elementIndices.data()); + + if (includeMatrixInCache) + s->matrix = old; } void QGL2PaintEngineEx::drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QDrawPixmaps::DrawingHints hints) diff --git a/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h b/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h index e816e17..c60eac1 100644 --- a/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h +++ b/src/opengl/gl2paintengineex/qpaintengineex_opengl2_p.h @@ -133,6 +133,7 @@ public: virtual void stroke(const QVectorPath &path, const QPen &pen); virtual void clip(const QVectorPath &path, Qt::ClipOperation op); + virtual void drawStaticTextItem(QStaticTextItem *textItem); Type type() const { return OpenGL2; } @@ -194,7 +195,8 @@ public: void stroke(const QVectorPath &path, const QPen &pen); void drawTexture(const QGLRect& dest, const QGLRect& src, const QSize &textureSize, bool opaque, bool pattern = false); void drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QDrawPixmaps::DrawingHints hints); - void drawCachedGlyphs(const QPointF &p, QFontEngineGlyphCache::Type glyphType, const QTextItemInt &ti); + void drawCachedGlyphs(QFontEngineGlyphCache::Type glyphType, QStaticTextItem *staticTextItem, + bool includeMatrixInCache); // Calls glVertexAttributePointer if the pointer has changed inline void setVertexAttributePointer(unsigned int arrayIndex, const GLfloat *pointer); @@ -265,6 +267,7 @@ public: QGL2PEXVertexArray vertexCoordinateArray; QGL2PEXVertexArray textureCoordinateArray; + QVector<GLushort> elementIndices; QDataBuffer<GLfloat> opacityArray; GLfloat staticVertexCoordinateArray[8]; GLfloat staticTextureCoordinateArray[8]; diff --git a/src/opengl/qgl_mac.mm b/src/opengl/qgl_mac.mm index c01575b..4d7532e 100644 --- a/src/opengl/qgl_mac.mm +++ b/src/opengl/qgl_mac.mm @@ -951,8 +951,6 @@ void QGLWidgetPrivate::init(QGLContext *context, const QGLWidget *shareWidget) break; current = current->parentWidget(); } - - isGLWidget = 1; } bool QGLWidgetPrivate::renderCxPm(QPixmap*) diff --git a/src/opengl/qgl_p.h b/src/opengl/qgl_p.h index 18fc9c2..efd2090 100644 --- a/src/opengl/qgl_p.h +++ b/src/opengl/qgl_p.h @@ -173,7 +173,9 @@ public: #if defined(Q_WS_X11) && defined(QT_OPENGL_ES) , eglSurfaceWindowId(0) #endif - {} + { + isGLWidget = 1; + } ~QGLWidgetPrivate() {} diff --git a/src/opengl/qglextensions_p.h b/src/opengl/qglextensions_p.h index 4edd5f7..f6926f3 100644 --- a/src/opengl/qglextensions_p.h +++ b/src/opengl/qglextensions_p.h @@ -452,6 +452,14 @@ struct QGLExtensionFuncs // OpenGL constants +#ifndef GL_ARRAY_BUFFER +#define GL_ARRAY_BUFFER 0x8892 +#endif + +#ifndef GL_STATIC_DRAW +#define GL_STATIC_DRAW 0x88E4 +#endif + /* NV_texture_rectangle */ #ifndef GL_NV_texture_rectangle #define GL_TEXTURE_RECTANGLE_NV 0x84F5 diff --git a/src/opengl/qglpixmapfilter.cpp b/src/opengl/qglpixmapfilter.cpp index 37bb7c0..d5a11d9 100644 --- a/src/opengl/qglpixmapfilter.cpp +++ b/src/opengl/qglpixmapfilter.cpp @@ -394,6 +394,7 @@ void QGLBlurTextureCache::insertBlurTextureInfo(const QPixmap &pixmap, QGLBlurTe static bool hookAdded = false; if (!hookAdded) { QImagePixmapCleanupHooks::instance()->addPixmapDataDestructionHook(pixmapDestroyed); + QImagePixmapCleanupHooks::instance()->addPixmapDataModificationHook(pixmapDestroyed); hookAdded = true; } diff --git a/src/opengl/qpaintengine_opengl.cpp b/src/opengl/qpaintengine_opengl.cpp index 3845e43..c8307a0 100644 --- a/src/opengl/qpaintengine_opengl.cpp +++ b/src/opengl/qpaintengine_opengl.cpp @@ -60,6 +60,7 @@ #include <private/qglpixelbuffer_p.h> #include <private/qbezier_p.h> #include <qglframebufferobject.h> +#include <private/qstatictext_p.h> #include "private/qtessellator_p.h" @@ -4548,7 +4549,7 @@ public: QGLGlyphCache() : QObject(0) { current_cache = 0; } ~QGLGlyphCache(); QGLGlyphCoord *lookup(QFontEngine *, glyph_t); - void cacheGlyphs(QGLContext *, const QTextItemInt &, const QVarLengthArray<glyph_t> &); + void cacheGlyphs(QGLContext *, QFontEngine *, glyph_t *glyphs, int numGlyphs); void cleanCache(); void allocTexture(int width, int height, GLuint texture); @@ -4700,8 +4701,8 @@ static QImage getCurrentTexture(const QColor &color, QGLFontTexture *font_tex) } #endif -void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs) +void QGLGlyphCache::cacheGlyphs(QGLContext *context, QFontEngine *fontEngine, + glyph_t *glyphs, int numGlyphs) { QGLContextHash::const_iterator dev_it = qt_context_cache.constFind(context); QGLFontGlyphHash *font_cache = 0; @@ -4737,25 +4738,25 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti, } Q_ASSERT(font_cache != 0); - QGLFontGlyphHash::const_iterator cache_it = font_cache->constFind(ti.fontEngine); + QGLFontGlyphHash::const_iterator cache_it = font_cache->constFind(fontEngine); QGLGlyphHash *cache = 0; if (cache_it == font_cache->constEnd()) { cache = new QGLGlyphHash; - font_cache->insert(ti.fontEngine, cache); - connect(ti.fontEngine, SIGNAL(destroyed(QObject*)), SLOT(fontEngineDestroyed(QObject*))); + font_cache->insert(fontEngine, cache); + connect(fontEngine, SIGNAL(destroyed(QObject*)), SLOT(fontEngineDestroyed(QObject*))); } else { cache = cache_it.value(); } current_cache = cache; quint64 font_key = (reinterpret_cast<quint64>(context_key ? context_key : context) << 32) - | reinterpret_cast<quint64>(ti.fontEngine); + | reinterpret_cast<quint64>(fontEngine); QGLFontTexHash::const_iterator it = qt_font_textures.constFind(font_key); QGLFontTexture *font_tex; if (it == qt_font_textures.constEnd()) { GLuint font_texture; glGenTextures(1, &font_texture); - GLint tex_height = qt_next_power_of_two(qRound(ti.ascent.toReal() + ti.descent.toReal())+2); + GLint tex_height = qt_next_power_of_two(qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2); GLint tex_width = qt_next_power_of_two(tex_height*30); // ### GLint max_tex_size; glGetIntegerv(GL_MAX_TEXTURE_SIZE, &max_tex_size); @@ -4777,16 +4778,16 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti, glBindTexture(GL_TEXTURE_2D, font_tex->texture); } - for (int i=0; i< glyphs.size(); ++i) { + for (int i=0; i< numGlyphs; ++i) { QGLGlyphHash::const_iterator it = cache->constFind(glyphs[i]); if (it == cache->constEnd()) { // render new glyph and put it in the cache - glyph_metrics_t metrics = ti.fontEngine->boundingBox(glyphs[i]); + glyph_metrics_t metrics = fontEngine->boundingBox(glyphs[i]); int glyph_width = qRound(metrics.width.toReal())+2; - int glyph_height = qRound(ti.ascent.toReal() + ti.descent.toReal())+2; + int glyph_height = qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2; if (font_tex->x_offset + glyph_width + x_margin > font_tex->width) { - int strip_height = qt_next_power_of_two(qRound(ti.ascent.toReal() + ti.descent.toReal())+2); + int strip_height = qt_next_power_of_two(qRound(fontEngine->ascent().toReal() + fontEngine->descent().toReal())+2); font_tex->x_offset = x_margin; font_tex->y_offset += strip_height; if (font_tex->y_offset >= font_tex->height) { @@ -4819,7 +4820,7 @@ void QGLGlyphCache::cacheGlyphs(QGLContext *context, const QTextItemInt &ti, } } - QImage glyph_im(ti.fontEngine->alphaMapForGlyph(glyphs[i])); + QImage glyph_im(fontEngine->alphaMapForGlyph(glyphs[i])); glyph_im = glyph_im.convertToFormat(QImage::Format_Indexed8); glyph_width = glyph_im.width(); Q_ASSERT(glyph_width >= 0); @@ -4899,30 +4900,15 @@ void qgl_cleanup_glyph_cache(QGLContext *ctx) qt_glyph_cache()->cleanupContext(ctx); } -void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) +void QOpenGLPaintEngine::drawStaticTextItem(QStaticTextItem *textItem) { Q_D(QOpenGLPaintEngine); - const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem); - - // fall back to drawing a polygon if the scale factor is large, or - // we use a gradient pen - if ((d->matrix.det() > 1) || (d->pen_brush_style >= Qt::LinearGradientPattern - && d->pen_brush_style <= Qt::ConicalGradientPattern)) { - QPaintEngine::drawTextItem(p, textItem); - return; - } - d->flushDrawQueue(); - // add the glyphs used to the glyph texture cache - QVarLengthArray<QFixedPoint> positions; - QVarLengthArray<glyph_t> glyphs; - QTransform matrix = QTransform::fromTranslate(qRound(p.x()), qRound(p.y())); - ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); - // make sure the glyphs we want to draw are in the cache - qt_glyph_cache()->cacheGlyphs(d->device->context(), ti, glyphs); + qt_glyph_cache()->cacheGlyphs(d->device->context(), textItem->fontEngine, textItem->glyphs, + textItem->numGlyphs); d->setGradientOps(Qt::SolidPattern, QRectF()); // turns off gradient ops qt_glColor4ubv(d->pen_color); @@ -4944,13 +4930,13 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte glEnableClientState(GL_VERTEX_ARRAY); glEnableClientState(GL_TEXTURE_COORD_ARRAY); - bool antialias = !(ti.fontEngine->fontDef.styleStrategy & QFont::NoAntialias) - && (d->matrix.type() > QTransform::TxTranslate); + bool antialias = !(textItem->fontEngine->fontDef.styleStrategy & QFont::NoAntialias) + && (d->matrix.type() > QTransform::TxTranslate); glTexParameterf(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, antialias ? GL_LINEAR : GL_NEAREST); glTexParameterf(GL_TEXTURE_2D, GL_TEXTURE_MAG_FILTER, antialias ? GL_LINEAR : GL_NEAREST); - for (int i=0; i< glyphs.size(); ++i) { - QGLGlyphCoord *g = qt_glyph_cache()->lookup(ti.fontEngine, glyphs[i]); + for (int i=0; i< textItem->numGlyphs; ++i) { + QGLGlyphCoord *g = qt_glyph_cache()->lookup(textItem->fontEngine, textItem->glyphs[i]); // we don't cache glyphs with no width/height if (!g) @@ -4962,8 +4948,8 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte x2 = x1 + g->width; y2 = y1 + g->height; - QPointF logical_pos((positions[i].x - g->x_offset).toReal(), - (positions[i].y + g->y_offset).toReal()); + QPointF logical_pos((textItem->glyphPositions[i].x - g->x_offset).toReal(), + (textItem->glyphPositions[i].y + g->y_offset).toReal()); qt_add_rect_to_array(QRectF(logical_pos, QSizeF(g->log_width, g->log_height)), vertexArray); qt_add_texcoords_to_array(x1, y1, x2, y2, texCoordArray); @@ -4980,6 +4966,40 @@ void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textIte // XXX: This may not be needed as this behavior does seem to be caused by driver bug glColorMask(GL_TRUE, GL_TRUE, GL_TRUE, GL_TRUE); #endif + +} + +void QOpenGLPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) +{ + Q_D(QOpenGLPaintEngine); + + const QTextItemInt &ti = static_cast<const QTextItemInt &>(textItem); + + // fall back to drawing a polygon if the scale factor is large, or + // we use a gradient pen + if ((d->matrix.det() > 1) || (d->pen_brush_style >= Qt::LinearGradientPattern + && d->pen_brush_style <= Qt::ConicalGradientPattern)) { + QPaintEngine::drawTextItem(p, textItem); + return; + } + + // add the glyphs used to the glyph texture cache + QVarLengthArray<QFixedPoint> positions; + QVarLengthArray<glyph_t> glyphs; + QTransform matrix = QTransform::fromTranslate(qRound(p.x()), qRound(p.y())); + ti.fontEngine->getGlyphPositions(ti.glyphs, matrix, ti.flags, glyphs, positions); + + { + QStaticTextItem staticTextItem; + staticTextItem.chars = ti.chars; + staticTextItem.fontEngine = ti.fontEngine; + staticTextItem.glyphs = glyphs.data(); + staticTextItem.numChars = ti.num_chars; + staticTextItem.numGlyphs = glyphs.size(); + staticTextItem.glyphPositions = positions.data(); + drawStaticTextItem(&staticTextItem); + } + } diff --git a/src/opengl/qpaintengine_opengl_p.h b/src/opengl/qpaintengine_opengl_p.h index de0086a..55f7792 100644 --- a/src/opengl/qpaintengine_opengl_p.h +++ b/src/opengl/qpaintengine_opengl_p.h @@ -133,6 +133,7 @@ public: void drawImage(const QRectF &r, const QImage &image, const QRectF &sr, Qt::ImageConversionFlags conversionFlags); void drawTextItem(const QPointF &p, const QTextItem &ti); + void drawStaticTextItem(QStaticTextItem *staticTextItem); void drawEllipse(const QRectF &rect); diff --git a/src/openvg/qpaintengine_vg.cpp b/src/openvg/qpaintengine_vg.cpp index 18d6b0a..62f0293 100644 --- a/src/openvg/qpaintengine_vg.cpp +++ b/src/openvg/qpaintengine_vg.cpp @@ -50,10 +50,10 @@ #endif #include <QtCore/qvarlengtharray.h> #include <QtGui/private/qdrawhelper_p.h> -#include <QtGui/private/qtextureglyphcache_p.h> #include <QtGui/private/qtextengine_p.h> #include <QtGui/private/qfontengine_p.h> #include <QtGui/private/qpainterpath_p.h> +#include <QtGui/private/qstatictext_p.h> #include <QDebug> #include <QSet> @@ -86,10 +86,9 @@ public: QVGFontGlyphCache(); ~QVGFontGlyphCache(); - void cacheGlyphs(QVGPaintEnginePrivate *d, - const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs); - void setScaleFromText(const QTextItemInt &ti); + void cacheGlyphs(QVGPaintEnginePrivate *d, QFontEngine *fontEngine, const glyph_t *g, int count); + + void setScaleFromText(const QFont &font, QFontEngine *fontEngine); VGFont font; VGfloat scaleX; @@ -3185,22 +3184,20 @@ QVGFontGlyphCache::~QVGFontGlyphCache() vgDestroyFont(font); } -void QVGFontGlyphCache::setScaleFromText(const QTextItemInt &ti) +void QVGFontGlyphCache::setScaleFromText(const QFont &font, QFontEngine *fontEngine) { - QFontInfo fi(ti.font()); + QFontInfo fi(font); qreal pixelSize = fi.pixelSize(); - qreal emSquare = ti.fontEngine->properties().emSquare.toReal(); + qreal emSquare = fontEngine->properties().emSquare.toReal(); scaleX = scaleY = static_cast<VGfloat>(pixelSize / emSquare); } -void QVGFontGlyphCache::cacheGlyphs - (QVGPaintEnginePrivate *d, const QTextItemInt &ti, - const QVarLengthArray<glyph_t> &glyphs) +void QVGFontGlyphCache::cacheGlyphs(QVGPaintEnginePrivate *d, + QFontEngine *fontEngine, + const glyph_t *g, int count) { VGfloat origin[2]; VGfloat escapement[2]; - const glyph_t *g = glyphs.constData(); - int count = glyphs.size(); glyph_metrics_t metrics; // Some Qt font engines don't set yoff in getUnscaledGlyph(). // Zero the metric structure so that everything has a default value. @@ -3219,9 +3216,9 @@ void QVGFontGlyphCache::cacheGlyphs } #if !defined(QVG_NO_IMAGE_GLYPHS) Q_UNUSED(d); - QImage scaledImage = ti.fontEngine->alphaMapForGlyph(glyph); + QImage scaledImage = fontEngine->alphaMapForGlyph(glyph); VGImage vgImage = VG_INVALID_HANDLE; - metrics = ti.fontEngine->boundingBox(glyph); + metrics = fontEngine->boundingBox(glyph); if (!scaledImage.isNull()) { // Not a space character if (scaledImage.format() == QImage::Format_Indexed8) { vgImage = vgCreateImage(VG_A_8, scaledImage.width(), scaledImage.height(), VG_IMAGE_QUALITY_FASTER); @@ -3245,7 +3242,7 @@ void QVGFontGlyphCache::cacheGlyphs #else // Calculate the path for the glyph and cache it. QPainterPath path; - ti.fontEngine->getUnscaledGlyph(glyph, &path, &metrics); + fontEngine->getUnscaledGlyph(glyph, &path, &metrics); VGPath vgPath; if (!path.isEmpty()) { vgPath = d->painterPathToVGPath(path); @@ -3286,8 +3283,28 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) ti.fontEngine->getGlyphPositions (ti.glyphs, matrix, ti.flags, glyphs, positions); + if (!drawCachedGlyphs(glyphs.size(), glyphs.data(), ti.font(), ti.fontEngine, p)) + QPaintEngineEx::drawTextItem(p, textItem); +#else + // OpenGL 1.0 does not have support for VGFont and glyphs, + // so fall back to the default Qt path stroking algorithm. + QPaintEngineEx::drawTextItem(p, textItem); +#endif +} + +void QVGPaintEngine::drawStaticTextItem(QStaticTextItem *textItem) +{ + drawCachedGlyphs(textItem->numGlyphs, textItem->glyphs, textItem->font, textItem->fontEngine, + QPointF(0, 0)); +} + + bool QVGPaintEngine::drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFont &font, + QFontEngine *fontEngine, const QPointF &p) + { + Q_D(QVGPaintEngine); + // Find the glyph cache for this font. - QVGFontCache::ConstIterator it = d->fontCache.constFind(ti.fontEngine); + QVGFontCache::ConstIterator it = d->fontCache.constFind(fontEngine); QVGFontGlyphCache *glyphCache; if (it != d->fontCache.constEnd()) { glyphCache = it.value(); @@ -3295,15 +3312,14 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) glyphCache = new QVGFontGlyphCache(); if (glyphCache->font == VG_INVALID_HANDLE) { qWarning("QVGPaintEngine::drawTextItem: OpenVG fonts are not supported by the OpenVG engine"); - delete glyphCache; - QPaintEngineEx::drawTextItem(p, textItem); - return; + delete glyphCache; + return false; } - glyphCache->setScaleFromText(ti); - d->fontCache.insert(ti.fontEngine, glyphCache); + glyphCache->setScaleFromText(font, fontEngine); + d->fontCache.insert(fontEngine, glyphCache); if (!d->fontEngineCleaner) d->fontEngineCleaner = new QVGFontEngineCleaner(d); - QObject::connect(ti.fontEngine, SIGNAL(destroyed()), + QObject::connect(fontEngine, SIGNAL(destroyed()), d->fontEngineCleaner, SLOT(fontEngineDestroyed())); } @@ -3316,7 +3332,7 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) d->setTransform(VG_MATRIX_GLYPH_USER_TO_SURFACE, glyphTransform); // Add the glyphs from the text item into the glyph cache. - glyphCache->cacheGlyphs(d, ti, glyphs); + glyphCache->cacheGlyphs(d, fontEngine, glyphs, numGlyphs); // Set the glyph drawing origin. VGfloat origin[2]; @@ -3335,13 +3351,10 @@ void QVGPaintEngine::drawTextItem(const QPointF &p, const QTextItem &textItem) // Draw the glyphs. We need to fill with the brush associated with // the Qt pen, not the Qt brush. d->ensureBrush(state()->pen.brush()); - vgDrawGlyphs(glyphCache->font, glyphs.size(), (VGuint*)glyphs.data(), + vgDrawGlyphs(glyphCache->font, numGlyphs, (VGuint*)glyphs, NULL, NULL, VG_FILL_PATH, VG_TRUE); -#else - // OpenGL 1.0 does not have support for VGFont and glyphs, - // so fall back to the default Qt path stroking algorithm. - QPaintEngineEx::drawTextItem(p, textItem); -#endif + + return true; } void QVGPaintEngine::setState(QPainterState *s) diff --git a/src/openvg/qpaintengine_vg_p.h b/src/openvg/qpaintengine_vg_p.h index 3f87a72..3f73fed 100644 --- a/src/openvg/qpaintengine_vg_p.h +++ b/src/openvg/qpaintengine_vg_p.h @@ -54,6 +54,7 @@ // #include <QtGui/private/qpaintengineex_p.h> +#include <QtGui/private/qtextureglyphcache_p.h> QT_BEGIN_NAMESPACE @@ -139,6 +140,9 @@ public: void drawPixmaps(const QDrawPixmaps::Data *drawingData, int dataCount, const QPixmap &pixmap, QFlags<QDrawPixmaps::DrawingHint> hints); void drawTextItem(const QPointF &p, const QTextItem &textItem); + void drawStaticTextItem(QStaticTextItem *staticTextItem); + bool drawCachedGlyphs(int numGlyphs, const glyph_t *glyphs, const QFont &font, + QFontEngine *fontEngine, const QPointF &p); void setState(QPainterState *s); QVGPainterState *state() { return static_cast<QVGPainterState *>(QPaintEngineEx::state()); } diff --git a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp index 2b11058..12f4c6b 100644 --- a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp +++ b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.cpp @@ -176,7 +176,7 @@ enum PaintOperation { DRAW_PATH = 0x0040, DRAW_POINTS = 0x0080, DRAW_ELLIPSE = 0x0100, DRAW_POLYGON = 0x0200, DRAW_TEXT = 0x0400, FILL_PATH = 0x0800, FILL_RECT = 0x1000, DRAW_COLORSPANS = 0x2000, DRAW_ROUNDED_RECT = 0x4000, - ALL = 0xffff + DRAW_STATICTEXT = 0x8000, ALL = 0xffff }; #endif @@ -711,6 +711,14 @@ void QDirectFBPaintEngine::drawRoundedRect(const QRectF &rect, qreal xrad, qreal QRasterPaintEngine::drawRoundedRect(rect, xrad, yrad, mode); } +void QDirectFBPaintEngine::drawStaticTextItem(QStaticTextItem *item) +{ + RASTERFALLBACK(DRAW_STATICTEXT, item, VOID_ARG(), VOID_ARG()); + Q_D(QDirectFBPaintEngine); + d->lock(); + QRasterPaintEngine::drawStaticTextItem(item); +} + void QDirectFBPaintEngine::fillRect(const QRectF &rect, const QBrush &brush) { Q_D(QDirectFBPaintEngine); diff --git a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h index 64609d7..19e8b84 100644 --- a/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h +++ b/src/plugins/gfxdrivers/directfb/qdirectfbpaintengine.h @@ -109,6 +109,8 @@ public: virtual void clip(const QRegion ®ion, Qt::ClipOperation op); virtual void clip(const QRect &rect, Qt::ClipOperation op); + virtual void drawStaticTextItem(QStaticTextItem *item); + static void initImageCache(int size); }; diff --git a/src/qt3support/dialogs/q3filedialog.cpp b/src/qt3support/dialogs/q3filedialog.cpp index 9b8e4d3..35f7890 100644 --- a/src/qt3support/dialogs/q3filedialog.cpp +++ b/src/qt3support/dialogs/q3filedialog.cpp @@ -475,9 +475,17 @@ static int sortFilesBy = (int)QDir::Name; static bool sortAscending = true; static bool detailViewMode = false; -static Q3CleanupHandler<QPixmap> qfd_cleanup_pixmap; static Q3CleanupHandler<QString> qfd_cleanup_string; +static void qt_cleanup_fd_pixmaps(); +typedef QList<QPixmap *> FDPixmaps; +Q_GLOBAL_STATIC_WITH_INITIALIZER(FDPixmaps, qfd_pixmaps, qAddPostRoutine(qt_cleanup_fd_pixmaps)) + +static void qt_cleanup_fd_pixmaps() +{ + qDeleteAll(*qfd_pixmaps()); +} + static QString toRootIfNotExists( const QString &path ) { if ( !path.isEmpty() ) @@ -533,37 +541,37 @@ static void makeVariables() { qfd_cleanup_string.add(&workingDirectory); openFolderIcon = new QPixmap((const char **)open_xpm); - qfd_cleanup_pixmap.add(&openFolderIcon); + qfd_pixmaps()->append(openFolderIcon); symLinkDirIcon = new QPixmap((const char **)link_dir_xpm); - qfd_cleanup_pixmap.add(&symLinkDirIcon); + qfd_pixmaps()->append(symLinkDirIcon); symLinkFileIcon = new QPixmap((const char **)link_file_xpm); - qfd_cleanup_pixmap.add(&symLinkFileIcon); + qfd_pixmaps()->append(symLinkFileIcon); fileIcon = new QPixmap((const char **)file_xpm); - qfd_cleanup_pixmap.add(&fileIcon); + qfd_pixmaps()->append(fileIcon); closedFolderIcon = new QPixmap((const char **)closed_xpm); - qfd_cleanup_pixmap.add(&closedFolderIcon); + qfd_pixmaps()->append(closedFolderIcon); detailViewIcon = new QPixmap((const char **)detailedview_xpm); - qfd_cleanup_pixmap.add(&detailViewIcon); + qfd_pixmaps()->append(detailViewIcon); multiColumnListViewIcon = new QPixmap((const char **)mclistview_xpm); - qfd_cleanup_pixmap.add(&multiColumnListViewIcon); + qfd_pixmaps()->append(multiColumnListViewIcon); cdToParentIcon = new QPixmap((const char **)cdtoparent_xpm); - qfd_cleanup_pixmap.add(&cdToParentIcon); + qfd_pixmaps()->append(cdToParentIcon); newFolderIcon = new QPixmap((const char **)newfolder_xpm); - qfd_cleanup_pixmap.add(&newFolderIcon); + qfd_pixmaps()->append(newFolderIcon); previewInfoViewIcon = new QPixmap((const char **)previewinfoview_xpm); - qfd_cleanup_pixmap.add(&previewInfoViewIcon); + qfd_pixmaps()->append(previewInfoViewIcon); previewContentsViewIcon = new QPixmap((const char **)previewcontentsview_xpm); - qfd_cleanup_pixmap.add(&previewContentsViewIcon); + qfd_pixmaps()->append(previewContentsViewIcon); startCopyIcon = new QPixmap((const char **)start_xpm); - qfd_cleanup_pixmap.add(&startCopyIcon); + qfd_pixmaps()->append(startCopyIcon); endCopyIcon = new QPixmap((const char **)end_xpm); - qfd_cleanup_pixmap.add(&endCopyIcon); + qfd_pixmaps()->append(endCopyIcon); goBackIcon = new QPixmap((const char **)back_xpm); - qfd_cleanup_pixmap.add(&goBackIcon); + qfd_pixmaps()->append(goBackIcon); fifteenTransparentPixels = new QPixmap(closedFolderIcon->width(), 1); - qfd_cleanup_pixmap.add(&fifteenTransparentPixels); + qfd_pixmaps()->append(fifteenTransparentPixels); QBitmap m(fifteenTransparentPixels->width(), 1); m.fill(Qt::color0); fifteenTransparentPixels->setMask(m); diff --git a/src/qt3support/itemviews/q3iconview.cpp b/src/qt3support/itemviews/q3iconview.cpp index 67c956e..683e3d6 100644 --- a/src/qt3support/itemviews/q3iconview.cpp +++ b/src/qt3support/itemviews/q3iconview.cpp @@ -132,14 +132,21 @@ static QPixmap *qiv_selection = 0; #endif static bool optimize_layout = false; -static Q3CleanupHandler<QPixmap> qiv_cleanup_pixmap; +static void qt_cleanup_iv_pixmaps(); +typedef QList<QPixmap *> IVPixmaps; +Q_GLOBAL_STATIC_WITH_INITIALIZER(IVPixmaps, qiv_pixmaps, qAddPostRoutine(qt_cleanup_iv_pixmaps)) + +static void qt_cleanup_iv_pixmaps() +{ + qDeleteAll(*qiv_pixmaps()); +} static QPixmap *get_qiv_buffer_pixmap(const QSize &s) { if (!qiv_buffer_pixmap) { qiv_buffer_pixmap = new QPixmap(s); - qiv_cleanup_pixmap.add(&qiv_buffer_pixmap); + qiv_pixmaps()->append(qiv_buffer_pixmap); return qiv_buffer_pixmap; } @@ -2580,7 +2587,7 @@ Q3IconView::Q3IconView(QWidget *parent, const char *name, Qt::WindowFlags f) { if (!unknown_icon) { unknown_icon = new QPixmap((const char **)unknown_xpm); - qiv_cleanup_pixmap.add(&unknown_icon); + qiv_pixmaps()->append(unknown_icon); } d = new Q3IconViewPrivate; diff --git a/src/qt3support/itemviews/q3listview.cpp b/src/qt3support/itemviews/q3listview.cpp index 2c15ad0..12dad84 100644 --- a/src/qt3support/itemviews/q3listview.cpp +++ b/src/qt3support/itemviews/q3listview.cpp @@ -70,9 +70,6 @@ QT_BEGIN_NAMESPACE const int Unsorted = 16383; -static Q3CleanupHandler<QBitmap> qlv_cleanup_bitmap; - - struct Q3ListViewPrivate { // classes that are here to avoid polluting the global name space diff --git a/src/sql/drivers/odbc/qsql_odbc.cpp b/src/sql/drivers/odbc/qsql_odbc.cpp index 18bc743..6b82692 100644 --- a/src/sql/drivers/odbc/qsql_odbc.cpp +++ b/src/sql/drivers/odbc/qsql_odbc.cpp @@ -137,6 +137,7 @@ public: QSqlRecord rInf; QVector<QVariant> fieldCache; + QVector<wchar_t *> paramCache; int fieldCacheIdx; int disconnectCount; bool hasSQLFetchScroll; @@ -195,7 +196,7 @@ static QString qWarnODBCHandle(int handleType, SQLHANDLE handle, int *nativeCode *nativeCode = nativeCode_; QString tmpstore; #ifdef UNICODE - tmpstore = QString((const QChar*)description_.data(), msgLen); + tmpstore = QString::fromWCharArray((const wchar_t*)description_, msgLen); #else tmpstore = QString::fromLocal8Bit((const char*)description_.data(), msgLen); #endif @@ -323,7 +324,7 @@ static QString qGetStringData(SQLHANDLE hStmt, int column, int colSize, bool uni } else { colSize++; // make sure there is room for more than the 0 termination if (unicode) { - colSize *= 2; // a tiny bit faster, since it saves a SQLGetData() call + colSize *= sizeof(wchar_t); // a tiny bit faster, since it saves a SQLGetData() call } } QVarLengthArray<char> buf(colSize); @@ -344,9 +345,9 @@ static QString qGetStringData(SQLHANDLE hStmt, int column, int colSize, bool uni // contain the number of bytes returned - it contains the // total number of bytes that CAN be fetched // colSize-1: remove 0 termination when there is more data to fetch - int rSize = (r == SQL_SUCCESS_WITH_INFO) ? (unicode ? colSize-2 : colSize-1) : lengthIndicator; + int rSize = (r == SQL_SUCCESS_WITH_INFO) ? (unicode ? colSize-sizeof(wchar_t) : colSize-1) : lengthIndicator; if (unicode) { - fieldVal += QString((const QChar*) buf.constData(), rSize / 2); + fieldVal += QString::fromWCharArray((wchar_t*)buf.constData(), rSize / sizeof(wchar_t)); } else { fieldVal += QString::fromAscii(buf.constData(), rSize); } @@ -542,7 +543,7 @@ static QSqlField qMakeFieldInfo(const QODBCPrivate* p, int i ) } #ifdef UNICODE - QString qColName((const QChar*)colName, colNameLen); + QString qColName = QString::fromWCharArray((const wchar_t*)colName, colNameLen); #else QString qColName = QString::fromLocal8Bit((const char*)colName); #endif @@ -1257,9 +1258,12 @@ bool QODBCResult::exec() // bind parameters - only positional binding allowed QVector<QVariant>& values = boundValues(); + QVector<wchar_t *> wcharstorage; + int i; SQLRETURN r; for (i = 0; i < values.count(); ++i) { + wcharstorage.append(NULL); if (bindValueType(i) & QSql::Out) values[i].detach(); const QVariant &val = values.at(i); @@ -1421,13 +1425,14 @@ bool QODBCResult::exec() case QVariant::String: if (d->unicode) { QString str = val.toString(); - str.utf16(); + int strSize = str.length() * sizeof(wchar_t); if (*ind != SQL_NULL_DATA) - *ind = str.length() * sizeof(QChar); - int strSize = str.length() * sizeof(QChar); + *ind = strSize; if (bindValueType(i) & QSql::Out) { - QByteArray ba((char*)str.constData(), str.capacity() * sizeof(QChar)); + wchar_t *temp=new wchar_t[str.capacity()*sizeof(wchar_t)]; + str.toWCharArray(temp); + QByteArray ba((char*)temp, str.capacity() * sizeof(wchar_t)); r = SQLBindParameter(d->hStmt, i + 1, qParamType[(QFlag)(bindValueType(i)) & QSql::InOut], @@ -1439,9 +1444,13 @@ bool QODBCResult::exec() ba.size(), ind); tmpStorage.append(ba); + wcharstorage.replace(i,temp); break; } + wchar_t *temp=new wchar_t[(1+str.length())*sizeof(wchar_t)]; + str.toWCharArray(temp); + temp[str.length()]=0; r = SQLBindParameter(d->hStmt, i + 1, qParamType[(QFlag)(bindValueType(i)) & QSql::InOut], @@ -1449,9 +1458,10 @@ bool QODBCResult::exec() strSize > 254 ? SQL_WLONGVARCHAR : SQL_WVARCHAR, strSize, 0, - (void *)str.constData(), + (void *)temp, strSize, ind); + wcharstorage.replace(i,temp); break; } else @@ -1500,6 +1510,13 @@ bool QODBCResult::exec() } } r = SQLExecute(d->hStmt); + + for(int i=0;i<wcharstorage.size();i++) + { + if(wcharstorage.at(i)) + delete [](wcharstorage.at(i)); + } + if (r != SQL_SUCCESS && r != SQL_SUCCESS_WITH_INFO) { qWarning() << "QODBCResult::exec: Unable to execute statement:" << qODBCWarn(d); setLastError(qMakeError(QCoreApplication::translate("QODBCResult", diff --git a/src/sql/drivers/sqlite/qsql_sqlite.cpp b/src/sql/drivers/sqlite/qsql_sqlite.cpp index 9fff552..d3be304 100644 --- a/src/sql/drivers/sqlite/qsql_sqlite.cpp +++ b/src/sql/drivers/sqlite/qsql_sqlite.cpp @@ -500,32 +500,6 @@ bool QSQLiteDriver::hasFeature(DriverFeature f) const return false; } -static int qGetSqliteTimeout(QString opts) -{ - enum { DefaultTimeout = 5000 }; - - opts.remove(QLatin1Char(' ')); - foreach(QString option, opts.split(QLatin1Char(';'))) { - if (option.startsWith(QLatin1String("QSQLITE_BUSY_TIMEOUT="))) { - bool ok; - int nt = option.mid(21).toInt(&ok); - if (ok) - return nt; - } - } - return DefaultTimeout; -} - -static int qGetSqliteOpenMode(QString opts) -{ - opts.remove(QLatin1Char(' ')); - foreach(QString option, opts.split(QLatin1Char(';'))) { - if (option == QLatin1String("QSQLITE_OPEN_READONLY")) - return SQLITE_OPEN_READONLY; - } - return SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE; -} - /* SQLite dbs have no user name, passwords, hosts or ports. just file names. @@ -537,9 +511,26 @@ bool QSQLiteDriver::open(const QString & db, const QString &, const QString &, c if (db.isEmpty()) return false; + bool sharedCache = false; + int openMode = SQLITE_OPEN_READWRITE | SQLITE_OPEN_CREATE, timeOut=5000; + QStringList opts=QString(conOpts).remove(QLatin1Char(' ')).split(QLatin1Char(';')); + foreach(const QString &option, opts) { + if (option.startsWith(QLatin1String("QSQLITE_BUSY_TIMEOUT="))) { + bool ok; + int nt = option.mid(21).toInt(&ok); + if (ok) + timeOut = nt; + } + if (option == QLatin1String("QSQLITE_OPEN_READONLY")) + openMode = SQLITE_OPEN_READONLY; + if (option == QLatin1String("QSQLITE_ENABLE_SHARED_CACHE")) + sharedCache = true; + } + + sqlite3_enable_shared_cache(sharedCache); - if (sqlite3_open_v2(db.toUtf8().constData(), &d->access, qGetSqliteOpenMode(conOpts), NULL) == SQLITE_OK) { - sqlite3_busy_timeout(d->access, qGetSqliteTimeout(conOpts)); + if (sqlite3_open_v2(db.toUtf8().constData(), &d->access, openMode, NULL) == SQLITE_OK) { + sqlite3_busy_timeout(d->access, timeOut); setOpen(true); setOpenError(false); return true; diff --git a/src/sql/kernel/qsqldatabase.cpp b/src/sql/kernel/qsqldatabase.cpp index 031261d..1416ee3 100644 --- a/src/sql/kernel/qsqldatabase.cpp +++ b/src/sql/kernel/qsqldatabase.cpp @@ -1267,6 +1267,7 @@ QSqlRecord QSqlDatabase::record(const QString& tablename) const \list \i QSQLITE_BUSY_TIMEOUT \i QSQLITE_OPEN_READONLY + \i QSQLITE_ENABLE_SHARED_CACHE \endlist \i diff --git a/src/xmlpatterns/data/qatomicvalue.cpp b/src/xmlpatterns/data/qatomicvalue.cpp index 6858e27..c4f3578 100644 --- a/src/xmlpatterns/data/qatomicvalue.cpp +++ b/src/xmlpatterns/data/qatomicvalue.cpp @@ -226,6 +226,8 @@ ItemType::Ptr AtomicValue::qtToXDMType(const QXmlItem &item) /* Fallthrough. */ case QVariant::Time: return BuiltinTypes::xsDateTime; + case QMetaType::Float: + return BuiltinTypes::xsFloat; case QVariant::Double: return BuiltinTypes::xsDouble; default: |